]> git.alsa-project.org Git - alsa-lib.git/commitdiff
Switch to automake and libtool
authorChris Cannam <cannam@all-day-breakfast.com>
Wed, 18 Nov 1998 20:42:09 +0000 (20:42 +0000)
committerChris Cannam <cannam@all-day-breakfast.com>
Wed, 18 Nov 1998 20:42:09 +0000 (20:42 +0000)
45 files changed:
Makefile [deleted file]
Makefile.am [new file with mode: 0644]
Makefile.conf.in [deleted file]
Makefile.in [new file with mode: 0644]
acconfig.h [new file with mode: 0644]
acinclude.m4 [new file with mode: 0644]
aclocal.m4
config.guess [new file with mode: 0644]
config.sub [new file with mode: 0644]
configure.in
doc/Makefile [deleted file]
doc/Makefile.am [new file with mode: 0644]
doc/Makefile.in [new file with mode: 0644]
include/Makefile.am [new file with mode: 0644]
include/Makefile.in [new file with mode: 0644]
include/config.h.in
include/version.h.in
ltconfig [new file with mode: 0644]
ltmain.sh [new file with mode: 0644]
missing [new file with mode: 0644]
mkinstalldirs [new file with mode: 0644]
src/Makefile [deleted file]
src/Makefile.am [new file with mode: 0644]
src/Makefile.in [new file with mode: 0644]
src/control/Makefile [deleted file]
src/control/Makefile.am [new file with mode: 0644]
src/control/Makefile.in [new file with mode: 0644]
src/mixer/Makefile [deleted file]
src/mixer/Makefile.am [new file with mode: 0644]
src/mixer/Makefile.in [new file with mode: 0644]
src/pcm/Makefile [deleted file]
src/pcm/Makefile.am [new file with mode: 0644]
src/pcm/Makefile.in [new file with mode: 0644]
src/rawmidi/Makefile [deleted file]
src/rawmidi/Makefile.am [new file with mode: 0644]
src/rawmidi/Makefile.in [new file with mode: 0644]
test/Makefile [deleted file]
test/Makefile.am [new file with mode: 0644]
test/Makefile.in [new file with mode: 0644]
utils/Makefile [deleted file]
utils/Makefile.am [new file with mode: 0644]
utils/Makefile.in [new file with mode: 0644]
utils/alsa-lib.spec.in
utils/buildrpm
version [deleted file]

diff --git a/Makefile b/Makefile
deleted file mode 100644 (file)
index 31cee68..0000000
--- a/Makefile
+++ /dev/null
@@ -1,63 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-ifeq (Makefile.conf,$(wildcard Makefile.conf))
-include Makefile.conf
-else
-dummy:
-       @echo
-       @echo "Please, run configure script as first..."
-       @echo
-endif
-
-
-all: include/asoundlib.h
-       $(MAKE) -C src
-       $(MAKE) -C doc
-       @echo
-       @echo "ALSA library were sucessfully compiled."
-       @echo
-
-include/asoundlib.h:   include/header.h include/version.h include/error.h include/footer.h \
-                       include/control.h include/mixer.h include/pcm.h include/rawmidi.h
-       cat include/header.h include/version.h include/error.h \
-           include/control.h include/mixer.h \
-           include/pcm.h include/rawmidi.h \
-           include/footer.h > include/asoundlib.h
-
-install: all
-       $(INSTALL) -m 755 -o root -g root -d ${aclocaldir}
-       $(INSTALL) -m 755 -o root -g root aclocal.m4 ${aclocaldir}/alsa-lib.m4
-       $(INSTALL) -m 755 -o root -g root -d ${includedir}/sys
-       $(INSTALL) -m 644 -o root -g root include/asoundlib.h ${includedir}/sys
-       $(INSTALL) -m 755 -o root -g root -d ${libdir}
-       $(INSTALL) -m 644 -o root -g root lib/libasound.a ${libdir}
-       $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so
-       $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so.${SND_LIB_MAJOR}
-       $(INSTALL) -m 644 -o root -g root lib/libasound.so.${SND_LIB_VERSION} ${libdir}
-       /sbin/ldconfig
-
-clean:
-       $(MAKE) -C include clean
-       $(MAKE) -C src clean
-       $(MAKE) -C test clean
-       $(MAKE) -C doc clean
-       $(MAKE) -C utils clean
-       rm -f core .depend *.o *.orig *~
-       rm -f `find . -name "out.txt"`
-
-mrproper: clean
-       rm -f config.cache config.log config.status Makefile.conf \
-              utils/alsa-lib.spec include/config.h include/version.h
-
-cvsclean: mrproper
-       rm -f configure include/asoundlib.h
-
-pack: mrproper
-       chown -R root.root ../alsa-lib
-       mv ../alsa-lib ../alsa-lib-$(SND_LIB_VERSION)
-       tar cvz -C .. -f ../alsa-lib-$(SND_LIB_VERSION).tar.gz alsa-lib-$(SND_LIB_VERSION)
-       mv ../alsa-lib-$(SND_LIB_VERSION) ../alsa-lib
-
diff --git a/Makefile.am b/Makefile.am
new file mode 100644 (file)
index 0000000..d10e67f
--- /dev/null
@@ -0,0 +1,4 @@
+SUBDIRS=doc include src test utils
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/Makefile.conf.in b/Makefile.conf.in
deleted file mode 100644 (file)
index fe2e803..0000000
+++ /dev/null
@@ -1,26 +0,0 @@
-#
-# Configuration Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-srcdir=@srcdir@
-VPATH=@srcdir@
-prefix=@prefix@
-exec_prefix=@exec_prefix@
-includedir=@includedir@
-libdir=@libdir@
-aclocaldir=/usr/share/aclocal
-c_opts=@CFLAGS@
-INSTALL=@INSTALL@
-SND_LIB_VERSION=@SND_LIB_VERSION@
-SND_LIB_MAJOR=@SND_LIB_MAJOR@
-SND_LIB_MINOR=@SND_LIB_MINOR@
-SND_LIB_SUBMINOR=@SND_LIB_SUBMINOR@
-
-CC=@CC@
-CPP=@CPP@
-INCLUDE=-I../include -I../../include
-COPTS = $(c_opts)
-COPTS += -Wall -Wstrict-prototypes -fomit-frame-pointer -pipe
-LINKER=ld
-LN_S=@LN_S@
diff --git a/Makefile.in b/Makefile.in
new file mode 100644 (file)
index 0000000..e83c031
--- /dev/null
@@ -0,0 +1,291 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = .
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+SUBDIRS=doc include src test utils
+
+INCLUDES=-I$(top_srcdir)/include
+ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ./include/config.h
+CONFIG_CLEAN_FILES = 
+DIST_COMMON =  COPYING ChangeLog Makefile.am Makefile.in acinclude.m4 \
+aclocal.m4 config.guess config.sub configure.in install-sh ltconfig \
+ltmain.sh missing mkinstalldirs
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: all-recursive all-am
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+$(ACLOCAL_M4):  configure.in  acinclude.m4
+       cd $(srcdir) && $(ACLOCAL)
+
+config.status: $(srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
+       $(SHELL) ./config.status --recheck
+$(srcdir)/configure: $(srcdir)/configure.in $(ACLOCAL_M4) $(CONFIGURE_DEPENDENCIES)
+       cd $(srcdir) && $(AUTOCONF)
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run `make' without going through this Makefile.
+# To change the values of `make' variables: instead of editing Makefiles,
+# (1) if the variable is set in `config.status', edit `config.status'
+#     (which will cause the Makefiles to be regenerated when you run `make');
+# (2) otherwise, pass the desired values on the `make' command line.
+
+@SET_MAKE@
+
+all-recursive install-data-recursive install-exec-recursive \
+installdirs-recursive install-recursive uninstall-recursive  \
+check-recursive installcheck-recursive info-recursive dvi-recursive:
+       @set fnord $(MAKEFLAGS); amf=$$2; \
+       list='$(SUBDIRS)'; for subdir in $$list; do \
+         target=`echo $@ | sed s/-recursive//`; \
+         echo "Making $$target in $$subdir"; \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+          || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+       done && test -z "$$fail"
+
+mostlyclean-recursive clean-recursive distclean-recursive \
+maintainer-clean-recursive:
+       @set fnord $(MAKEFLAGS); amf=$$2; \
+       rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \
+         rev="$$subdir $$rev"; \
+       done; \
+       for subdir in $$rev; do \
+         target=`echo $@ | sed s/-recursive//`; \
+         echo "Making $$target in $$subdir"; \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+          || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+       done && test -z "$$fail"
+tags-recursive:
+       list='$(SUBDIRS)'; for subdir in $$list; do \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \
+       done
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: tags-recursive $(HEADERS) $(SOURCES)  $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SUBDIRS)'; for subdir in $$list; do \
+         test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \
+       done; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags  $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(PACKAGE)-$(VERSION)
+top_distdir = $(distdir)
+
+# This target untars the dist file and tries a VPATH configuration.  Then
+# it guarantees that the distribution is self-contained by making another
+# tarfile.
+distcheck: dist
+       -rm -rf $(distdir)
+       GZIP=$(GZIP) $(TAR) zxf $(distdir).tar.gz
+       mkdir $(distdir)/=build
+       mkdir $(distdir)/=inst
+       dc_install_base=`cd $(distdir)/=inst && pwd`; \
+       cd $(distdir)/=build \
+         && ../configure --srcdir=.. --prefix=$$dc_install_base \
+         && $(MAKE) $(AM_MAKEFLAGS) \
+         && $(MAKE) $(AM_MAKEFLAGS) dvi \
+         && $(MAKE) $(AM_MAKEFLAGS) check \
+         && $(MAKE) $(AM_MAKEFLAGS) install \
+         && $(MAKE) $(AM_MAKEFLAGS) installcheck \
+         && $(MAKE) $(AM_MAKEFLAGS) dist
+       -rm -rf $(distdir)
+       @echo "========================"; \
+       echo "$(distdir).tar.gz is ready for distribution"; \
+       echo "========================"
+dist: distdir
+       -chmod -R a+r $(distdir)
+       GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir)
+       -rm -rf $(distdir)
+dist-all: distdir
+       -chmod -R a+r $(distdir)
+       GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir)
+       -rm -rf $(distdir)
+distdir: $(DISTFILES)
+       -rm -rf $(distdir)
+       mkdir $(distdir)
+       -chmod 777 $(distdir)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+       for subdir in $(SUBDIRS); do \
+         test -d $(distdir)/$$subdir \
+         || mkdir $(distdir)/$$subdir \
+         || exit 1; \
+         chmod 777 $(distdir)/$$subdir; \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(distdir) distdir=../$(distdir)/$$subdir distdir) \
+           || exit 1; \
+       done
+info: info-recursive
+dvi: dvi-recursive
+check: all-am
+       $(MAKE) $(AM_MAKEFLAGS) check-recursive
+installcheck: installcheck-recursive
+all-am: Makefile
+
+install-exec: install-exec-recursive
+       @$(NORMAL_INSTALL)
+
+install-data: install-data-recursive
+       @$(NORMAL_INSTALL)
+
+install: install-recursive
+       @:
+
+uninstall: uninstall-recursive
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs: installdirs-recursive
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean-am:  mostlyclean-tags mostlyclean-generic
+
+clean-am:  clean-tags clean-generic mostlyclean-am
+
+distclean-am:  distclean-tags distclean-generic clean-am
+
+maintainer-clean-am:  maintainer-clean-tags maintainer-clean-generic \
+               distclean-am
+
+mostlyclean:  mostlyclean-recursive mostlyclean-am
+
+clean:  clean-recursive clean-am
+
+distclean:  distclean-recursive distclean-am
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-recursive maintainer-clean-am
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+       -rm -f config.status
+
+.PHONY: install-data-recursive uninstall-data-recursive \
+install-exec-recursive uninstall-exec-recursive installdirs-recursive \
+uninstalldirs-recursive all-recursive check-recursive \
+installcheck-recursive info-recursive dvi-recursive \
+mostlyclean-recursive distclean-recursive clean-recursive \
+maintainer-clean-recursive tags tags-recursive mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck all-am install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/acconfig.h b/acconfig.h
new file mode 100644 (file)
index 0000000..e26f178
--- /dev/null
@@ -0,0 +1,8 @@
+/* Package name */
+#undef PACKAGE
+
+/* Package version */
+#undef VERSION
+
+/* Sound library version string */
+#undef SND_LIB_VERSION
diff --git a/acinclude.m4 b/acinclude.m4
new file mode 100644 (file)
index 0000000..5b6c1e8
--- /dev/null
@@ -0,0 +1,109 @@
+dnl Configure Paths for Alsa
+dnl Christopher Lansdown (lansdoct@cs.alfred.edu)
+dnl 29/10/1998
+dnl AM_PATH_ALSA(MINIMUM-VERSION)
+dnl Test for libasound, and define ALSA_CFLAGS and ALSA_LIBS as appropriate.
+dnl enables arguments --with-alsa-prefix= --with-alsa-enc-prefix= --disable-alsatest
+dnl
+AC_DEFUN(AM_PATH_ALSA,
+[dnl
+dnl Get the clfags and libraries for alsa
+dnl
+AC_ARG_WITH(alsa-prefix,[ --with-alsa-prefix=PFX  Prefix where Alsa library is installed(optional)],
+       [alsa_prefix="$withval"], [alsa_prefix=""])
+AC_ARG_WITH(alsa-inc-prefix, [ --with-alsa-inc-prefix=PFX  Prefix where include libraries are (optional)],
+       [alsa_inc_prefix="$withval"], [alsa_inc_prefix=""])
+AC_ARG_ENABLE(alsatest, [ --disable-alsatest       Do not try to compile and run a test Alsa program], [enable_alsatest=no], [enable_alsatest=yes])
+
+dnl Add any special include directories
+AC_MSG_CHECKING(for ALSA CFLAGS)
+if test "$alsa_inc_prefix" != "" ; then
+       ALSA_CFLAGS="$ALSA_CFLAGS -I$alsa_inc_prefix"
+       CFLAGS="-I$alsa_inc_prefix"
+fi
+AC_MSG_RESULT($ALSA_CFLAGS)
+
+dnl add any special lib dirs
+AC_MSG_CHECKING(for ALSA LDFLAGS)
+if test "$alsa_prefix" != "" ; then
+       ALSA_LIBS="$ALSA_LIBS -L$alsa_prefix"
+       LIBS="-L$alsa_prefix"
+fi
+
+dnl add the alsa library
+ALSA_LIBS="$ALSA_LIBS -lasound"
+LDFLAGS="$ALSA_LIBS -lasound"
+AC_MSG_RESULT($ALSA_LIBS)
+
+dnl Check for the presence of the library
+dnl if test $enable_alsatest = yes; then
+dnl   AC_MSG_CHECKING(for working libasound)
+dnl   AC_TRY_RUN([
+dnl #include <sys/asoundlib.h>
+dnl void main(void)
+dnl {
+dnl   snd_cards();
+dnl   exit(0);
+dnl }
+dnl ],
+dnl    [AC_MSG_RESULT("present")],
+dnl    [AC_MSG_RESULT("not found. ")
+dnl    AC_MSG_ERROR(Fatal error: Install alsa-lib package or use --with-alsa-prefix option...)],
+dnl    [AC_MSG_RESULT(unsopported)
+dnl     AC_MSG_ERROR(Cross-compiling isn't supported...)]
+dnl  )
+dnl fi
+
+dnl Check for a working version of libasound that is of the right version.
+min_alsa_version=ifelse([$1], ,0.1.1,$1)
+AC_MSG_CHECKING(for libasound headers version >= $min_alsa_version)
+no_alsa=""
+    alsa_min_major_version=`echo $min_alsa_version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'`
+    alsa_min_minor_version=`echo $min_alsa_version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'`
+    alsa_min_micro_version=`echo $min_alsa_version | \
+           sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'`
+
+AC_TRY_COMPILE([
+#include <sys/asoundlib.h>
+], [
+void main(void)
+{
+#  if(SOUNDLIB_VERSION_MAJOR > $alsa_min_major_version)
+  exit(0);
+#  else
+#    if(SOUNDLIB_VERSION_MAJOR < $alsa_min_major_version)
+#       error not present
+#    endif
+
+#   if(SOUNDLIB_VERSION_MINOR > $alsa_min_minor_version)
+  exit(0);
+#   else
+#     if(SOUNDLIB_VERSION_MINOR < $alsa_min_minor_version)
+#          error not present
+#      endif
+
+#      if(SOUNDLIB_VERSION_SUBMINOR < $alsa_min_micro_version)
+#        error not present
+#      endif
+#    endif
+#  endif
+exit(0);
+}
+],
+  [AC_MSG_RESULT(found.)],
+  [AC_MSG_RESULT(not present.)
+   AC_MSG_ERROR(Sufficiently new version of libasound not found.)]
+)
+
+dnl Now that we know that we have the right version, let's see if we have the library and not just the headers.
+AC_CHECK_LIB([asound], [snd_cards],,
+       [AC_MSG_ERROR(No linkable libasound was found.)]
+)
+
+dnl That should be it.  Now just export out symbols:
+AC_SUBST(ALSA_CFLAGS)
+AC_SUBST(ALSA_LIBS)
+])
+
index 5b6c1e8447aa9d35e67b0dfc9b06d94d7e102872..7b080f1e1c34842930abe6fc0cec900b15dfa7fb 100644 (file)
@@ -1,3 +1,15 @@
+dnl aclocal.m4 generated automatically by aclocal 1.3b
+
+dnl Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+dnl This file is free software; the Free Software Foundation
+dnl gives unlimited permission to copy and/or distribute it,
+dnl with or without modifications, as long as this notice is preserved.
+
+dnl This program is distributed in the hope that it will be useful,
+dnl but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+dnl even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+dnl PARTICULAR PURPOSE.
+
 dnl Configure Paths for Alsa
 dnl Christopher Lansdown (lansdoct@cs.alfred.edu)
 dnl 29/10/1998
@@ -107,3 +119,366 @@ AC_SUBST(ALSA_CFLAGS)
 AC_SUBST(ALSA_LIBS)
 ])
 
+
+# Do all the work for Automake.  This macro actually does too much --
+# some checks are only needed if your package does certain things.
+# But this isn't really a big deal.
+
+# serial 1
+
+dnl Usage:
+dnl AM_INIT_AUTOMAKE(package,version, [no-define])
+
+AC_DEFUN(AM_INIT_AUTOMAKE,
+[AC_REQUIRE([AM_PROG_INSTALL])
+PACKAGE=[$1]
+AC_SUBST(PACKAGE)
+VERSION=[$2]
+AC_SUBST(VERSION)
+dnl test to see if srcdir already configured
+if test "`cd $srcdir && pwd`" != "`pwd`" && test -f $srcdir/config.status; then
+  AC_MSG_ERROR([source directory already configured; run "make distclean" there first])
+fi
+ifelse([$3],,
+AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE")
+AC_DEFINE_UNQUOTED(VERSION, "$VERSION"))
+AC_REQUIRE([AM_SANITY_CHECK])
+AC_REQUIRE([AC_ARG_PROGRAM])
+dnl FIXME This is truly gross.
+missing_dir=`cd $ac_aux_dir && pwd`
+AM_MISSING_PROG(ACLOCAL, aclocal, $missing_dir)
+AM_MISSING_PROG(AUTOCONF, autoconf, $missing_dir)
+AM_MISSING_PROG(AUTOMAKE, automake, $missing_dir)
+AM_MISSING_PROG(AUTOHEADER, autoheader, $missing_dir)
+AM_MISSING_PROG(MAKEINFO, makeinfo, $missing_dir)
+AC_REQUIRE([AC_PROG_MAKE_SET])])
+
+
+# serial 1
+
+AC_DEFUN(AM_PROG_INSTALL,
+[AC_REQUIRE([AC_PROG_INSTALL])
+test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL_PROGRAM}'
+AC_SUBST(INSTALL_SCRIPT)dnl
+])
+
+#
+# Check to make sure that the build environment is sane.
+#
+
+AC_DEFUN(AM_SANITY_CHECK,
+[AC_MSG_CHECKING([whether build environment is sane])
+# Just in case
+sleep 1
+echo timestamp > conftestfile
+# Do `set' in a subshell so we don't clobber the current shell's
+# arguments.  Must try -L first in case configure is actually a
+# symlink; some systems play weird games with the mod time of symlinks
+# (eg FreeBSD returns the mod time of the symlink's containing
+# directory).
+if (
+   set X `ls -Lt $srcdir/configure conftestfile 2> /dev/null`
+   if test "[$]*" = "X"; then
+      # -L didn't work.
+      set X `ls -t $srcdir/configure conftestfile`
+   fi
+   if test "[$]*" != "X $srcdir/configure conftestfile" \
+      && test "[$]*" != "X conftestfile $srcdir/configure"; then
+
+      # If neither matched, then we have a broken ls.  This can happen
+      # if, for instance, CONFIG_SHELL is bash and it inherits a
+      # broken ls alias from the environment.  This has actually
+      # happened.  Such a system could not be considered "sane".
+      AC_MSG_ERROR([ls -t appears to fail.  Make sure there is not a broken
+alias in your environment])
+   fi
+
+   test "[$]2" = conftestfile
+   )
+then
+   # Ok.
+   :
+else
+   AC_MSG_ERROR([newly created file is older than distributed files!
+Check your system clock])
+fi
+rm -f conftest*
+AC_MSG_RESULT(yes)])
+
+dnl AM_MISSING_PROG(NAME, PROGRAM, DIRECTORY)
+dnl The program must properly implement --version.
+AC_DEFUN(AM_MISSING_PROG,
+[AC_MSG_CHECKING(for working $2)
+# Run test in a subshell; some versions of sh will print an error if
+# an executable is not found, even if stderr is redirected.
+# Redirect stdin to placate older versions of autoconf.  Sigh.
+if ($2 --version) < /dev/null > /dev/null 2>&1; then
+   $1=$2
+   AC_MSG_RESULT(found)
+else
+   $1="$3/missing $2"
+   AC_MSG_RESULT(missing)
+fi
+AC_SUBST($1)])
+
+
+# serial 25 AM_PROG_LIBTOOL
+AC_DEFUN(AM_PROG_LIBTOOL,
+[AC_REQUIRE([AM_ENABLE_SHARED])dnl
+AC_REQUIRE([AM_ENABLE_STATIC])dnl
+AC_REQUIRE([AC_CANONICAL_HOST])dnl
+AC_REQUIRE([AC_PROG_RANLIB])dnl
+AC_REQUIRE([AC_PROG_CC])dnl
+AC_REQUIRE([AM_PROG_LD])dnl
+AC_REQUIRE([AM_PROG_NM])dnl
+AC_REQUIRE([AC_PROG_LN_S])dnl
+dnl
+# Always use our own libtool.
+LIBTOOL='$(SHELL) $(top_builddir)/libtool'
+AC_SUBST(LIBTOOL)dnl
+
+# Check for any special flags to pass to ltconfig.
+libtool_flags=
+test "$enable_shared" = no && libtool_flags="$libtool_flags --disable-shared"
+test "$enable_static" = no && libtool_flags="$libtool_flags --disable-static"
+test "$silent" = yes && libtool_flags="$libtool_flags --silent"
+test "$ac_cv_prog_gcc" = yes && libtool_flags="$libtool_flags --with-gcc"
+test "$ac_cv_prog_gnu_ld" = yes && libtool_flags="$libtool_flags --with-gnu-ld"
+
+# Some flags need to be propagated to the compiler or linker for good
+# libtool support.
+case "$host" in
+*-*-irix6*)
+  # Find out which ABI we are using.
+  echo '[#]line __oline__ "configure"' > conftest.$ac_ext
+  if AC_TRY_EVAL(ac_compile); then
+    case "`/usr/bin/file conftest.o`" in
+    *32-bit*)
+      LD="${LD-ld} -32"
+      ;;
+    *N32*)
+      LD="${LD-ld} -n32"
+      ;;
+    *64-bit*)
+      LD="${LD-ld} -64"
+      ;;
+    esac
+  fi
+  rm -rf conftest*
+  ;;
+
+*-*-sco3.2v5*)
+  # On SCO OpenServer 5, we need -belf to get full-featured binaries.
+  CFLAGS="$CFLAGS -belf"
+  ;;
+esac
+
+# Actually configure libtool.  ac_aux_dir is where install-sh is found.
+CC="$CC" CFLAGS="$CFLAGS" CPPFLAGS="$CPPFLAGS" \
+LD="$LD" NM="$NM" RANLIB="$RANLIB" LN_S="$LN_S" \
+${CONFIG_SHELL-/bin/sh} $ac_aux_dir/ltconfig --no-reexec \
+$libtool_flags --no-verify $ac_aux_dir/ltmain.sh $host \
+|| AC_MSG_ERROR([libtool configure failed])
+
+# Redirect the config.log output again, so that the ltconfig log is not
+# clobbered by the next message.
+exec 5>>./config.log
+])
+
+# AM_ENABLE_SHARED - implement the --enable-shared flag
+# Usage: AM_ENABLE_SHARED[(DEFAULT)]
+#   Where DEFAULT is either `yes' or `no'.  If omitted, it defaults to
+#   `yes'.
+AC_DEFUN(AM_ENABLE_SHARED,
+[define([AM_ENABLE_SHARED_DEFAULT], ifelse($1, no, no, yes))dnl
+AC_ARG_ENABLE(shared,
+changequote(<<, >>)dnl
+<<  --enable-shared[=PKGS]  build shared libraries [default=>>AM_ENABLE_SHARED_DEFAULT],
+changequote([, ])dnl
+[p=${PACKAGE-default}
+case "$enableval" in
+yes) enable_shared=yes ;;
+no) enable_shared=no ;;
+*)
+  enable_shared=no
+  # Look at the argument we got.  We use all the common list separators.
+  IFS="${IFS=  }"; ac_save_ifs="$IFS"; IFS="${IFS}:,"
+  for pkg in $enableval; do
+    if test "X$pkg" = "X$p"; then
+      enable_shared=yes
+    fi
+  done
+  IFS="$ac_save_ifs"
+  ;;
+esac],
+enable_shared=AM_ENABLE_SHARED_DEFAULT)dnl
+])
+
+# AM_DISABLE_SHARED - set the default shared flag to --disable-shared
+AC_DEFUN(AM_DISABLE_SHARED,
+[AM_ENABLE_SHARED(no)])
+
+# AM_DISABLE_STATIC - set the default static flag to --disable-static
+AC_DEFUN(AM_DISABLE_STATIC,
+[AM_ENABLE_STATIC(no)])
+
+# AM_ENABLE_STATIC - implement the --enable-static flag
+# Usage: AM_ENABLE_STATIC[(DEFAULT)]
+#   Where DEFAULT is either `yes' or `no'.  If omitted, it defaults to
+#   `yes'.
+AC_DEFUN(AM_ENABLE_STATIC,
+[define([AM_ENABLE_STATIC_DEFAULT], ifelse($1, no, no, yes))dnl
+AC_ARG_ENABLE(static,
+changequote(<<, >>)dnl
+<<  --enable-static[=PKGS]  build static libraries [default=>>AM_ENABLE_STATIC_DEFAULT],
+changequote([, ])dnl
+[p=${PACKAGE-default}
+case "$enableval" in
+yes) enable_static=yes ;;
+no) enable_static=no ;;
+*)
+  enable_static=no
+  # Look at the argument we got.  We use all the common list separators.
+  IFS="${IFS=  }"; ac_save_ifs="$IFS"; IFS="${IFS}:,"
+  for pkg in $enableval; do
+    if test "X$pkg" = "X$p"; then
+      enable_static=yes
+    fi
+  done
+  IFS="$ac_save_ifs"
+  ;;
+esac],
+enable_static=AM_ENABLE_STATIC_DEFAULT)dnl
+])
+
+
+# AM_PROG_LD - find the path to the GNU or non-GNU linker
+AC_DEFUN(AM_PROG_LD,
+[AC_ARG_WITH(gnu-ld,
+[  --with-gnu-ld           assume the C compiler uses GNU ld [default=no]],
+test "$withval" = no || with_gnu_ld=yes, with_gnu_ld=no)
+AC_REQUIRE([AC_PROG_CC])
+ac_prog=ld
+if test "$ac_cv_prog_gcc" = yes; then
+  # Check if gcc -print-prog-name=ld gives a path.
+  AC_MSG_CHECKING([for ld used by GCC])
+  ac_prog=`($CC -print-prog-name=ld) 2>&5`
+  case "$ac_prog" in
+  # Accept absolute paths.
+changequote(,)dnl
+  /* | [A-Za-z]:\\*)
+changequote([,])dnl
+    test -z "$LD" && LD="$ac_prog"
+    ;;
+  "")
+    # If it fails, then pretend we aren't using GCC.
+    ac_prog=ld
+    ;;
+  *)
+    # If it is relative, then search for the first ld in PATH.
+    with_gnu_ld=unknown
+    ;;
+  esac
+elif test "$with_gnu_ld" = yes; then
+  AC_MSG_CHECKING([for GNU ld])
+else
+  AC_MSG_CHECKING([for non-GNU ld])
+fi
+AC_CACHE_VAL(ac_cv_path_LD,
+[if test -z "$LD"; then
+  IFS="${IFS=  }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+  for ac_dir in $PATH; do
+    test -z "$ac_dir" && ac_dir=.
+    if test -f "$ac_dir/$ac_prog"; then
+      ac_cv_path_LD="$ac_dir/$ac_prog"
+      # Check to see if the program is GNU ld.  I'd rather use --version,
+      # but apparently some GNU ld's only accept -v.
+      # Break only if it was the GNU/non-GNU ld that we prefer.
+      if "$ac_cv_path_LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then
+       test "$with_gnu_ld" != no && break
+      else
+        test "$with_gnu_ld" != yes && break
+      fi
+    fi
+  done
+  IFS="$ac_save_ifs"
+else
+  ac_cv_path_LD="$LD" # Let the user override the test with a path.
+fi])
+LD="$ac_cv_path_LD"
+if test -n "$LD"; then
+  AC_MSG_RESULT($LD)
+else
+  AC_MSG_RESULT(no)
+fi
+test -z "$LD" && AC_MSG_ERROR([no acceptable ld found in \$PATH])
+AC_SUBST(LD)
+AM_PROG_LD_GNU
+])
+
+AC_DEFUN(AM_PROG_LD_GNU,
+[AC_CACHE_CHECK([if the linker ($LD) is GNU ld], ac_cv_prog_gnu_ld,
+[# I'd rather use --version here, but apparently some GNU ld's only accept -v.
+if $LD -v 2>&1 </dev/null | egrep '(GNU|with BFD)' 1>&5; then
+  ac_cv_prog_gnu_ld=yes
+else
+  ac_cv_prog_gnu_ld=no
+fi])
+])
+
+# AM_PROG_NM - find the path to a BSD-compatible name lister
+AC_DEFUN(AM_PROG_NM,
+[AC_MSG_CHECKING([for BSD-compatible nm])
+AC_CACHE_VAL(ac_cv_path_NM,
+[if test -n "$NM"; then
+  # Let the user override the test.
+  ac_cv_path_NM="$NM"
+else
+  IFS="${IFS=  }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+  for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do
+    test -z "$ac_dir" && ac_dir=.
+    if test -f $ac_dir/nm; then
+      # Check to see if the nm accepts a BSD-compat flag.
+      # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+      #   nm: unknown option "B" ignored
+      if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+        ac_cv_path_NM="$ac_dir/nm -B"
+      elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+        ac_cv_path_NM="$ac_dir/nm -p"
+      else
+        ac_cv_path_NM="$ac_dir/nm"
+      fi
+      break
+    fi
+  done
+  IFS="$ac_save_ifs"
+  test -z "$ac_cv_path_NM" && ac_cv_path_NM=nm
+fi])
+NM="$ac_cv_path_NM"
+AC_MSG_RESULT([$NM])
+AC_SUBST(NM)
+])
+
+# Like AC_CONFIG_HEADER, but automatically create stamp file.
+
+AC_DEFUN(AM_CONFIG_HEADER,
+[AC_PREREQ([2.12])
+AC_CONFIG_HEADER([$1])
+dnl When config.status generates a header, we must update the stamp-h file.
+dnl This file resides in the same directory as the config header
+dnl that is generated.  We must strip everything past the first ":",
+dnl and everything past the last "/".
+AC_OUTPUT_COMMANDS(changequote(<<,>>)dnl
+ifelse(patsubst(<<$1>>, <<[^ ]>>, <<>>), <<>>,
+<<test -z "<<$>>CONFIG_HEADERS" || echo timestamp > patsubst(<<$1>>, <<^\([^:]*/\)?.*>>, <<\1>>)stamp-h<<>>dnl>>,
+<<am_indx=1
+for am_file in <<$1>>; do
+  case " <<$>>CONFIG_HEADERS " in
+  *" <<$>>am_file "*<<)>>
+    echo timestamp > `echo <<$>>am_file | sed -e 's%:.*%%' -e 's%[^/]*$%%'`stamp-h$am_indx
+    ;;
+  esac
+  am_indx=`expr "<<$>>am_indx" + 1`
+done<<>>dnl>>)
+changequote([,]))])
+
diff --git a/config.guess b/config.guess
new file mode 100644 (file)
index 0000000..30230b3
--- /dev/null
@@ -0,0 +1,890 @@
+#! /bin/sh
+# Attempt to guess a canonical system name.
+#   Copyright (C) 1992, 93, 94, 95, 96, 97, 1998 Free Software Foundation, Inc.
+#
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Written by Per Bothner <bothner@cygnus.com>.
+# The master version of this file is at the FSF in /home/gd/gnu/lib.
+#
+# This script attempts to guess a canonical system name similar to
+# config.sub.  If it succeeds, it prints the system name on stdout, and
+# exits with 0.  Otherwise, it exits with 1.
+#
+# The plan is that this can be called by configure scripts if you
+# don't specify an explicit system type (host/target name).
+#
+# Only a few systems have been added to this list; please add others
+# (but try to keep the structure clean).
+#
+
+# This is needed to find uname on a Pyramid OSx when run in the BSD universe.
+# (ghazi@noc.rutgers.edu 8/24/94.)
+if (test -f /.attbin/uname) >/dev/null 2>&1 ; then
+       PATH=$PATH:/.attbin ; export PATH
+fi
+
+UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown
+UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown
+UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown
+UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown
+
+trap 'rm -f dummy.c dummy.o dummy; exit 1' 1 2 15
+
+# Note: order is significant - the case branches are not exclusive.
+
+case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in
+    alpha:OSF1:*:*)
+       if test $UNAME_RELEASE = "V4.0"; then
+               UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'`
+       fi
+       # A Vn.n version is a released version.
+       # A Tn.n version is a released field test version.
+       # A Xn.n version is an unreleased experimental baselevel.
+       # 1.2 uses "1.2" for uname -r.
+       cat <<EOF >dummy.s
+       .globl main
+       .ent main
+main:
+       .frame \$30,0,\$26,0
+       .prologue 0
+       .long 0x47e03d80 # implver $0
+       lda \$2,259
+       .long 0x47e20c21 # amask $2,$1
+       srl \$1,8,\$2
+       sll \$2,2,\$2
+       sll \$0,3,\$0
+       addl \$1,\$0,\$0
+       addl \$2,\$0,\$0
+       ret \$31,(\$26),1
+       .end main
+EOF
+       ${CC-cc} dummy.s -o dummy 2>/dev/null
+       if test "$?" = 0 ; then
+               ./dummy
+               case "$?" in
+                       7)
+                               UNAME_MACHINE="alpha"
+                               ;;
+                       15)
+                               UNAME_MACHINE="alphaev5"
+                               ;;
+                       14)
+                               UNAME_MACHINE="alphaev56"
+                               ;;
+                       10)
+                               UNAME_MACHINE="alphapca56"
+                               ;;
+                       16)
+                               UNAME_MACHINE="alphaev6"
+                               ;;
+               esac
+       fi
+       rm -f dummy.s dummy
+       echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[VTX]//' | tr [[A-Z]] [[a-z]]`
+       exit 0 ;;
+    21064:Windows_NT:50:3)
+       echo alpha-dec-winnt3.5
+       exit 0 ;;
+    Amiga*:UNIX_System_V:4.0:*)
+       echo m68k-cbm-sysv4
+       exit 0;;
+    amiga:NetBSD:*:*)
+      echo m68k-cbm-netbsd${UNAME_RELEASE}
+      exit 0 ;;
+    amiga:OpenBSD:*:*)
+       echo m68k-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    arc64:OpenBSD:*:*)
+       echo mips64el-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    arc:OpenBSD:*:*)
+       echo mipsel-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    hkmips:OpenBSD:*:*)
+       echo mips-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    pmax:OpenBSD:*:*)
+       echo mipsel-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    sgi:OpenBSD:*:*)
+       echo mips-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    wgrisc:OpenBSD:*:*)
+       echo mipsel-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*)
+       echo arm-acorn-riscix${UNAME_RELEASE}
+       exit 0;;
+    arm32:NetBSD:*:*)
+       echo arm-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+       exit 0 ;;
+    SR2?01:HI-UX/MPP:*:*)
+       echo hppa1.1-hitachi-hiuxmpp
+       exit 0;;
+    Pyramid*:OSx*:*:*|MIS*:OSx*:*:*)
+       # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE.
+       if test "`(/bin/universe) 2>/dev/null`" = att ; then
+               echo pyramid-pyramid-sysv3
+       else
+               echo pyramid-pyramid-bsd
+       fi
+       exit 0 ;;
+    NILE:*:*:dcosx)
+       echo pyramid-pyramid-svr4
+       exit 0 ;;
+    sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*)
+       echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+       exit 0 ;;
+    i86pc:SunOS:5.*:*)
+       echo i386-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+       exit 0 ;;
+    sun4*:SunOS:6*:*)
+       # According to config.sub, this is the proper way to canonicalize
+       # SunOS6.  Hard to guess exactly what SunOS6 will be like, but
+       # it's likely to be more like Solaris than SunOS4.
+       echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+       exit 0 ;;
+    sun4*:SunOS:*:*)
+       case "`/usr/bin/arch -k`" in
+           Series*|S4*)
+               UNAME_RELEASE=`uname -v`
+               ;;
+       esac
+       # Japanese Language versions have a version number like `4.1.3-JL'.
+       echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'`
+       exit 0 ;;
+    sun3*:SunOS:*:*)
+       echo m68k-sun-sunos${UNAME_RELEASE}
+       exit 0 ;;
+    sun*:*:4.2BSD:*)
+       UNAME_RELEASE=`(head -1 /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null`
+       test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3
+       case "`/bin/arch`" in
+           sun3)
+               echo m68k-sun-sunos${UNAME_RELEASE}
+               ;;
+           sun4)
+               echo sparc-sun-sunos${UNAME_RELEASE}
+               ;;
+       esac
+       exit 0 ;;
+    aushp:SunOS:*:*)
+       echo sparc-auspex-sunos${UNAME_RELEASE}
+       exit 0 ;;
+    atari*:NetBSD:*:*)
+       echo m68k-atari-netbsd${UNAME_RELEASE}
+       exit 0 ;;
+    atari*:OpenBSD:*:*)
+       echo m68k-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    sun3*:NetBSD:*:*)
+       echo m68k-sun-netbsd${UNAME_RELEASE}
+       exit 0 ;;
+    sun3*:OpenBSD:*:*)
+       echo m68k-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    mac68k:NetBSD:*:*)
+       echo m68k-apple-netbsd${UNAME_RELEASE}
+       exit 0 ;;
+    mac68k:OpenBSD:*:*)
+       echo m68k-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    mvme68k:OpenBSD:*:*)
+       echo m68k-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    mvme88k:OpenBSD:*:*)
+       echo m88k-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    powerpc:machten:*:*)
+       echo powerpc-apple-machten${UNAME_RELEASE}
+       exit 0 ;;
+    RISC*:Mach:*:*)
+       echo mips-dec-mach_bsd4.3
+       exit 0 ;;
+    RISC*:ULTRIX:*:*)
+       echo mips-dec-ultrix${UNAME_RELEASE}
+       exit 0 ;;
+    VAX*:ULTRIX*:*:*)
+       echo vax-dec-ultrix${UNAME_RELEASE}
+       exit 0 ;;
+    2020:CLIX:*:*)
+       echo clipper-intergraph-clix${UNAME_RELEASE}
+       exit 0 ;;
+    mips:*:*:UMIPS | mips:*:*:RISCos)
+       sed 's/^        //' << EOF >dummy.c
+       int main (argc, argv) int argc; char **argv; {
+       #if defined (host_mips) && defined (MIPSEB)
+       #if defined (SYSTYPE_SYSV)
+         printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0);
+       #endif
+       #if defined (SYSTYPE_SVR4)
+         printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0);
+       #endif
+       #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD)
+         printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0);
+       #endif
+       #endif
+         exit (-1);
+       }
+EOF
+       ${CC-cc} dummy.c -o dummy \
+         && ./dummy `echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` \
+         && rm dummy.c dummy && exit 0
+       rm -f dummy.c dummy
+       echo mips-mips-riscos${UNAME_RELEASE}
+       exit 0 ;;
+    Night_Hawk:Power_UNIX:*:*)
+       echo powerpc-harris-powerunix
+       exit 0 ;;
+    m88k:CX/UX:7*:*)
+       echo m88k-harris-cxux7
+       exit 0 ;;
+    m88k:*:4*:R4*)
+       echo m88k-motorola-sysv4
+       exit 0 ;;
+    m88k:*:3*:R3*)
+       echo m88k-motorola-sysv3
+       exit 0 ;;
+    AViiON:dgux:*:*)
+        # DG/UX returns AViiON for all architectures
+        UNAME_PROCESSOR=`/usr/bin/uname -p`
+        if [ $UNAME_PROCESSOR = mc88100 -o $UNAME_PROCESSOR = mc88110 ] ; then
+       if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx \
+            -o ${TARGET_BINARY_INTERFACE}x = x ] ; then
+               echo m88k-dg-dgux${UNAME_RELEASE}
+       else
+               echo m88k-dg-dguxbcs${UNAME_RELEASE}
+       fi
+        else echo i586-dg-dgux${UNAME_RELEASE}
+        fi
+       exit 0 ;;
+    M88*:DolphinOS:*:*)        # DolphinOS (SVR3)
+       echo m88k-dolphin-sysv3
+       exit 0 ;;
+    M88*:*:R3*:*)
+       # Delta 88k system running SVR3
+       echo m88k-motorola-sysv3
+       exit 0 ;;
+    XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3)
+       echo m88k-tektronix-sysv3
+       exit 0 ;;
+    Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD)
+       echo m68k-tektronix-bsd
+       exit 0 ;;
+    *:IRIX*:*:*)
+       echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'`
+       exit 0 ;;
+    ????????:AIX?:[12].1:2)   # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX.
+       echo romp-ibm-aix      # uname -m gives an 8 hex-code CPU id
+       exit 0 ;;              # Note that: echo "'`uname -s`'" gives 'AIX '
+    i?86:AIX:*:*)
+       echo i386-ibm-aix
+       exit 0 ;;
+    *:AIX:2:3)
+       if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then
+               sed 's/^                //' << EOF >dummy.c
+               #include <sys/systemcfg.h>
+
+               main()
+                       {
+                       if (!__power_pc())
+                               exit(1);
+                       puts("powerpc-ibm-aix3.2.5");
+                       exit(0);
+                       }
+EOF
+               ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0
+               rm -f dummy.c dummy
+               echo rs6000-ibm-aix3.2.5
+       elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then
+               echo rs6000-ibm-aix3.2.4
+       else
+               echo rs6000-ibm-aix3.2
+       fi
+       exit 0 ;;
+    *:AIX:*:4)
+       if /usr/sbin/lsattr -EHl proc0 | grep POWER >/dev/null 2>&1; then
+               IBM_ARCH=rs6000
+       else
+               IBM_ARCH=powerpc
+       fi
+       if [ -x /usr/bin/oslevel ] ; then
+               IBM_REV=`/usr/bin/oslevel`
+       else
+               IBM_REV=4.${UNAME_RELEASE}
+       fi
+       echo ${IBM_ARCH}-ibm-aix${IBM_REV}
+       exit 0 ;;
+    *:AIX:*:*)
+       echo rs6000-ibm-aix
+       exit 0 ;;
+    ibmrt:4.4BSD:*|romp-ibm:BSD:*)
+       echo romp-ibm-bsd4.4
+       exit 0 ;;
+    ibmrt:*BSD:*|romp-ibm:BSD:*)            # covers RT/PC NetBSD and
+       echo romp-ibm-bsd${UNAME_RELEASE}   # 4.3 with uname added to
+       exit 0 ;;                           # report: romp-ibm BSD 4.3
+    *:BOSX:*:*)
+       echo rs6000-bull-bosx
+       exit 0 ;;
+    DPX/2?00:B.O.S.:*:*)
+       echo m68k-bull-sysv3
+       exit 0 ;;
+    9000/[34]??:4.3bsd:1.*:*)
+       echo m68k-hp-bsd
+       exit 0 ;;
+    hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*)
+       echo m68k-hp-bsd4.4
+       exit 0 ;;
+    9000/[3478]??:HP-UX:*:*)
+       case "${UNAME_MACHINE}" in
+           9000/31? )            HP_ARCH=m68000 ;;
+           9000/[34]?? )         HP_ARCH=m68k ;;
+           9000/7?? | 9000/8?[1679] ) HP_ARCH=hppa1.1 ;;
+           9000/8?? )            HP_ARCH=hppa1.0 ;;
+       esac
+       HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'`
+       echo ${HP_ARCH}-hp-hpux${HPUX_REV}
+       exit 0 ;;
+    3050*:HI-UX:*:*)
+       sed 's/^        //' << EOF >dummy.c
+       #include <unistd.h>
+       int
+       main ()
+       {
+         long cpu = sysconf (_SC_CPU_VERSION);
+         /* The order matters, because CPU_IS_HP_MC68K erroneously returns
+            true for CPU_PA_RISC1_0.  CPU_IS_PA_RISC returns correct
+            results, however.  */
+         if (CPU_IS_PA_RISC (cpu))
+           {
+             switch (cpu)
+               {
+                 case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break;
+                 case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break;
+                 case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break;
+                 default: puts ("hppa-hitachi-hiuxwe2"); break;
+               }
+           }
+         else if (CPU_IS_HP_MC68K (cpu))
+           puts ("m68k-hitachi-hiuxwe2");
+         else puts ("unknown-hitachi-hiuxwe2");
+         exit (0);
+       }
+EOF
+       ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0
+       rm -f dummy.c dummy
+       echo unknown-hitachi-hiuxwe2
+       exit 0 ;;
+    9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* )
+       echo hppa1.1-hp-bsd
+       exit 0 ;;
+    9000/8??:4.3bsd:*:*)
+       echo hppa1.0-hp-bsd
+       exit 0 ;;
+    hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* )
+       echo hppa1.1-hp-osf
+       exit 0 ;;
+    hp8??:OSF1:*:*)
+       echo hppa1.0-hp-osf
+       exit 0 ;;
+    i?86:OSF1:*:*)
+       if [ -x /usr/sbin/sysversion ] ; then
+           echo ${UNAME_MACHINE}-unknown-osf1mk
+       else
+           echo ${UNAME_MACHINE}-unknown-osf1
+       fi
+       exit 0 ;;
+    parisc*:Lites*:*:*)
+       echo hppa1.1-hp-lites
+       exit 0 ;;
+    C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*)
+       echo c1-convex-bsd
+        exit 0 ;;
+    C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*)
+       if getsysinfo -f scalar_acc
+       then echo c32-convex-bsd
+       else echo c2-convex-bsd
+       fi
+        exit 0 ;;
+    C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*)
+       echo c34-convex-bsd
+        exit 0 ;;
+    C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*)
+       echo c38-convex-bsd
+        exit 0 ;;
+    C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*)
+       echo c4-convex-bsd
+        exit 0 ;;
+    CRAY*X-MP:*:*:*)
+       echo xmp-cray-unicos
+        exit 0 ;;
+    CRAY*Y-MP:*:*:*)
+       echo ymp-cray-unicos${UNAME_RELEASE}
+       exit 0 ;;
+    CRAY*[A-Z]90:*:*:*)
+       echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \
+       | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \
+             -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/
+       exit 0 ;;
+    CRAY*TS:*:*:*)
+       echo t90-cray-unicos${UNAME_RELEASE}
+       exit 0 ;;
+    CRAY-2:*:*:*)
+       echo cray2-cray-unicos
+        exit 0 ;;
+    F300:UNIX_System_V:*:*)
+        FUJITSU_SYS=`uname -p | tr [A-Z] [a-z] | sed -e 's/\///'`
+        FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'`
+        echo "f300-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}"
+        exit 0 ;;
+    F301:UNIX_System_V:*:*)
+       echo f301-fujitsu-uxpv`echo $UNAME_RELEASE | sed 's/ .*//'`
+       exit 0 ;;
+    hp3[0-9][05]:NetBSD:*:*)
+       echo m68k-hp-netbsd${UNAME_RELEASE}
+       exit 0 ;;
+    hp300:OpenBSD:*:*)
+       echo m68k-unknown-openbsd${UNAME_RELEASE}
+       exit 0 ;;
+    i?86:BSD/386:*:* | *:BSD/OS:*:*)
+       echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE}
+       exit 0 ;;
+    *:FreeBSD:*:*)
+       echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'`
+       exit 0 ;;
+    *:NetBSD:*:*)
+       echo ${UNAME_MACHINE}-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+       exit 0 ;;
+    *:OpenBSD:*:*)
+       echo ${UNAME_MACHINE}-unknown-openbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'`
+       exit 0 ;;
+    i*:CYGWIN*:*)
+       echo ${UNAME_MACHINE}-pc-cygwin32
+       exit 0 ;;
+    i*:MINGW*:*)
+       echo ${UNAME_MACHINE}-pc-mingw32
+       exit 0 ;;
+    p*:CYGWIN*:*)
+       echo powerpcle-unknown-cygwin32
+       exit 0 ;;
+    prep*:SunOS:5.*:*)
+       echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'`
+       exit 0 ;;
+    *:GNU:*:*)
+       echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'`
+       exit 0 ;;
+    *:Linux:*:*)
+       # uname on the ARM produces all sorts of strangeness, and we need to
+       # filter it out.
+       case "$UNAME_MACHINE" in
+         arm* | sa110*)              UNAME_MACHINE="arm" ;;
+       esac
+
+       # The BFD linker knows what the default object file format is, so
+       # first see if it will tell us.
+       ld_help_string=`ld --help 2>&1`
+       ld_supported_emulations=`echo $ld_help_string \
+                        | sed -ne '/supported emulations:/!d
+                                   s/[         ][      ]*/ /g
+                                   s/.*supported emulations: *//
+                                   s/ .*//
+                                   p'`
+        case "$ld_supported_emulations" in
+         i?86linux)  echo "${UNAME_MACHINE}-pc-linux-gnuaout"      ; exit 0 ;;
+         i?86coff)   echo "${UNAME_MACHINE}-pc-linux-gnucoff"      ; exit 0 ;;
+         sparclinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;;
+         armlinux)   echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;;
+         m68klinux)  echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;;
+         elf32ppc)   echo "powerpc-unknown-linux-gnu"              ; exit 0 ;;
+       esac
+
+       if test "${UNAME_MACHINE}" = "alpha" ; then
+               sed 's/^        //'  <<EOF >dummy.s
+               .globl main
+               .ent main
+       main:
+               .frame \$30,0,\$26,0
+               .prologue 0
+               .long 0x47e03d80 # implver $0
+               lda \$2,259
+               .long 0x47e20c21 # amask $2,$1
+               srl \$1,8,\$2
+               sll \$2,2,\$2
+               sll \$0,3,\$0
+               addl \$1,\$0,\$0
+               addl \$2,\$0,\$0
+               ret \$31,(\$26),1
+               .end main
+EOF
+               LIBC=""
+               ${CC-cc} dummy.s -o dummy 2>/dev/null
+               if test "$?" = 0 ; then
+                       ./dummy
+                       case "$?" in
+                       7)
+                               UNAME_MACHINE="alpha"
+                               ;;
+                       15)
+                               UNAME_MACHINE="alphaev5"
+                               ;;
+                       14)
+                               UNAME_MACHINE="alphaev56"
+                               ;;
+                       10)
+                               UNAME_MACHINE="alphapca56"
+                               ;;
+                       16)
+                               UNAME_MACHINE="alphaev6"
+                               ;;
+                       esac    
+
+                       objdump --private-headers dummy | \
+                         grep ld.so.1 > /dev/null
+                       if test "$?" = 0 ; then
+                               LIBC="libc1"
+                       fi
+               fi      
+               rm -f dummy.s dummy
+               echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC} ; exit 0
+       elif test "${UNAME_MACHINE}" = "mips" ; then
+         cat >dummy.c <<EOF
+main(argc, argv)
+     int argc;
+     char *argv[];
+{
+#ifdef __MIPSEB__
+  printf ("%s-unknown-linux-gnu\n", argv[1]);
+#endif
+#ifdef __MIPSEL__
+  printf ("%sel-unknown-linux-gnu\n", argv[1]);
+#endif
+  return 0;
+}
+EOF
+         ${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0
+         rm -f dummy.c dummy
+       else
+         # Either a pre-BFD a.out linker (linux-gnuoldld)
+         # or one that does not give us useful --help.
+         # GCC wants to distinguish between linux-gnuoldld and linux-gnuaout.
+         # If ld does not provide *any* "supported emulations:"
+         # that means it is gnuoldld.
+         echo "$ld_help_string" | grep >/dev/null 2>&1 "supported emulations:"
+         test $? != 0 && echo "${UNAME_MACHINE}-pc-linux-gnuoldld" && exit 0
+
+         case "${UNAME_MACHINE}" in
+         i?86)
+           VENDOR=pc;
+           ;;
+         *)
+           VENDOR=unknown;
+           ;;
+         esac
+         # Determine whether the default compiler is a.out or elf
+         cat >dummy.c <<EOF
+#include <features.h>
+main(argc, argv)
+     int argc;
+     char *argv[];
+{
+#ifdef __ELF__
+# ifdef __GLIBC__
+#  if __GLIBC__ >= 2
+    printf ("%s-${VENDOR}-linux-gnu\n", argv[1]);
+#  else
+    printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]);
+#  endif
+# else
+   printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]);
+# endif
+#else
+  printf ("%s-${VENDOR}-linux-gnuaout\n", argv[1]);
+#endif
+  return 0;
+}
+EOF
+         ${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0
+         rm -f dummy.c dummy
+       fi ;;
+# ptx 4.0 does uname -s correctly, with DYNIX/ptx in there.  earlier versions
+# are messed up and put the nodename in both sysname and nodename.
+    i?86:DYNIX/ptx:4*:*)
+       echo i386-sequent-sysv4
+       exit 0 ;;
+    i?86:UNIX_SV:4.2MP:2.*)
+        # Unixware is an offshoot of SVR4, but it has its own version
+        # number series starting with 2...
+        # I am not positive that other SVR4 systems won't match this,
+       # I just have to hope.  -- rms.
+        # Use sysv4.2uw... so that sysv4* matches it.
+       echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION}
+       exit 0 ;;
+    i?86:*:4.*:* | i?86:SYSTEM_V:4.*:*)
+       if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then
+               echo ${UNAME_MACHINE}-univel-sysv${UNAME_RELEASE}
+       else
+               echo ${UNAME_MACHINE}-pc-sysv${UNAME_RELEASE}
+       fi
+       exit 0 ;;
+    i?86:*:3.2:*)
+       if test -f /usr/options/cb.name; then
+               UNAME_REL=`sed -n 's/.*Version //p' </usr/options/cb.name`
+               echo ${UNAME_MACHINE}-pc-isc$UNAME_REL
+       elif /bin/uname -X 2>/dev/null >/dev/null ; then
+               UNAME_REL=`(/bin/uname -X|egrep Release|sed -e 's/.*= //')`
+               (/bin/uname -X|egrep i80486 >/dev/null) && UNAME_MACHINE=i486
+               (/bin/uname -X|egrep '^Machine.*Pentium' >/dev/null) \
+                       && UNAME_MACHINE=i586
+               echo ${UNAME_MACHINE}-pc-sco$UNAME_REL
+       else
+               echo ${UNAME_MACHINE}-pc-sysv32
+       fi
+       exit 0 ;;
+    pc:*:*:*)
+        # uname -m prints for DJGPP always 'pc', but it prints nothing about
+        # the processor, so we play safe by assuming i386.
+       echo i386-pc-msdosdjgpp
+        exit 0 ;;
+    Intel:Mach:3*:*)
+       echo i386-pc-mach3
+       exit 0 ;;
+    paragon:*:*:*)
+       echo i860-intel-osf1
+       exit 0 ;;
+    i860:*:4.*:*) # i860-SVR4
+       if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then
+         echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4
+       else # Add other i860-SVR4 vendors below as they are discovered.
+         echo i860-unknown-sysv${UNAME_RELEASE}  # Unknown i860-SVR4
+       fi
+       exit 0 ;;
+    mini*:CTIX:SYS*5:*)
+       # "miniframe"
+       echo m68010-convergent-sysv
+       exit 0 ;;
+    M68*:*:R3V[567]*:*)
+       test -r /sysV68 && echo 'm68k-motorola-sysv' && exit 0 ;;
+    3[34]??:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 4850:*:4.0:3.0)
+       OS_REL=''
+       test -r /etc/.relid \
+       && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid`
+       /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+         && echo i486-ncr-sysv4.3${OS_REL} && exit 0
+       /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \
+         && echo i586-ncr-sysv4.3${OS_REL} && exit 0 ;;
+    3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*)
+        /bin/uname -p 2>/dev/null | grep 86 >/dev/null \
+          && echo i486-ncr-sysv4 && exit 0 ;;
+    m68*:LynxOS:2.*:*)
+       echo m68k-unknown-lynxos${UNAME_RELEASE}
+       exit 0 ;;
+    mc68030:UNIX_System_V:4.*:*)
+       echo m68k-atari-sysv4
+       exit 0 ;;
+    i?86:LynxOS:2.*:*)
+       echo i386-unknown-lynxos${UNAME_RELEASE}
+       exit 0 ;;
+    TSUNAMI:LynxOS:2.*:*)
+       echo sparc-unknown-lynxos${UNAME_RELEASE}
+       exit 0 ;;
+    rs6000:LynxOS:2.*:* | PowerPC:LynxOS:2.*:*)
+       echo rs6000-unknown-lynxos${UNAME_RELEASE}
+       exit 0 ;;
+    SM[BE]S:UNIX_SV:*:*)
+       echo mips-dde-sysv${UNAME_RELEASE}
+       exit 0 ;;
+    RM*:SINIX-*:*:*)
+       echo mips-sni-sysv4
+       exit 0 ;;
+    *:SINIX-*:*:*)
+       if uname -p 2>/dev/null >/dev/null ; then
+               UNAME_MACHINE=`(uname -p) 2>/dev/null`
+               echo ${UNAME_MACHINE}-sni-sysv4
+       else
+               echo ns32k-sni-sysv
+       fi
+       exit 0 ;;
+    PENTIUM:CPunix:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort
+                           # says <Richard.M.Bartel@ccMail.Census.GOV>
+        echo i586-unisys-sysv4
+        exit 0 ;;
+    *:UNIX_System_V:4*:FTX*)
+       # From Gerald Hewes <hewes@openmarket.com>.
+       # How about differentiating between stratus architectures? -djm
+       echo hppa1.1-stratus-sysv4
+       exit 0 ;;
+    *:*:*:FTX*)
+       # From seanf@swdc.stratus.com.
+       echo i860-stratus-sysv4
+       exit 0 ;;
+    mc68*:A/UX:*:*)
+       echo m68k-apple-aux${UNAME_RELEASE}
+       exit 0 ;;
+    news*:NEWS-OS:*:6*)
+       echo mips-sony-newsos6
+       exit 0 ;;
+    R3000:*System_V*:*:* | R4000:UNIX_SYSV:*:*)
+       if [ -d /usr/nec ]; then
+               echo mips-nec-sysv${UNAME_RELEASE}
+       else
+               echo mips-unknown-sysv${UNAME_RELEASE}
+       fi
+        exit 0 ;;
+esac
+
+#echo '(No uname command or uname output not recognized.)' 1>&2
+#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2
+
+cat >dummy.c <<EOF
+#ifdef _SEQUENT_
+# include <sys/types.h>
+# include <sys/utsname.h>
+#endif
+main ()
+{
+#if defined (sony)
+#if defined (MIPSEB)
+  /* BFD wants "bsd" instead of "newsos".  Perhaps BFD should be changed,
+     I don't know....  */
+  printf ("mips-sony-bsd\n"); exit (0);
+#else
+#include <sys/param.h>
+  printf ("m68k-sony-newsos%s\n",
+#ifdef NEWSOS4
+          "4"
+#else
+         ""
+#endif
+         ); exit (0);
+#endif
+#endif
+
+#if defined (__arm) && defined (__acorn) && defined (__unix)
+  printf ("arm-acorn-riscix"); exit (0);
+#endif
+
+#if defined (hp300) && !defined (hpux)
+  printf ("m68k-hp-bsd\n"); exit (0);
+#endif
+
+#if defined (NeXT)
+#if !defined (__ARCHITECTURE__)
+#define __ARCHITECTURE__ "m68k"
+#endif
+  int version;
+  version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`;
+  printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version);
+  exit (0);
+#endif
+
+#if defined (MULTIMAX) || defined (n16)
+#if defined (UMAXV)
+  printf ("ns32k-encore-sysv\n"); exit (0);
+#else
+#if defined (CMU)
+  printf ("ns32k-encore-mach\n"); exit (0);
+#else
+  printf ("ns32k-encore-bsd\n"); exit (0);
+#endif
+#endif
+#endif
+
+#if defined (__386BSD__)
+  printf ("i386-pc-bsd\n"); exit (0);
+#endif
+
+#if defined (sequent)
+#if defined (i386)
+  printf ("i386-sequent-dynix\n"); exit (0);
+#endif
+#if defined (ns32000)
+  printf ("ns32k-sequent-dynix\n"); exit (0);
+#endif
+#endif
+
+#if defined (_SEQUENT_)
+    struct utsname un;
+
+    uname(&un);
+
+    if (strncmp(un.version, "V2", 2) == 0) {
+       printf ("i386-sequent-ptx2\n"); exit (0);
+    }
+    if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */
+       printf ("i386-sequent-ptx1\n"); exit (0);
+    }
+    printf ("i386-sequent-ptx\n"); exit (0);
+
+#endif
+
+#if defined (vax)
+#if !defined (ultrix)
+  printf ("vax-dec-bsd\n"); exit (0);
+#else
+  printf ("vax-dec-ultrix\n"); exit (0);
+#endif
+#endif
+
+#if defined (alliant) && defined (i860)
+  printf ("i860-alliant-bsd\n"); exit (0);
+#endif
+
+  exit (1);
+}
+EOF
+
+${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy && rm dummy.c dummy && exit 0
+rm -f dummy.c dummy
+
+# Apollos put the system type in the environment.
+
+test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit 0; }
+
+# Convex versions that predate uname can use getsysinfo(1)
+
+if [ -x /usr/convex/getsysinfo ]
+then
+    case `getsysinfo -f cpu_type` in
+    c1*)
+       echo c1-convex-bsd
+       exit 0 ;;
+    c2*)
+       if getsysinfo -f scalar_acc
+       then echo c32-convex-bsd
+       else echo c2-convex-bsd
+       fi
+       exit 0 ;;
+    c34*)
+       echo c34-convex-bsd
+       exit 0 ;;
+    c38*)
+       echo c38-convex-bsd
+       exit 0 ;;
+    c4*)
+       echo c4-convex-bsd
+       exit 0 ;;
+    esac
+fi
+
+#echo '(Unable to guess system type)' 1>&2
+
+exit 1
diff --git a/config.sub b/config.sub
new file mode 100644 (file)
index 0000000..e24b850
--- /dev/null
@@ -0,0 +1,952 @@
+#! /bin/sh
+# Configuration validation subroutine script, version 1.1.
+#   Copyright (C) 1991, 92-97, 1998 Free Software Foundation, Inc.
+# This file is (in principle) common to ALL GNU software.
+# The presence of a machine in this file suggests that SOME GNU software
+# can handle that machine.  It does not imply ALL GNU software can.
+#
+# This file is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330,
+# Boston, MA 02111-1307, USA.
+
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Configuration subroutine to validate and canonicalize a configuration type.
+# Supply the specified configuration type as an argument.
+# If it is invalid, we print an error message on stderr and exit with code 1.
+# Otherwise, we print the canonical config type on stdout and succeed.
+
+# This file is supposed to be the same for all GNU packages
+# and recognize all the CPU types, system types and aliases
+# that are meaningful with *any* GNU software.
+# Each package is responsible for reporting which valid configurations
+# it does not support.  The user should be able to distinguish
+# a failure to support a valid configuration from a meaningless
+# configuration.
+
+# The goal of this file is to map all the various variations of a given
+# machine specification into a single specification in the form:
+#      CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM
+# or in some cases, the newer four-part form:
+#      CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM
+# It is wrong to echo any other type of specification.
+
+if [ x$1 = x ]
+then
+       echo Configuration name missing. 1>&2
+       echo "Usage: $0 CPU-MFR-OPSYS" 1>&2
+       echo "or     $0 ALIAS" 1>&2
+       echo where ALIAS is a recognized configuration type. 1>&2
+       exit 1
+fi
+
+# First pass through any local machine types.
+case $1 in
+       *local*)
+               echo $1
+               exit 0
+               ;;
+       *)
+       ;;
+esac
+
+# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any).
+# Here we must recognize all the valid KERNEL-OS combinations.
+maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'`
+case $maybe_os in
+  linux-gnu*)
+    os=-$maybe_os
+    basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'`
+    ;;
+  *)
+    basic_machine=`echo $1 | sed 's/-[^-]*$//'`
+    if [ $basic_machine != $1 ]
+    then os=`echo $1 | sed 's/.*-/-/'`
+    else os=; fi
+    ;;
+esac
+
+### Let's recognize common machines as not being operating systems so
+### that things like config.sub decstation-3100 work.  We also
+### recognize some manufacturers as not being operating systems, so we
+### can provide default operating systems below.
+case $os in
+       -sun*os*)
+               # Prevent following clause from handling this invalid input.
+               ;;
+       -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \
+       -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \
+       -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \
+       -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\
+       -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \
+       -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \
+       -apple)
+               os=
+               basic_machine=$1
+               ;;
+       -hiux*)
+               os=-hiuxwe2
+               ;;
+       -sco5)
+               os=sco3.2v5
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+               ;;
+       -sco4)
+               os=-sco3.2v4
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+               ;;
+       -sco3.2.[4-9]*)
+               os=`echo $os | sed -e 's/sco3.2./sco3.2v/'`
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+               ;;
+       -sco3.2v[4-9]*)
+               # Don't forget version if it is 3.2v4 or newer.
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+               ;;
+       -sco*)
+               os=-sco3.2v2
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+               ;;
+       -isc)
+               os=-isc2.2
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+               ;;
+       -clix*)
+               basic_machine=clipper-intergraph
+               ;;
+       -isc*)
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'`
+               ;;
+       -lynx*)
+               os=-lynxos
+               ;;
+       -ptx*)
+               basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'`
+               ;;
+       -windowsnt*)
+               os=`echo $os | sed -e 's/windowsnt/winnt/'`
+               ;;
+       -psos*)
+               os=-psos
+               ;;
+esac
+
+# Decode aliases for certain CPU-COMPANY combinations.
+case $basic_machine in
+       # Recognize the basic CPU types without company name.
+       # Some are omitted here because they have special meanings below.
+       tahoe | i860 | m32r | m68k | m68000 | m88k | ns32k | arc | arm \
+               | arme[lb] | pyramid | mn10200 | mn10300 \
+               | tron | a29k | 580 | i960 | h8300 | hppa | hppa1.0 | hppa1.1 \
+               | alpha | alphaev5 | alphaev56 | we32k | ns16k | clipper \
+               | i370 | sh | powerpc | powerpcle | 1750a | dsp16xx | pdp11 \
+               | mips64 | mipsel | mips64el | mips64orion | mips64orionel \
+               | mipstx39 | mipstx39el \
+               | sparc | sparclet | sparclite | sparc64 | v850)
+               basic_machine=$basic_machine-unknown
+               ;;
+       # We use `pc' rather than `unknown'
+       # because (1) that's what they normally are, and
+       # (2) the word "unknown" tends to confuse beginning users.
+       i[34567]86)
+         basic_machine=$basic_machine-pc
+         ;;
+       # Object if more than one company name word.
+       *-*-*)
+               echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+               exit 1
+               ;;
+       # Recognize the basic CPU types with company name.
+       vax-* | tahoe-* | i[34567]86-* | i860-* | m32r-* | m68k-* | m68000-* \
+             | m88k-* | sparc-* | ns32k-* | fx80-* | arc-* | arm-* | c[123]* \
+             | mips-* | pyramid-* | tron-* | a29k-* | romp-* | rs6000-* \
+             | power-* | none-* | 580-* | cray2-* | h8300-* | i960-* \
+             | xmp-* | ymp-* | hppa-* | hppa1.0-* | hppa1.1-* \
+             | alpha-* | alphaev5-* | alphaev56-* | we32k-* | cydra-* \
+             | ns16k-* | pn-* | np1-* | xps100-* | clipper-* | orion-* \
+             | sparclite-* | pdp11-* | sh-* | powerpc-* | powerpcle-* \
+             | sparc64-* | mips64-* | mipsel-* \
+             | mips64el-* | mips64orion-* | mips64orionel-*  \
+             | mipstx39-* | mipstx39el-* \
+             | f301-*)
+               ;;
+       # Recognize the various machine names and aliases which stand
+       # for a CPU type and a company and sometimes even an OS.
+       3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc)
+               basic_machine=m68000-att
+               ;;
+       3b*)
+               basic_machine=we32k-att
+               ;;
+       alliant | fx80)
+               basic_machine=fx80-alliant
+               ;;
+       altos | altos3068)
+               basic_machine=m68k-altos
+               ;;
+       am29k)
+               basic_machine=a29k-none
+               os=-bsd
+               ;;
+       amdahl)
+               basic_machine=580-amdahl
+               os=-sysv
+               ;;
+       amiga | amiga-*)
+               basic_machine=m68k-cbm
+               ;;
+       amigaos | amigados)
+               basic_machine=m68k-cbm
+               os=-amigaos
+               ;;
+       amigaunix | amix)
+               basic_machine=m68k-cbm
+               os=-sysv4
+               ;;
+       apollo68)
+               basic_machine=m68k-apollo
+               os=-sysv
+               ;;
+       aux)
+               basic_machine=m68k-apple
+               os=-aux
+               ;;
+       balance)
+               basic_machine=ns32k-sequent
+               os=-dynix
+               ;;
+       convex-c1)
+               basic_machine=c1-convex
+               os=-bsd
+               ;;
+       convex-c2)
+               basic_machine=c2-convex
+               os=-bsd
+               ;;
+       convex-c32)
+               basic_machine=c32-convex
+               os=-bsd
+               ;;
+       convex-c34)
+               basic_machine=c34-convex
+               os=-bsd
+               ;;
+       convex-c38)
+               basic_machine=c38-convex
+               os=-bsd
+               ;;
+       cray | ymp)
+               basic_machine=ymp-cray
+               os=-unicos
+               ;;
+       cray2)
+               basic_machine=cray2-cray
+               os=-unicos
+               ;;
+       [ctj]90-cray)
+               basic_machine=c90-cray
+               os=-unicos
+               ;;
+       crds | unos)
+               basic_machine=m68k-crds
+               ;;
+       da30 | da30-*)
+               basic_machine=m68k-da30
+               ;;
+       decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn)
+               basic_machine=mips-dec
+               ;;
+       delta | 3300 | motorola-3300 | motorola-delta \
+             | 3300-motorola | delta-motorola)
+               basic_machine=m68k-motorola
+               ;;
+       delta88)
+               basic_machine=m88k-motorola
+               os=-sysv3
+               ;;
+       dpx20 | dpx20-*)
+               basic_machine=rs6000-bull
+               os=-bosx
+               ;;
+       dpx2* | dpx2*-bull)
+               basic_machine=m68k-bull
+               os=-sysv3
+               ;;
+       ebmon29k)
+               basic_machine=a29k-amd
+               os=-ebmon
+               ;;
+       elxsi)
+               basic_machine=elxsi-elxsi
+               os=-bsd
+               ;;
+       encore | umax | mmax)
+               basic_machine=ns32k-encore
+               ;;
+       fx2800)
+               basic_machine=i860-alliant
+               ;;
+       genix)
+               basic_machine=ns32k-ns
+               ;;
+       gmicro)
+               basic_machine=tron-gmicro
+               os=-sysv
+               ;;
+       h3050r* | hiux*)
+               basic_machine=hppa1.1-hitachi
+               os=-hiuxwe2
+               ;;
+       h8300hms)
+               basic_machine=h8300-hitachi
+               os=-hms
+               ;;
+       harris)
+               basic_machine=m88k-harris
+               os=-sysv3
+               ;;
+       hp300-*)
+               basic_machine=m68k-hp
+               ;;
+       hp300bsd)
+               basic_machine=m68k-hp
+               os=-bsd
+               ;;
+       hp300hpux)
+               basic_machine=m68k-hp
+               os=-hpux
+               ;;
+       hp9k2[0-9][0-9] | hp9k31[0-9])
+               basic_machine=m68000-hp
+               ;;
+       hp9k3[2-9][0-9])
+               basic_machine=m68k-hp
+               ;;
+       hp9k7[0-9][0-9] | hp7[0-9][0-9] | hp9k8[0-9]7 | hp8[0-9]7)
+               basic_machine=hppa1.1-hp
+               ;;
+       hp9k8[0-9][0-9] | hp8[0-9][0-9])
+               basic_machine=hppa1.0-hp
+               ;;
+       hppa-next)
+               os=-nextstep3
+               ;;
+       i370-ibm* | ibm*)
+               basic_machine=i370-ibm
+               os=-mvs
+               ;;
+# I'm not sure what "Sysv32" means.  Should this be sysv3.2?
+       i[34567]86v32)
+               basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+               os=-sysv32
+               ;;
+       i[34567]86v4*)
+               basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+               os=-sysv4
+               ;;
+       i[34567]86v)
+               basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+               os=-sysv
+               ;;
+       i[34567]86sol2)
+               basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'`
+               os=-solaris2
+               ;;
+       iris | iris4d)
+               basic_machine=mips-sgi
+               case $os in
+                   -irix*)
+                       ;;
+                   *)
+                       os=-irix4
+                       ;;
+               esac
+               ;;
+       isi68 | isi)
+               basic_machine=m68k-isi
+               os=-sysv
+               ;;
+       m88k-omron*)
+               basic_machine=m88k-omron
+               ;;
+       magnum | m3230)
+               basic_machine=mips-mips
+               os=-sysv
+               ;;
+       merlin)
+               basic_machine=ns32k-utek
+               os=-sysv
+               ;;
+       miniframe)
+               basic_machine=m68000-convergent
+               ;;
+       mipsel*-linux*)
+               basic_machine=mipsel-unknown
+               os=-linux-gnu
+               ;;
+       mips*-linux*)
+               basic_machine=mips-unknown
+               os=-linux-gnu
+               ;;
+       mips3*-*)
+               basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`
+               ;;
+       mips3*)
+               basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown
+               ;;
+       ncr3000)
+               basic_machine=i486-ncr
+               os=-sysv4
+               ;;
+       news | news700 | news800 | news900)
+               basic_machine=m68k-sony
+               os=-newsos
+               ;;
+       news1000)
+               basic_machine=m68030-sony
+               os=-newsos
+               ;;
+       news-3600 | risc-news)
+               basic_machine=mips-sony
+               os=-newsos
+               ;;
+       next | m*-next )
+               basic_machine=m68k-next
+               case $os in
+                   -nextstep* )
+                       ;;
+                   -ns2*)
+                     os=-nextstep2
+                       ;;
+                   *)
+                     os=-nextstep3
+                       ;;
+               esac
+               ;;
+       nh3000)
+               basic_machine=m68k-harris
+               os=-cxux
+               ;;
+       nh[45]000)
+               basic_machine=m88k-harris
+               os=-cxux
+               ;;
+       nindy960)
+               basic_machine=i960-intel
+               os=-nindy
+               ;;
+       np1)
+               basic_machine=np1-gould
+               ;;
+       pa-hitachi)
+               basic_machine=hppa1.1-hitachi
+               os=-hiuxwe2
+               ;;
+       paragon)
+               basic_machine=i860-intel
+               os=-osf
+               ;;
+       pbd)
+               basic_machine=sparc-tti
+               ;;
+       pbb)
+               basic_machine=m68k-tti
+               ;;
+        pc532 | pc532-*)
+               basic_machine=ns32k-pc532
+               ;;
+       pentium | p5 | k5 | nexen)
+               basic_machine=i586-pc
+               ;;
+       pentiumpro | p6 | k6 | 6x86)
+               basic_machine=i686-pc
+               ;;
+       pentiumii | pentium2)
+               basic_machine=i786-pc
+               ;;
+       pentium-* | p5-* | k5-* | nexen-*)
+               basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'`
+               ;;
+       pentiumpro-* | p6-* | k6-* | 6x86-*)
+               basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'`
+               ;;
+       pentiumii-* | pentium2-*)
+               basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'`
+               ;;
+       pn)
+               basic_machine=pn-gould
+               ;;
+       power)  basic_machine=rs6000-ibm
+               ;;
+       ppc)    basic_machine=powerpc-unknown
+               ;;
+       ppc-*)  basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'`
+               ;;
+       ppcle | powerpclittle | ppc-le | powerpc-little)
+               basic_machine=powerpcle-unknown
+               ;;
+       ppcle-* | powerpclittle-*)
+               basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'`
+               ;;
+       ps2)
+               basic_machine=i386-ibm
+               ;;
+       rm[46]00)
+               basic_machine=mips-siemens
+               ;;
+       rtpc | rtpc-*)
+               basic_machine=romp-ibm
+               ;;
+       sequent)
+               basic_machine=i386-sequent
+               ;;
+       sh)
+               basic_machine=sh-hitachi
+               os=-hms
+               ;;
+       sps7)
+               basic_machine=m68k-bull
+               os=-sysv2
+               ;;
+       spur)
+               basic_machine=spur-unknown
+               ;;
+       sun2)
+               basic_machine=m68000-sun
+               ;;
+       sun2os3)
+               basic_machine=m68000-sun
+               os=-sunos3
+               ;;
+       sun2os4)
+               basic_machine=m68000-sun
+               os=-sunos4
+               ;;
+       sun3os3)
+               basic_machine=m68k-sun
+               os=-sunos3
+               ;;
+       sun3os4)
+               basic_machine=m68k-sun
+               os=-sunos4
+               ;;
+       sun4os3)
+               basic_machine=sparc-sun
+               os=-sunos3
+               ;;
+       sun4os4)
+               basic_machine=sparc-sun
+               os=-sunos4
+               ;;
+       sun4sol2)
+               basic_machine=sparc-sun
+               os=-solaris2
+               ;;
+       sun3 | sun3-*)
+               basic_machine=m68k-sun
+               ;;
+       sun4)
+               basic_machine=sparc-sun
+               ;;
+       sun386 | sun386i | roadrunner)
+               basic_machine=i386-sun
+               ;;
+       symmetry)
+               basic_machine=i386-sequent
+               os=-dynix
+               ;;
+       tx39)
+               basic_machine=mipstx39-unknown
+               ;;
+       tx39el)
+               basic_machine=mipstx39el-unknown
+               ;;
+       tower | tower-32)
+               basic_machine=m68k-ncr
+               ;;
+       udi29k)
+               basic_machine=a29k-amd
+               os=-udi
+               ;;
+       ultra3)
+               basic_machine=a29k-nyu
+               os=-sym1
+               ;;
+       vaxv)
+               basic_machine=vax-dec
+               os=-sysv
+               ;;
+       vms)
+               basic_machine=vax-dec
+               os=-vms
+               ;;
+       vpp*|vx|vx-*)
+               basic_machine=f301-fujitsu
+               ;;
+       vxworks960)
+               basic_machine=i960-wrs
+               os=-vxworks
+               ;;
+       vxworks68)
+               basic_machine=m68k-wrs
+               os=-vxworks
+               ;;
+       vxworks29k)
+               basic_machine=a29k-wrs
+               os=-vxworks
+               ;;
+       xmp)
+               basic_machine=xmp-cray
+               os=-unicos
+               ;;
+        xps | xps100)
+               basic_machine=xps100-honeywell
+               ;;
+       none)
+               basic_machine=none-none
+               os=-none
+               ;;
+
+# Here we handle the default manufacturer of certain CPU types.  It is in
+# some cases the only manufacturer, in others, it is the most popular.
+       mips)
+               if [ x$os = x-linux-gnu ]; then
+                       basic_machine=mips-unknown
+               else
+                       basic_machine=mips-mips
+               fi
+               ;;
+       romp)
+               basic_machine=romp-ibm
+               ;;
+       rs6000)
+               basic_machine=rs6000-ibm
+               ;;
+       vax)
+               basic_machine=vax-dec
+               ;;
+       pdp11)
+               basic_machine=pdp11-dec
+               ;;
+       we32k)
+               basic_machine=we32k-att
+               ;;
+       sparc)
+               basic_machine=sparc-sun
+               ;;
+        cydra)
+               basic_machine=cydra-cydrome
+               ;;
+       orion)
+               basic_machine=orion-highlevel
+               ;;
+       orion105)
+               basic_machine=clipper-highlevel
+               ;;
+       *)
+               echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2
+               exit 1
+               ;;
+esac
+
+# Here we canonicalize certain aliases for manufacturers.
+case $basic_machine in
+       *-digital*)
+               basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'`
+               ;;
+       *-commodore*)
+               basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'`
+               ;;
+       *)
+               ;;
+esac
+
+# Decode manufacturer-specific aliases for certain operating systems.
+
+if [ x"$os" != x"" ]
+then
+case $os in
+        # First match some system type aliases
+        # that might get confused with valid system types.
+       # -solaris* is a basic system type, with this one exception.
+       -solaris1 | -solaris1.*)
+               os=`echo $os | sed -e 's|solaris1|sunos4|'`
+               ;;
+       -solaris)
+               os=-solaris2
+               ;;
+       -svr4*)
+               os=-sysv4
+               ;;
+       -unixware*)
+               os=-sysv4.2uw
+               ;;
+       -gnu/linux*)
+               os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'`
+               ;;
+       # First accept the basic system types.
+       # The portable systems comes first.
+       # Each alternative MUST END IN A *, to match a version number.
+       # -sysv* is not here because it comes later, after sysvr4.
+       -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \
+             | -*vms* | -sco* | -esix* | -isc* | -aix* | -sunos | -sunos[34]*\
+             | -hpux* | -unos* | -osf* | -luna* | -dgux* | -solaris* | -sym* \
+             | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \
+             | -aos* \
+             | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \
+             | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \
+             | -hiux* | -386bsd* | -netbsd* | -openbsd* | -freebsd* | -riscix* \
+             | -lynxos* | -bosx* | -nextstep* | -cxux* | -aout* | -elf* \
+             | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \
+             | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \
+             | -cygwin32* | -pe* | -psos* | -moss* | -proelf* | -rtems* \
+             | -mingw32* | -linux-gnu* | -uxpv*)
+       # Remember, each alternative MUST END IN *, to match a version number.
+               ;;
+       -linux*)
+               os=`echo $os | sed -e 's|linux|linux-gnu|'`
+               ;;
+       -sunos5*)
+               os=`echo $os | sed -e 's|sunos5|solaris2|'`
+               ;;
+       -sunos6*)
+               os=`echo $os | sed -e 's|sunos6|solaris3|'`
+               ;;
+       -osfrose*)
+               os=-osfrose
+               ;;
+       -osf*)
+               os=-osf
+               ;;
+       -utek*)
+               os=-bsd
+               ;;
+       -dynix*)
+               os=-bsd
+               ;;
+       -acis*)
+               os=-aos
+               ;;
+       -ctix* | -uts*)
+               os=-sysv
+               ;;
+       -ns2 )
+               os=-nextstep2
+               ;;
+       # Preserve the version number of sinix5.
+       -sinix5.*)
+               os=`echo $os | sed -e 's|sinix|sysv|'`
+               ;;
+       -sinix*)
+               os=-sysv4
+               ;;
+       -triton*)
+               os=-sysv3
+               ;;
+       -oss*)
+               os=-sysv3
+               ;;
+       -svr4)
+               os=-sysv4
+               ;;
+       -svr3)
+               os=-sysv3
+               ;;
+       -sysvr4)
+               os=-sysv4
+               ;;
+       # This must come after -sysvr4.
+       -sysv*)
+               ;;
+       -xenix)
+               os=-xenix
+               ;;
+       -none)
+               ;;
+       *)
+               # Get rid of the `-' at the beginning of $os.
+               os=`echo $os | sed 's/[^-]*-//'`
+               echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2
+               exit 1
+               ;;
+esac
+else
+
+# Here we handle the default operating systems that come with various machines.
+# The value should be what the vendor currently ships out the door with their
+# machine or put another way, the most popular os provided with the machine.
+
+# Note that if you're going to try to match "-MANUFACTURER" here (say,
+# "-sun"), then you have to tell the case statement up towards the top
+# that MANUFACTURER isn't an operating system.  Otherwise, code above
+# will signal an error saying that MANUFACTURER isn't an operating
+# system, and we'll never get to this point.
+
+case $basic_machine in
+       *-acorn)
+               os=-riscix1.2
+               ;;
+       arm*-semi)
+               os=-aout
+               ;;
+        pdp11-*)
+               os=-none
+               ;;
+       *-dec | vax-*)
+               os=-ultrix4.2
+               ;;
+       m68*-apollo)
+               os=-domain
+               ;;
+       i386-sun)
+               os=-sunos4.0.2
+               ;;
+       m68000-sun)
+               os=-sunos3
+               # This also exists in the configure program, but was not the
+               # default.
+               # os=-sunos4
+               ;;
+       *-tti)  # must be before sparc entry or we get the wrong os.
+               os=-sysv3
+               ;;
+       sparc-* | *-sun)
+               os=-sunos4.1.1
+               ;;
+       *-ibm)
+               os=-aix
+               ;;
+       *-hp)
+               os=-hpux
+               ;;
+       *-hitachi)
+               os=-hiux
+               ;;
+       i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent)
+               os=-sysv
+               ;;
+       *-cbm)
+               os=-amigaos
+               ;;
+       *-dg)
+               os=-dgux
+               ;;
+       *-dolphin)
+               os=-sysv3
+               ;;
+       m68k-ccur)
+               os=-rtu
+               ;;
+       m88k-omron*)
+               os=-luna
+               ;;
+       *-next )
+               os=-nextstep
+               ;;
+       *-sequent)
+               os=-ptx
+               ;;
+       *-crds)
+               os=-unos
+               ;;
+       *-ns)
+               os=-genix
+               ;;
+       i370-*)
+               os=-mvs
+               ;;
+       *-next)
+               os=-nextstep3
+               ;;
+        *-gould)
+               os=-sysv
+               ;;
+        *-highlevel)
+               os=-bsd
+               ;;
+       *-encore)
+               os=-bsd
+               ;;
+        *-sgi)
+               os=-irix
+               ;;
+        *-siemens)
+               os=-sysv4
+               ;;
+       *-masscomp)
+               os=-rtu
+               ;;
+       f301-fujitsu)
+               os=-uxpv
+               ;;
+       *)
+               os=-none
+               ;;
+esac
+fi
+
+# Here we handle the case where we know the os, and the CPU type, but not the
+# manufacturer.  We pick the logical manufacturer.
+vendor=unknown
+case $basic_machine in
+       *-unknown)
+               case $os in
+                       -riscix*)
+                               vendor=acorn
+                               ;;
+                       -sunos*)
+                               vendor=sun
+                               ;;
+                       -aix*)
+                               vendor=ibm
+                               ;;
+                       -hpux*)
+                               vendor=hp
+                               ;;
+                       -hiux*)
+                               vendor=hitachi
+                               ;;
+                       -unos*)
+                               vendor=crds
+                               ;;
+                       -dgux*)
+                               vendor=dg
+                               ;;
+                       -luna*)
+                               vendor=omron
+                               ;;
+                       -genix*)
+                               vendor=ns
+                               ;;
+                       -mvs*)
+                               vendor=ibm
+                               ;;
+                       -ptx*)
+                               vendor=sequent
+                               ;;
+                       -vxsim* | -vxworks*)
+                               vendor=wrs
+                               ;;
+                       -aux*)
+                               vendor=apple
+                               ;;
+               esac
+               basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"`
+               ;;
+esac
+
+echo $basic_machine$os
index 3ea6e2fa54078eaa2c0fc0195b7fd6f6e022bd9f..271c1a140336fd4a6076bc34aa62f9f7167c3abe 100644 (file)
@@ -1,17 +1,18 @@
 dnl Process this file with autoconf to produce a configure script.
+AC_INIT(src/control/control.c)
+AM_INIT_AUTOMAKE(alsa-lib, 0.1.2)
 
-AC_INIT(Makefile.conf.in)
 AC_PREFIX_DEFAULT(/usr)
 
 dnl Checks for programs.
 AC_PROG_CC
-AC_PROG_RANLIB
 AC_PROG_INSTALL
 AC_PROG_LN_S 
+AM_PROG_LIBTOOL
 
 dnl Checks for header files.
 AC_HEADER_STDC
-AC_CONFIG_HEADER(include/config.h)
+AM_CONFIG_HEADER(include/config.h)
 AC_CHECK_HEADERS(linux/asound.h)
 
 dnl Checks for typedefs, structures, and compiler characteristics.
@@ -23,41 +24,9 @@ AC_HEADER_TIME
 dnl Checks for library functions.
 AC_PROG_GCC_TRADITIONAL
 
-dnl Check for ALSA driver package.
-myprefix=$prefix
-if test "$myprefix" = "NONE"; then
-  myprefix=$ac_default_prefix
-fi
-CFLAGS="-I$myprefix/include"
-#echo "CFLAGS=$CFLAGS"
-AC_MSG_CHECKING(for alsa-driver package)
-AC_TRY_RUN([
-#include <linux/asound.h>
-void main(void)
-{
-#if !defined( SND_PROTOCOL_VERSION ) || !defined( SND_PROTOCOL_UNCOMPATIBLE )
-  exit(1);
-#else
-  exit(0);
-#endif
-}
-],
-  AC_MSG_RESULT("present"),
-  AC_MSG_RESULT("not found"); echo "Fatal error: Install alsa-driver v0.2.0pre6+ package at first..."; exit 1;,
-  AC_MSG_RESULT("not supported"); echo "Fatal error: Cross-compiling isn't supported..."; exit 1;,
-)
+AM_PATH_ALSA
 
-dnl Check for version...
-AC_MSG_CHECKING(for library version)
-SND_LIB_VERSION=`cat $srcdir/version`
-AC_DEFINE_UNQUOTED(SND_LIB_VERSION, "$SND_LIB_VERSION")
-AC_SUBST(SND_LIB_VERSION)
-SND_LIB_MAJOR=`echo $SND_LIB_VERSION | cut -d . -f 1`
-AC_SUBST(SND_LIB_MAJOR)
-SND_LIB_MINOR=`echo $SND_LIB_VERSION | cut -d . -f 2`
-AC_SUBST(SND_LIB_MINOR)
-SND_LIB_SUBMINOR=`echo $SND_LIB_VERSION | cut -d . -f 3`
-AC_SUBST(SND_LIB_SUBMINOR)
-AC_MSG_RESULT($SND_LIB_VERSION)
-
-AC_OUTPUT(Makefile.conf include/version.h utils/alsa-lib.spec)
+AC_OUTPUT(Makefile doc/Makefile include/Makefile src/Makefile \
+          src/control/Makefile src/mixer/Makefile src/pcm/Makefile \
+          src/rawmidi/Makefile test/Makefile utils/Makefile include/version.h \
+          utils/alsa-lib.spec)
diff --git a/doc/Makefile b/doc/Makefile
deleted file mode 100644 (file)
index 708995b..0000000
+++ /dev/null
@@ -1,20 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../Makefile.conf
-
-TARGETS=soundapi.txt \
-        soundapi.html
-
-all: $(TARGETS)
-
-soundapi.txt: soundapi.sgml
-       sgml2txt soundapi.sgml
-
-soundapi.html: soundapi.sgml
-       sgml2html soundapi.sgml
-
-clean:
-       rm -f core .depend *.orig *~
diff --git a/doc/Makefile.am b/doc/Makefile.am
new file mode 100644 (file)
index 0000000..aa8e446
--- /dev/null
@@ -0,0 +1,3 @@
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/doc/Makefile.in b/doc/Makefile.in
new file mode 100644 (file)
index 0000000..a9ef722
--- /dev/null
@@ -0,0 +1,159 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES = 
+DIST_COMMON =  Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: Makefile
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps doc/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+tags: TAGS
+TAGS:
+
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = doc
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: 
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: 
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-generic
+
+clean:  clean-generic mostlyclean
+
+distclean:  distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-generic distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: tags distdir info dvi installcheck install-exec install-data \
+install uninstall all installdirs mostlyclean-generic distclean-generic \
+clean-generic maintainer-clean-generic clean mostlyclean distclean \
+maintainer-clean
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/include/Makefile.am b/include/Makefile.am
new file mode 100644 (file)
index 0000000..501365f
--- /dev/null
@@ -0,0 +1,15 @@
+sysincludedir = ${includedir}/sys
+sysinclude_HEADERS = asoundlib.h
+
+# This is the order they will be concatenated into asoundlib.h!
+#
+header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \
+             footer.h
+
+noinst_HEADERS=$(header_files)
+
+$(srcdir)/asoundlib.h: $(header_files)
+       cat $^ > $@
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/include/Makefile.in b/include/Makefile.in
new file mode 100644 (file)
index 0000000..f4000a4
--- /dev/null
@@ -0,0 +1,240 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+sysincludedir = ${includedir}/sys
+sysinclude_HEADERS = asoundlib.h
+
+# This is the order they will be concatenated into asoundlib.h!
+#
+header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \
+             footer.h
+
+noinst_HEADERS=$(header_files)
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = config.h
+CONFIG_CLEAN_FILES =  version.h
+HEADERS =  $(noinst_HEADERS) $(sysinclude_HEADERS)
+
+DIST_COMMON =  Makefile.am Makefile.in config.h.in stamp-h.in \
+version.h.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: Makefile $(HEADERS) config.h
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps include/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+config.h: stamp-h
+       @:
+stamp-h: $(srcdir)/config.h.in $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES= CONFIG_HEADERS=include/config.h \
+            $(SHELL) ./config.status
+       @echo timestamp > stamp-h
+$(srcdir)/config.h.in: $(srcdir)/stamp-h.in
+$(srcdir)/stamp-h.in: $(top_srcdir)/configure.in $(ACLOCAL_M4) 
+       cd $(top_srcdir) && $(AUTOHEADER)
+       @echo timestamp > $(srcdir)/stamp-h.in
+
+mostlyclean-hdr:
+
+clean-hdr:
+
+distclean-hdr:
+       -rm -f config.h
+
+maintainer-clean-hdr:
+version.h: $(top_builddir)/config.status version.h.in
+       cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+install-sysincludeHEADERS: $(sysinclude_HEADERS)
+       @$(NORMAL_INSTALL)
+       $(mkinstalldirs) $(DESTDIR)$(sysincludedir)
+       @list='$(sysinclude_HEADERS)'; for p in $$list; do \
+         if test -f "$$p"; then d= ; else d="$(srcdir)/"; fi; \
+         echo " $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p"; \
+         $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p; \
+       done
+
+uninstall-sysincludeHEADERS:
+       @$(NORMAL_UNINSTALL)
+       list='$(sysinclude_HEADERS)'; for p in $$list; do \
+         rm -f $(DESTDIR)$(sysincludedir)/$$p; \
+       done
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS:  $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)config.h.in$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags config.h.in $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = include
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: install-sysincludeHEADERS
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: uninstall-sysincludeHEADERS
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+       $(mkinstalldirs)  $(DESTDIR)$(sysincludedir)
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-hdr mostlyclean-tags mostlyclean-generic
+
+clean:  clean-hdr clean-tags clean-generic mostlyclean
+
+distclean:  distclean-hdr distclean-tags distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-hdr maintainer-clean-tags \
+               maintainer-clean-generic distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-hdr distclean-hdr clean-hdr maintainer-clean-hdr \
+uninstall-sysincludeHEADERS install-sysincludeHEADERS tags \
+mostlyclean-tags distclean-tags clean-tags maintainer-clean-tags \
+distdir info dvi installcheck install-exec install-data install \
+uninstall all installdirs mostlyclean-generic distclean-generic \
+clean-generic maintainer-clean-generic clean mostlyclean distclean \
+maintainer-clean
+
+
+$(srcdir)/asoundlib.h: $(header_files)
+       cat $^ > $@
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
index b6042e0253591f37b83956d0bcd7f20f3a71f70d..3dda2224012f0a899317af93f19e2dd8757a3f13 100644 (file)
@@ -1,6 +1,29 @@
-/*
- *  Configuration header file for compilation of the ALSA driver
- */
+/* include/config.h.in.  Generated automatically from configure.in by autoheader.  */
 
-#undef SND_LIB_VERSION
+/* Define to empty if the keyword does not work.  */
+#undef const
+
+/* Define as __inline if that's what the C compiler calls it.  */
+#undef inline
+
+/* Define if you have the ANSI C header files.  */
+#undef STDC_HEADERS
+
+/* Define if you can safely include both <sys/time.h> and <time.h>.  */
+#undef TIME_WITH_SYS_TIME
+
+/* Define if your processor stores words with the most significant
+   byte first (like Motorola and SPARC, unlike Intel and VAX).  */
 #undef WORDS_BIGENDIAN
+
+/* Package name */
+#undef PACKAGE
+
+/* Package version */
+#undef VERSION
+
+/* Sound library version string */
+#undef SND_LIB_VERSION
+
+/* Define if you have the <linux/asound.h> header file.  */
+#undef HAVE_LINUX_ASOUND_H
index 0a4ac28269e3c3fc2661a3931bce773f09b00073..19b3a91cb4ba68f0a3d6dba1e3aa6791db38c481 100644 (file)
@@ -5,5 +5,5 @@
 #define SOUNDLIB_VERSION_MAJOR         @SND_LIB_MAJOR@
 #define SOUNDLIB_VERSION_MINOR         @SND_LIB_MINOR@
 #define SOUNDLIB_VERSION_SUBMINOR      @SND_LIB_SUBMINOR@
-#define SOUNDLIB_VERSION               ( ( LIBULTRA_VERSION_MAJOR << 16 ) | ( LIBULTRA_VERSION_MINOR << 8 ) | LIB_ULTRA_VERSION_SUBMINOR )
+#define SOUNDLIB_VERSION               ( ( SOUNDLIB_VERSION_MAJOR << 16 ) | ( SOUNDLIB_VERSION_MINOR << 8 ) | SOUNDLIB_VERSION_SUBMINOR )
 
diff --git a/ltconfig b/ltconfig
new file mode 100644 (file)
index 0000000..40d40da
--- /dev/null
+++ b/ltconfig
@@ -0,0 +1,1563 @@
+#! /bin/sh
+
+# ltconfig - Create a system-specific libtool.
+# Copyright (C) 1996-1998 Free Software Foundation, Inc.
+# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This file is free software; you can redistribute it and/or modify it
+# under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# A lot of this script is taken from autoconf-2.10.
+
+# Check that we are running under the correct shell.
+SHELL=${CONFIG_SHELL-/bin/sh}
+echo=echo
+if test "X$1" = X--no-reexec; then
+  # Discard the --no-reexec flag, and continue.
+  shift
+elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then
+  # Yippee, $echo works!
+  :
+else
+  # Restart under the correct shell.
+  exec "$SHELL" "$0" --no-reexec ${1+"$@"}
+fi
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+if test "${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi
+
+if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then
+  # The Solaris, AIX, and Digital Unix default echo programs unquote
+  # backslashes.  This makes it impossible to quote backslashes using
+  #   echo "$something" | sed 's/\\/\\\\/g'
+  #
+  # So, first we look for a working echo in the user's PATH.
+  IFS="${IFS=  }"; save_ifs="$IFS"; IFS="${IFS}:"
+  for dir in $PATH /usr/ucb; do
+    if test -f $dir/echo && test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t'; then
+      echo="$dir/echo"
+      break
+    fi
+  done
+  IFS="$save_ifs"
+
+  if test "X$echo" = Xecho; then
+    # We didn't find a better echo, so look for alternatives.
+    if test "X`(print -r '\t') 2>/dev/null`" = 'X\t'; then
+      # This shell has a builtin print -r that does the trick.
+      echo='print -r'
+    elif test -f /bin/ksh && test "X$CONFIG_SHELL" != X/bin/ksh; then
+      # If we have ksh, try running ltconfig again with it.
+      CONFIG_SHELL=/bin/ksh
+      export CONFIG_SHELL
+      exec "$CONFIG_SHELL" "$0" --no-reexec ${1+"$@"}
+    else
+      # Try using printf.
+      echo='printf %s\n'
+      if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then
+        # Oops.  We lost completely, so just stick with echo.
+        echo=echo
+      fi
+    fi
+  fi
+fi
+
+# Sed substitution that helps us do robust quoting.  It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e s/^X//'
+sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g'
+
+# Same as above, but do not quote variable references.
+double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g'
+
+# The name of this program.
+progname=`$echo "X$0" | $Xsed -e 's%^.*/%%'`
+
+# Constants:
+PROGRAM=ltconfig
+PACKAGE=libtool
+VERSION=1.2b
+ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.c 1>&5'
+ac_link='${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.c $LIBS 1>&5'
+rm="rm -f"
+
+help="Try \`$progname --help' for more information."
+
+# Global variables:
+default_ofile=libtool
+can_build_shared=yes
+enable_shared=yes
+# All known linkers require a `.a' archive for static linking.
+enable_static=yes
+ltmain=
+silent=
+srcdir=
+ac_config_guess=
+ac_config_sub=
+host=
+nonopt=
+ofile="$default_ofile"
+verify_host=yes
+with_gcc=no
+with_gnu_ld=no
+
+old_AR="$AR"
+old_CC="$CC"
+old_CFLAGS="$CFLAGS"
+old_CPPFLAGS="$CPPFLAGS"
+old_LD="$LD"
+old_LN_S="$LN_S"
+old_NM="$NM"
+old_RANLIB="$RANLIB"
+
+# Parse the command line options.
+args=
+prev=
+for option
+do
+  case "$option" in
+  -*=*) optarg=`echo "$option" | sed 's/[-_a-zA-Z0-9]*=//'` ;;
+  *) optarg= ;;
+  esac
+
+  # If the previous option needs an argument, assign it.
+  if test -n "$prev"; then
+    eval "$prev=\$option"
+    prev=
+    continue
+  fi
+
+  case "$option" in
+  --help) cat <<EOM
+Usage: $progname [OPTION]... LTMAIN [HOST]
+
+Generate a system-specific libtool script.
+
+    --debug                enable verbose shell tracing
+    --disable-shared       do not build shared libraries
+    --disable-static       do not build static libraries
+    --help                 display this help and exit
+    --no-verify            do not verify that HOST is a valid host type
+-o, --output=FILE          specify the output file [default=$default_ofile]
+    --quiet                same as \`--silent'
+    --silent               do not print informational messages
+    --srcdir=DIR           find \`config.guess' in DIR
+    --version              output version information and exit
+    --with-gcc             assume that the GNU C compiler will be used
+    --with-gnu-ld          assume that the C compiler uses the GNU linker
+
+LTMAIN is the \`ltmain.sh' shell script fragment that provides basic libtool
+functionality.
+
+HOST is the canonical host system name [default=guessed].
+EOM
+  exit 0
+  ;;
+
+  --debug)
+    echo "$progname: enabling shell trace mode"
+    set -x
+    ;;
+
+  --disable-shared) enable_shared=no ;;
+
+  --disable-static) enable_static=no ;;
+
+  --quiet | --silent) silent=yes ;;
+
+  --srcdir) prev=srcdir ;;
+  --srcdir=*) srcdir="$optarg" ;;
+
+  --no-verify) verify_host=no ;;
+
+  --output | -o) prev=ofile ;;
+  --output=*) ofile="$optarg" ;;
+
+  --version) echo "$PROGRAM (GNU $PACKAGE) $VERSION"; exit 0 ;;
+
+  --with-gcc) with_gcc=yes ;;
+  --with-gnu-ld) with_gnu_ld=yes ;;
+
+  -*)
+    echo "$progname: unrecognized option \`$option'" 1>&2
+    echo "$help" 1>&2
+    exit 1
+    ;;
+
+  *)
+    if test -z "$ltmain"; then
+      ltmain="$option"
+    elif test -z "$host"; then
+# This generates an unnecessary warning for sparc-sun-solaris4.1.3_U1
+#      if test -n "`echo $option| sed 's/[-a-z0-9.]//g'`"; then
+#        echo "$progname: warning \`$option' is not a valid host type" 1>&2
+#      fi
+      host="$option"
+    else
+      echo "$progname: too many arguments" 1>&2
+      echo "$help" 1>&2
+      exit 1
+    fi ;;
+  esac
+done
+
+if test -z "$ltmain"; then
+  echo "$progname: you must specify a LTMAIN file" 1>&2
+  echo "$help" 1>&2
+  exit 1
+fi
+
+if test ! -f "$ltmain"; then
+  echo "$progname: \`$ltmain' does not exist" 1>&2
+  echo "$help" 1>&2
+  exit 1
+fi
+
+# Quote any args containing shell metacharacters.
+ltconfig_args=
+for arg
+do
+  case "$arg" in
+  *" "*|*"     "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*)
+  ltconfig_args="$ltconfig_args '$arg'" ;;
+  *) ltconfig_args="$ltconfig_args $arg" ;;
+  esac
+done
+
+# A relevant subset of AC_INIT.
+
+# File descriptor usage:
+# 0 standard input
+# 1 file creation
+# 2 errors and warnings
+# 3 some systems may open it to /dev/tty
+# 4 used on the Kubota Titan
+# 5 compiler messages saved in config.log
+# 6 checking for... messages and results
+if test "$silent" = yes; then
+  exec 6>/dev/null
+else
+  exec 6>&1
+fi
+exec 5>>./config.log
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi
+if test "${LANG+set}"   = set; then LANG=C;   export LANG;   fi
+
+if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then
+  # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu.
+  if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then
+    ac_n= ac_c='
+' ac_t='       '
+  else
+    ac_n=-n ac_c= ac_t=
+  fi
+else
+  ac_n= ac_c='\c' ac_t=
+fi
+
+if test -z "$srcdir"; then
+  # Assume the source directory is the same one as the path to ltmain.sh.
+  srcdir=`$echo "$ltmain" | $Xsed -e 's%/[^/]*$%%'`
+  test "$srcdir" = "$ltmain" && srcdir=.
+fi
+
+trap "$rm conftest*; exit 1" 1 2 15
+if test "$verify_host" = yes; then
+  # Check for config.guess and config.sub.
+  ac_aux_dir=
+  for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do
+    if test -f $ac_dir/config.guess; then
+      ac_aux_dir=$ac_dir
+      break
+    fi
+  done
+  if test -z "$ac_aux_dir"; then
+    echo "$progname: cannot find config.guess in $srcdir $srcdir/.. $srcdir/../.." 1>&2
+    echo "$help" 1>&2
+    exit 1
+  fi
+  ac_config_guess=$ac_aux_dir/config.guess
+  ac_config_sub=$ac_aux_dir/config.sub
+
+  # Make sure we can run config.sub.
+  if $SHELL $ac_config_sub sun4 >/dev/null 2>&1; then :
+  else
+    echo "$progname: cannot run $ac_config_sub" 1>&2
+    echo "$help" 1>&2
+    exit 1
+  fi
+
+  echo $ac_n "checking host system type""... $ac_c" 1>&6
+
+  host_alias=$host
+  case "$host_alias" in
+  "")
+    if host_alias=`$SHELL $ac_config_guess`; then :
+    else
+      echo "$progname: cannot guess host type; you must specify one" 1>&2
+      echo "$help" 1>&2
+      exit 1
+    fi ;;
+  esac
+  host=`$SHELL $ac_config_sub $host_alias`
+  echo "$ac_t$host" 1>&6
+
+  # Make sure the host verified.
+  test -z "$host" && exit 1
+
+elif test -z "$host"; then
+  echo "$progname: you must specify a host type if you use \`--no-verify'" 1>&2
+  echo "$help" 1>&2
+  exit 1
+else
+  host_alias=$host
+fi
+
+# Transform linux* to *-*-linux-gnu*, to support old configure scripts.
+case "$host_os" in
+linux-gnu*) ;;
+linux*) host=`echo $host | sed 's/^\(.*-.*-linux\)\(.*\)$/\1-gnu\2/'`
+esac
+
+host_cpu=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'`
+host_vendor=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'`
+host_os=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'`
+
+case "$host_os" in
+aix3*)
+  # AIX sometimes has problems with the GCC collect2 program.  For some
+  # reason, if we set the COLLECT_NAMES environment variable, the problems
+  # vanish in a puff of smoke.
+  if test "${COLLECT_NAMES+set}" != set; then
+    COLLECT_NAMES=
+    export COLLECT_NAMES
+  fi
+  ;;
+esac
+
+# Determine commands to create old-style static archives.
+old_archive_cmds='$AR cru $oldlib$oldobjs'
+old_postinstall_cmds='chmod 644 $oldlib'
+old_postuninstall_cmds=
+
+# Set a sane default for `AR'.
+test -z "$AR" && AR=ar
+
+# If RANLIB is not set, then run the test.
+if test "${RANLIB+set}" != "set"; then
+  result=no
+
+  echo $ac_n "checking for ranlib... $ac_c" 1>&6
+  IFS="${IFS=  }"; save_ifs="$IFS"; IFS="${IFS}:"
+  for dir in $PATH; do
+    test -z "$dir" && dir=.
+    if test -f $dir/ranlib; then
+      RANLIB="ranlib"
+      result="ranlib"
+      break
+    fi
+  done
+  IFS="$save_ifs"
+
+  echo "$ac_t$result" 1>&6
+fi
+
+if test -n "$RANLIB"; then
+  old_archive_cmds="$old_archive_cmds;\$RANLIB \$oldlib"
+  old_postinstall_cmds="\$RANLIB \$oldlib;$old_postinstall_cmds"
+fi
+
+# Check to see if we are using GCC.
+if test "$with_gcc" != yes || test -z "$CC"; then
+  # If CC is not set, then try to find GCC or a usable CC.
+  if test -z "$CC"; then
+    echo $ac_n "checking for gcc... $ac_c" 1>&6
+    IFS="${IFS=        }"; save_ifs="$IFS"; IFS="${IFS}:"
+    for dir in $PATH; do
+      IFS="$save_ifs"
+      test -z "$dir" && dir=.
+      if test -f $dir/gcc; then
+       CC="gcc"
+       break
+      fi
+    done
+    IFS="$save_ifs"
+
+    if test -n "$CC"; then
+      echo "$ac_t$CC" 1>&6
+    else
+      echo "$ac_t"no 1>&6
+    fi
+  fi
+
+  # Not "gcc", so try "cc", rejecting "/usr/ucb/cc".
+  if test -z "$CC"; then
+    echo $ac_n "checking for cc... $ac_c" 1>&6
+    IFS="${IFS=        }"; save_ifs="$IFS"; IFS="${IFS}:"
+    cc_rejected=no
+    for dir in $PATH; do
+      test -z "$dir" && dir=.
+      if test -f $dir/cc; then
+       if test "$dir/cc" = "/usr/ucb/cc"; then
+         cc_rejected=yes
+         continue
+       fi
+       CC="cc"
+       break
+      fi
+    done
+    IFS="$save_ifs"
+    if test $cc_rejected = yes; then
+      # We found a bogon in the path, so make sure we never use it.
+      set dummy $CC
+      shift
+      if test $# -gt 0; then
+       # We chose a different compiler from the bogus one.
+       # However, it has the same name, so the bogon will be chosen
+       # first if we set CC to just the name; use the full file name.
+       shift
+       set dummy "$dir/cc" "$@"
+       shift
+       CC="$@"
+      fi
+    fi
+
+    if test -n "$CC"; then
+      echo "$ac_t$CC" 1>&6
+    else
+      echo "$ac_t"no 1>&6
+    fi
+
+    if test -z "$CC"; then
+      echo "$progname: error: no acceptable cc found in \$PATH" 1>&2
+      exit 1
+    fi
+  fi
+
+  # Now see if the compiler is really GCC.
+  with_gcc=no
+  echo $ac_n "checking whether we are using GNU C... $ac_c" 1>&6
+  echo "$progname:462: checking whether we are using GNU C" >&5
+
+  $rm conftest.c
+  cat > conftest.c <<EOF
+#ifdef __GNUC__
+  yes;
+#endif
+EOF
+  if { ac_try='${CC-cc} -E conftest.c'; { (eval echo $progname:470: \"$ac_try\") 1>&5; (eval $ac_try) 2>&5; }; } | egrep yes >/dev/null 2>&1; then
+    with_gcc=yes
+  fi
+  $rm conftest.c
+  echo "$ac_t$with_gcc" 1>&6
+fi
+
+# Allow CC to be a program name with arguments.
+set dummy $CC
+compiler="$2"
+
+echo $ac_n "checking for $compiler option to produce PIC... $ac_c" 1>&6
+pic_flag=
+special_shlib_compile_flags=
+wl=
+link_static_flag=
+no_builtin_flag=
+
+if test "$with_gcc" = yes; then
+  wl='-Wl,'
+  link_static_flag='-static'
+  no_builtin_flag=' -fno-builtin'
+
+  case "$host_os" in
+  aix3* | aix4* | irix5* | irix6* | osf3* | osf4*)
+    # PIC is the default for these OSes.
+    ;;
+  os2*)
+    # We can build DLLs from non-PIC.
+    ;;
+  amigaos*)
+    # FIXME: we need at least 68020 code to build shared libraries, but
+    # adding the `-m68020' flag to GCC prevents building anything better,
+    # like `-m68040'.
+    pic_flag='-m68020 -resident32 -malways-restore-a4'
+    ;;
+  *)
+    pic_flag='-fPIC'
+    ;;
+  esac
+else
+  # PORTME Check for PIC flags for the system compiler.
+  case "$host_os" in
+  aix3* | aix4*)
+    # All AIX code is PIC.
+    link_static_flag='-bnso -bI:/lib/syscalls.exp'
+    ;;
+
+  hpux9* | hpux10* | hpux11*)
+    # Is there a better link_static_flag that works with the bundled CC?
+    wl='-Wl,'
+    link_static_flag="${wl}-a ${wl}archive"
+    pic_flag='+Z'
+    ;;
+
+  irix5* | irix6*)
+    wl='-Wl,'
+    link_static_flag='-non_shared'
+    # PIC (with -KPIC) is the default.
+    ;;
+
+  os2*)
+    # We can build DLLs from non-PIC.
+    ;;
+
+  osf3* | osf4*)
+    # All OSF/1 code is PIC.
+    wl='-Wl,'
+    link_static_flag='-non_shared'
+    ;;
+
+  sco3.2v5*)
+    pic_flag='-Kpic'
+    link_static_flag='-dn'
+    special_shlib_compile_flags='-belf'
+    ;;
+
+  solaris2*)
+    pic_flag='-KPIC'
+    link_static_flag='-Bstatic'
+    wl='-Wl,'
+    ;;
+
+  sunos4*)
+    pic_flag='-PIC'
+    link_static_flag='-Bstatic'
+    wl='-Qoption ld '
+    ;;
+
+  sysv4.2uw2*)
+    pic_flag='-KPIC'
+    link_static_flag='-Bstatic'
+    wl='-Wl,'
+    ;;
+
+  uts4*)
+    pic_flag='-pic'
+    link_static_flag='-Bstatic'
+    ;;
+
+  *)
+    can_build_shared=no
+    ;;
+  esac
+fi
+
+if test -n "$pic_flag"; then
+  echo "$ac_t$pic_flag" 1>&6
+
+  # Check to make sure the pic_flag actually works.
+  echo $ac_n "checking if $compiler PIC flag $pic_flag works... $ac_c" 1>&6
+  $rm conftest*
+  echo "int some_variable = 0;" > conftest.c
+  save_CFLAGS="$CFLAGS"
+  CFLAGS="$CFLAGS $pic_flag -DPIC"
+  echo "$progname:585: checking if $compiler PIC flag $pic_flag works" >&5
+  if { (eval echo $progname:586: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>conftest.err; } && test -s conftest.o; then
+    # Append any warnings to the config.log.
+    cat conftest.err 1>&5
+
+    # On HP-UX, both CC and GCC only warn that PIC is supported... then they
+    # create non-PIC objects.  So, if there were any warnings, we assume that
+    # PIC is not supported.
+    if test -s conftest.err; then
+      echo "$ac_t"no 1>&6
+      can_build_shared=no
+      pic_flag=
+    else
+      echo "$ac_t"yes 1>&6
+      pic_flag=" $pic_flag"
+    fi
+  else
+    # Append any errors to the config.log.
+    cat conftest.err 1>&5
+    can_build_shared=no
+    pic_flag=
+    echo "$ac_t"no 1>&6
+  fi
+  CFLAGS="$save_CFLAGS"
+  $rm conftest*
+else
+  echo "$ac_t"none 1>&6
+fi
+
+# Check for any special shared library compilation flags.
+if test -n "$special_shlib_compile_flags"; then
+  echo "$progname: warning: \`$CC' requires \`$special_shlib_compile_flags' to build shared libraries" 1>&2
+  if echo "$old_CC $old_CFLAGS " | egrep -e "[         ]$special_shlib_compile_flags[  ]" >/dev/null; then :
+  else
+    echo "$progname: add \`$special_shlib_compile_flags' to the CC or CFLAGS env variable and reconfigure" 1>&2
+    can_build_shared=no
+  fi
+fi
+
+echo $ac_n "checking if $compiler static flag $link_static_flag works... $ac_c" 1>&6
+$rm conftest*
+echo 'main(){return(0);}' > conftest.c
+save_LDFLAGS="$LDFLAGS"
+LDFLAGS="$LDFLAGS $link_static_flag"
+echo "$progname:629: checking if $compiler static flag $link_static_flag works" >&5
+if { (eval echo $progname:630: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then
+  echo "$ac_t$link_static_flag" 1>&6
+else
+  echo "$ac_t"none 1>&6
+  link_static_flag=
+fi
+LDFLAGS="$save_LDFLAGS"
+$rm conftest*
+
+if test -z "$LN_S"; then
+  # Check to see if we can use ln -s, or we need hard links.
+  echo $ac_n "checking whether ln -s works... $ac_c" 1>&6
+  $rm conftestdata
+  if ln -s X conftestdata 2>/dev/null; then
+    $rm conftestdata
+    LN_S="ln -s"
+  else
+    LN_S=ln
+  fi
+  if test "$LN_S" = "ln -s"; then
+    echo "$ac_t"yes 1>&6
+  else
+    echo "$ac_t"no 1>&6
+  fi
+fi
+
+# Make sure LD is an absolute path.
+if test -z "$LD"; then
+  ac_prog=ld
+  if test "$with_gcc" = yes; then
+    # Check if gcc -print-prog-name=ld gives a path.
+    echo $ac_n "checking for ld used by GCC... $ac_c" 1>&6
+    echo "$progname:662: checking for ld used by GCC" >&5
+    ac_prog=`($CC -print-prog-name=ld) 2>&5`
+    case "$ac_prog" in
+    # Accept absolute paths.
+    /* | [A-Za-z]:[/\\]*)
+      test -z "$LD" && LD="$ac_prog"
+      ;;
+    "")
+      # If it fails, then pretend we are not using GCC.
+      ac_prog=ld
+      ;;
+    *)
+      # If it is relative, then search for the first ld in PATH.
+      with_gnu_ld=unknown
+      ;;
+    esac
+  elif test "$with_gnu_ld" = yes; then
+    echo $ac_n "checking for GNU ld... $ac_c" 1>&6
+    echo "$progname:680: checking for GNU ld" >&5
+  else
+    echo $ac_n "checking for non-GNU ld""... $ac_c" 1>&6
+    echo "$progname:683: checking for non-GNU ld" >&5
+  fi
+
+  if test -z "$LD"; then
+    IFS="${IFS=        }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+    for ac_dir in $PATH; do
+      test -z "$ac_dir" && ac_dir=.
+      if test -f "$ac_dir/$ac_prog"; then
+       LD="$ac_dir/$ac_prog"
+       # Check to see if the program is GNU ld.  I'd rather use --version,
+       # but apparently some GNU ld's only accept -v.
+       # Break only if it was the GNU/non-GNU ld that we prefer.
+       if "$LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then
+         test "$with_gnu_ld" != no && break
+       else
+         test "$with_gnu_ld" != yes && break
+       fi
+      fi
+    done
+    IFS="$ac_save_ifs"
+  fi
+
+  if test -n "$LD"; then
+    echo "$ac_t$LD" 1>&6
+  else
+    echo "$ac_t"no 1>&6
+  fi
+
+  if test -z "$LD"; then
+    echo "$progname: error: no acceptable ld found in \$PATH" 1>&2
+    exit 1
+  fi
+fi
+
+# Check to see if it really is or is not GNU ld.
+echo $ac_n "checking if the linker ($LD) is GNU ld... $ac_c" 1>&6
+# I'd rather use --version here, but apparently some GNU ld's only accept -v.
+if $LD -v 2>&1 </dev/null | egrep '(GNU|with BFD)' 1>&5; then
+  with_gnu_ld=yes
+else
+  with_gnu_ld=no
+fi
+echo "$ac_t$with_gnu_ld" 1>&6
+
+# See if the linker supports building shared libraries.
+echo $ac_n "checking whether the linker ($LD) supports shared libraries... $ac_c" 1>&6
+
+allow_undefined_flag=
+no_undefined_flag=
+archive_cmds=
+old_archive_from_new_cmds=
+export_dynamic_flag_spec=
+whole_archive_flag_spec=
+hardcode_libdir_flag_spec=
+hardcode_libdir_separator=
+hardcode_direct=no
+hardcode_minus_L=no
+hardcode_shlibpath_var=unsupported
+runpath_var=
+
+ld_shlibs=yes
+if test "$with_gnu_ld" = yes; then
+
+  # See if GNU ld supports shared libraries.
+  case "$host_os" in
+  amigaos*)
+    archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)'
+    hardcode_libdir_flag_spec='-L$libdir'
+    hardcode_minus_L=yes
+    ;;
+
+  linux-gnu*)
+    if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then
+      archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs $deplibs'
+    else
+      ld_shlibs=no
+    fi
+    ;;
+
+  sunos4*)
+    archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs'
+    hardcode_direct=yes
+    hardcode_minus_L=yes
+    hardcode_shlibpath_var=no
+    ;;
+
+  *)
+    if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then
+      archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs'
+    else
+      ld_shlibs=no
+    fi
+    ;;
+  esac
+
+  if test "$ld_shlibs" = yes; then
+    runpath_var=LD_RUN_PATH
+    hardcode_libdir_flag_spec='${wl}--rpath ${wl}$libdir'
+    export_dynamic_flag_spec='${wl}--export-dynamic'
+    whole_archive_flag_spec='${wl}--whole-archive$convenience ${wl}--no-whole-archive'
+  fi
+else
+  # PORTME fill in a description of your system's linker (not GNU ld)
+  case "$host_os" in
+  aix3*)
+    allow_undefined_flag=unsupported
+    archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$LD -o $objdir/$soname$libobjs -bE:$lib.exp -T512 -H512 -bM:SRE;$AR cru $lib $objdir/$soname'
+    # Note: this linker hardcodes the directories in LIBPATH if there
+    # are no directories specified by -L.
+    hardcode_minus_L=yes
+    if test "$with_gcc" = yes && test -z "$link_static_flag"; then
+      # Neither direct hardcoding nor static linking is supported with a
+      # broken collect2.
+      hardcode_direct=unsupported
+    fi
+    ;;
+
+  aix4*)
+    allow_undefined_flag=unsupported
+    archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$CC -o $objdir/$soname$libobjs ${wl}-bE:$lib.exp ${wl}-bM:SRE ${wl}-bnoentry;$AR cru $lib $objdir/$soname'
+    hardcode_direct=yes
+    hardcode_minus_L=yes
+    ;;
+
+  amigaos*)
+    archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)'
+    hardcode_libdir_flag_spec='-L$libdir'
+    hardcode_minus_L=yes
+    ;;
+
+  # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor
+  # support.  Future versions do this automatically, but an explicit c++rt0.o
+  # does not break anything, and helps significantly (at the cost of a little
+  # extra space).
+  freebsd2.2*)
+    archive_cmds='$LD -Bshareable -o $lib$libobjs /usr/lib/c++rt0.o'
+    hardcode_libdir_flag_spec='-R$libdir'
+    hardcode_direct=yes
+    hardcode_minus_L=yes
+    hardcode_shlibpath_var=no
+    ;;
+
+  # Unfortunately, older versions of FreeBSD 2 do not have this feature.
+  freebsd2*)
+    archive_cmds='$LD -Bshareable -o $lib$libobjs'
+    hardcode_direct=yes
+    hardcode_minus_L=yes
+    hardcode_shlibpath_var=no
+    ;;
+
+  # FreeBSD 3, at last, uses gcc -shared to do shared libraries.
+  freebsd3*)
+    archive_cmds='$CC -shared -o $lib$libobjs'
+    hardcode_libdir_flag_spec='-R$libdir'
+    hardcode_direct=yes
+    hardcode_minus_L=no
+    hardcode_shlibpath_var=no
+    ;;
+
+  hpux9*)
+    archive_cmds='$rm $objdir/$soname;$LD -b +s +b $install_libdir -o $objdir/$soname$libobjs;mv $objdir/$soname $lib'
+    hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+    hardcode_direct=yes
+    hardcode_minus_L=yes
+    export_dynamic_flag_spec='${wl}-E'
+    ;;
+
+  hpux10* | hpux11*)
+    archive_cmds='$LD -b +h $soname +s +b $install_libdir -o $lib$libobjs'
+    hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir'
+    hardcode_direct=yes
+    hardcode_minus_L=yes
+    export_dynamic_flag_spec='${wl}-E'
+    ;;
+
+  irix5* | irix6*)
+    if test "$with_gcc" = yes; then
+      archive_cmds='$CC -shared -o $lib ${wl}-soname ${wl}$soname ${wl}-set_version ${wl}$verstring$libobjs'
+    else
+      archive_cmds='$LD -shared -o $lib -soname $soname -set_version $verstring$libobjs'
+    fi
+    hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+    ;;
+
+  netbsd*)
+    # Tested with NetBSD 1.2 ld
+    archive_cmds='$LD -Bshareable -o $lib$libobjs'
+    hardcode_libdir_flag_spec='-R$libdir'
+    hardcode_direct=yes
+    hardcode_shlibpath_var=no
+    ;;
+
+  openbsd*)
+    archive_cmds='$LD -Bshareable -o $lib$libobjs'
+    hardcode_libdir_flag_spec='-R$libdir'
+    hardcode_direct=yes
+    hardcode_shlibpath_var=no
+    ;;
+
+  os2*)
+    hardcode_libdir_flag_spec='-L$libdir'
+    hardcode_minus_L=yes
+    allow_undefined_flag=unsupported
+    archive_cmds='$echo "LIBRARY $libname INITINSTANCE" > $objdir/$libname.def;$echo "DESCRIPTION \"$libname\"" >> $objdir/$libname.def;$echo DATA >> $objdir/$libname.def;$echo " SINGLE NONSHARED" >> $objdir/$libname.def;$echo EXPORTS >> $objdir/$libname.def;emxexp$libobjs >> $objdir/$libname.def;$CC -Zdll -Zcrtdll -o $lib$libobjs $objdir/$libname.def'
+    old_archive_from_new_cmds='emximp -o $objdir/$libname.a $objdir/$libname.def'
+    ;;
+
+  osf3* | osf4*)
+    allow_undefined_flag=' -expect_unresolved \*'
+    archive_cmds='$LD -shared${allow_undefined_flag} -o $lib -soname $soname -set_version $verstring$libobjs$deplibs'
+    hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir'
+    hardcode_libdir_separator=:
+    ;;
+
+  sco3.2v5*)
+    archive_cmds='$LD -G -o $lib$libobjs'
+    hardcode_direct=yes
+    ;;
+
+  solaris2*)
+    no_undefined_flag=' -z text'
+    archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib$libobjs'
+    hardcode_libdir_flag_spec='-R$libdir'
+    hardcode_shlibpath_var=no
+
+    # Solaris 2 before 2.5 hardcodes -L paths.
+    case "$host_os" in
+    solaris2.[0-4]*)
+      hardcode_minus_L=yes
+      ;;
+    esac
+    ;;
+
+  sunos4*)
+    archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs'
+    hardcode_libdir_flag_spec='-L$libdir'
+    hardcode_direct=yes
+    hardcode_minus_L=yes
+    hardcode_shlibpath_var=no
+    ;;
+
+  uts4*)
+    archive_cmds='$LD -G -h $soname -o $lib$libobjs'
+    hardcode_libdir_flag_spec='-L$libdir'
+    hardcode_direct=no
+    hardcode_minus_L=no
+    hardcode_shlibpath_var=no
+    ;;
+
+  *)
+    ld_shlibs=no
+    can_build_shared=no
+    ;;
+  esac
+fi
+echo "$ac_t$ld_shlibs" 1>&6
+
+if test -z "$NM"; then
+  echo $ac_n "checking for BSD-compatible nm... $ac_c" 1>&6
+  case "$NM" in
+  /* | [A-Za-z]:[/\\]*) ;; # Let the user override the test with a path.
+  *)
+    IFS="${IFS=        }"; ac_save_ifs="$IFS"; IFS="${IFS}:"
+    for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do
+      test -z "$ac_dir" && ac_dir=.
+      if test -f $ac_dir/nm; then
+        # Check to see if the nm accepts a BSD-compat flag.
+        # Adding the `sed 1q' prevents false positives on HP-UX, which says:
+        #   nm: unknown option "B" ignored
+        if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+          NM="$ac_dir/nm -B"
+        elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then
+          NM="$ac_dir/nm -p"
+       else
+          NM="$ac_dir/nm"
+       fi
+        break
+      fi
+    done
+    IFS="$ac_save_ifs"
+    test -z "$NM" && NM=nm
+    ;;
+  esac
+  echo "$ac_t$NM" 1>&6
+fi
+
+# Check for command to grab the raw symbol name followed by C symbol from nm.
+echo $ac_n "checking command to parse $NM output... $ac_c" 1>&6
+
+# These are sane defaults that work on at least a few old systems.
+# [They come from Ultrix.  What could be older than Ultrix?!! ;)]
+
+# Character class describing NM global symbol codes.
+symcode='[BCDEGRSTU]'
+
+# Regexp to match symbols that can be accessed directly from C.
+sympat='\([_A-Za-z][_A-Za-z0-9]*\)'
+
+# Transform the above into a raw symbol and a C symbol.
+symxfrm='\1 \1'
+
+# Define system-specific variables.
+case "$host_os" in
+aix*)
+  symcode='[BCDTU]'
+  ;;
+irix*)
+  # Cannot use undefined symbols on IRIX because inlined functions mess us up.
+  symcode='[BCDEGRST]'
+  ;;
+solaris2*)
+  symcode='[BDTU]'
+  ;;
+esac
+
+# If we're using GNU nm, then use its standard symbol codes.
+if $NM -V 2>&1 | egrep '(GNU|with BFD)' > /dev/null; then
+  symcode='[ABCDGISTUW]'
+fi
+
+# Write the raw and C identifiers.
+global_symbol_pipe="sed -n -e 's/^.* $symcode $sympat$/$symxfrm/p'"
+
+# Check to see that the pipe works correctly.
+pipe_works=no
+$rm conftest*
+cat > conftest.c <<EOF
+#ifdef __cplusplus
+extern "C" {
+#endif
+char nm_test_var;
+void nm_test_func(){}
+#ifdef __cplusplus
+}
+#endif
+main(){nm_test_var='a';nm_test_func();return(0);}
+EOF
+
+echo "$progname:1021: checking if global_symbol_pipe works" >&5
+if { (eval echo $progname:1022: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; } && test -s conftest.o; then
+  # Now try to grab the symbols.
+  nlist=conftest.nm
+  if { echo "$progname:1025: eval \"$NM conftest.o | $global_symbol_pipe > $nlist\"" >&5; eval "$NM conftest.o | $global_symbol_pipe > $nlist 2>&5"; } && test -s "$nlist"; then
+
+    # Try sorting and uniquifying the output.
+    if sort "$nlist" | uniq > "$nlist"T; then
+      mv -f "$nlist"T "$nlist"
+      wcout=`wc "$nlist" 2>/dev/null`
+      count=`$echo "X$wcout" | $Xsed -e 's/^[  ]*\([0-9][0-9]*\).*$/\1/'`
+      (test "$count" -ge 0) 2>/dev/null || count=-1
+    else
+      rm -f "$nlist"T
+      count=-1
+    fi
+
+    # Make sure that we snagged all the symbols we need.
+    if egrep ' nm_test_var$' "$nlist" >/dev/null; then
+      if egrep ' nm_test_func$' "$nlist" >/dev/null; then
+       cat <<EOF > conftest.c
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+EOF
+        # Now generate the symbol file.
+        sed 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> conftest.c
+
+       cat <<EOF >> conftest.c
+#if defined (__STDC__) && __STDC__
+# define __ptr_t void *
+#else
+# define __ptr_t char *
+#endif
+
+/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */
+int dld_preloaded_symbol_count = $count;
+
+/* The mapping between symbol names and symbols. */
+struct {
+  char *name;
+  __ptr_t address;
+}
+dld_preloaded_symbols[] =
+{
+EOF
+        sed 's/^\(.*\) \(.*\)$/  {"\1", (__ptr_t) \&\2},/' < "$nlist" >> conftest.c
+        cat <<\EOF >> conftest.c
+  {0, (__ptr_t) 0}
+};
+
+#ifdef __cplusplus
+}
+#endif
+EOF
+        # Now try linking the two files.
+        mv conftest.o conftestm.o
+       save_LIBS="$LIBS"
+       save_CFLAGS="$CFLAGS"
+        LIBS='conftestm.o'
+       CFLAGS="$CFLAGS$no_builtin_flag"
+        if { (eval echo $progname:1083: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then
+          pipe_works=yes
+        else
+          echo "$progname: failed program was:" >&5
+          cat conftest.c >&5
+        fi
+        LIBS="$save_LIBS"
+      else
+        echo "cannot find nm_test_func in $nlist" >&5
+      fi
+    else
+      echo "cannot find nm_test_var in $nlist" >&5
+    fi
+  else
+    echo "cannot run $global_symbol_pipe" >&5
+  fi
+else
+  echo "$progname: failed program was:" >&5
+  cat conftest.c >&5
+fi
+$rm conftest*
+
+# Do not use the global_symbol_pipe unless it works.
+echo "$ac_t$pipe_works" 1>&6
+test "$pipe_works" = yes || global_symbol_pipe=
+
+# Check hardcoding attributes.
+echo $ac_n "checking how to hardcode library paths into programs... $ac_c" 1>&6
+hardcode_action=
+if test -n "$hardcode_libdir_flag_spec" || \
+   test -n "$runpath_var"; then
+
+  # We can hardcode non-existant directories.
+  if test "$hardcode_direct" != no && \
+     test "$hardcode_minus_L" != no && \
+     test "$hardcode_shlibpath_var" != no; then
+
+    # Linking always hardcodes the temporary library directory.
+    hardcode_action=relink
+  else
+    # We can link without hardcoding, and we can hardcode nonexisting dirs.
+    hardcode_action=immediate
+  fi
+else
+  # We cannot hardcode anything, or else we can only hardcode existing
+  # directories.
+  hardcode_action=unsupported
+fi
+echo "$ac_t$hardcode_action" 1>&6
+
+
+reload_flag=
+reload_cmds='$LD$reload_flag -o $output$reload_objs'
+echo $ac_n "checking for $LD option to reload object files... $ac_c" 1>&6
+# PORTME Some linkers may need a different reload flag.
+reload_flag='-r'
+echo "$ac_t$reload_flag" 1>&6
+test -n "$reload_flag" && reload_flag=" $reload_flag"
+
+# PORTME Fill in your ld.so characteristics
+library_names_spec=
+libname_spec='lib$name'
+soname_spec=
+postinstall_cmds=
+postuninstall_cmds=
+finish_cmds=
+finish_eval=
+shlibpath_var=
+version_type=none
+dynamic_linker="$host_os ld.so"
+
+echo $ac_n "checking dynamic linker characteristics... $ac_c" 1>&6
+case "$host_os" in
+aix3* | aix4*)
+  version_type=linux
+  library_names_spec='${libname}${release}.so$versuffix $libname.a'
+  shlibpath_var=LIBPATH
+
+  # AIX has no versioning support, so we append a major version to the name.
+  soname_spec='${libname}${release}.so$major'
+  ;;
+
+amigaos*)
+  library_names_spec='$libname.ixlibrary $libname.a'
+  # Create ${libname}_ixlibrary.a entries in /sys/libs.
+  finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "(cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a)"; (cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a) || exit 1; done'
+  ;;
+
+freebsd2* | freebsd3*)
+  version_type=sunos
+  library_names_spec='${libname}${release}.so$versuffix $libname.so'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+gnu*)
+  version_type=linux
+  library_names_spec='${libname}${release}.so$versuffix ${libname}.so'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+hpux9* | hpux10* | hpux11*)
+  # Give a soname corresponding to the major version so that dld.sl refuses to
+  # link against other versions.
+  dynamic_linker="$host_os dld.sl"
+  version_type=sunos
+  shlibpath_var=SHLIB_PATH
+  library_names_spec='${libname}${release}.sl$versuffix ${libname}${release}.sl$major $libname.sl'
+  soname_spec='${libname}${release}.sl$major'
+  # HP-UX runs *really* slowly unless shared libraries are mode 555.
+  postinstall_cmds='chmod 555 $lib'
+  ;;
+
+irix5* | irix6*)
+  version_type=osf
+  soname_spec='${libname}${release}.so'
+  library_names_spec='${libname}${release}.so$versuffix $libname.so'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+# No shared lib support for Linux oldld, aout, or coff.
+linux-gnuoldld* | linux-gnuaout* | linux-gnucoff*)
+  dynamic_linker=no
+  ;;
+
+# This must be Linux ELF.
+linux-gnu*)
+  version_type=linux
+  library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+  soname_spec='${libname}${release}.so$major'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+
+  if test -f /lib/ld.so.1; then
+    dynamic_linker='GNU ld.so'
+  else
+    # Only the GNU ld.so supports shared libraries on MkLinux.
+    case "$host_cpu" in
+    powerpc*) dynamic_linker=no ;;
+    *) dynamic_linker='Linux ld.so' ;;
+    esac
+  fi
+  ;;
+
+netbsd* | openbsd*)
+  version_type=sunos
+  library_names_spec='${libname}${release}.so$versuffix'
+  finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+os2*)
+  libname_spec='$name'
+  library_names_spec='$libname.dll $libname.a'
+  dynamic_linker='OS/2 ld.exe'
+  shlibpath_var=LIBPATH
+  ;;
+
+osf3* | osf4*)
+  version_type=osf
+  soname_spec='${libname}${release}.so'
+  library_names_spec='${libname}${release}.so$versuffix $libname.so'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+sco3.2v5*)
+  version_type=osf
+  soname_spec='${libname}${release}.so$major'
+  library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+solaris2*)
+  version_type=linux
+  library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+  soname_spec='${libname}${release}.so$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  # ldd complains unless libraries are executable
+  postinstall_cmds='chmod +x $lib'
+  ;;
+
+sunos4*)
+  version_type=sunos
+  library_names_spec='${libname}${release}.so$versuffix'
+  finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+sysv4.2uw2*)
+  version_type=linux
+  library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+  soname_spec='${libname}${release}.so$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+uts4*)
+  version_type=linux
+  library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so'
+  soname_spec='${libname}${release}.so$major'
+  shlibpath_var=LD_LIBRARY_PATH
+  ;;
+
+*)
+  dynamic_linker=no
+  ;;
+esac
+echo "$ac_t$dynamic_linker"
+test "$dynamic_linker" = no && can_build_shared=no
+
+# Report the final consequences.
+echo "checking if libtool supports shared libraries... $can_build_shared" 1>&6
+
+echo $ac_n "checking whether to build shared libraries... $ac_c" 1>&6
+test "$can_build_shared" = "no" && enable_shared=no
+
+# On AIX, shared libraries and static libraries use the same namespace, and
+# are all built from PIC.
+case "$host_os" in
+aix*)
+  test "$enable_shared" = yes && enable_static=no
+  if test -n "$RANLIB"; then
+    archive_cmds="$archive_cmds;\$RANLIB \$lib"
+    postinstall_cmds='$RANLIB $lib'
+  fi
+  ;;
+esac
+
+echo "$ac_t$enable_shared" 1>&6
+
+# Make sure either enable_shared or enable_static is yes.
+test "$enable_shared" = yes || enable_static=yes
+
+echo "checking whether to build static libraries... $enable_static" 1>&6
+
+echo $ac_n "checking for objdir... $ac_c" 1>&6
+rm -f .libs 2>/dev/null
+mkdir .libs 2>/dev/null
+if test -d .libs; then
+  objdir=.libs
+else
+  # MS-DOS does not allow filenames that begin with a dot.
+  objdir=_libs
+fi
+rmdir .libs 2>/dev/null
+echo "$ac_t$objdir" 1>&6
+
+# Copy echo and quote the copy, instead of the original, because it is
+# used later.
+ltecho="$echo"
+
+# Now quote all the things that may contain metacharacters.
+for var in ltecho old_CC old_CFLAGS old_CPPFLAGS old_LD old_NM old_RANLIB \
+  old_LN_S AR CC LD LN_S NM reload_flag reload_cmds wl pic_flag \
+  link_static_flag no_builtin_flag export_dynamic_flag_spec \
+  whole_archive_flag_spec libname_spec library_names_spec soname_spec RANLIB \
+  old_archive_cmds old_archive_from_new_cmds old_postinstall_cmds \
+  old_postuninstall_cmds archive_cmds postinstall_cmds postuninstall_cmds \
+  allow_undefined_flag no_undefined_flag \
+  finish_cmds finish_eval global_symbol_pipe \
+  hardcode_libdir_flag_spec hardcode_libdir_separator; do
+
+  case "$var" in
+  reload_cmds | old_archive_cmds | old_archive_from_new_cmds | \
+  old_postinstall_cmds | old_postuninstall_cmds | archive_cmds | \
+  postinstall_cmds | postuninstall_cmds | finish_cmds)
+    # Double-quote double-evaled strings.
+    eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\"\`"
+    ;;
+  *)
+    eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`"
+    ;;
+  esac
+done
+
+trap "$rm \"$ofile\"; exit 1" 1 2 15
+echo "creating $ofile"
+$rm "$ofile"
+cat <<EOF > "$ofile"
+#! $SHELL
+
+# `$echo "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services.
+# Generated automatically by $PROGRAM - GNU $PACKAGE $VERSION
+# NOTE: Changes made to this file will be lost: look at ltconfig or ltmain.sh.
+#
+# Copyright (C) 1996-1998 Free Software Foundation, Inc.
+# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Sed that helps us avoid accidentally triggering echo(1) options like -n.
+Xsed="sed -e s/^X//"
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+if test "\${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi
+
+### BEGIN LIBTOOL CONFIG
+# Libtool was configured as follows, on host `(hostname || uname -n) 2>/dev/null | sed 1q`:
+#
+# CC="$old_CC" CFLAGS="$old_CFLAGS" CPPFLAGS="$old_CPPFLAGS" \\
+# LD="$old_LD" NM="$old_NM" RANLIB="$old_RANLIB" LN_S="$old_LN_S" \\
+#   $0$ltconfig_args
+#
+# Compiler and other test output produced by $progname, useful for
+# debugging $progname, is in ./config.log if it exists.
+
+# The version of $progname that generated this script.
+LTCONFIG_VERSION="$VERSION"
+
+# Shell to use when invoking shell scripts.
+SHELL="$SHELL"
+
+# Whether or not to build shared libraries.
+build_libtool_libs=$enable_shared
+
+# Whether or not to build static libraries.
+build_old_libs=$enable_static
+
+# The host system.
+host_alias="$host_alias"
+host="$host"
+
+# An echo program that does not interpret backslashes.
+echo="$ltecho"
+
+# The archiver.
+AR="$AR"
+
+# The default C compiler.
+CC="$CC"
+
+# The linker used to build libraries.
+LD="$LD"
+
+# Whether we need hard or soft links.
+LN_S="$LN_S"
+
+# A BSD-compatible nm program.
+NM="$NM"
+
+# The name of the directory that contains temporary libtool files.
+objdir="$objdir"
+
+# How to create reloadable object files.
+reload_flag="$reload_flag"
+reload_cmds="$reload_cmds"
+
+# How to pass a linker flag through the compiler.
+wl="$wl"
+
+# Additional compiler flags for building library objects.
+pic_flag="$pic_flag"
+
+# Compiler flag to prevent dynamic linking.
+link_static_flag="$link_static_flag"
+
+# Compiler flag to turn off builtin functions.
+no_builtin_flag="$no_builtin_flag"
+
+# Compiler flag to allow reflexive dlopens.
+export_dynamic_flag_spec="$export_dynamic_flag_spec"
+
+# Compiler flag to generate shared objects directly from archives.
+whole_archive_flag_spec="$whole_archive_flag_spec"
+
+# Library versioning type.
+version_type=$version_type
+
+# Format of library name prefix.
+libname_spec="$libname_spec"
+
+# List of archive names.  First name is the real one, the rest are links.
+# The last name is the one that the linker finds with -lNAME.
+library_names_spec="$library_names_spec"
+
+# The coded name of the library, if different from the real name.
+soname_spec="$soname_spec"
+
+# Commands used to build and install an old-style archive.
+RANLIB="$RANLIB"
+old_archive_cmds="$old_archive_cmds"
+old_postinstall_cmds="$old_postinstall_cmds"
+old_postuninstall_cmds="$old_postuninstall_cmds"
+
+# Create an old-style archive from a shared archive.
+old_archive_from_new_cmds="$old_archive_from_new_cmds"
+
+# Commands used to build and install a shared archive.
+archive_cmds="$archive_cmds"
+postinstall_cmds="$postinstall_cmds"
+postuninstall_cmds="$postuninstall_cmds"
+
+# Flag that allows shared libraries with undefined symbols to be built.
+allow_undefined_flag="$allow_undefined_flag"
+
+# Flag that forces no undefined symbols.
+no_undefined_flag="$no_undefined_flag"
+
+# Commands used to finish a libtool library installation in a directory.
+finish_cmds="$finish_cmds"
+
+# Same as above, but a single script fragment to be evaled but not shown.
+finish_eval="$finish_eval"
+
+# Take the output of nm and produce a listing of raw symbols and C names.
+global_symbol_pipe="$global_symbol_pipe"
+
+# This is the shared library runtime path variable.
+runpath_var=$runpath_var
+
+# This is the shared library path variable.
+shlibpath_var=$shlibpath_var
+
+# How to hardcode a shared library path into an executable.
+hardcode_action=$hardcode_action
+
+# Flag to hardcode \$libdir into a binary during linking.
+# This must work even if \$libdir does not exist.
+hardcode_libdir_flag_spec="$hardcode_libdir_flag_spec"
+
+# Whether we need a single -rpath flag with a separated argument.
+hardcode_libdir_separator="$hardcode_libdir_separator"
+
+# Set to yes if using DIR/libNAME.so during linking hardcodes DIR into the
+# resulting binary.
+hardcode_direct=$hardcode_direct
+
+# Set to yes if using the -LDIR flag during linking hardcodes DIR into the
+# resulting binary.
+hardcode_minus_L=$hardcode_minus_L
+
+# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into
+# the resulting binary.
+hardcode_shlibpath_var=$hardcode_shlibpath_var
+EOF
+
+case "$host_os" in
+aix3*)
+  cat <<\EOF >> "$ofile"
+
+# AIX sometimes has problems with the GCC collect2 program.  For some
+# reason, if we set the COLLECT_NAMES environment variable, the problems
+# vanish in a puff of smoke.
+if test "${COLLECT_NAMES+set}" != set; then
+  COLLECT_NAMES=
+  export COLLECT_NAMES
+fi
+EOF
+  ;;
+esac
+
+echo '### END LIBTOOL CONFIG' >> "$ofile"
+echo >> "$ofile"
+
+# Append the ltmain.sh script.
+cat "$ltmain" >> "$ofile" || (rm -f "$ofile"; exit 1)
+
+chmod +x "$ofile"
+exit 0
+
+# Local Variables:
+# mode:shell-script
+# sh-indentation:2
+# End:
diff --git a/ltmain.sh b/ltmain.sh
new file mode 100644 (file)
index 0000000..cb81747
--- /dev/null
+++ b/ltmain.sh
@@ -0,0 +1,2608 @@
+# ltmain.sh - Provide generalized library-building support services.
+# NOTE: Changing this file will not affect anything until you rerun ltconfig.
+#
+# Copyright (C) 1996-1998 Free Software Foundation, Inc.
+# Gordon Matzigkeit <gord@gnu.ai.mit.edu>, 1996
+#
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2 of the License, or
+# (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful, but
+# WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the GNU
+# General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+#
+# As a special exception to the GNU General Public License, if you
+# distribute this file as part of a program that contains a
+# configuration script generated by Autoconf, you may include it under
+# the same distribution terms that you use for the rest of that program.
+
+# Check that we have a working $echo.
+if test "X$1" = X--no-reexec; then
+  # Discard the --no-reexec flag, and continue.
+  shift
+elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then
+  # Yippee, $echo works!
+  :
+else
+  # Restart under the correct shell, and then maybe $echo will work.
+  exec $SHELL "$0" --no-reexec ${1+"$@"}
+fi
+
+# The name of this program.
+progname=`$echo "$0" | sed 's%^.*/%%'`
+modename="$progname"
+
+# Constants.
+PROGRAM=ltmain.sh
+PACKAGE=libtool
+VERSION=1.2b
+
+default_mode=
+help="Try \`$progname --help' for more information."
+magic="%%%MAGIC variable%%%"
+mkdir="mkdir"
+mv="mv -f"
+rm="rm -f"
+
+# Sed substitution that helps us do robust quoting.  It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e s/^X//'
+sed_quote_subst='s/\([\\`\\"$\\\\]\)/\\\1/g'
+
+# NLS nuisances.
+# Only set LANG and LC_ALL to C if already set.
+# These must not be set unconditionally because not all systems understand
+# e.g. LANG=C (notably SCO).
+# We save the old values to restore during execute mode.
+if test "${LC_ALL+set}" = set; then
+  save_LC_ALL="$LC_ALL"; LC_ALL=C; export LC_ALL
+fi
+if test "${LANG+set}" = set; then
+  save_LANG="$LANG"; LANG=C; export LANG
+fi
+
+if test "$LTCONFIG_VERSION" != "$VERSION"; then
+  echo "$modename: ltconfig version \`$LTCONFIG_VERSION' does not match $PROGRAM version \`$VERSION'" 1>&2
+  echo "Fatal configuration error.  See the $PACKAGE docs for more information." 1>&2
+  exit 1
+fi
+
+if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then
+  echo "$modename: not configured to build any kind of library" 1>&2
+  echo "Fatal configuration error.  See the $PACKAGE docs for more information." 1>&2
+  exit 1
+fi
+
+# Global variables.
+mode=$default_mode
+nonopt=
+prev=
+prevopt=
+run=
+show="$echo"
+show_help=
+execute_dlfiles=
+
+# Parse our command line options once, thoroughly.
+while test $# -gt 0
+do
+  arg="$1"
+  shift
+
+  case "$arg" in
+  -*=*) optarg=`$echo "X$arg" | $Xsed -e 's/[-_a-zA-Z0-9]*=//'` ;;
+  *) optarg= ;;
+  esac
+
+  # If the previous option needs an argument, assign it.
+  if test -n "$prev"; then
+    case "$prev" in
+    execute_dlfiles)
+      eval "$prev=\"\$$prev \$arg\""
+      ;;
+    *)
+      eval "$prev=\$arg"
+      ;;
+    esac
+
+    prev=
+    prevopt=
+    continue
+  fi
+
+  # Have we seen a non-optional argument yet?
+  case "$arg" in
+  --help)
+    show_help=yes
+    ;;
+
+  --version)
+    echo "$PROGRAM (GNU $PACKAGE) $VERSION"
+    exit 0
+    ;;
+
+  --config)
+    sed -e '1,/^### BEGIN LIBTOOL CONFIG/d' -e '/^### END LIBTOOL CONFIG/,$d' $0
+    exit 0
+    ;;
+
+  --debug)
+    echo "$progname: enabling shell trace mode"
+    set -x
+    ;;
+
+  --dry-run | -n)
+    run=:
+    ;;
+
+  --features)
+    echo "host: $host"
+    if test "$build_libtool_libs" = yes; then
+      echo "enable shared libraries"
+    else
+      echo "disable shared libraries"
+    fi
+    if test "$build_old_libs" = yes; then
+      echo "enable static libraries"
+    else
+      echo "disable static libraries"
+    fi
+    exit 0
+    ;;
+
+  --finish) mode="finish" ;;
+
+  --mode) prevopt="--mode" prev=mode ;;
+  --mode=*) mode="$optarg" ;;
+
+  --quiet | --silent)
+    show=:
+    ;;
+
+  -dlopen)
+    prevopt="-dlopen"
+    prev=execute_dlfiles
+    ;;
+
+  -*)
+    $echo "$modename: unrecognized option \`$arg'" 1>&2
+    $echo "$help" 1>&2
+    exit 1
+    ;;
+
+  *)
+    nonopt="$arg"
+    break
+    ;;
+  esac
+done
+
+if test -n "$prevopt"; then
+  $echo "$modename: option \`$prevopt' requires an argument" 1>&2
+  $echo "$help" 1>&2
+  exit 1
+fi
+
+if test -z "$show_help"; then
+
+  # Infer the operation mode.
+  if test -z "$mode"; then
+    case "$nonopt" in
+    *cc | *++ | gcc* | *-gcc*)
+      mode=link
+      for arg
+      do
+        case "$arg" in
+        -c)
+           mode=compile
+           break
+           ;;
+        esac
+      done
+      ;;
+    *db | *dbx | *strace | *truss)
+      mode=execute
+      ;;
+    *install*|cp|mv)
+      mode=install
+      ;;
+    *rm)
+      mode=uninstall
+      ;;
+    *)
+      # If we have no mode, but dlfiles were specified, then do execute mode.
+      test -n "$execute_dlfiles" && mode=execute
+
+      # Just use the default operation mode.
+      if test -z "$mode"; then
+        if test -n "$nonopt"; then
+          $echo "$modename: warning: cannot infer operation mode from \`$nonopt'" 1>&2
+        else
+          $echo "$modename: warning: cannot infer operation mode without MODE-ARGS" 1>&2
+        fi
+      fi
+      ;;
+    esac
+  fi
+
+  # Only execute mode is allowed to have -dlopen flags.
+  if test -n "$execute_dlfiles" && test "$mode" != execute; then
+    $echo "$modename: unrecognized option \`-dlopen'" 1>&2
+    $echo "$help" 1>&2
+    exit 1
+  fi
+
+  # Change the help message to a mode-specific one.
+  generic_help="$help"
+  help="Try \`$modename --help --mode=$mode' for more information."
+
+  # These modes are in order of execution frequency so that they run quickly.
+  case "$mode" in
+  # libtool compile mode
+  compile)
+    modename="$modename: compile"
+    # Get the compilation command and the source file.
+    base_compile=
+    lastarg=
+    srcfile="$nonopt"
+    suppress_output=
+
+    for arg
+    do
+      # Accept any command-line options.
+      case "$arg" in
+      -o)
+       $echo "$modename: you cannot specify the output filename with \`-o'" 1>&2
+       $echo "$help" 1>&2
+       exit 1
+       ;;
+
+      -static)
+       build_old_libs=yes
+       continue
+       ;;
+      esac
+
+      # Accept the current argument as the source file.
+      lastarg="$srcfile"
+      srcfile="$arg"
+
+      # Aesthetically quote the previous argument.
+
+      # Backslashify any backslashes, double quotes, and dollar signs.
+      # These are the only characters that are still specially
+      # interpreted inside of double-quoted scrings.
+      lastarg=`$echo "X$lastarg" | $Xsed -e "$sed_quote_subst"`
+
+      # Double-quote args containing other shell metacharacters.
+      # Many Bourne shells cannot handle close brackets correctly in scan
+      # sets, so we specify it separately.
+      case "$lastarg" in
+      *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \    ]*|*]*)
+       lastarg="\"$lastarg\""
+       ;;
+      esac
+
+      # Add the previous argument to base_compile.
+      if test -z "$base_compile"; then
+       base_compile="$lastarg"
+      else
+       base_compile="$base_compile $lastarg"
+      fi
+    done
+
+    # Get the name of the library object.
+    libobj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%'`
+
+    # Recognize several different file suffixes.
+    xform='[cCFSfms]'
+    case "$libobj" in
+    *.ada) xform=ada ;;
+    *.adb) xform=adb ;;
+    *.ads) xform=ads ;;
+    *.asm) xform=asm ;;
+    *.c++) xform=c++ ;;
+    *.cc) xform=cc ;;
+    *.cpp) xform=cpp ;;
+    *.cxx) xform=cxx ;;
+    *.f90) xform=f90 ;;
+    *.for) xform=for ;;
+    esac
+
+    libobj=`$echo "X$libobj" | $Xsed -e "s/\.$xform$/.lo/"`
+
+    case "$libobj" in
+    *.lo) obj=`$echo "X$libobj" | $Xsed -e 's/\.lo$/.o/'` ;;
+    *)
+      $echo "$modename: cannot determine name of library object from \`$srcfile'" 1>&2
+      exit 1
+      ;;
+    esac
+
+    if test -z "$base_compile"; then
+      $echo "$modename: you must specify a compilation command" 1>&2
+      $echo "$help" 1>&2
+      exit 1
+    fi
+
+    # Delete any leftover library objects.
+    if test "$build_old_libs" = yes; then
+      $run $rm $obj $libobj
+      trap "$run $rm $obj $libobj; exit 1" 1 2 15
+    else
+      $run $rm $libobj
+      trap "$run $rm $libobj; exit 1" 1 2 15
+    fi
+
+    # Only build a PIC object if we are building libtool libraries.
+    if test "$build_libtool_libs" = yes; then
+      # Without this assignment, base_compile gets emptied.
+      fbsd_hideous_sh_bug=$base_compile
+
+      # All platforms use -DPIC, to notify preprocessed assembler code.
+      $show "$base_compile$pic_flag -DPIC $srcfile"
+      if $run eval "$base_compile\$pic_flag -DPIC \$srcfile"; then :
+      else
+        test -n "$obj" && $run $rm $obj
+        exit 1
+      fi
+
+      # If we have no pic_flag, then copy the object into place and finish.
+      if test -z "$pic_flag"; then
+        $show "$LN_S $obj $libobj"
+        $run $LN_S $obj $libobj
+        exit $?
+      fi
+
+      # Just move the object, then go on to compile the next one
+      $show "$mv $obj $libobj"
+      $run $mv $obj $libobj || exit $?
+
+      # Allow error messages only from the first compilation.
+      suppress_output=' >/dev/null 2>&1'
+    fi
+
+    # Only build a position-dependent object if we build old libraries.
+    if test "$build_old_libs" = yes; then
+      # Suppress compiler output if we already did a PIC compilation.
+      $show "$base_compile $srcfile$suppress_output"
+      if $run eval "$base_compile \$srcfile$suppress_output"; then :
+      else
+        $run $rm $obj $libobj
+        exit 1
+      fi
+    fi
+
+    # Create an invalid libtool object if no PIC, so that we do not
+    # accidentally link it into a program.
+    if test "$build_libtool_libs" != yes; then
+      $show "echo timestamp > $libobj"
+      $run eval "echo timestamp > \$libobj" || exit $?
+    fi
+
+    exit 0
+    ;;
+
+  # libtool link mode
+  link)
+    modename="$modename: link"
+    CC="$nonopt"
+    allow_undefined=yes
+    compile_command="$CC"
+    finalize_command="$CC"
+
+    compile_shlibpath=
+    finalize_shlibpath=
+    convenience=
+    old_convenience=
+    deplibs=
+    dlfiles=
+    dlprefiles=
+    export_dynamic=no
+    generated=
+    hardcode_libdirs=
+    libobjs=
+    link_against_libtool_libs=
+    ltlibs=
+    objs=
+    prev=
+    prevarg=
+    release=
+    rpath=
+    perm_rpath=
+    temp_rpath=
+    vinfo=
+
+    # We need to know -static, to get the right output filenames.
+    for arg
+    do
+      case "$arg" in
+      -all-static | -static)
+        if test "X$arg" = "X-all-static" && test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then
+           $echo "$modename: warning: complete static linking is impossible in this configuration" 1>&2
+        fi
+        build_libtool_libs=no
+       build_old_libs=yes
+        break
+        ;;
+      esac
+    done
+
+    # See if our shared archives depend on static archives.
+    test -n "$old_archive_from_new_cmds" && build_old_libs=yes
+
+    # Go through the arguments, transforming them on the way.
+    while test $# -gt 0; do
+      arg="$1"
+      shift
+
+      # If the previous option needs an argument, assign it.
+      if test -n "$prev"; then
+        case "$prev" in
+        output)
+          compile_command="$compile_command @OUTPUT@"
+          finalize_command="$finalize_command @OUTPUT@"
+          ;;
+        esac
+
+        case "$prev" in
+        dlfiles|dlprefiles)
+          case "$arg" in
+          *.la | *.lo) ;;  # We handle these cases below.
+          *)
+            dlprefiles="$dlprefiles $arg"
+            test "$prev" = dlfiles && dlfiles="$dlfiles $arg"
+            prev=
+            ;;
+          esac
+          ;;
+       release)
+         release="-$arg"
+         prev=
+         continue
+         ;;
+        rpath)
+          rpath="$rpath $arg"
+         prev=
+         continue
+         ;;
+        *)
+          eval "$prev=\"\$arg\""
+          prev=
+          continue
+          ;;
+        esac
+      fi
+
+      prevarg="$arg"
+
+      case "$arg" in
+      -all-static)
+       if test -n "$link_static_flag"; then
+          compile_command="$compile_command $link_static_flag"
+         finalize_command="$finalize_command $link_static_flag"
+        fi
+        continue
+       ;;
+
+      -allow-undefined)
+       # FIXME: remove this flag sometime in the future.
+       $echo "$modename: \`-allow-undefined' is deprecated because it is the default" 1>&2
+       continue
+       ;;
+
+      -dlopen)
+        prev=dlfiles
+        continue
+        ;;
+
+      -dlpreopen)
+        prev=dlprefiles
+        continue
+        ;;
+
+      -export-dynamic)
+        if test "$export_dynamic" != yes; then
+          export_dynamic=yes
+         if test -n "$export_dynamic_flag_spec"; then
+           eval arg=\"$export_dynamic_flag_spec\"
+         else
+           arg=
+         fi
+
+          # Add the symbol object into the linking commands.
+         compile_command="$compile_command @SYMFILE@"
+         finalize_command="$finalize_command @SYMFILE@"
+        fi
+        ;;
+
+      -L*)
+        dir=`$echo "X$arg" | $Xsed -e 's%^-L\(.*\)$%\1%'`
+        case "$dir" in
+        /* | [A-Za-z]:[/\\]*)
+         # Add the corresponding hardcode_libdir_flag, if it is not identical.
+          ;;
+        *)
+          $echo "$modename: \`-L$dir' cannot specify a relative directory" 1>&2
+          exit 1
+          ;;
+        esac
+        deplibs="$deplibs $arg"
+        ;;
+
+      -l*) deplibs="$deplibs $arg" ;;
+
+      -no-undefined)
+       allow_undefined=no
+       continue
+       ;;
+
+      -o) prev=output ;;
+
+      -release)
+       prev=release
+       continue
+       ;;
+
+      -rpath)
+        prev=rpath
+        continue
+        ;;
+
+      -static)
+       # If we have no pic_flag, then this is the same as -all-static.
+       if test -z "$pic_flag" && test -n "$link_static_flag"; then
+          compile_command="$compile_command $link_static_flag"
+         finalize_command="$finalize_command $link_static_flag"
+        fi
+       continue
+       ;;
+
+      -version-info)
+        prev=vinfo
+        continue
+        ;;
+
+      # Some other compiler flag.
+      -* | +*)
+       # Unknown arguments in both finalize_command and compile_command need
+       # to be aesthetically quoted because they are evaled later.
+       arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+       case "$arg" in
+       *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \   ]*|*]*)
+         arg="\"$arg\""
+         ;;
+       esac
+        ;;
+
+      *.o | *.a)
+        # A standard object.
+        objs="$objs $arg"
+        ;;
+
+      *.lo)
+        # A library object.
+       if test "$prev" = dlfiles; then
+         dlfiles="$dlfiles $arg"
+         if test "$build_libtool_libs" = yes; then
+           prev=
+           continue
+         else
+           # If libtool objects are unsupported, then we need to preload.
+           prev=dlprefiles
+         fi
+       fi
+
+       if test "$prev" = dlprefiles; then
+         # Preload the old-style object.
+         dlprefiles="$dlprefiles "`$echo "X$arg" | $Xsed -e 's/\.lo$/.o/'`
+         prev=
+       fi
+       libobjs="$libobjs $arg"
+        ;;
+
+      *.la)
+        # A libtool-controlled library.
+
+        dlname=
+        libdir=
+        library_names=
+        old_library=
+
+        # Check to see that this really is a libtool archive.
+        if (sed -e '2q' $arg | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+        else
+          $echo "$modename: \`$arg' is not a valid libtool archive" 1>&2
+          exit 1
+        fi
+
+        # If there is no directory component, then add one.
+        case "$arg" in
+        */* | *\\*) . $arg ;;
+        *) . ./$arg ;;
+        esac
+
+        # Get the name of the library we link against.
+        linklib=
+        for l in $old_library $library_names; do
+          linklib="$l"
+        done
+
+        if test -z "$linklib"; then
+          $echo "$modename: cannot find name of link library for \`$arg'" 1>&2
+          exit 1
+        fi
+
+        # Find the relevant object directory and library name.
+        name=`$echo "X$arg" | $Xsed -e 's%^.*/%%' -e 's/\.la$//' -e 's/^lib//'`
+        dir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'`
+        if test "X$dir" = "X$arg"; then
+          dir="$objdir"
+        else
+          dir="$dir/$objdir"
+        fi
+
+        if test -z "$libdir"; then
+         # It is a libtool convenience library, so add in its objects.
+         convenience="$convenience $dir/$old_library"l
+         old_convenience="$old_convenience $dir/$old_library"
+         compile_command="$compile_command $dir/$old_library"
+         finalize_command="$finalize_command $dir/$old_library"
+         continue
+       fi
+
+        # This library was specified with -dlopen.
+        if test "$prev" = dlfiles; then
+          dlfiles="$dlfiles $arg"
+          if test -z "$dlname"; then
+            # If there is no dlname, we need to preload.
+            prev=dlprefiles
+          else
+            # We should not create a dependency on this library, but we
+           # may need any libraries it requires.
+           compile_command="$compile_command$dependency_libs"
+           finalize_command="$finalize_command$dependency_libs"
+            prev=
+            continue
+          fi
+        fi
+
+        # The library was specified with -dlpreopen.
+        if test "$prev" = dlprefiles; then
+          # Prefer using a static library (so that no silly _DYNAMIC symbols
+          # are required to link).
+          if test -n "$old_library"; then
+            dlprefiles="$dlprefiles $dir/$old_library"
+          else
+            dlprefiles="$dlprefiles $dir/$linklib"
+          fi
+          prev=
+        fi
+
+        if test "$build_libtool_libs" = yes && test -n "$library_names"; then
+          link_against_libtool_libs="$link_against_libtool_libs $arg"
+          if test -n "$shlibpath_var"; then
+            # Make sure the rpath contains only unique directories.
+            case "$temp_rpath " in
+            *" $dir "*) ;;
+            *) temp_rpath="$temp_rpath $dir" ;;
+            esac
+          fi
+
+         # This is the magic to use -rpath.
+          if test -n "$hardcode_libdir_flag_spec"; then
+            if test -n "$hardcode_libdir_separator"; then
+              if test -z "$hardcode_libdirs"; then
+                # Put the magic libdir with the hardcode flag.
+                hardcode_libdirs="$libdir"
+                libdir="@HARDCODE_LIBDIRS@"
+              else
+                # Just accumulate the unique libdirs.
+               case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in
+               *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+                 ;;
+               *)
+                 hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir"
+                 ;;
+               esac
+                libdir=
+              fi
+            fi
+
+            if test -n "$libdir"; then
+              eval flag=\"$hardcode_libdir_flag_spec\"
+
+              compile_command="$compile_command $flag"
+              finalize_command="$finalize_command $flag"
+            fi
+          elif test -n "$runpath_var"; then
+            # Do the same for the permanent run path.
+            case "$perm_rpath " in
+            *" $libdir "*) ;;
+            *) perm_rpath="$perm_rpath $libdir" ;;
+            esac
+          fi
+
+
+         lib_linked=yes
+          case "$hardcode_action" in
+          immediate | unsupported)
+            if test "$hardcode_direct" = no; then
+              compile_command="$compile_command $dir/$linklib"
+            elif test "$hardcode_minus_L" = no; then
+              compile_command="$compile_command -L$dir -l$name"
+            elif test "$hardcode_shlibpath_var" = no; then
+              compile_shlibpath="$compile_shlibpath$dir:"
+              compile_command="$compile_command -l$name"
+           else
+             lib_linked=no
+            fi
+            ;;
+
+          relink)
+            # We need an absolute path.
+            case "$dir" in
+            /* | [A-Za-z]:[/\\]*) ;;
+            *)
+              absdir=`cd "$dir" && pwd`
+              if test -z "$absdir"; then
+                $echo "$modename: cannot determine absolute directory name of \`$dir'" 1>&2
+                exit 1
+              fi
+              dir="$absdir"
+              ;;
+            esac
+
+            if test "$hardcode_direct" = yes; then
+              compile_command="$compile_command $dir/$linklib"
+            elif test "$hardcode_minus_L" = yes; then
+              compile_command="$compile_command -L$dir -l$name"
+            elif test "$hardcode_shlibpath_var" = yes; then
+              compile_shlibpath="$compile_shlibpath$dir:"
+              compile_command="$compile_command -l$name"
+           else
+             lib_linked=no
+            fi
+            ;;
+
+         *)
+           lib_linked=no
+           ;;
+          esac
+
+         if test "$lib_linked" != yes; then
+           $echo "$modename: configuration error: unsupported hardcode properties"
+           exit 1
+         fi
+
+          # Finalize command for both is simple: just hardcode it.
+          if test "$hardcode_direct" = yes; then
+            finalize_command="$finalize_command $libdir/$linklib"
+          elif test "$hardcode_minus_L" = yes; then
+            finalize_command="$finalize_command -L$libdir -l$name"
+          elif test "$hardcode_shlibpath_var" = yes; then
+            finalize_shlibpath="$finalize_shlibpath$libdir:"
+            finalize_command="$finalize_command -l$name"
+          else
+            # We cannot seem to hardcode it, guess we'll fake it.
+            finalize_command="$finalize_command -L$libdir -l$name"
+          fi
+        else
+          # Transform directly to old archives if we don't build new libraries.
+          if test -n "$pic_flag" && test -z "$old_library"; then
+            $echo "$modename: cannot find static library for \`$arg'" 1>&2
+            exit 1
+          fi
+
+         # Here we assume that one of hardcode_direct or hardcode_minus_L
+         # is not unsupported.  This is valid on all known static and
+         # shared platforms.
+         if test "$hardcode_direct" != unsupported; then
+           test -n "$old_library" && linklib="$old_library"
+           compile_command="$compile_command $dir/$linklib"
+           finalize_command="$finalize_command $dir/$linklib"
+         else
+           compile_command="$compile_command -L$dir -l$name"
+           finalize_command="$finalize_command -L$dir -l$name"
+         fi
+        fi
+
+       # Add in any libraries that this one depends upon.
+       compile_command="$compile_command$dependency_libs"
+       finalize_command="$finalize_command$dependency_libs"
+       continue
+        ;;
+
+      # Some other compiler argument.
+      *)
+       # Unknown arguments in both finalize_command and compile_command need
+       # to be aesthetically quoted because they are evaled later.
+       arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+       case "$arg" in
+       *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \   ]*|*]*)
+         arg="\"$arg\""
+         ;;
+       esac
+        ;;
+      esac
+
+      # Now actually substitute the argument into the commands.
+      if test -n "$arg"; then
+       compile_command="$compile_command $arg"
+       finalize_command="$finalize_command $arg"
+      fi
+    done
+
+    if test -n "$prev"; then
+      $echo "$modename: the \`$prevarg' option requires an argument" 1>&2
+      $echo "$help" 1>&2
+      exit 1
+    fi
+
+    oldlibs=
+    case "$output" in
+    "")
+      $echo "$modename: you must specify an output file" 1>&2
+      $echo "$help" 1>&2
+      exit 1
+      ;;
+
+    */* | *\\*)
+      $echo "$modename: output file \`$output' must have no directory components" 1>&2
+      $echo "$help" 1>&2
+      exit 1
+      ;;
+
+    *.a)
+      if test -n "$link_against_libtool_libs"; then
+        $echo "$modename: error: cannot link libtool libraries into archives" 1>&2
+        exit 1
+      fi
+
+      if test -n "$deplibs"; then
+        $echo "$modename: warning: \`-l' and \`-L' are ignored for archives" 1>&2
+      fi
+
+      if test -n "$dlfiles$dlprefiles"; then
+        $echo "$modename: warning: \`-dlopen' is ignored for archives" 1>&2
+      fi
+
+      if test -n "$rpath"; then
+        $echo "$modename: warning: \`-rpath' is ignored for archives" 1>&2
+      fi
+
+      if test -n "$vinfo"; then
+        $echo "$modename: warning: \`-version-info' is ignored for archives" 1>&2
+      fi
+
+      if test -n "$release"; then
+        $echo "$modename: warning: \`-release' is ignored for archives" 1>&2
+      fi
+
+      # Now set the variables for building old libraries.
+      build_libtool_libs=no
+      oldlibs="$output"
+      ;;
+
+    *.la)
+      # Make sure we only generate libraries of the form `libNAME.la'.
+      case "$output" in
+      lib*) ;;
+      *)
+       $echo "$modename: libtool library \`$output' must begin with \`lib'" 1>&2
+       $echo "$help" 1>&2
+       exit 1
+       ;;
+      esac
+
+      name=`$echo "X$output" | $Xsed -e 's/\.la$//' -e 's/^lib//'`
+      eval libname=\"$libname_spec\"
+
+      # All the library-specific variables (install_libdir is set above).
+      library_names=
+      old_library=
+      dlname=
+
+      if test -n "$objs"; then
+        $echo "$modename: cannot build libtool library \`$output' from non-libtool objects:$objs" 2>&1
+        exit 1
+      fi
+
+      # How the heck are we supposed to write a wrapper for a shared library?
+      if test -n "$link_against_libtool_libs"; then
+        $echo "$modename: error: cannot link shared libraries into libtool libraries" 1>&2
+        exit 1
+      fi
+
+      if test -n "$dlfiles$dlprefiles"; then
+        $echo "$modename: warning: \`-dlopen' is ignored for libtool libraries" 1>&2
+      fi
+
+      set dummy $rpath
+      if test $# -gt 2; then
+       $echo "$modename: warning: ignoring multiple \`-rpath's for a libtool library" 1>&2
+      fi
+      install_libdir="$2"
+
+      # Now set the variables for building old libraries.
+      oldlibs="$objdir/$libname.a"
+      if test -z "$rpath"; then
+       # Building a libtool convenience library.
+       oldlibs="$objdir/$libname.al $oldlibs"
+       build_libtool_libs=convenience
+
+       if test -n "$vinfo"; then
+         $echo "$modename: warning: \`-version-info' is ignored for convenience libraries" 1>&2
+       fi
+
+       if test -n "$release"; then
+         $echo "$modename: warning: \`-release' is ignored for convenience libraries" 1>&2
+       fi
+      else
+
+       # Parse the version information argument.
+       IFS="${IFS=     }"; save_ifs="$IFS"; IFS=':'
+       set dummy $vinfo 0 0 0
+       IFS="$save_ifs"
+
+       if test -n "$8"; then
+         $echo "$modename: too many parameters to \`-version-info'" 1>&2
+         $echo "$help" 1>&2
+         exit 1
+       fi
+
+       current="$2"
+       revision="$3"
+       age="$4"
+
+       # Check that each of the things are valid numbers.
+       case "$current" in
+       0 | [1-9] | [1-9][0-9]*) ;;
+       *)
+         $echo "$modename: CURRENT \`$current' is not a nonnegative integer" 1>&2
+         $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+         exit 1
+         ;;
+       esac
+
+       case "$revision" in
+       0 | [1-9] | [1-9][0-9]*) ;;
+       *)
+         $echo "$modename: REVISION \`$revision' is not a nonnegative integer" 1>&2
+         $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+         exit 1
+         ;;
+       esac
+
+       case "$age" in
+       0 | [1-9] | [1-9][0-9]*) ;;
+       *)
+         $echo "$modename: AGE \`$age' is not a nonnegative integer" 1>&2
+         $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+         exit 1
+         ;;
+       esac
+
+       if test $age -gt $current; then
+         $echo "$modename: AGE \`$age' is greater than the current interface number \`$current'" 1>&2
+         $echo "$modename: \`$vinfo' is not valid version information" 1>&2
+         exit 1
+       fi
+
+       # Calculate the version variables.
+       major=
+       versuffix=
+       verstring=
+       case "$version_type" in
+       none) ;;
+
+       linux)
+         major=.`expr $current - $age`
+         versuffix="$major.$age.$revision"
+         ;;
+
+       osf)
+         major=`expr $current - $age`
+         versuffix=".$current.$age.$revision"
+         verstring="$current.$age.$revision"
+
+         # Add in all the interfaces that we are compatible with.
+         loop=$age
+         while test $loop != 0; do
+           iface=`expr $current - $loop`
+           loop=`expr $loop - 1`
+           verstring="$verstring:${iface}.0"
+         done
+
+         # Make executables depend on our current version.
+         verstring="$verstring:${current}.0"
+         ;;
+
+       sunos)
+         major=".$current"
+         versuffix=".$current.$revision"
+         ;;
+
+       *)
+         $echo "$modename: unknown library version type \`$version_type'" 1>&2
+         echo "Fatal configuration error.  See the $PACKAGE docs for more information." 1>&2
+         exit 1
+         ;;
+       esac
+
+       # Clear the version info if we defaulted, and they specified a release.
+       if test -z "$vinfo" && test -n "$release"; then
+         major=
+         versuffix=
+         verstring="0.0"
+       fi
+
+       # Check to see if the archive will have undefined symbols.
+       if test "$allow_undefined" = yes; then
+         if test "$allow_undefined_flag" = unsupported; then
+           $echo "$modename: warning: undefined symbols not allowed in $host shared libraries" 1>&2
+           build_libtool_libs=no
+           build_old_libs=yes
+         fi
+       else
+         # Don't allow undefined symbols.
+         allow_undefined_flag="$no_undefined_flag"
+       fi
+
+       # Add libc to deplibs on all systems.
+       dependency_libs="$deplibs"
+       deplibs="$deplibs -lc"
+      fi
+
+      # Create the output directory, or remove our outputs if we need to.
+      if test -d $objdir; then
+        $show "${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.*"
+       $run ${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.*
+      else
+        $show "$mkdir $objdir"
+        $run $mkdir $objdir
+        status=$?
+        if test $status -ne 0 && test ! -d $objdir; then
+          exit $status
+        fi
+      fi
+
+      if test "$build_libtool_libs" = yes; then
+       # Get the real and link names of the library.
+       eval library_names=\"$library_names_spec\"
+       set dummy $library_names
+       realname="$2"
+       shift; shift
+
+       if test -n "$soname_spec"; then
+         eval soname=\"$soname_spec\"
+       else
+         soname="$realname"
+       fi
+
+       lib="$objdir/$realname"
+       for link
+       do
+         linknames="$linknames $link"
+       done
+
+       # Use standard objects if they are PIC.
+       test -z "$pic_flag" && libobjs=`$echo "X$libobjs " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//g'`
+
+       # Transform .lo files to .o files.
+       test "$build_old_libs" = yes && oldobjs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^   ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'`
+
+       if test -n "$whole_archive_flag_spec"; then
+         if test -n "$convenience"; then
+           eval libobjs=\"\$libobjs $whole_archive_flag_spec\"
+         fi
+       else
+         for xlib in $convenience; do
+           # Extract the objects.
+           xdir="$xlib"x
+           generated="$generated $xdir"
+           xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'`
+
+           $show "${rm}r $xdir"
+           $run ${rm}r "$xdir"
+           $show "mkdir $xdir"
+           $run mkdir "$xdir"
+           status=$?
+           if test $status -ne 0 && test ! -d "$xdir"; then
+             exit $status
+           fi
+           $show "(cd $xdir && $AR x ../$xlib)"
+           $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $?
+
+           libobjs="$libobjs `echo $xdir/*`"
+         done
+       fi
+
+       # Do each of the archive commands.
+       eval cmds=\"$archive_cmds\"
+       IFS="${IFS=     }"; save_ifs="$IFS"; IFS=';'
+       for cmd in $cmds; do
+         IFS="$save_ifs"
+         $show "$cmd"
+         $run eval "$cmd" || exit $?
+       done
+       IFS="$save_ifs"
+
+       # Create links to the real library.
+       for linkname in $linknames; do
+         if test "$realname" != "$linkname"; then
+           $show "(cd $objdir && $LN_S $realname $linkname)"
+           $run eval '(cd $objdir && $LN_S $realname $linkname)' || exit $?
+         fi
+       done
+
+       # If -export-dynamic was specified, set the dlname.
+       if test "$export_dynamic" = yes; then
+         # On all known operating systems, these are identical.
+         dlname="$soname"
+       fi
+      fi
+      ;;
+
+    *.lo | *.o)
+      if test -n "$link_against_libtool_libs"; then
+        $echo "$modename: error: cannot link libtool libraries into objects" 1>&2
+        exit 1
+      fi
+
+      if test -n "$deplibs"; then
+        $echo "$modename: warning: \`-l' and \`-L' are ignored for objects" 1>&2
+      fi
+
+      if test -n "$dlfiles$dlprefiles"; then
+        $echo "$modename: warning: \`-dlopen' is ignored for objects" 1>&2
+      fi
+
+      if test -n "$rpath"; then
+        $echo "$modename: warning: \`-rpath' is ignored for objects" 1>&2
+      fi
+
+      if test -n "$vinfo"; then
+        $echo "$modename: warning: \`-version-info' is ignored for objects" 1>&2
+      fi
+
+      if test -n "$release"; then
+        $echo "$modename: warning: \`-release' is ignored for objects" 1>&2
+      fi
+
+      case "$output" in
+      *.lo)
+        if test -n "$objs"; then
+          $echo "$modename: cannot build library object \`$output' from non-libtool objects" 1>&2
+          exit 1
+        fi
+        libobj="$output"
+        obj=`$echo "X$output" | $Xsed -e 's/\.lo$/.o/'`
+        ;;
+      *)
+        libobj=
+        obj="$output"
+        ;;
+      esac
+
+      # Delete the old objects.
+      $run $rm $obj $libobj
+
+      # Create the old-style object.
+      reload_objs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^       ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'`
+
+      output="$obj"
+      eval cmds=\"$reload_cmds\"
+      IFS="${IFS=      }"; save_ifs="$IFS"; IFS=';'
+      for cmd in $cmds; do
+        IFS="$save_ifs"
+        $show "$cmd"
+        $run eval "$cmd" || exit $?
+      done
+      IFS="$save_ifs"
+
+      # Exit if we aren't doing a library object file.
+      test -z "$libobj" && exit 0
+
+      if test "$build_libtool_libs" != yes; then
+        # Create an invalid libtool object if no PIC, so that we don't
+        # accidentally link it into a program.
+        $show "echo timestamp > $libobj"
+        $run eval "echo timestamp > $libobj" || exit $?
+        exit 0
+      fi
+
+      if test -n "$pic_flag"; then
+        # Only do commands if we really have different PIC objects.
+        reload_objs="$libobjs"
+        output="$libobj"
+        eval cmds=\"$reload_cmds\"
+        IFS="${IFS=    }"; save_ifs="$IFS"; IFS=';'
+        for cmd in $cmds; do
+          IFS="$save_ifs"
+          $show "$cmd"
+          $run eval "$cmd" || exit $?
+        done
+        IFS="$save_ifs"
+      else
+        # Just create a symlink.
+        $show "$LN_S $obj $libobj"
+        $run $LN_S $obj $libobj || exit $?
+      fi
+
+      exit 0
+      ;;
+
+    *)
+      if test -n "$vinfo"; then
+        $echo "$modename: warning: \`-version-info' is ignored for programs" 1>&2
+      fi
+
+      if test -n "$release"; then
+        $echo "$modename: warning: \`-release' is ignored for programs" 1>&2
+      fi
+
+      if test -n "$rpath"; then
+       # If the user specified any rpath flags, then add them.
+       for libdir in $rpath; do
+          if test -n "$hardcode_libdir_flag_spec"; then
+            if test -n "$hardcode_libdir_separator"; then
+              if test -z "$hardcode_libdirs"; then
+                # Put the magic libdir with the hardcode flag.
+                hardcode_libdirs="$libdir"
+                libdir="@HARDCODE_LIBDIRS@"
+              else
+                # Just accumulate the unique libdirs.
+               case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in
+               *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*)
+                 ;;
+               *)
+                 hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir"
+                 ;;
+               esac
+                libdir=
+              fi
+            fi
+
+            if test -n "$libdir"; then
+              eval flag=\"$hardcode_libdir_flag_spec\"
+
+              compile_command="$compile_command $flag"
+              finalize_command="$finalize_command $flag"
+            fi
+          elif test -n "$runpath_var"; then
+            case "$perm_rpath " in
+            *" $libdir "*) ;;
+            *) perm_rpath="$perm_rpath $libdir" ;;
+            esac
+          fi
+       done
+      fi
+
+      # Substitute the hardcoded libdirs into the compile commands.
+      if test -n "$hardcode_libdir_separator"; then
+       compile_command=`$echo "X$compile_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"`
+       finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"`
+      fi
+
+      if test -n "$libobjs" && test "$build_old_libs" = yes; then
+        # Transform all the library objects into standard objects.
+        compile_command=`$echo "X$compile_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'`
+        finalize_command=`$echo "X$finalize_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'`
+      fi
+
+      if test "$export_dynamic" = yes && test -n "$NM" && test -n "$global_symbol_pipe"; then
+        dlsyms="${output}S.c"
+      else
+        dlsyms=
+      fi
+
+      if test -n "$dlsyms"; then
+        # Add our own program objects to the preloaded list.
+        dlprefiles=`$echo "X$objs$dlprefiles " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'`
+
+       # Discover the nlist of each of the dlfiles.
+        nlist="$objdir/${output}.nm"
+
+       if test -d $objdir; then
+         $show "$rm $nlist ${nlist}T"
+         $run $rm "$nlist" "${nlist}T"
+       else
+         $show "$mkdir $objdir"
+         $run $mkdir $objdir
+         status=$?
+         if test $status -ne 0 && test ! -d $objdir; then
+           exit $status
+         fi
+       fi
+
+        for arg in $dlprefiles; do
+         $show "extracting global C symbols from \`$arg'"
+         $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'"
+        done
+
+        # Parse the name list into a source file.
+        $show "creating $objdir/$dlsyms"
+        if test -z "$run"; then
+         # Make sure we at least have an empty file.
+         test -f "$nlist" || : > "$nlist"
+
+         # Try sorting and uniquifying the output.
+         if sort "$nlist" | uniq > "$nlist"T; then
+           mv -f "$nlist"T "$nlist"
+           wcout=`wc "$nlist" 2>/dev/null`
+           count=`echo "X$wcout" | $Xsed -e 's/^[      ]*\([0-9][0-9]*\).*$/\1/'`
+           (test "$count" -ge 0) 2>/dev/null || count=-1
+         else
+           $rm "$nlist"T
+           count=-1
+         fi
+
+         case "$dlsyms" in
+         "") ;;
+         *.c)
+           $echo > "$objdir/$dlsyms" "\
+/* $dlsyms - symbol resolution table for \`$output' dlsym emulation. */
+/* Generated by $PROGRAM - GNU $PACKAGE $VERSION */
+
+#ifdef __cplusplus
+extern \"C\" {
+#endif
+
+/* Prevent the only kind of declaration conflicts we can make. */
+#define dld_preloaded_symbol_count some_other_symbol
+#define dld_preloaded_symbols some_other_symbol
+
+/* External symbol declarations for the compiler. */\
+"
+
+           if test -f "$nlist"; then
+             sed -e 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> "$objdir/$dlsyms"
+           else
+             echo '/* NONE */' >> "$objdir/$dlsyms"
+           fi
+
+           $echo >> "$objdir/$dlsyms" "\
+
+#undef dld_preloaded_symbol_count
+#undef dld_preloaded_symbols
+
+#if defined (__STDC__) && __STDC__
+# define __ptr_t void *
+#else
+# define __ptr_t char *
+#endif
+
+/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */
+int dld_preloaded_symbol_count = $count;
+
+/* The mapping between symbol names and symbols. */
+struct {
+  char *name;
+  __ptr_t address;
+}
+dld_preloaded_symbols[] =
+{\
+"
+
+           if test -f "$nlist"; then
+             sed 's/^\(.*\) \(.*\)$/  {"\1", (__ptr_t) \&\2},/' < "$nlist" >> "$objdir/$dlsyms"
+           fi
+
+           $echo >> "$objdir/$dlsyms" "\
+  {0, (__ptr_t) 0}
+};
+
+#ifdef __cplusplus
+}
+#endif\
+"
+           ;;
+
+         *)
+           $echo "$modename: unknown suffix for \`$dlsyms'" 1>&2
+           exit 1
+           ;;
+         esac
+        fi
+
+        # Now compile the dynamic symbol file.
+        $show "(cd $objdir && $CC -c$no_builtin_flag \"$dlsyms\")"
+        $run eval '(cd $objdir && $CC -c$no_builtin_flag "$dlsyms")' || exit $?
+
+        # Transform the symbol file into the correct name.
+        compile_command=`$echo "X$compile_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"`
+        finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"`
+      elif test "$export_dynamic" != yes; then
+        test -n "$dlfiles$dlprefiles" && $echo "$modename: warning: \`-dlopen' and \`-dlpreopen' are ignored without \`-export-dynamic'" 1>&2
+      else
+        # We keep going just in case the user didn't refer to
+        # dld_preloaded_symbols.  The linker will fail if global_symbol_pipe
+        # really was required.
+        $echo "$modename: not configured to extract global symbols from dlpreopened files" 1>&2
+
+        # Nullify the symbol file.
+        compile_command=`$echo "X$compile_command" | $Xsed -e "s% @SYMFILE@%%"`
+        finalize_command=`$echo "X$finalize_command" | $Xsed -e "s% @SYMFILE@%%"`
+      fi
+
+      if test -z "$link_against_libtool_libs" || test "$build_libtool_libs" != yes; then
+        # Replace the output file specification.
+        compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'`
+        finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'`
+
+        # We have no uninstalled library dependencies, so finalize right now.
+        $show "$compile_command"
+        $run eval "$compile_command"
+        exit $?
+      fi
+
+      # Replace the output file specification.
+      compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'%g'`
+      finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'T%g'`
+
+      # Create the binary in the object directory, then wrap it.
+      if test ! -d $objdir; then
+        $show "$mkdir $objdir"
+       $run $mkdir $objdir
+       status=$?
+       if test $status -ne 0 && test ! -d $objdir; then
+         exit $status
+       fi
+      fi
+
+      if test -n "$shlibpath_var"; then
+        # We should set the shlibpath_var
+        rpath=
+        for dir in $temp_rpath; do
+          case "$dir" in
+          /* | [A-Za-z]:[/\\]*)
+            # Absolute path.
+            rpath="$rpath$dir:"
+            ;;
+          *)
+            # Relative path: add a thisdir entry.
+            rpath="$rpath\$thisdir/$dir:"
+            ;;
+          esac
+        done
+        temp_rpath="$rpath"
+      fi
+
+      # Delete the old output file.
+      $run $rm $output
+
+      if test -n "$compile_shlibpath"; then
+        compile_command="$shlibpath_var=\"$compile_shlibpath\$$shlibpath_var\" $compile_command"
+      fi
+      if test -n "$finalize_shlibpath"; then
+        finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command"
+      fi
+
+      if test -n "$runpath_var" && test -n "$perm_rpath"; then
+        # We should set the runpath_var.
+        rpath=
+        for dir in $perm_rpath; do
+          rpath="$rpath$dir:"
+        done
+        compile_command="$runpath_var=\"$rpath\$$runpath_var\" $compile_command"
+        finalize_command="$runpath_var=\"$rpath\$$runpath_var\" $finalize_command"
+      fi
+
+      if test "$hardcode_action" = relink; then
+        # AGH! Flame the AIX and HP-UX people for me, will ya?
+        $echo "$modename: warning: using a buggy system linker" 1>&2
+        $echo "$modename: relinking will be required before \`$output' can be installed" 1>&2
+      fi
+
+      $show "$compile_command"
+      $run eval "$compile_command" || exit $?
+
+      # Now create the wrapper script.
+      $show "creating $output"
+
+      # Quote the finalize command for shipping.
+      finalize_command=`$echo "X$finalize_command" | $Xsed -e "$sed_quote_subst"`
+
+      # Quote $echo for shipping.
+      qecho=`$echo "X$echo" | $Xsed -e "$sed_quote_subst"`
+
+      # Only actually do things if our run command is non-null.
+      if test -z "$run"; then
+        $rm $output
+        trap "$rm $output; exit 1" 1 2 15
+
+        $echo > $output "\
+#! $SHELL
+
+# $output - temporary wrapper script for $objdir/$output
+# Generated by $PROGRAM - GNU $PACKAGE $VERSION
+#
+# The $output program cannot be directly executed until all the libtool
+# libraries that it depends on are installed.
+#
+# This wrapper script should never be moved out of \``pwd`'.
+# If it is, it will not operate correctly.
+
+# Sed substitution that helps us do robust quoting.  It backslashifies
+# metacharacters that are still active within double-quoted strings.
+Xsed='sed -e s/^X//'
+sed_quote_subst='$sed_quote_subst'
+
+# The HP-UX ksh and POSIX shell print the target directory to stdout
+# if CDPATH is set.
+if test \"\${CDPATH+set}\" = set; then CDPATH=; export CDPATH; fi
+
+# This environment variable determines our operation mode.
+if test \"\$libtool_install_magic\" = \"$magic\"; then
+  # install mode needs the following variables:
+  link_against_libtool_libs='$link_against_libtool_libs'
+  finalize_command=\"$finalize_command\"
+else
+  # When we are sourced in execute mode, \$file and \$echo are already set.
+  if test \"\$libtool_execute_magic\" != \"$magic\"; then
+    echo=\"$qecho\"
+    file=\"\$0\"
+    # Make sure echo works.
+    if test \"X\$1\" = X--no-reexec; then
+      # Discard the --no-reexec flag, and continue.
+      shift
+    elif test \"X\`(\$echo '\t') 2>/dev/null\`\" = 'X\t'; then
+      # Yippee, \$echo works!
+      :
+    else
+      # Restart under the correct shell, and then maybe \$echo will work.
+      exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"}
+    fi
+  fi\
+"
+        $echo >> $output "\
+
+  # Find the directory that this script lives in.
+  thisdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\`
+  test \"x\$thisdir\" = \"x\$file\" && thisdir=.
+
+  # Follow symbolic links until we get to the real thisdir.
+  file=\`ls -ld \"\$file\" | sed -n 's/.*-> //p'\`
+  while test -n \"\$file\"; do
+    destdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\`
+
+    # If there was a directory component, then change thisdir.
+    if test \"x\$destdir\" != \"x\$file\"; then
+      case \"\$destdir\" in
+      /* | [A-Za-z]:[/\\]*) thisdir=\"\$destdir\" ;;
+      *) thisdir=\"\$thisdir/\$destdir\" ;;
+      esac
+    fi
+
+    file=\`\$echo \"X\$file\" | \$Xsed -e 's%^.*/%%'\`
+    file=\`ls -ld \"\$thisdir/\$file\" | sed -n 's/.*-> //p'\`
+  done
+
+  # Try to get the absolute directory name.
+  absdir=\`cd \"\$thisdir\" && pwd\`
+  test -n \"\$absdir\" && thisdir=\"\$absdir\"
+
+  progdir=\"\$thisdir/$objdir\"
+  program='$output'
+
+  if test -f \"\$progdir/\$program\"; then"
+
+        # Export our shlibpath_var if we have one.
+        if test -n "$shlibpath_var" && test -n "$temp_rpath"; then
+          $echo >> $output "\
+    # Add our own library path to $shlibpath_var
+    $shlibpath_var=\"$temp_rpath\$$shlibpath_var\"
+
+    # Some systems cannot cope with colon-terminated $shlibpath_var
+    $shlibpath_var=\`\$echo \"X\$$shlibpath_var\" | \$Xsed -e 's/:*\$//'\`
+
+    export $shlibpath_var
+"
+        fi
+
+        $echo >> $output "\
+    if test \"\$libtool_execute_magic\" != \"$magic\"; then
+      # Run the actual program with our arguments.
+
+      # Export the path to the program.
+      PATH=\"\$progdir:\$PATH\"
+      export PATH
+
+      exec \$program \${1+\"\$@\"}
+
+      \$echo \"\$0: cannot exec \$program \${1+\"\$@\"}\"
+      exit 1
+    fi
+  else
+    # The program doesn't exist.
+    \$echo \"\$0: error: \$progdir/\$program does not exist\" 1>&2
+    \$echo \"This script is just a wrapper for \$program.\" 1>&2
+    echo \"See the $PACKAGE documentation for more information.\" 1>&2
+    exit 1
+  fi
+fi\
+"
+        chmod +x $output
+      fi
+      exit 0
+      ;;
+    esac
+
+    # See if we need to build an old-fashioned archive.
+    for oldlib in $oldlibs; do
+
+      if test "$build_libtool_libs" = convenience; then
+       oldobjs="$libobjs"
+       addlibs="$convenience"
+       build_libtool_libs=no
+      else
+       addlibs="$old_convenience"
+      fi
+
+      # Add in members from convenience archives.
+      for xlib in $addlibs; do
+       # Extract the objects.
+       xdir="$xlib"x
+       generated="$generated $xdir"
+       xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'`
+
+       $show "${rm}r $xdir"
+       $run ${rm}r "$xdir"
+       $show "mkdir $xdir"
+       $run mkdir "$xdir"
+       status=$?
+       if test $status -ne 0 && test ! -d "$xdir"; then
+         exit $status
+       fi
+       $show "(cd $xdir && $AR x ../$xlib)"
+       $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $?
+
+       oldobjs="$oldobjs `echo $xdir/*`"
+      done
+
+      # Do each command in the archive commands.
+      if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then
+       eval cmds=\"$old_archive_from_new_cmds\"
+      else
+       eval cmds=\"$old_archive_cmds\"
+      fi
+      IFS="${IFS=      }"; save_ifs="$IFS"; IFS=';'
+      for cmd in $cmds; do
+        IFS="$save_ifs"
+        $show "$cmd"
+        $run eval "$cmd" || exit $?
+      done
+      IFS="$save_ifs"
+    done
+
+    if test -n "$generated"; then
+      $show "${rm}r$generated"
+      $run ${rm}r$generated
+    fi
+
+    # Now create the libtool archive.
+    case "$output" in
+    *.la)
+      old_library=
+      test "$build_old_libs" = yes && old_library="$libname.a"
+      $show "creating $output"
+
+      # Only create the output if not a dry run.
+      if test -z "$run"; then
+        $echo > $output "\
+# $output - a libtool library file
+# Generated by $PROGRAM - GNU $PACKAGE $VERSION
+
+# The name that we can dlopen(3).
+dlname='$dlname'
+
+# Names of this library.
+library_names='$library_names'
+
+# The name of the static archive.
+old_library='$old_library'
+
+# Libraries that this one depends upon.
+dependency_libs='$dependency_libs'
+
+# Version information for $libname.
+current=$current
+age=$age
+revision=$revision
+
+# Directory that this library needs to be installed in:
+libdir='$install_libdir'\
+"
+      fi
+
+      # Do a symbolic link so that the libtool archive can be found in
+      # LD_LIBRARY_PATH before the program is installed.
+      $show "(cd $objdir && $LN_S ../$output $output)"
+      $run eval "(cd $objdir && $LN_S ../$output $output)" || exit $?
+      ;;
+    esac
+    exit 0
+    ;;
+
+  # libtool install mode
+  install)
+    modename="$modename: install"
+
+    # There may be an optional sh(1) argument at the beginning of
+    # install_prog (especially on Windows NT).
+    if test "$nonopt" = "$SHELL"; then
+      # Aesthetically quote it.
+      arg=`$echo "X$nonopt" | $Xsed -e "$sed_quote_subst"`
+      case "$arg" in
+      *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \    ]*|*]*)
+       arg="\"$arg\""
+       ;;
+      esac
+      install_prog="$arg "
+      arg="$1"
+      shift
+    else
+      install_prog=
+      arg="$nonopt"
+    fi
+
+    # The real first argument should be the name of the installation program.
+    # Aesthetically quote it.
+    arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+    case "$arg" in
+    *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \      ]*|*]*)
+      arg="\"$arg\""
+      ;;
+    esac
+    install_prog="$install_prog$arg"
+
+    # We need to accept at least all the BSD install flags.
+    dest=
+    files=
+    opts=
+    prev=
+    install_type=
+    isdir=no
+    stripme=
+    for arg
+    do
+      if test -n "$dest"; then
+        files="$files $dest"
+        dest="$arg"
+        continue
+      fi
+
+      case "$arg" in
+      -d) isdir=yes ;;
+      -f) prev="-f" ;;
+      -g) prev="-g" ;;
+      -m) prev="-m" ;;
+      -o) prev="-o" ;;
+      -s)
+        stripme=" -s"
+        continue
+        ;;
+      -*) ;;
+
+      *)
+        # If the previous option needed an argument, then skip it.
+        if test -n "$prev"; then
+          prev=
+        else
+          dest="$arg"
+          continue
+        fi
+        ;;
+      esac
+
+      # Aesthetically quote the argument.
+      arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"`
+      case "$arg" in
+      *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \    ]*|*]*)
+       arg="\"$arg\""
+       ;;
+      esac
+      install_prog="$install_prog $arg"
+    done
+
+    if test -z "$install_prog"; then
+      $echo "$modename: you must specify an install program" 1>&2
+      $echo "$help" 1>&2
+      exit 1
+    fi
+
+    if test -n "$prev"; then
+      $echo "$modename: the \`$prev' option requires an argument" 1>&2
+      $echo "$help" 1>&2
+      exit 1
+    fi
+
+    if test -z "$files"; then
+      if test -z "$dest"; then
+        $echo "$modename: no file or destination specified" 1>&2
+      else
+        $echo "$modename: you must specify a destination" 1>&2
+      fi
+      $echo "$help" 1>&2
+      exit 1
+    fi
+
+    # Strip any trailing slash from the destination.
+    dest=`$echo "X$dest" | $Xsed -e 's%/$%%'`
+
+    # Check to see that the destination is a directory.
+    test -d "$dest" && isdir=yes
+    if test "$isdir" = yes; then
+      destdir="$dest"
+      destname=
+    else
+      destdir=`$echo "X$dest" | $Xsed -e 's%/[^/]*$%%'`
+      test "X$destdir" = "X$dest" && destdir=.
+      destname=`$echo "X$dest" | $Xsed -e 's%^.*/%%'`
+
+      # Not a directory, so check to see that there is only one file specified.
+      set dummy $files
+      if test $# -gt 2; then
+        $echo "$modename: \`$dest' is not a directory" 1>&2
+        $echo "$help" 1>&2
+        exit 1
+      fi
+    fi
+    case "$destdir" in
+    /* | [A-Za-z]:[/\\]*) ;;
+    *)
+      for file in $files; do
+        case "$file" in
+        *.lo) ;;
+        *)
+          $echo "$modename: \`$destdir' must be an absolute directory name" 1>&2
+          $echo "$help" 1>&2
+          exit 1
+          ;;
+        esac
+      done
+      ;;
+    esac
+
+    # This variable tells wrapper scripts just to set variables rather
+    # than running their programs.
+    libtool_install_magic="$magic"
+
+    staticlibs=
+    future_libdirs=
+    current_libdirs=
+    for file in $files; do
+
+      # Do each installation.
+      case "$file" in
+      *.a)
+        # Do the static libraries later.
+        staticlibs="$staticlibs $file"
+        ;;
+
+      *.la)
+        # Check to see that this really is a libtool archive.
+        if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+        else
+          $echo "$modename: \`$file' is not a valid libtool archive" 1>&2
+          $echo "$help" 1>&2
+          exit 1
+        fi
+
+        library_names=
+        old_library=
+        # If there is no directory component, then add one.
+        case "$file" in
+        */* | *\\*) . $file ;;
+        *) . ./$file ;;
+        esac
+
+        # Add the libdir to current_libdirs if it is the destination.
+        if test "X$destdir" = "X$libdir"; then
+          case "$current_libdirs " in
+          *" $libdir "*) ;;
+          *) current_libdirs="$current_libdirs $libdir" ;;
+          esac
+        else
+          # Note the libdir as a future libdir.
+          case "$future_libdirs " in
+          *" $libdir "*) ;;
+          *) future_libdirs="$future_libdirs $libdir" ;;
+          esac
+        fi
+
+        dir="`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`/"
+        test "X$dir" = "X$file/" && dir=
+        dir="$dir$objdir"
+
+        # See the names of the shared library.
+        set dummy $library_names
+        if test -n "$2"; then
+          realname="$2"
+          shift
+          shift
+
+          # Install the shared library and build the symlinks.
+          $show "$install_prog $dir/$realname $destdir/$realname"
+          $run eval "$install_prog $dir/$realname $destdir/$realname" || exit $?
+          test "X$dlname" = "X$realname" && dlname=
+
+          if test $# -gt 0; then
+            # Delete the old symlinks.
+            rmcmd="$rm"
+            for linkname
+            do
+              rmcmd="$rmcmd $destdir/$linkname"
+            done
+            $show "$rmcmd"
+            $run $rmcmd
+
+            # ... and create new ones.
+            for linkname
+            do
+              test "X$dlname" = "X$linkname" && dlname=
+              $show "(cd $destdir && $LN_S $realname $linkname)"
+              $run eval "(cd $destdir && $LN_S $realname $linkname)"
+            done
+          fi
+
+          if test -n "$dlname"; then
+            # Install the dynamically-loadable library.
+            $show "$install_prog $dir/$dlname $destdir/$dlname"
+            $run eval "$install_prog $dir/$dlname $destdir/$dlname" || exit $?
+          fi
+
+          # Do each command in the postinstall commands.
+          lib="$destdir/$realname"
+          eval cmds=\"$postinstall_cmds\"
+          IFS="${IFS=  }"; save_ifs="$IFS"; IFS=';'
+          for cmd in $cmds; do
+            IFS="$save_ifs"
+            $show "$cmd"
+            $run eval "$cmd" || exit $?
+          done
+          IFS="$save_ifs"
+        fi
+
+        # Install the pseudo-library for information purposes.
+        name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+        $show "$install_prog $file $destdir/$name"
+        $run eval "$install_prog $file $destdir/$name" || exit $?
+
+        # Maybe install the static library, too.
+        test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library"
+        ;;
+
+      *.lo)
+        # Install (i.e. copy) a libtool object.
+
+        # Figure out destination file name, if it wasn't already specified.
+        if test -n "$destname"; then
+          destfile="$destdir/$destname"
+        else
+          destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+          destfile="$destdir/$destfile"
+        fi
+
+        # Deduce the name of the destination old-style object file.
+        case "$destfile" in
+        *.lo)
+          staticdest=`$echo "X$destfile" | $Xsed -e 's/\.lo$/.o/'`
+          ;;
+        *.o)
+          staticdest="$destfile"
+          destfile=
+          ;;
+        *)
+          $echo "$modename: cannot copy a libtool object to \`$destfile'" 1>&2
+          $echo "$help" 1>&2
+          exit 1
+          ;;
+        esac
+
+        # Install the libtool object if requested.
+        if test -n "$destfile"; then
+          $show "$install_prog $file $destfile"
+          $run eval "$install_prog $file $destfile" || exit $?
+        fi
+
+        # Install the old object if enabled.
+        if test "$build_old_libs" = yes; then
+          # Deduce the name of the old-style object file.
+          staticobj=`$echo "X$file" | $Xsed -e 's/\.lo$/.o/'`
+
+          $show "$install_prog $staticobj $staticdest"
+          $run eval "$install_prog \$staticobj \$staticdest" || exit $?
+        fi
+        exit 0
+        ;;
+
+      *)
+        # Figure out destination file name, if it wasn't already specified.
+        if test -n "$destname"; then
+          destfile="$destdir/$destname"
+        else
+          destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+          destfile="$destdir/$destfile"
+        fi
+
+        # Do a test to see if this is really a libtool program.
+        if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+          link_against_libtool_libs=
+          finalize_command=
+
+          # If there is no directory component, then add one.
+          case "$file" in
+          */* | *\\*) . $file ;;
+          *) . ./$file ;;
+          esac
+
+          # Check the variables that should have been set.
+          if test -z "$link_against_libtool_libs" || test -z "$finalize_command"; then
+            $echo "$modename: invalid libtool wrapper script \`$file'" 1>&2
+            exit 1
+          fi
+
+          finalize=yes
+          for lib in $link_against_libtool_libs; do
+            # Check to see that each library is installed.
+            libdir=
+            if test -f "$lib"; then
+              # If there is no directory component, then add one.
+              case "$lib" in
+              */* | *\\*) . $lib ;;
+              *) . ./$lib ;;
+              esac
+            fi
+            libfile="$libdir/`$echo "X$lib" | $Xsed -e 's%^.*/%%g'`"
+            if test -n "$libdir" && test ! -f "$libfile"; then
+              $echo "$modename: warning: \`$lib' has not been installed in \`$libdir'" 1>&2
+              finalize=no
+            fi
+          done
+
+          if test "$hardcode_action" = relink; then
+            if test "$finalize" = yes; then
+              $echo "$modename: warning: relinking \`$file' on behalf of your buggy system linker" 1>&2
+              $show "$finalize_command"
+              if $run eval "$finalize_command"; then :
+              else
+                $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2
+                continue
+              fi
+              file="$objdir/$file"T
+            else
+              $echo "$modename: warning: cannot relink \`$file' on behalf of your buggy system linker" 1>&2
+            fi
+          else
+            # Install the binary that we compiled earlier.
+           file=`$echo "X$file" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"`
+          fi
+        fi
+
+        $show "$install_prog$stripme $file $destfile"
+        $run eval "$install_prog\$stripme \$file \$destfile" || exit $?
+        ;;
+      esac
+    done
+
+    for file in $staticlibs; do
+      name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+
+      # Set up the ranlib parameters.
+      oldlib="$destdir/$name"
+
+      $show "$install_prog $file $oldlib"
+      $run eval "$install_prog \$file \$oldlib" || exit $?
+
+      # Do each command in the postinstall commands.
+      eval cmds=\"$old_postinstall_cmds\"
+      IFS="${IFS=      }"; save_ifs="$IFS"; IFS=';'
+      for cmd in $cmds; do
+        IFS="$save_ifs"
+        $show "$cmd"
+        $run eval "$cmd" || exit $?
+      done
+      IFS="$save_ifs"
+    done
+
+    if test -n "$future_libdirs"; then
+      $echo "$modename: warning: remember to run \`$progname --finish$future_libdirs'" 1>&2
+    fi
+
+    if test -n "$current_libdirs"; then
+      # Maybe just do a dry run.
+      test -n "$run" && current_libdirs=" -n$current_libdirs"
+      exec $SHELL $0 --finish$current_libdirs
+      exit 1
+    fi
+
+    exit 0
+    ;;
+
+  # libtool finish mode
+  finish)
+    modename="$modename: finish"
+    libdirs="$nonopt"
+    admincmds=
+
+    if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then
+      for dir
+      do
+        libdirs="$libdirs $dir"
+      done
+
+      for libdir in $libdirs; do
+       if test -n "$finish_cmds"; then
+         # Do each command in the finish commands.
+         eval cmds=\"$finish_cmds\"
+          IFS="${IFS=  }"; save_ifs="$IFS"; IFS=';'
+          for cmd in $cmds; do
+            IFS="$save_ifs"
+            $show "$cmd"
+            $run eval "$cmd" || admincmds="$admincmds
+       $cmd"
+          done
+          IFS="$save_ifs"
+       fi
+       if test -n "$finish_eval"; then
+         # Do the single finish_eval.
+         eval cmds=\"$finish_eval\"
+         $run eval "$cmds" || admincmds="$admincmds
+       $cmds"
+       fi
+      done
+    fi
+
+    echo "----------------------------------------------------------------------"
+    echo "Libraries have been installed in:"
+    for libdir in $libdirs; do
+      echo "   $libdir"
+    done
+    echo
+    echo "To link against installed libraries in a given directory, LIBDIR,"
+    echo "you must use the \`-LLIBDIR' flag during linking."
+    echo
+    echo " You will also need to do at least one of the following:"
+    if test -n "$shlibpath_var"; then
+      echo "   - add LIBDIR to the \`$shlibpath_var' environment variable"
+      echo "     during execution"
+    fi
+    if test -n "$runpath_var"; then
+      echo "   - add LIBDIR to the \`$runpath_var' environment variable"
+      echo "     during linking"
+    fi
+    if test -n "$hardcode_libdir_flag_spec"; then
+      libdir=LIBDIR
+      eval flag=\"$hardcode_libdir_flag_spec\"
+
+      echo "   - use the \`$flag' linker flag"
+    fi
+    if test -n "$admincmds"; then
+      echo "   - have your system administrator run these commands:$admincmds"
+    fi
+    if test -f /etc/ld.so.conf; then
+      echo "   - have your system administrator add LIBDIR to \`/etc/ld.so.conf'"
+    fi
+    echo
+    echo "See any operating system documentation about shared libraries for"
+    echo "more information, such as the ld(1) and ld.so(8) manual pages."
+    echo "----------------------------------------------------------------------"
+    exit 0
+    ;;
+
+  # libtool execute mode
+  execute)
+    modename="$modename: execute"
+
+    # The first argument is the command name.
+    cmd="$nonopt"
+    if test -z "$cmd"; then
+      $echo "$modename: you must specify a COMMAND" 1>&2
+      $echo "$help"
+      exit 1
+    fi
+
+    # Handle -dlopen flags immediately.
+    for file in $execute_dlfiles; do
+      if test ! -f "$file"; then
+       $echo "$modename: \`$file' is not a file" 1>&2
+       $echo "$help" 1>&2
+       exit 1
+      fi
+
+      dir=
+      case "$file" in
+      *.la)
+        # Check to see that this really is a libtool archive.
+        if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then :
+        else
+          $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2
+          $echo "$help" 1>&2
+          exit 1
+        fi
+
+       # Read the libtool library.
+       dlname=
+       library_names=
+
+        # If there is no directory component, then add one.
+       case "$file" in
+       */* | *\\*) . $file ;;
+        *) . ./$file ;;
+       esac
+
+       # Skip this library if it cannot be dlopened.
+       if test -z "$dlname"; then
+         # Warn if it was a shared library.
+         test -n "$library_names" && $echo "$modename: warning: \`$file' was not linked with \`-export-dynamic'"
+         continue
+       fi
+
+       dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+       test "X$dir" = "X$file" && dir=.
+
+       if test -f "$dir/$objdir/$dlname"; then
+         dir="$dir/$objdir"
+       else
+         $echo "$modename: cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'" 1>&2
+         exit 1
+       fi
+       ;;
+
+      *.lo)
+       # Just add the directory containing the .lo file.
+       dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+       test "X$dir" = "X$file" && dir=.
+       ;;
+
+      *)
+       $echo "$modename: warning \`-dlopen' is ignored for non-libtool libraries and objects" 1>&2
+        continue
+       ;;
+      esac
+
+      # Get the absolute pathname.
+      absdir=`cd "$dir" && pwd`
+      test -n "$absdir" && dir="$absdir"
+
+      # Now add the directory to shlibpath_var.
+      if eval "test -z \"\$$shlibpath_var\""; then
+       eval "$shlibpath_var=\"\$dir\""
+      else
+       eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\""
+      fi
+    done
+
+    # This variable tells wrapper scripts just to set shlibpath_var
+    # rather than running their programs.
+    libtool_execute_magic="$magic"
+
+    # Check if any of the arguments is a wrapper script.
+    args=
+    for file
+    do
+      case "$file" in
+      -*) ;;
+      *)
+        # Do a test to see if this is really a libtool program.
+        if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+         # If there is no directory component, then add one.
+         case "$file" in
+         */* | *\\*) . $file ;;
+         *) . ./$file ;;
+         esac
+
+         # Transform arg to wrapped name.
+         file="$progdir/$program"
+       fi
+        ;;
+      esac
+      # Quote arguments (to preserve shell metacharacters).
+      file=`$echo "X$file" | $Xsed -e "$sed_quote_subst"`
+      args="$args \"$file\""
+    done
+
+    if test -z "$run"; then
+      # Export the shlibpath_var.
+      eval "export $shlibpath_var"
+
+      # Restore saved enviroment variables
+      if test "${save_LC_ALL+set}" = set; then
+        LC_ALL="$save_LC_ALL"; export LC_ALL
+      fi
+      if test "${save_LANG+set}" = set; then
+        LANG="$save_LANG"; export LANG
+      fi
+
+      # Now actually exec the command.
+      eval "exec \$cmd$args"
+
+      $echo "$modename: cannot exec \$cmd$args"
+      exit 1
+    else
+      # Display what would be done.
+      eval "\$echo \"\$shlibpath_var=\$$shlibpath_var\""
+      $echo "export $shlibpath_var"
+      $echo "$cmd$args"
+      exit 0
+    fi
+    ;;
+
+  # libtool uninstall mode
+  uninstall)
+    modename="$modename: uninstall"
+    rm="$nonopt"
+    files=
+
+    for arg
+    do
+      case "$arg" in
+      -*) rm="$rm $arg" ;;
+      *) files="$files $arg" ;;
+      esac
+    done
+
+    if test -z "$rm"; then
+      $echo "$modename: you must specify an RM program" 1>&2
+      $echo "$help" 1>&2
+      exit 1
+    fi
+
+    for file in $files; do
+      dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`
+      test "X$dir" = "X$file" && dir=.
+      name=`$echo "X$file" | $Xsed -e 's%^.*/%%'`
+
+      rmfiles="$file"
+
+      case "$name" in
+      *.la)
+        # Possibly a libtool archive, so verify it.
+        if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then
+          . $dir/$name
+
+          # Delete the libtool libraries and symlinks.
+          for n in $library_names; do
+            rmfiles="$rmfiles $dir/$n"
+            test "X$n" = "X$dlname" && dlname=
+          done
+          test -n "$dlname" && rmfiles="$rmfiles $dir/$dlname"
+          test -n "$old_library" && rmfiles="$rmfiles $dir/$old_library"
+
+         $show "$rm $rmfiles"
+         $run $rm $rmfiles
+
+         if test -n "$library_names"; then
+           # Do each command in the postuninstall commands.
+           eval cmds=\"$postuninstall_cmds\"
+           IFS="${IFS=         }"; save_ifs="$IFS"; IFS=';'
+           for cmd in $cmds; do
+             IFS="$save_ifs"
+             $show "$cmd"
+             $run eval "$cmd"
+           done
+           IFS="$save_ifs"
+         fi
+
+          if test -n "$old_library"; then
+           # Do each command in the old_postuninstall commands.
+           eval cmds=\"$old_postuninstall_cmds\"
+           IFS="${IFS=         }"; save_ifs="$IFS"; IFS=';'
+           for cmd in $cmds; do
+             IFS="$save_ifs"
+             $show "$cmd"
+             $run eval "$cmd"
+           done
+           IFS="$save_ifs"
+         fi
+
+          # FIXME: should reinstall the best remaining shared library.
+        fi
+        ;;
+
+      *.lo)
+        if test "$build_old_libs" = yes; then
+          oldobj=`$echo "X$name" | $Xsed -e 's/\.lo$/.o/'`
+          rmfiles="$rmfiles $dir/$oldobj"
+        fi
+       $show "$rm $rmfiles"
+       $run $rm $rmfiles
+        ;;
+
+      *)
+       $show "$rm $rmfiles"
+       $run $rm $rmfiles
+       ;;
+      esac
+    done
+    exit 0
+    ;;
+
+  "")
+    $echo "$modename: you must specify a MODE" 1>&2
+    $echo "$generic_help" 1>&2
+    exit 1
+    ;;
+  esac
+
+  $echo "$modename: invalid operation mode \`$mode'" 1>&2
+  $echo "$generic_help" 1>&2
+  exit 1
+fi # test -z "$show_help"
+
+# We need to display help for each of the modes.
+case "$mode" in
+"") $echo \
+"Usage: $modename [OPTION]... [MODE-ARG]...
+
+Provide generalized library-building support services.
+
+    --config          show all configuration variables
+    --debug           enable verbose shell tracing
+-n, --dry-run         display commands without modifying any files
+    --features        display basic configuration information and exit
+    --finish          same as \`--mode=finish'
+    --help            display this help message and exit
+    --mode=MODE       use operation mode MODE [default=inferred from MODE-ARGS]
+    --quiet           same as \`--silent'
+    --silent          don't print informational messages
+    --version         print version information
+
+MODE must be one of the following:
+
+      compile         compile a source file into a libtool object
+      execute         automatically set library path, then run a program
+      finish          complete the installation of libtool libraries
+      install         install libraries or executables
+      link            create a library or an executable
+      uninstall       remove libraries from an installed directory
+
+MODE-ARGS vary depending on the MODE.  Try \`$modename --help --mode=MODE' for
+a more detailed description of MODE."
+  exit 0
+  ;;
+
+compile)
+  $echo \
+"Usage: $modename [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE
+
+Compile a source file into a libtool library object.
+
+This mode accepts the following additional options:
+
+  -static           always build a \`.o' file suitable for static linking
+
+COMPILE-COMMAND is a command to be used in creating a \`standard' object file
+from the given SOURCEFILE.
+
+The output file name is determined by removing the directory component from
+SOURCEFILE, then substituting the C source code suffix \`.c' with the
+library object suffix, \`.lo'."
+  ;;
+
+execute)
+  $echo \
+"Usage: $modename [OPTION]... --mode=execute COMMAND [ARGS]...
+
+Automatically set library path, then run a program.
+
+This mode accepts the following additional options:
+
+  -dlopen FILE      add the directory containing FILE to the library path
+
+This mode sets the library path environment variable according to \`-dlopen'
+flags.
+
+If any of the ARGS are libtool executable wrappers, then they are translated
+into their corresponding uninstalled binary, and any of their required library
+directories are added to the library path.
+
+Then, COMMAND is executed, with ARGS as arguments."
+  ;;
+
+finish)
+  $echo \
+"Usage: $modename [OPTION]... --mode=finish [LIBDIR]...
+
+Complete the installation of libtool libraries.
+
+Each LIBDIR is a directory that contains libtool libraries.
+
+The commands that this mode executes may require superuser privileges.  Use
+the \`--dry-run' option if you just want to see what would be executed."
+  ;;
+
+install)
+  $echo \
+"Usage: $modename [OPTION]... --mode=install INSTALL-COMMAND...
+
+Install executables or libraries.
+
+INSTALL-COMMAND is the installation command.  The first component should be
+either the \`install' or \`cp' program.
+
+The rest of the components are interpreted as arguments to that command (only
+BSD-compatible install options are recognized)."
+  ;;
+
+link)
+  $echo \
+"Usage: $modename [OPTION]... --mode=link LINK-COMMAND...
+
+Link object files or libraries together to form another library, or to
+create an executable program.
+
+LINK-COMMAND is a command using the C compiler that you would use to create
+a program from several object files.
+
+The following components of LINK-COMMAND are treated specially:
+
+  -all-static       do not do any dynamic linking at all
+  -dlopen FILE      \`-dlpreopen' FILE if it cannot be dlopened at runtime
+  -dlpreopen FILE   link in FILE and add its symbols to dld_preloaded_symbols
+  -export-dynamic   allow symbols from OUTPUT-FILE to be resolved with dlsym(3)
+  -LLIBDIR          search LIBDIR for required installed libraries
+  -lNAME            OUTPUT-FILE requires the installed library libNAME
+  -no-undefined     declare that a library does not refer to external symbols
+  -o OUTPUT-FILE    create OUTPUT-FILE from the specified objects
+  -release RELEASE  specify package release information
+  -rpath LIBDIR     the created library will eventually be installed in LIBDIR
+  -static           do not do any dynamic linking of libtool libraries
+  -version-info CURRENT[:REVISION[:AGE]]
+                    specify library version info [each variable defaults to 0]
+
+All other options (arguments beginning with \`-') are ignored.
+
+Every other argument is treated as a filename.  Files ending in \`.la' are
+treated as uninstalled libtool libraries, other files are standard or library
+object files.
+
+If the OUTPUT-FILE ends in \`.la', then a libtool library is created, only
+library objects (\`.lo' files) may be specified, and \`-rpath' is required.
+
+If OUTPUT-FILE ends in \`.a', then a standard library is created using \`ar'
+and \`ranlib'.
+
+If OUTPUT-FILE ends in \`.lo' or \`.o', then a reloadable object file is
+created, otherwise an executable program is created."
+  ;;
+
+uninstall)
+  $echo
+"Usage: $modename [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE...
+
+Remove libraries from an installation directory.
+
+RM is the name of the program to use to delete files associated with each FILE
+(typically \`/bin/rm').  RM-OPTIONS are options (such as \`-f') to be passed
+to RM.
+
+If FILE is a libtool library, all the files associated with it are deleted.
+Otherwise, only FILE itself is deleted using RM."
+  ;;
+
+*)
+  $echo "$modename: invalid operation mode \`$mode'" 1>&2
+  $echo "$help" 1>&2
+  exit 1
+  ;;
+esac
+
+echo
+$echo "Try \`$modename --help' for more information about other modes."
+
+exit 0
+
+# Local Variables:
+# mode:shell-script
+# sh-indentation:2
+# End:
diff --git a/missing b/missing
new file mode 100644 (file)
index 0000000..cbe2b0e
--- /dev/null
+++ b/missing
@@ -0,0 +1,188 @@
+#! /bin/sh
+# Common stub for a few missing GNU programs while installing.
+# Copyright (C) 1996, 1997 Free Software Foundation, Inc.
+# Franc,ois Pinard <pinard@iro.umontreal.ca>, 1996.
+
+# This program is free software; you can redistribute it and/or modify
+# it under the terms of the GNU General Public License as published by
+# the Free Software Foundation; either version 2, or (at your option)
+# any later version.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA
+# 02111-1307, USA.
+
+if test $# -eq 0; then
+  echo 1>&2 "Try \`$0 --help' for more information"
+  exit 1
+fi
+
+case "$1" in
+
+  -h|--h|--he|--hel|--help)
+    echo "\
+$0 [OPTION]... PROGRAM [ARGUMENT]...
+
+Handle \`PROGRAM [ARGUMENT]...' for when PROGRAM is missing, or return an
+error status if there is no known handling for PROGRAM.
+
+Options:
+  -h, --help      display this help and exit
+  -v, --version   output version information and exit
+
+Supported PROGRAM values:
+  aclocal      touch file \`aclocal.m4'
+  autoconf     touch file \`configure'
+  autoheader   touch file \`config.h.in'
+  automake     touch all \`Makefile.in' files
+  bison        create \`y.tab.[ch]', if possible, from existing .[ch]
+  flex         create \`lex.yy.c', if possible, from existing .c
+  lex          create \`lex.yy.c', if possible, from existing .c
+  makeinfo     touch the output file
+  yacc         create \`y.tab.[ch]', if possible, from existing .[ch]"
+    ;;
+
+  -v|--v|--ve|--ver|--vers|--versi|--versio|--version)
+    echo "missing - GNU libit 0.0"
+    ;;
+
+  -*)
+    echo 1>&2 "$0: Unknown \`$1' option"
+    echo 1>&2 "Try \`$0 --help' for more information"
+    exit 1
+    ;;
+
+  aclocal)
+    echo 1>&2 "\
+WARNING: \`$1' is missing on your system.  You should only need it if
+         you modified \`acinclude.m4' or \`configure.in'.  You might want
+         to install the \`Automake' and \`Perl' packages.  Grab them from
+         any GNU archive site."
+    touch aclocal.m4
+    ;;
+
+  autoconf)
+    echo 1>&2 "\
+WARNING: \`$1' is missing on your system.  You should only need it if
+         you modified \`configure.in'.  You might want to install the
+         \`Autoconf' and \`GNU m4' packages.  Grab them from any GNU
+         archive site."
+    touch configure
+    ;;
+
+  autoheader)
+    echo 1>&2 "\
+WARNING: \`$1' is missing on your system.  You should only need it if
+         you modified \`acconfig.h' or \`configure.in'.  You might want
+         to install the \`Autoconf' and \`GNU m4' packages.  Grab them
+         from any GNU archive site."
+    files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER([^):]*:\([^)]*\)).*/\1/p' configure.in`
+    if test -z "$files"; then
+      files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER(\([^):]*\)).*/\1/p' configure.in`
+      test -z "$files" || files="$files.in"
+    else
+      files=`echo "$files" | sed -e 's/:/ /g'`
+    fi
+    test -z "$files" && files="config.h.in"
+    touch $files
+    ;;
+
+  automake)
+    echo 1>&2 "\
+WARNING: \`$1' is missing on your system.  You should only need it if
+         you modified \`Makefile.am', \`acinclude.m4' or \`configure.in'.
+         You might want to install the \`Automake' and \`Perl' packages.
+         Grab them from any GNU archive site."
+    find . -type f -name Makefile.am -print \
+      | sed 's/^\(.*\).am$/touch \1.in/' \
+      | sh
+    ;;
+
+  bison|yacc)
+    echo 1>&2 "\
+WARNING: \`$1' is missing on your system.  You should only need it if
+         you modified a \`.y' file.  You may need the \`Bison' package
+         in order for those modifications to take effect.  You can get
+         \`Bison' from any GNU archive site."
+    rm -f y.tab.c y.tab.h
+    if [ $# -ne 1 ]; then
+        eval LASTARG="\${$#}"
+       case "$LASTARG" in
+       *.y)
+           SRCFILE=`echo "$LASTARG" | sed 's/y$/c/'`
+           if [ -f "$SRCFILE" ]; then
+                cp "$SRCFILE" y.tab.c
+           fi
+           SRCFILE=`echo "$LASTARG" | sed 's/y$/h/'`
+           if [ -f "$SRCFILE" ]; then
+                cp "$SRCFILE" y.tab.h
+           fi
+         ;;
+       esac
+    fi
+    if [ ! -f y.tab.h ]; then
+       echo >y.tab.h
+    fi
+    if [ ! -f y.tab.c ]; then
+       echo 'main() { return 0; }' >y.tab.c
+    fi
+    ;;
+
+  lex|flex)
+    echo 1>&2 "\
+WARNING: \`$1' is missing on your system.  You should only need it if
+         you modified a \`.l' file.  You may need the \`Flex' package
+         in order for those modifications to take effect.  You can get
+         \`Flex' from any GNU archive site."
+    rm -f lex.yy.c
+    if [ $# -ne 1 ]; then
+        eval LASTARG="\${$#}"
+       case "$LASTARG" in
+       *.l)
+           SRCFILE=`echo "$LASTARG" | sed 's/l$/c/'`
+           if [ -f "$SRCFILE" ]; then
+                cp "$SRCFILE" lex.yy.c
+           fi
+         ;;
+       esac
+    fi
+    if [ ! -f lex.yy.c ]; then
+       echo 'main() { return 0; }' >lex.yy.c
+    fi
+    ;;
+
+  makeinfo)
+    echo 1>&2 "\
+WARNING: \`$1' is missing on your system.  You should only need it if
+         you modified a \`.texi' or \`.texinfo' file, or any other file
+         indirectly affecting the aspect of the manual.  The spurious
+         call might also be the consequence of using a buggy \`make' (AIX,
+         DU, IRIX).  You might want to install the \`Texinfo' package or
+         the \`GNU make' package.  Grab either from any GNU archive site."
+    file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'`
+    if test -z "$file"; then
+      file=`echo "$*" | sed 's/.* \([^ ]*\) *$/\1/'`
+      file=`sed -n '/^@setfilename/ { s/.* \([^ ]*\) *$/\1/; p; q; }' $file`
+    fi
+    touch $file
+    ;;
+
+  *)
+    echo 1>&2 "\
+WARNING: \`$1' is needed, and you do not seem to have it handy on your
+         system.  You might have modified some files without having the
+         proper tools for further handling them.  Check the \`README' file,
+         it often tells you about the needed prerequirements for installing
+         this package.  You may also peek at any GNU archive site, in case
+         some other package would contain this missing \`$1' program."
+    exit 1
+    ;;
+esac
+
+exit 0
diff --git a/mkinstalldirs b/mkinstalldirs
new file mode 100644 (file)
index 0000000..a719d6a
--- /dev/null
@@ -0,0 +1,40 @@
+#! /bin/sh
+# mkinstalldirs --- make directory hierarchy
+# Author: Noah Friedman <friedman@prep.ai.mit.edu>
+# Created: 1993-05-16
+# Public domain
+
+# $Id: mkinstalldirs,v 1.1 1998/11/18 20:42:13 chris Exp $
+
+errstatus=0
+
+for file
+do
+   set fnord `echo ":$file" | sed -ne 's/^:\//#/;s/^://;s/\// /g;s/^#/\//;p'`
+   shift
+
+   pathcomp=
+   for d
+   do
+     pathcomp="$pathcomp$d"
+     case "$pathcomp" in
+       -* ) pathcomp=./$pathcomp ;;
+     esac
+
+     if test ! -d "$pathcomp"; then
+        echo "mkdir $pathcomp" 1>&2
+
+        mkdir "$pathcomp" || lasterr=$?
+
+        if test ! -d "$pathcomp"; then
+         errstatus=$lasterr
+        fi
+     fi
+
+     pathcomp="$pathcomp/"
+   done
+done
+
+exit $errstatus
+
+# mkinstalldirs ends here
diff --git a/src/Makefile b/src/Makefile
deleted file mode 100644 (file)
index 42740fe..0000000
+++ /dev/null
@@ -1,82 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../Makefile.conf
-
-TARGET=../lib/libasound.a
-STARGET=../lib/libasound.so
-STARGETX=../lib/libasound.so.$(SND_LIB_VERSION)
-STARGETO=../lib/libasound.so.$(SND_LIB_MAJOR)
-TARGETS=$(TARGET) $(STARGET)
-
-STATIC_LIBS=   control/libcontrol.a \
-               mixer/libmixer.a \
-               pcm/libpcm.a \
-               rawmidi/librawmidi.a
-DYNAMIC_LIBS=  control/libcontrol.Sa \
-               mixer/libmixer.Sa \
-               pcm/libpcm.Sa \
-               rawmidi/librawmidi.Sa
-
-OBJECTS=error.o
-SOBJECTS=error.So
-
-.SUFFIXES:
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
-       $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
-       $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)
-
-$(TARGET): .depend $(OBJECTS) $(STATIC_LIBS)
-       rm -f ../lib/libasound.a
-       $(LINKER) -r -o $(TARGET) $(STATIC_LIBS) $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS) $(DYNAMIC_LIBS)
-       rm -f ../lib/libasound*.so*
-       $(CC) -shared -Wl,-soname,libasound.so.$(SND_LIB_MAJOR) $(DYNAMIC_LIBS) $(SOBJECTS) -o $(STARGETX)
-       ln -s libasound.so.$(SND_LIB_VERSION) $(STARGET)
-       ln -s libasound.so.$(SND_LIB_VERSION) $(STARGETO)
-
-control/libcontrol.a:
-       $(MAKE) -C control
-control/libcontrol.sa:
-       $(MAKE) -C control
-
-mixer/libmixer.a:
-       $(MAKE) -C mixer
-mixer/libmixer.sa:
-       $(MAKE) -C mixer
-
-pcm/libpcm.a:
-       $(MAKE) -C pcm
-pcm/libpcm.sa:
-       $(MAKE) -C pcm
-
-rawmidi/librawmidi.a:
-       $(MAKE) -C rawmidi
-rawmidi/librawmidi.sa:
-       $(MAKE) -C rawmidi
-
-clean:
-       $(MAKE) -C control clean
-       $(MAKE) -C pcm clean
-       $(MAKE) -C mixer clean
-       $(MAKE) -C rawmidi clean
-       rm -f core .depend *.o *.So *.orig *~
-       rm -f ../lib/libasound.*
-
-.depend:
-       $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
diff --git a/src/Makefile.am b/src/Makefile.am
new file mode 100644 (file)
index 0000000..9e1c1ca
--- /dev/null
@@ -0,0 +1,22 @@
+SUBDIRS=control mixer pcm rawmidi
+
+lib_LTLIBRARIES = libasound.la
+libasound_la_SOURCES = error.c 
+libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \
+                      rawmidi/librawmidi.la
+
+control/libcontrol.la:
+       $(MAKE) -C control libcontrol.la
+
+mixer/libmixer.la:
+       $(MAKE) -C mixer libmixer.la
+
+pcm/libpcm.la:
+       $(MAKE) -C pcm libpcm.la
+
+rawmidi/librawmidi.la:
+       $(MAKE) -C rawmidi librawmidi.la
+
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/src/Makefile.in b/src/Makefile.in
new file mode 100644 (file)
index 0000000..064b432
--- /dev/null
@@ -0,0 +1,369 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+SUBDIRS=control mixer pcm rawmidi
+
+lib_LTLIBRARIES = libasound.la
+libasound_la_SOURCES = error.c 
+libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \
+                      rawmidi/librawmidi.la
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES = 
+LTLIBRARIES =  $(lib_LTLIBRARIES)
+
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libasound_la_LDFLAGS = 
+libasound_la_DEPENDENCIES =  control/libcontrol.la mixer/libmixer.la \
+pcm/libpcm.la rawmidi/librawmidi.la
+libasound_la_OBJECTS =  error.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON =  Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libasound_la_SOURCES)
+OBJECTS = $(libasound_la_OBJECTS)
+
+all: all-recursive all-am
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+mostlyclean-libLTLIBRARIES:
+
+clean-libLTLIBRARIES:
+       -test -z "$(lib_LTLIBRARIES)" || rm -f $(lib_LTLIBRARIES)
+
+distclean-libLTLIBRARIES:
+
+maintainer-clean-libLTLIBRARIES:
+
+install-libLTLIBRARIES: $(lib_LTLIBRARIES)
+       @$(NORMAL_INSTALL)
+       $(mkinstalldirs) $(DESTDIR)$(libdir)
+       @list='$(lib_LTLIBRARIES)'; for p in $$list; do \
+         if test -f $$p; then \
+           echo "$(LIBTOOL)  --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p"; \
+           $(LIBTOOL)  --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p; \
+         else :; fi; \
+       done
+
+uninstall-libLTLIBRARIES:
+       @$(NORMAL_UNINSTALL)
+       list='$(lib_LTLIBRARIES)'; for p in $$list; do \
+         $(LIBTOOL)  --mode=uninstall rm -f $(DESTDIR)$(libdir)/$$p; \
+       done
+
+.c.o:
+       $(COMPILE) -c $<
+
+.s.o:
+       $(COMPILE) -c $<
+
+.S.o:
+       $(COMPILE) -c $<
+
+mostlyclean-compile:
+       -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+       -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+       -rm -f *.lo
+
+clean-libtool:
+       -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libasound.la: $(libasound_la_OBJECTS) $(libasound_la_DEPENDENCIES)
+       $(LINK) -rpath $(libdir) $(libasound_la_LDFLAGS) $(libasound_la_OBJECTS) $(libasound_la_LIBADD) $(LIBS)
+
+# This directory's subdirectories are mostly independent; you can cd
+# into them and run `make' without going through this Makefile.
+# To change the values of `make' variables: instead of editing Makefiles,
+# (1) if the variable is set in `config.status', edit `config.status'
+#     (which will cause the Makefiles to be regenerated when you run `make');
+# (2) otherwise, pass the desired values on the `make' command line.
+
+@SET_MAKE@
+
+all-recursive install-data-recursive install-exec-recursive \
+installdirs-recursive install-recursive uninstall-recursive  \
+check-recursive installcheck-recursive info-recursive dvi-recursive:
+       @set fnord $(MAKEFLAGS); amf=$$2; \
+       list='$(SUBDIRS)'; for subdir in $$list; do \
+         target=`echo $@ | sed s/-recursive//`; \
+         echo "Making $$target in $$subdir"; \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+          || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+       done && test -z "$$fail"
+
+mostlyclean-recursive clean-recursive distclean-recursive \
+maintainer-clean-recursive:
+       @set fnord $(MAKEFLAGS); amf=$$2; \
+       rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \
+         rev="$$subdir $$rev"; \
+       done; \
+       for subdir in $$rev; do \
+         target=`echo $@ | sed s/-recursive//`; \
+         echo "Making $$target in $$subdir"; \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \
+          || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \
+       done && test -z "$$fail"
+tags-recursive:
+       list='$(SUBDIRS)'; for subdir in $$list; do \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \
+       done
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS: tags-recursive $(HEADERS) $(SOURCES)  $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SUBDIRS)'; for subdir in $$list; do \
+         test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \
+       done; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags  $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+       for subdir in $(SUBDIRS); do \
+         test -d $(distdir)/$$subdir \
+         || mkdir $(distdir)/$$subdir \
+         || exit 1; \
+         chmod 777 $(distdir)/$$subdir; \
+         (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(top_distdir) distdir=../$(distdir)/$$subdir distdir) \
+           || exit 1; \
+       done
+info: info-recursive
+dvi: dvi-recursive
+check: all-am
+       $(MAKE) $(AM_MAKEFLAGS) check-recursive
+installcheck: installcheck-recursive
+all-am: Makefile $(LTLIBRARIES)
+
+install-exec-am: install-libLTLIBRARIES
+
+uninstall-am: uninstall-libLTLIBRARIES
+
+install-exec: install-exec-recursive install-exec-am
+       @$(NORMAL_INSTALL)
+
+install-data: install-data-recursive
+       @$(NORMAL_INSTALL)
+
+install: install-recursive install-exec-am
+       @:
+
+uninstall: uninstall-recursive uninstall-am
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs: installdirs-recursive
+       $(mkinstalldirs)  $(DESTDIR)$(libdir)
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean-am:  mostlyclean-libLTLIBRARIES mostlyclean-compile \
+               mostlyclean-libtool mostlyclean-tags \
+               mostlyclean-generic
+
+clean-am:  clean-libLTLIBRARIES clean-compile clean-libtool clean-tags \
+               clean-generic mostlyclean-am
+
+distclean-am:  distclean-libLTLIBRARIES distclean-compile \
+               distclean-libtool distclean-tags distclean-generic \
+               clean-am
+
+maintainer-clean-am:  maintainer-clean-libLTLIBRARIES \
+               maintainer-clean-compile maintainer-clean-libtool \
+               maintainer-clean-tags maintainer-clean-generic \
+               distclean-am
+
+mostlyclean:  mostlyclean-recursive mostlyclean-am
+
+clean:  clean-recursive clean-am
+
+distclean:  distclean-recursive distclean-am
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-recursive maintainer-clean-am
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-libLTLIBRARIES distclean-libLTLIBRARIES \
+clean-libLTLIBRARIES maintainer-clean-libLTLIBRARIES \
+uninstall-libLTLIBRARIES install-libLTLIBRARIES mostlyclean-compile \
+distclean-compile clean-compile maintainer-clean-compile \
+mostlyclean-libtool distclean-libtool clean-libtool \
+maintainer-clean-libtool install-data-recursive \
+uninstall-data-recursive install-exec-recursive \
+uninstall-exec-recursive installdirs-recursive uninstalldirs-recursive \
+all-recursive check-recursive installcheck-recursive info-recursive \
+dvi-recursive mostlyclean-recursive distclean-recursive clean-recursive \
+maintainer-clean-recursive tags tags-recursive mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck all-am install-exec-am uninstall-am install-exec \
+install-data install uninstall all installdirs mostlyclean-generic \
+distclean-generic clean-generic maintainer-clean-generic clean \
+mostlyclean distclean maintainer-clean
+
+
+control/libcontrol.la:
+       $(MAKE) -C control libcontrol.la
+
+mixer/libmixer.la:
+       $(MAKE) -C mixer libmixer.la
+
+pcm/libpcm.la:
+       $(MAKE) -C pcm libpcm.la
+
+rawmidi/librawmidi.la:
+       $(MAKE) -C rawmidi librawmidi.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/src/control/Makefile b/src/control/Makefile
deleted file mode 100644 (file)
index 38a47f1..0000000
+++ /dev/null
@@ -1,42 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=libcontrol.a
-STARGET=libcontrol.Sa
-OBJECTS=cards.o control.o
-SOBJECTS=cards.So control.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES:
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
-       $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
-       $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-
-all: $(TARGETS)        
-
-$(TARGET): .depend $(OBJECTS)
-       $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
-       $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
-       rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
-       $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
diff --git a/src/control/Makefile.am b/src/control/Makefile.am
new file mode 100644 (file)
index 0000000..5390f27
--- /dev/null
@@ -0,0 +1,8 @@
+EXTRA_LTLIBRARIES = libcontrol.la
+
+libcontrol_la_SOURCES = cards.c control.c
+
+all: libcontrol.la
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/src/control/Makefile.in b/src/control/Makefile.in
new file mode 100644 (file)
index 0000000..f49957e
--- /dev/null
@@ -0,0 +1,251 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES = libcontrol.la
+
+libcontrol_la_SOURCES = cards.c control.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES = 
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libcontrol_la_LDFLAGS = 
+libcontrol_la_LIBADD = 
+libcontrol_la_OBJECTS =  cards.lo control.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON =  Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libcontrol_la_SOURCES)
+OBJECTS = $(libcontrol_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/control/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+       $(COMPILE) -c $<
+
+.s.o:
+       $(COMPILE) -c $<
+
+.S.o:
+       $(COMPILE) -c $<
+
+mostlyclean-compile:
+       -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+       -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+       -rm -f *.lo
+
+clean-libtool:
+       -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libcontrol.la: $(libcontrol_la_OBJECTS) $(libcontrol_la_DEPENDENCIES)
+       $(LINK)  $(libcontrol_la_LDFLAGS) $(libcontrol_la_OBJECTS) $(libcontrol_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS:  $(HEADERS) $(SOURCES)  $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags  $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/control
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: 
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: 
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+               mostlyclean-generic
+
+clean:  clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean:  distclean-compile distclean-libtool distclean-tags \
+               distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-compile maintainer-clean-libtool \
+               maintainer-clean-tags maintainer-clean-generic \
+               distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+all: libcontrol.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/src/mixer/Makefile b/src/mixer/Makefile
deleted file mode 100644 (file)
index 6d60adb..0000000
+++ /dev/null
@@ -1,41 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=libmixer.a
-STARGET=libmixer.Sa
-OBJECTS=mixer.o
-SOBJECTS=mixer.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES:
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
-       $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
-       $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)        
-
-$(TARGET): .depend $(OBJECTS)
-       $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
-       $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
-       rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
-       $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
diff --git a/src/mixer/Makefile.am b/src/mixer/Makefile.am
new file mode 100644 (file)
index 0000000..1350aba
--- /dev/null
@@ -0,0 +1,8 @@
+EXTRA_LTLIBRARIES=libmixer.la
+
+libmixer_la_SOURCES = mixer.c
+
+all: libmixer.la
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/src/mixer/Makefile.in b/src/mixer/Makefile.in
new file mode 100644 (file)
index 0000000..1e92268
--- /dev/null
@@ -0,0 +1,251 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES=libmixer.la
+
+libmixer_la_SOURCES = mixer.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES = 
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libmixer_la_LDFLAGS = 
+libmixer_la_LIBADD = 
+libmixer_la_OBJECTS =  mixer.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON =  Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libmixer_la_SOURCES)
+OBJECTS = $(libmixer_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/mixer/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+       $(COMPILE) -c $<
+
+.s.o:
+       $(COMPILE) -c $<
+
+.S.o:
+       $(COMPILE) -c $<
+
+mostlyclean-compile:
+       -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+       -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+       -rm -f *.lo
+
+clean-libtool:
+       -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libmixer.la: $(libmixer_la_OBJECTS) $(libmixer_la_DEPENDENCIES)
+       $(LINK)  $(libmixer_la_LDFLAGS) $(libmixer_la_OBJECTS) $(libmixer_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS:  $(HEADERS) $(SOURCES)  $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags  $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/mixer
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: 
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: 
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+               mostlyclean-generic
+
+clean:  clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean:  distclean-compile distclean-libtool distclean-tags \
+               distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-compile maintainer-clean-libtool \
+               maintainer-clean-tags maintainer-clean-generic \
+               distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+all: libmixer.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/src/pcm/Makefile b/src/pcm/Makefile
deleted file mode 100644 (file)
index 8bc28fb..0000000
+++ /dev/null
@@ -1,40 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=libpcm.a
-STARGET=libpcm.Sa
-OBJECTS=pcm.o pcm_loopback.o
-SOBJECTS=pcm.So pcm_loopback.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
-       $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
-       $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)        
-
-$(TARGET): .depend $(OBJECTS)
-       $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
-       $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
-       rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
-       $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
diff --git a/src/pcm/Makefile.am b/src/pcm/Makefile.am
new file mode 100644 (file)
index 0000000..2f08022
--- /dev/null
@@ -0,0 +1,7 @@
+EXTRA_LTLIBRARIES=libpcm.la
+
+libpcm_la_SOURCES = pcm.c
+all: libpcm.la
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/src/pcm/Makefile.in b/src/pcm/Makefile.in
new file mode 100644 (file)
index 0000000..901ac57
--- /dev/null
@@ -0,0 +1,250 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES=libpcm.la
+
+libpcm_la_SOURCES = pcm.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES = 
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+libpcm_la_LDFLAGS = 
+libpcm_la_LIBADD = 
+libpcm_la_OBJECTS =  pcm.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON =  Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(libpcm_la_SOURCES)
+OBJECTS = $(libpcm_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/pcm/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+       $(COMPILE) -c $<
+
+.s.o:
+       $(COMPILE) -c $<
+
+.S.o:
+       $(COMPILE) -c $<
+
+mostlyclean-compile:
+       -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+       -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+       -rm -f *.lo
+
+clean-libtool:
+       -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+libpcm.la: $(libpcm_la_OBJECTS) $(libpcm_la_DEPENDENCIES)
+       $(LINK)  $(libpcm_la_LDFLAGS) $(libpcm_la_OBJECTS) $(libpcm_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS:  $(HEADERS) $(SOURCES)  $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags  $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/pcm
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: 
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: 
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+               mostlyclean-generic
+
+clean:  clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean:  distclean-compile distclean-libtool distclean-tags \
+               distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-compile maintainer-clean-libtool \
+               maintainer-clean-tags maintainer-clean-generic \
+               distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+all: libpcm.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/src/rawmidi/Makefile b/src/rawmidi/Makefile
deleted file mode 100644 (file)
index c675bf4..0000000
+++ /dev/null
@@ -1,40 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../../Makefile.conf
-
-TARGET=librawmidi.a
-STARGET=librawmidi.Sa
-OBJECTS=rawmidi.o
-SOBJECTS=rawmidi.So
-TARGETS=$(TARGET) $(STARGET)
-
-.SUFFIXES: .c .s .S .o .So .a .Sa
-
-.c.o:
-       $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $<
-.c.So:
-       $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $<
-
-all: $(TARGETS)        
-
-$(TARGET): .depend $(OBJECTS)
-       $(LINKER) -r -o $@ $(OBJECTS)
-
-$(STARGET): .depend $(SOBJECTS)
-       $(LINKER) -r -o $@ $(SOBJECTS)
-
-clean:
-       rm -f core .depend *.o *.So *.a *.Sa *.orig *~
-
-.depend:
-       $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend
-
-#
-# include a dependency file if one exists
-#
-ifeq (.depend,$(wildcard .depend))
-include .depend
-endif
diff --git a/src/rawmidi/Makefile.am b/src/rawmidi/Makefile.am
new file mode 100644 (file)
index 0000000..1abeadd
--- /dev/null
@@ -0,0 +1,7 @@
+EXTRA_LTLIBRARIES=librawmidi.la
+
+librawmidi_la_SOURCES = rawmidi.c
+all: librawmidi.la
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/src/rawmidi/Makefile.in b/src/rawmidi/Makefile.in
new file mode 100644 (file)
index 0000000..b9c1b6e
--- /dev/null
@@ -0,0 +1,250 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ../..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+EXTRA_LTLIBRARIES=librawmidi.la
+
+librawmidi_la_SOURCES = rawmidi.c
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../../include/config.h
+CONFIG_CLEAN_FILES = 
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+librawmidi_la_LDFLAGS = 
+librawmidi_la_LIBADD = 
+librawmidi_la_OBJECTS =  rawmidi.lo
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON =  Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = $(librawmidi_la_SOURCES)
+OBJECTS = $(librawmidi_la_OBJECTS)
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/rawmidi/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+.c.o:
+       $(COMPILE) -c $<
+
+.s.o:
+       $(COMPILE) -c $<
+
+.S.o:
+       $(COMPILE) -c $<
+
+mostlyclean-compile:
+       -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+       -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+       -rm -f *.lo
+
+clean-libtool:
+       -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+librawmidi.la: $(librawmidi_la_OBJECTS) $(librawmidi_la_DEPENDENCIES)
+       $(LINK)  $(librawmidi_la_LDFLAGS) $(librawmidi_la_OBJECTS) $(librawmidi_la_LIBADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS:  $(HEADERS) $(SOURCES)  $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags  $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = src/rawmidi
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: 
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: 
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-compile mostlyclean-libtool mostlyclean-tags \
+               mostlyclean-generic
+
+clean:  clean-compile clean-libtool clean-tags clean-generic mostlyclean
+
+distclean:  distclean-compile distclean-libtool distclean-tags \
+               distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-compile maintainer-clean-libtool \
+               maintainer-clean-tags maintainer-clean-generic \
+               distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-compile distclean-compile clean-compile \
+maintainer-clean-compile mostlyclean-libtool distclean-libtool \
+clean-libtool maintainer-clean-libtool tags mostlyclean-tags \
+distclean-tags clean-tags maintainer-clean-tags distdir info dvi \
+installcheck install-exec install-data install uninstall all \
+installdirs mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+all: librawmidi.la
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/test/Makefile b/test/Makefile
deleted file mode 100644 (file)
index 5ea0893..0000000
+++ /dev/null
@@ -1,24 +0,0 @@
-CC             = gcc
-CFLAGS = -static -O2 -g -Wall -pipe
-TARGETS = control mixer switches pause pcm
-LIB    = -L../lib -lasound
-
-all: $(TARGETS)
-
-control: control.c
-       $(CC) $(CFLAGS) $(LIB) -o control control.c
-
-mixer: mixer.c
-       $(CC) $(CFLAGS) $(LIB) -o mixer mixer.c
-
-switches: switches.c
-       $(CC) $(CFLAGS) $(LIB) -o switches switches.c
-
-pause: pause.c
-       $(CC) $(CFLAGS) $(LIB) -o pause pause.c
-
-pcm: pcm.c
-       $(CC) $(CFLAGS) $(LIB) -o pcm pcm.c
-
-clean:
-       rm -f *.o $(TARGETS) *~
diff --git a/test/Makefile.am b/test/Makefile.am
new file mode 100644 (file)
index 0000000..d3e5d6e
--- /dev/null
@@ -0,0 +1,10 @@
+check_PROGRAMS=control mixer switches pause pcm
+
+control_LDADD=../src/libasound.la
+mixer_LDADD=../src/libasound.la
+switches_LDADD=../src/libasound.la
+pause_LDADD=../src/libasound.la
+pcm_LDADD=../src/libasound.la
+
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/test/Makefile.in b/test/Makefile.in
new file mode 100644 (file)
index 0000000..46acd88
--- /dev/null
@@ -0,0 +1,301 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+check_PROGRAMS=control mixer switches pause pcm
+
+control_LDADD=../src/libasound.la
+mixer_LDADD=../src/libasound.la
+switches_LDADD=../src/libasound.la
+pause_LDADD=../src/libasound.la
+pcm_LDADD=../src/libasound.la
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES = 
+
+DEFS = @DEFS@ -I. -I$(srcdir) -I../include
+CPPFLAGS = @CPPFLAGS@
+LDFLAGS = @LDFLAGS@
+LIBS = @LIBS@
+control_SOURCES = control.c
+control_OBJECTS =  control.o
+control_DEPENDENCIES =  ../src/libasound.la
+control_LDFLAGS = 
+mixer_SOURCES = mixer.c
+mixer_OBJECTS =  mixer.o
+mixer_DEPENDENCIES =  ../src/libasound.la
+mixer_LDFLAGS = 
+switches_SOURCES = switches.c
+switches_OBJECTS =  switches.o
+switches_DEPENDENCIES =  ../src/libasound.la
+switches_LDFLAGS = 
+pause_SOURCES = pause.c
+pause_OBJECTS =  pause.o
+pause_DEPENDENCIES =  ../src/libasound.la
+pause_LDFLAGS = 
+pcm_SOURCES = pcm.c
+pcm_OBJECTS =  pcm.o
+pcm_DEPENDENCIES =  ../src/libasound.la
+pcm_LDFLAGS = 
+CFLAGS = @CFLAGS@
+COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS)
+LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@
+DIST_COMMON =  Makefile.am Makefile.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+SOURCES = control.c mixer.c switches.c pause.c pcm.c
+OBJECTS = control.o mixer.o switches.o pause.o pcm.o
+
+all: Makefile
+
+.SUFFIXES:
+.SUFFIXES: .S .c .lo .o .s
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps test/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+
+mostlyclean-checkPROGRAMS:
+
+clean-checkPROGRAMS:
+       -test -z "$(check_PROGRAMS)" || rm -f $(check_PROGRAMS)
+
+distclean-checkPROGRAMS:
+
+maintainer-clean-checkPROGRAMS:
+
+.c.o:
+       $(COMPILE) -c $<
+
+.s.o:
+       $(COMPILE) -c $<
+
+.S.o:
+       $(COMPILE) -c $<
+
+mostlyclean-compile:
+       -rm -f *.o core *.core
+
+clean-compile:
+
+distclean-compile:
+       -rm -f *.tab.c
+
+maintainer-clean-compile:
+
+.c.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.s.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+.S.lo:
+       $(LIBTOOL) --mode=compile $(COMPILE) -c $<
+
+mostlyclean-libtool:
+       -rm -f *.lo
+
+clean-libtool:
+       -rm -rf .libs _libs
+
+distclean-libtool:
+
+maintainer-clean-libtool:
+
+control: $(control_OBJECTS) $(control_DEPENDENCIES)
+       @rm -f control
+       $(LINK) $(control_LDFLAGS) $(control_OBJECTS) $(control_LDADD) $(LIBS)
+
+mixer: $(mixer_OBJECTS) $(mixer_DEPENDENCIES)
+       @rm -f mixer
+       $(LINK) $(mixer_LDFLAGS) $(mixer_OBJECTS) $(mixer_LDADD) $(LIBS)
+
+switches: $(switches_OBJECTS) $(switches_DEPENDENCIES)
+       @rm -f switches
+       $(LINK) $(switches_LDFLAGS) $(switches_OBJECTS) $(switches_LDADD) $(LIBS)
+
+pause: $(pause_OBJECTS) $(pause_DEPENDENCIES)
+       @rm -f pause
+       $(LINK) $(pause_LDFLAGS) $(pause_OBJECTS) $(pause_LDADD) $(LIBS)
+
+pcm: $(pcm_OBJECTS) $(pcm_DEPENDENCIES)
+       @rm -f pcm
+       $(LINK) $(pcm_LDFLAGS) $(pcm_OBJECTS) $(pcm_LDADD) $(LIBS)
+
+tags: TAGS
+
+ID: $(HEADERS) $(SOURCES) $(LISP)
+       here=`pwd` && cd $(srcdir) \
+         && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP)
+
+TAGS:  $(HEADERS) $(SOURCES)  $(TAGS_DEPENDENCIES) $(LISP)
+       tags=; \
+       here=`pwd`; \
+       list='$(SOURCES) $(HEADERS)'; \
+       unique=`for i in $$list; do echo $$i; done | \
+         awk '    { files[$$0] = 1; } \
+              END { for (i in files) print i; }'`; \
+       test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \
+         || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags  $$unique $(LISP) -o $$here/TAGS)
+
+mostlyclean-tags:
+
+clean-tags:
+
+distclean-tags:
+       -rm -f TAGS ID
+
+maintainer-clean-tags:
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = test
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all $(check_PROGRAMS)
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: 
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: 
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-checkPROGRAMS mostlyclean-compile \
+               mostlyclean-libtool mostlyclean-tags \
+               mostlyclean-generic
+
+clean:  clean-checkPROGRAMS clean-compile clean-libtool clean-tags \
+               clean-generic mostlyclean
+
+distclean:  distclean-checkPROGRAMS distclean-compile distclean-libtool \
+               distclean-tags distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-checkPROGRAMS \
+               maintainer-clean-compile maintainer-clean-libtool \
+               maintainer-clean-tags maintainer-clean-generic \
+               distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: mostlyclean-checkPROGRAMS distclean-checkPROGRAMS \
+clean-checkPROGRAMS maintainer-clean-checkPROGRAMS mostlyclean-compile \
+distclean-compile clean-compile maintainer-clean-compile \
+mostlyclean-libtool distclean-libtool clean-libtool \
+maintainer-clean-libtool tags mostlyclean-tags distclean-tags \
+clean-tags maintainer-clean-tags distdir info dvi installcheck \
+install-exec install-data install uninstall all installdirs \
+mostlyclean-generic distclean-generic clean-generic \
+maintainer-clean-generic clean mostlyclean distclean maintainer-clean
+
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
diff --git a/utils/Makefile b/utils/Makefile
deleted file mode 100644 (file)
index d9e9765..0000000
+++ /dev/null
@@ -1,10 +0,0 @@
-#
-# Makefile for ALSA library
-# Copyright (c) 1994-98 by Jaroslav Kysela <perex@jcu.cz>
-#
-
-include ../Makefile.conf
-
-clean:
-       rm -f core .depend *.o *.orig *~
-
diff --git a/utils/Makefile.am b/utils/Makefile.am
new file mode 100644 (file)
index 0000000..de05268
--- /dev/null
@@ -0,0 +1,4 @@
+rpm: buildrpm alsa-lib.spec
+       VERSION=$(VERSION) $(srcdir)/buildrpm
+
+INCLUDES=-I$(top_srcdir)/include
diff --git a/utils/Makefile.in b/utils/Makefile.in
new file mode 100644 (file)
index 0000000..f6a6b79
--- /dev/null
@@ -0,0 +1,164 @@
+# Makefile.in generated automatically by automake 1.3b from Makefile.am
+
+# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc.
+# This Makefile.in is free software; the Free Software Foundation
+# gives unlimited permission to copy and/or distribute it,
+# with or without modifications, as long as this notice is preserved.
+
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY, to the extent permitted by law; without
+# even the implied warranty of MERCHANTABILITY or FITNESS FOR A
+# PARTICULAR PURPOSE.
+
+
+SHELL = /bin/sh
+
+srcdir = @srcdir@
+top_srcdir = @top_srcdir@
+VPATH = @srcdir@
+prefix = @prefix@
+exec_prefix = @exec_prefix@
+
+bindir = @bindir@
+sbindir = @sbindir@
+libexecdir = @libexecdir@
+datadir = @datadir@
+sysconfdir = @sysconfdir@
+sharedstatedir = @sharedstatedir@
+localstatedir = @localstatedir@
+libdir = @libdir@
+infodir = @infodir@
+mandir = @mandir@
+includedir = @includedir@
+oldincludedir = /usr/include
+
+DESTDIR =
+
+pkgdatadir = $(datadir)/@PACKAGE@
+pkglibdir = $(libdir)/@PACKAGE@
+pkgincludedir = $(includedir)/@PACKAGE@
+
+top_builddir = ..
+
+ACLOCAL = @ACLOCAL@
+AUTOCONF = @AUTOCONF@
+AUTOMAKE = @AUTOMAKE@
+AUTOHEADER = @AUTOHEADER@
+
+INSTALL = @INSTALL@
+INSTALL_PROGRAM = @INSTALL_PROGRAM@
+INSTALL_DATA = @INSTALL_DATA@
+INSTALL_SCRIPT = @INSTALL_SCRIPT@
+transform = @program_transform_name@
+
+NORMAL_INSTALL = :
+PRE_INSTALL = :
+POST_INSTALL = :
+NORMAL_UNINSTALL = :
+PRE_UNINSTALL = :
+POST_UNINSTALL = :
+host_alias = @host_alias@
+host_triplet = @host@
+ALSA_CFLAGS = @ALSA_CFLAGS@
+ALSA_LIBS = @ALSA_LIBS@
+CC = @CC@
+LD = @LD@
+LIBTOOL = @LIBTOOL@
+LN_S = @LN_S@
+MAKEINFO = @MAKEINFO@
+NM = @NM@
+PACKAGE = @PACKAGE@
+RANLIB = @RANLIB@
+VERSION = @VERSION@
+
+INCLUDES=-I$(top_srcdir)/include
+mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs
+CONFIG_HEADER = ../include/config.h
+CONFIG_CLEAN_FILES =  alsa-lib.spec
+DIST_COMMON =  Makefile.am Makefile.in alsa-lib.spec.in
+
+
+DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST)
+
+TAR = tar
+GZIP = --best
+all: Makefile
+
+.SUFFIXES:
+$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4)
+       cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps utils/Makefile
+
+Makefile: $(srcdir)/Makefile.in  $(top_builddir)/config.status
+       cd $(top_builddir) \
+         && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+
+alsa-lib.spec: $(top_builddir)/config.status alsa-lib.spec.in
+       cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status
+tags: TAGS
+TAGS:
+
+
+distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir)
+
+subdir = utils
+
+distdir: $(DISTFILES)
+       @for file in $(DISTFILES); do \
+         d=$(srcdir); \
+         test -f $(distdir)/$$file \
+         || ln $$d/$$file $(distdir)/$$file 2> /dev/null \
+         || cp -p $$d/$$file $(distdir)/$$file; \
+       done
+info:
+dvi:
+check: all
+installcheck:
+install-exec: 
+       @$(NORMAL_INSTALL)
+
+install-data: 
+       @$(NORMAL_INSTALL)
+
+install: install-exec install-data all
+       @:
+
+uninstall: 
+
+install-strip:
+       $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install
+installdirs:
+
+
+mostlyclean-generic:
+
+clean-generic:
+
+distclean-generic:
+       -rm -f Makefile $(CONFIG_CLEAN_FILES)
+       -rm -f config.cache config.log stamp-h stamp-h[0-9]*
+
+maintainer-clean-generic:
+mostlyclean:  mostlyclean-generic
+
+clean:  clean-generic mostlyclean
+
+distclean:  distclean-generic clean
+       -rm -f config.status
+       -rm -f libtool
+
+maintainer-clean:  maintainer-clean-generic distclean
+       @echo "This command is intended for maintainers to use;"
+       @echo "it deletes files that may require special tools to rebuild."
+
+.PHONY: tags distdir info dvi installcheck install-exec install-data \
+install uninstall all installdirs mostlyclean-generic distclean-generic \
+clean-generic maintainer-clean-generic clean mostlyclean distclean \
+maintainer-clean
+
+
+rpm: buildrpm alsa-lib.spec
+       VERSION=$(VERSION) $(srcdir)/buildrpm
+
+# Tell versions [3.59,3.63) of GNU make to not export all variables.
+# Otherwise a system limit (for SysV at least) may be exceeded.
+.NOEXPORT:
index 8989a9872a19322f16ec78346f83d3ee1c3b7580..8ff7f66e8c63de6bd5bf3d54c27876c723d005c5 100644 (file)
@@ -74,6 +74,5 @@ rm -rf $RPM_BUILD_ROOT
 %doc doc/*.sgml
 %doc doc/*.txt
 
-%{prefix}/usr/include/sys/asoundlib.h
+%{prefix}/usr/include/sys/soundlib.h
 %{prefix}/usr/lib/lib*
-/usr/share/aclocal/alsa-lib.m4
index 36230e22c08c1e9d2e7b257ab50298db50649825..aaf88659d9460f1b8f7f60514eb796f95ae346d1 100644 (file)
@@ -1,15 +1,15 @@
 #!/bin/bash
 
 source=.
-version=`cat $source/../version`
-package=$source/../../alsa-lib-$version.tar.gz
+version=$VERSION
+package=$source/../alsa-lib-$version.tar.gz
 
 if [ ! -r $package ]; then
   echo "Error: wrong package: $package"
   exit 1
 fi
 
-make -C .. pack
+make -C .. dist
 
 cp -fv $package /usr/src/redhat/SOURCES
 
diff --git a/version b/version
deleted file mode 100644 (file)
index 0ea3a94..0000000
--- a/version
+++ /dev/null
@@ -1 +0,0 @@
-0.2.0