From 96f35a05efc5c938f18bb552c36fcd4eba32463d Mon Sep 17 00:00:00 2001 From: Chris Cannam Date: Wed, 18 Nov 1998 20:42:09 +0000 Subject: [PATCH] Switch to automake and libtool --- Makefile | 63 - Makefile.am | 4 + Makefile.conf.in | 26 - Makefile.in | 291 +++++ acconfig.h | 8 + acinclude.m4 | 109 ++ aclocal.m4 | 375 ++++++ config.guess | 890 +++++++++++++ config.sub | 952 ++++++++++++++ configure.in | 49 +- doc/Makefile | 20 - doc/Makefile.am | 3 + doc/Makefile.in | 159 +++ include/Makefile.am | 15 + include/Makefile.in | 240 ++++ include/config.h.in | 31 +- include/version.h.in | 2 +- ltconfig | 1563 +++++++++++++++++++++++ ltmain.sh | 2608 +++++++++++++++++++++++++++++++++++++++ missing | 188 +++ mkinstalldirs | 40 + src/Makefile | 82 -- src/Makefile.am | 22 + src/Makefile.in | 369 ++++++ src/control/Makefile | 42 - src/control/Makefile.am | 8 + src/control/Makefile.in | 251 ++++ src/mixer/Makefile | 41 - src/mixer/Makefile.am | 8 + src/mixer/Makefile.in | 251 ++++ src/pcm/Makefile | 40 - src/pcm/Makefile.am | 7 + src/pcm/Makefile.in | 250 ++++ src/rawmidi/Makefile | 40 - src/rawmidi/Makefile.am | 7 + src/rawmidi/Makefile.in | 250 ++++ test/Makefile | 24 - test/Makefile.am | 10 + test/Makefile.in | 301 +++++ utils/Makefile | 10 - utils/Makefile.am | 4 + utils/Makefile.in | 164 +++ utils/alsa-lib.spec.in | 3 +- utils/buildrpm | 6 +- version | 1 - 45 files changed, 9388 insertions(+), 439 deletions(-) delete mode 100644 Makefile create mode 100644 Makefile.am delete mode 100644 Makefile.conf.in create mode 100644 Makefile.in create mode 100644 acconfig.h create mode 100644 acinclude.m4 create mode 100644 config.guess create mode 100644 config.sub delete mode 100644 doc/Makefile create mode 100644 doc/Makefile.am create mode 100644 doc/Makefile.in create mode 100644 include/Makefile.am create mode 100644 include/Makefile.in create mode 100644 ltconfig create mode 100644 ltmain.sh create mode 100644 missing create mode 100644 mkinstalldirs delete mode 100644 src/Makefile create mode 100644 src/Makefile.am create mode 100644 src/Makefile.in delete mode 100644 src/control/Makefile create mode 100644 src/control/Makefile.am create mode 100644 src/control/Makefile.in delete mode 100644 src/mixer/Makefile create mode 100644 src/mixer/Makefile.am create mode 100644 src/mixer/Makefile.in delete mode 100644 src/pcm/Makefile create mode 100644 src/pcm/Makefile.am create mode 100644 src/pcm/Makefile.in delete mode 100644 src/rawmidi/Makefile create mode 100644 src/rawmidi/Makefile.am create mode 100644 src/rawmidi/Makefile.in delete mode 100644 test/Makefile create mode 100644 test/Makefile.am create mode 100644 test/Makefile.in delete mode 100644 utils/Makefile create mode 100644 utils/Makefile.am create mode 100644 utils/Makefile.in delete mode 100644 version diff --git a/Makefile b/Makefile deleted file mode 100644 index 31cee684..00000000 --- a/Makefile +++ /dev/null @@ -1,63 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -ifeq (Makefile.conf,$(wildcard Makefile.conf)) -include Makefile.conf -else -dummy: - @echo - @echo "Please, run configure script as first..." - @echo -endif - - -all: include/asoundlib.h - $(MAKE) -C src - $(MAKE) -C doc - @echo - @echo "ALSA library were sucessfully compiled." - @echo - -include/asoundlib.h: include/header.h include/version.h include/error.h include/footer.h \ - include/control.h include/mixer.h include/pcm.h include/rawmidi.h - cat include/header.h include/version.h include/error.h \ - include/control.h include/mixer.h \ - include/pcm.h include/rawmidi.h \ - include/footer.h > include/asoundlib.h - -install: all - $(INSTALL) -m 755 -o root -g root -d ${aclocaldir} - $(INSTALL) -m 755 -o root -g root aclocal.m4 ${aclocaldir}/alsa-lib.m4 - $(INSTALL) -m 755 -o root -g root -d ${includedir}/sys - $(INSTALL) -m 644 -o root -g root include/asoundlib.h ${includedir}/sys - $(INSTALL) -m 755 -o root -g root -d ${libdir} - $(INSTALL) -m 644 -o root -g root lib/libasound.a ${libdir} - $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so - $(LN_S) -f libasound.so.${SND_LIB_VERSION} ${libdir}/libasound.so.${SND_LIB_MAJOR} - $(INSTALL) -m 644 -o root -g root lib/libasound.so.${SND_LIB_VERSION} ${libdir} - /sbin/ldconfig - -clean: - $(MAKE) -C include clean - $(MAKE) -C src clean - $(MAKE) -C test clean - $(MAKE) -C doc clean - $(MAKE) -C utils clean - rm -f core .depend *.o *.orig *~ - rm -f `find . -name "out.txt"` - -mrproper: clean - rm -f config.cache config.log config.status Makefile.conf \ - utils/alsa-lib.spec include/config.h include/version.h - -cvsclean: mrproper - rm -f configure include/asoundlib.h - -pack: mrproper - chown -R root.root ../alsa-lib - mv ../alsa-lib ../alsa-lib-$(SND_LIB_VERSION) - tar cvz -C .. -f ../alsa-lib-$(SND_LIB_VERSION).tar.gz alsa-lib-$(SND_LIB_VERSION) - mv ../alsa-lib-$(SND_LIB_VERSION) ../alsa-lib - diff --git a/Makefile.am b/Makefile.am new file mode 100644 index 00000000..d10e67f0 --- /dev/null +++ b/Makefile.am @@ -0,0 +1,4 @@ +SUBDIRS=doc include src test utils + + +INCLUDES=-I$(top_srcdir)/include diff --git a/Makefile.conf.in b/Makefile.conf.in deleted file mode 100644 index fe2e8033..00000000 --- a/Makefile.conf.in +++ /dev/null @@ -1,26 +0,0 @@ -# -# Configuration Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -srcdir=@srcdir@ -VPATH=@srcdir@ -prefix=@prefix@ -exec_prefix=@exec_prefix@ -includedir=@includedir@ -libdir=@libdir@ -aclocaldir=/usr/share/aclocal -c_opts=@CFLAGS@ -INSTALL=@INSTALL@ -SND_LIB_VERSION=@SND_LIB_VERSION@ -SND_LIB_MAJOR=@SND_LIB_MAJOR@ -SND_LIB_MINOR=@SND_LIB_MINOR@ -SND_LIB_SUBMINOR=@SND_LIB_SUBMINOR@ - -CC=@CC@ -CPP=@CPP@ -INCLUDE=-I../include -I../../include -COPTS = $(c_opts) -COPTS += -Wall -Wstrict-prototypes -fomit-frame-pointer -pipe -LINKER=ld -LN_S=@LN_S@ diff --git a/Makefile.in b/Makefile.in new file mode 100644 index 00000000..e83c0314 --- /dev/null +++ b/Makefile.in @@ -0,0 +1,291 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = . + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +SUBDIRS=doc include src test utils + +INCLUDES=-I$(top_srcdir)/include +ACLOCAL_M4 = $(top_srcdir)/aclocal.m4 +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ./include/config.h +CONFIG_CLEAN_FILES = +DIST_COMMON = COPYING ChangeLog Makefile.am Makefile.in acinclude.m4 \ +aclocal.m4 config.guess config.sub configure.in install-sh ltconfig \ +ltmain.sh missing mkinstalldirs + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: all-recursive all-am + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$@ CONFIG_HEADERS= $(SHELL) ./config.status + +$(ACLOCAL_M4): configure.in acinclude.m4 + cd $(srcdir) && $(ACLOCAL) + +config.status: $(srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES) + $(SHELL) ./config.status --recheck +$(srcdir)/configure: $(srcdir)/configure.in $(ACLOCAL_M4) $(CONFIGURE_DEPENDENCIES) + cd $(srcdir) && $(AUTOCONF) + +# This directory's subdirectories are mostly independent; you can cd +# into them and run `make' without going through this Makefile. +# To change the values of `make' variables: instead of editing Makefiles, +# (1) if the variable is set in `config.status', edit `config.status' +# (which will cause the Makefiles to be regenerated when you run `make'); +# (2) otherwise, pass the desired values on the `make' command line. + +@SET_MAKE@ + +all-recursive install-data-recursive install-exec-recursive \ +installdirs-recursive install-recursive uninstall-recursive \ +check-recursive installcheck-recursive info-recursive dvi-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" + +mostlyclean-recursive clean-recursive distclean-recursive \ +maintainer-clean-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \ + rev="$$subdir $$rev"; \ + done; \ + for subdir in $$rev; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" +tags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \ + done + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \ + done; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(PACKAGE)-$(VERSION) +top_distdir = $(distdir) + +# This target untars the dist file and tries a VPATH configuration. Then +# it guarantees that the distribution is self-contained by making another +# tarfile. +distcheck: dist + -rm -rf $(distdir) + GZIP=$(GZIP) $(TAR) zxf $(distdir).tar.gz + mkdir $(distdir)/=build + mkdir $(distdir)/=inst + dc_install_base=`cd $(distdir)/=inst && pwd`; \ + cd $(distdir)/=build \ + && ../configure --srcdir=.. --prefix=$$dc_install_base \ + && $(MAKE) $(AM_MAKEFLAGS) \ + && $(MAKE) $(AM_MAKEFLAGS) dvi \ + && $(MAKE) $(AM_MAKEFLAGS) check \ + && $(MAKE) $(AM_MAKEFLAGS) install \ + && $(MAKE) $(AM_MAKEFLAGS) installcheck \ + && $(MAKE) $(AM_MAKEFLAGS) dist + -rm -rf $(distdir) + @echo "========================"; \ + echo "$(distdir).tar.gz is ready for distribution"; \ + echo "========================" +dist: distdir + -chmod -R a+r $(distdir) + GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir) + -rm -rf $(distdir) +dist-all: distdir + -chmod -R a+r $(distdir) + GZIP=$(GZIP) $(TAR) chozf $(distdir).tar.gz $(distdir) + -rm -rf $(distdir) +distdir: $(DISTFILES) + -rm -rf $(distdir) + mkdir $(distdir) + -chmod 777 $(distdir) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done + for subdir in $(SUBDIRS); do \ + test -d $(distdir)/$$subdir \ + || mkdir $(distdir)/$$subdir \ + || exit 1; \ + chmod 777 $(distdir)/$$subdir; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(distdir) distdir=../$(distdir)/$$subdir distdir) \ + || exit 1; \ + done +info: info-recursive +dvi: dvi-recursive +check: all-am + $(MAKE) $(AM_MAKEFLAGS) check-recursive +installcheck: installcheck-recursive +all-am: Makefile + +install-exec: install-exec-recursive + @$(NORMAL_INSTALL) + +install-data: install-data-recursive + @$(NORMAL_INSTALL) + +install: install-recursive + @: + +uninstall: uninstall-recursive + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: installdirs-recursive + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean-am: mostlyclean-tags mostlyclean-generic + +clean-am: clean-tags clean-generic mostlyclean-am + +distclean-am: distclean-tags distclean-generic clean-am + +maintainer-clean-am: maintainer-clean-tags maintainer-clean-generic \ + distclean-am + +mostlyclean: mostlyclean-recursive mostlyclean-am + +clean: clean-recursive clean-am + +distclean: distclean-recursive distclean-am + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-recursive maintainer-clean-am + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + -rm -f config.status + +.PHONY: install-data-recursive uninstall-data-recursive \ +install-exec-recursive uninstall-exec-recursive installdirs-recursive \ +uninstalldirs-recursive all-recursive check-recursive \ +installcheck-recursive info-recursive dvi-recursive \ +mostlyclean-recursive distclean-recursive clean-recursive \ +maintainer-clean-recursive tags tags-recursive mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck all-am install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/acconfig.h b/acconfig.h new file mode 100644 index 00000000..e26f1785 --- /dev/null +++ b/acconfig.h @@ -0,0 +1,8 @@ +/* Package name */ +#undef PACKAGE + +/* Package version */ +#undef VERSION + +/* Sound library version string */ +#undef SND_LIB_VERSION diff --git a/acinclude.m4 b/acinclude.m4 new file mode 100644 index 00000000..5b6c1e84 --- /dev/null +++ b/acinclude.m4 @@ -0,0 +1,109 @@ +dnl Configure Paths for Alsa +dnl Christopher Lansdown (lansdoct@cs.alfred.edu) +dnl 29/10/1998 +dnl AM_PATH_ALSA(MINIMUM-VERSION) +dnl Test for libasound, and define ALSA_CFLAGS and ALSA_LIBS as appropriate. +dnl enables arguments --with-alsa-prefix= --with-alsa-enc-prefix= --disable-alsatest +dnl +AC_DEFUN(AM_PATH_ALSA, +[dnl +dnl Get the clfags and libraries for alsa +dnl +AC_ARG_WITH(alsa-prefix,[ --with-alsa-prefix=PFX Prefix where Alsa library is installed(optional)], + [alsa_prefix="$withval"], [alsa_prefix=""]) +AC_ARG_WITH(alsa-inc-prefix, [ --with-alsa-inc-prefix=PFX Prefix where include libraries are (optional)], + [alsa_inc_prefix="$withval"], [alsa_inc_prefix=""]) +AC_ARG_ENABLE(alsatest, [ --disable-alsatest Do not try to compile and run a test Alsa program], [enable_alsatest=no], [enable_alsatest=yes]) + +dnl Add any special include directories +AC_MSG_CHECKING(for ALSA CFLAGS) +if test "$alsa_inc_prefix" != "" ; then + ALSA_CFLAGS="$ALSA_CFLAGS -I$alsa_inc_prefix" + CFLAGS="-I$alsa_inc_prefix" +fi +AC_MSG_RESULT($ALSA_CFLAGS) + +dnl add any special lib dirs +AC_MSG_CHECKING(for ALSA LDFLAGS) +if test "$alsa_prefix" != "" ; then + ALSA_LIBS="$ALSA_LIBS -L$alsa_prefix" + LIBS="-L$alsa_prefix" +fi + +dnl add the alsa library +ALSA_LIBS="$ALSA_LIBS -lasound" +LDFLAGS="$ALSA_LIBS -lasound" +AC_MSG_RESULT($ALSA_LIBS) + +dnl Check for the presence of the library +dnl if test $enable_alsatest = yes; then +dnl AC_MSG_CHECKING(for working libasound) +dnl AC_TRY_RUN([ +dnl #include +dnl void main(void) +dnl { +dnl snd_cards(); +dnl exit(0); +dnl } +dnl ], +dnl [AC_MSG_RESULT("present")], +dnl [AC_MSG_RESULT("not found. ") +dnl AC_MSG_ERROR(Fatal error: Install alsa-lib package or use --with-alsa-prefix option...)], +dnl [AC_MSG_RESULT(unsopported) +dnl AC_MSG_ERROR(Cross-compiling isn't supported...)] +dnl ) +dnl fi + +dnl Check for a working version of libasound that is of the right version. +min_alsa_version=ifelse([$1], ,0.1.1,$1) +AC_MSG_CHECKING(for libasound headers version >= $min_alsa_version) +no_alsa="" + alsa_min_major_version=`echo $min_alsa_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\1/'` + alsa_min_minor_version=`echo $min_alsa_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\2/'` + alsa_min_micro_version=`echo $min_alsa_version | \ + sed 's/\([[0-9]]*\).\([[0-9]]*\).\([[0-9]]*\)/\3/'` + +AC_TRY_COMPILE([ +#include +], [ +void main(void) +{ +# if(SOUNDLIB_VERSION_MAJOR > $alsa_min_major_version) + exit(0); +# else +# if(SOUNDLIB_VERSION_MAJOR < $alsa_min_major_version) +# error not present +# endif + +# if(SOUNDLIB_VERSION_MINOR > $alsa_min_minor_version) + exit(0); +# else +# if(SOUNDLIB_VERSION_MINOR < $alsa_min_minor_version) +# error not present +# endif + +# if(SOUNDLIB_VERSION_SUBMINOR < $alsa_min_micro_version) +# error not present +# endif +# endif +# endif +exit(0); +} +], + [AC_MSG_RESULT(found.)], + [AC_MSG_RESULT(not present.) + AC_MSG_ERROR(Sufficiently new version of libasound not found.)] +) + +dnl Now that we know that we have the right version, let's see if we have the library and not just the headers. +AC_CHECK_LIB([asound], [snd_cards],, + [AC_MSG_ERROR(No linkable libasound was found.)] +) + +dnl That should be it. Now just export out symbols: +AC_SUBST(ALSA_CFLAGS) +AC_SUBST(ALSA_LIBS) +]) + diff --git a/aclocal.m4 b/aclocal.m4 index 5b6c1e84..7b080f1e 100644 --- a/aclocal.m4 +++ b/aclocal.m4 @@ -1,3 +1,15 @@ +dnl aclocal.m4 generated automatically by aclocal 1.3b + +dnl Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +dnl This file is free software; the Free Software Foundation +dnl gives unlimited permission to copy and/or distribute it, +dnl with or without modifications, as long as this notice is preserved. + +dnl This program is distributed in the hope that it will be useful, +dnl but WITHOUT ANY WARRANTY, to the extent permitted by law; without +dnl even the implied warranty of MERCHANTABILITY or FITNESS FOR A +dnl PARTICULAR PURPOSE. + dnl Configure Paths for Alsa dnl Christopher Lansdown (lansdoct@cs.alfred.edu) dnl 29/10/1998 @@ -107,3 +119,366 @@ AC_SUBST(ALSA_CFLAGS) AC_SUBST(ALSA_LIBS) ]) + +# Do all the work for Automake. This macro actually does too much -- +# some checks are only needed if your package does certain things. +# But this isn't really a big deal. + +# serial 1 + +dnl Usage: +dnl AM_INIT_AUTOMAKE(package,version, [no-define]) + +AC_DEFUN(AM_INIT_AUTOMAKE, +[AC_REQUIRE([AM_PROG_INSTALL]) +PACKAGE=[$1] +AC_SUBST(PACKAGE) +VERSION=[$2] +AC_SUBST(VERSION) +dnl test to see if srcdir already configured +if test "`cd $srcdir && pwd`" != "`pwd`" && test -f $srcdir/config.status; then + AC_MSG_ERROR([source directory already configured; run "make distclean" there first]) +fi +ifelse([$3],, +AC_DEFINE_UNQUOTED(PACKAGE, "$PACKAGE") +AC_DEFINE_UNQUOTED(VERSION, "$VERSION")) +AC_REQUIRE([AM_SANITY_CHECK]) +AC_REQUIRE([AC_ARG_PROGRAM]) +dnl FIXME This is truly gross. +missing_dir=`cd $ac_aux_dir && pwd` +AM_MISSING_PROG(ACLOCAL, aclocal, $missing_dir) +AM_MISSING_PROG(AUTOCONF, autoconf, $missing_dir) +AM_MISSING_PROG(AUTOMAKE, automake, $missing_dir) +AM_MISSING_PROG(AUTOHEADER, autoheader, $missing_dir) +AM_MISSING_PROG(MAKEINFO, makeinfo, $missing_dir) +AC_REQUIRE([AC_PROG_MAKE_SET])]) + + +# serial 1 + +AC_DEFUN(AM_PROG_INSTALL, +[AC_REQUIRE([AC_PROG_INSTALL]) +test -z "$INSTALL_SCRIPT" && INSTALL_SCRIPT='${INSTALL_PROGRAM}' +AC_SUBST(INSTALL_SCRIPT)dnl +]) + +# +# Check to make sure that the build environment is sane. +# + +AC_DEFUN(AM_SANITY_CHECK, +[AC_MSG_CHECKING([whether build environment is sane]) +# Just in case +sleep 1 +echo timestamp > conftestfile +# Do `set' in a subshell so we don't clobber the current shell's +# arguments. Must try -L first in case configure is actually a +# symlink; some systems play weird games with the mod time of symlinks +# (eg FreeBSD returns the mod time of the symlink's containing +# directory). +if ( + set X `ls -Lt $srcdir/configure conftestfile 2> /dev/null` + if test "[$]*" = "X"; then + # -L didn't work. + set X `ls -t $srcdir/configure conftestfile` + fi + if test "[$]*" != "X $srcdir/configure conftestfile" \ + && test "[$]*" != "X conftestfile $srcdir/configure"; then + + # If neither matched, then we have a broken ls. This can happen + # if, for instance, CONFIG_SHELL is bash and it inherits a + # broken ls alias from the environment. This has actually + # happened. Such a system could not be considered "sane". + AC_MSG_ERROR([ls -t appears to fail. Make sure there is not a broken +alias in your environment]) + fi + + test "[$]2" = conftestfile + ) +then + # Ok. + : +else + AC_MSG_ERROR([newly created file is older than distributed files! +Check your system clock]) +fi +rm -f conftest* +AC_MSG_RESULT(yes)]) + +dnl AM_MISSING_PROG(NAME, PROGRAM, DIRECTORY) +dnl The program must properly implement --version. +AC_DEFUN(AM_MISSING_PROG, +[AC_MSG_CHECKING(for working $2) +# Run test in a subshell; some versions of sh will print an error if +# an executable is not found, even if stderr is redirected. +# Redirect stdin to placate older versions of autoconf. Sigh. +if ($2 --version) < /dev/null > /dev/null 2>&1; then + $1=$2 + AC_MSG_RESULT(found) +else + $1="$3/missing $2" + AC_MSG_RESULT(missing) +fi +AC_SUBST($1)]) + + +# serial 25 AM_PROG_LIBTOOL +AC_DEFUN(AM_PROG_LIBTOOL, +[AC_REQUIRE([AM_ENABLE_SHARED])dnl +AC_REQUIRE([AM_ENABLE_STATIC])dnl +AC_REQUIRE([AC_CANONICAL_HOST])dnl +AC_REQUIRE([AC_PROG_RANLIB])dnl +AC_REQUIRE([AC_PROG_CC])dnl +AC_REQUIRE([AM_PROG_LD])dnl +AC_REQUIRE([AM_PROG_NM])dnl +AC_REQUIRE([AC_PROG_LN_S])dnl +dnl +# Always use our own libtool. +LIBTOOL='$(SHELL) $(top_builddir)/libtool' +AC_SUBST(LIBTOOL)dnl + +# Check for any special flags to pass to ltconfig. +libtool_flags= +test "$enable_shared" = no && libtool_flags="$libtool_flags --disable-shared" +test "$enable_static" = no && libtool_flags="$libtool_flags --disable-static" +test "$silent" = yes && libtool_flags="$libtool_flags --silent" +test "$ac_cv_prog_gcc" = yes && libtool_flags="$libtool_flags --with-gcc" +test "$ac_cv_prog_gnu_ld" = yes && libtool_flags="$libtool_flags --with-gnu-ld" + +# Some flags need to be propagated to the compiler or linker for good +# libtool support. +case "$host" in +*-*-irix6*) + # Find out which ABI we are using. + echo '[#]line __oline__ "configure"' > conftest.$ac_ext + if AC_TRY_EVAL(ac_compile); then + case "`/usr/bin/file conftest.o`" in + *32-bit*) + LD="${LD-ld} -32" + ;; + *N32*) + LD="${LD-ld} -n32" + ;; + *64-bit*) + LD="${LD-ld} -64" + ;; + esac + fi + rm -rf conftest* + ;; + +*-*-sco3.2v5*) + # On SCO OpenServer 5, we need -belf to get full-featured binaries. + CFLAGS="$CFLAGS -belf" + ;; +esac + +# Actually configure libtool. ac_aux_dir is where install-sh is found. +CC="$CC" CFLAGS="$CFLAGS" CPPFLAGS="$CPPFLAGS" \ +LD="$LD" NM="$NM" RANLIB="$RANLIB" LN_S="$LN_S" \ +${CONFIG_SHELL-/bin/sh} $ac_aux_dir/ltconfig --no-reexec \ +$libtool_flags --no-verify $ac_aux_dir/ltmain.sh $host \ +|| AC_MSG_ERROR([libtool configure failed]) + +# Redirect the config.log output again, so that the ltconfig log is not +# clobbered by the next message. +exec 5>>./config.log +]) + +# AM_ENABLE_SHARED - implement the --enable-shared flag +# Usage: AM_ENABLE_SHARED[(DEFAULT)] +# Where DEFAULT is either `yes' or `no'. If omitted, it defaults to +# `yes'. +AC_DEFUN(AM_ENABLE_SHARED, +[define([AM_ENABLE_SHARED_DEFAULT], ifelse($1, no, no, yes))dnl +AC_ARG_ENABLE(shared, +changequote(<<, >>)dnl +<< --enable-shared[=PKGS] build shared libraries [default=>>AM_ENABLE_SHARED_DEFAULT], +changequote([, ])dnl +[p=${PACKAGE-default} +case "$enableval" in +yes) enable_shared=yes ;; +no) enable_shared=no ;; +*) + enable_shared=no + # Look at the argument we got. We use all the common list separators. + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:," + for pkg in $enableval; do + if test "X$pkg" = "X$p"; then + enable_shared=yes + fi + done + IFS="$ac_save_ifs" + ;; +esac], +enable_shared=AM_ENABLE_SHARED_DEFAULT)dnl +]) + +# AM_DISABLE_SHARED - set the default shared flag to --disable-shared +AC_DEFUN(AM_DISABLE_SHARED, +[AM_ENABLE_SHARED(no)]) + +# AM_DISABLE_STATIC - set the default static flag to --disable-static +AC_DEFUN(AM_DISABLE_STATIC, +[AM_ENABLE_STATIC(no)]) + +# AM_ENABLE_STATIC - implement the --enable-static flag +# Usage: AM_ENABLE_STATIC[(DEFAULT)] +# Where DEFAULT is either `yes' or `no'. If omitted, it defaults to +# `yes'. +AC_DEFUN(AM_ENABLE_STATIC, +[define([AM_ENABLE_STATIC_DEFAULT], ifelse($1, no, no, yes))dnl +AC_ARG_ENABLE(static, +changequote(<<, >>)dnl +<< --enable-static[=PKGS] build static libraries [default=>>AM_ENABLE_STATIC_DEFAULT], +changequote([, ])dnl +[p=${PACKAGE-default} +case "$enableval" in +yes) enable_static=yes ;; +no) enable_static=no ;; +*) + enable_static=no + # Look at the argument we got. We use all the common list separators. + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:," + for pkg in $enableval; do + if test "X$pkg" = "X$p"; then + enable_static=yes + fi + done + IFS="$ac_save_ifs" + ;; +esac], +enable_static=AM_ENABLE_STATIC_DEFAULT)dnl +]) + + +# AM_PROG_LD - find the path to the GNU or non-GNU linker +AC_DEFUN(AM_PROG_LD, +[AC_ARG_WITH(gnu-ld, +[ --with-gnu-ld assume the C compiler uses GNU ld [default=no]], +test "$withval" = no || with_gnu_ld=yes, with_gnu_ld=no) +AC_REQUIRE([AC_PROG_CC]) +ac_prog=ld +if test "$ac_cv_prog_gcc" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + AC_MSG_CHECKING([for ld used by GCC]) + ac_prog=`($CC -print-prog-name=ld) 2>&5` + case "$ac_prog" in + # Accept absolute paths. +changequote(,)dnl + /* | [A-Za-z]:\\*) +changequote([,])dnl + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we aren't using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac +elif test "$with_gnu_ld" = yes; then + AC_MSG_CHECKING([for GNU ld]) +else + AC_MSG_CHECKING([for non-GNU ld]) +fi +AC_CACHE_VAL(ac_cv_path_LD, +[if test -z "$LD"; then + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in $PATH; do + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog"; then + ac_cv_path_LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some GNU ld's only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + if "$ac_cv_path_LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then + test "$with_gnu_ld" != no && break + else + test "$with_gnu_ld" != yes && break + fi + fi + done + IFS="$ac_save_ifs" +else + ac_cv_path_LD="$LD" # Let the user override the test with a path. +fi]) +LD="$ac_cv_path_LD" +if test -n "$LD"; then + AC_MSG_RESULT($LD) +else + AC_MSG_RESULT(no) +fi +test -z "$LD" && AC_MSG_ERROR([no acceptable ld found in \$PATH]) +AC_SUBST(LD) +AM_PROG_LD_GNU +]) + +AC_DEFUN(AM_PROG_LD_GNU, +[AC_CACHE_CHECK([if the linker ($LD) is GNU ld], ac_cv_prog_gnu_ld, +[# I'd rather use --version here, but apparently some GNU ld's only accept -v. +if $LD -v 2>&1 &5; then + ac_cv_prog_gnu_ld=yes +else + ac_cv_prog_gnu_ld=no +fi]) +]) + +# AM_PROG_NM - find the path to a BSD-compatible name lister +AC_DEFUN(AM_PROG_NM, +[AC_MSG_CHECKING([for BSD-compatible nm]) +AC_CACHE_VAL(ac_cv_path_NM, +[if test -n "$NM"; then + # Let the user override the test. + ac_cv_path_NM="$NM" +else + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/nm; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + ac_cv_path_NM="$ac_dir/nm -B" + elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + ac_cv_path_NM="$ac_dir/nm -p" + else + ac_cv_path_NM="$ac_dir/nm" + fi + break + fi + done + IFS="$ac_save_ifs" + test -z "$ac_cv_path_NM" && ac_cv_path_NM=nm +fi]) +NM="$ac_cv_path_NM" +AC_MSG_RESULT([$NM]) +AC_SUBST(NM) +]) + +# Like AC_CONFIG_HEADER, but automatically create stamp file. + +AC_DEFUN(AM_CONFIG_HEADER, +[AC_PREREQ([2.12]) +AC_CONFIG_HEADER([$1]) +dnl When config.status generates a header, we must update the stamp-h file. +dnl This file resides in the same directory as the config header +dnl that is generated. We must strip everything past the first ":", +dnl and everything past the last "/". +AC_OUTPUT_COMMANDS(changequote(<<,>>)dnl +ifelse(patsubst(<<$1>>, <<[^ ]>>, <<>>), <<>>, +<>CONFIG_HEADERS" || echo timestamp > patsubst(<<$1>>, <<^\([^:]*/\)?.*>>, <<\1>>)stamp-h<<>>dnl>>, +<>; do + case " <<$>>CONFIG_HEADERS " in + *" <<$>>am_file "*<<)>> + echo timestamp > `echo <<$>>am_file | sed -e 's%:.*%%' -e 's%[^/]*$%%'`stamp-h$am_indx + ;; + esac + am_indx=`expr "<<$>>am_indx" + 1` +done<<>>dnl>>) +changequote([,]))]) + diff --git a/config.guess b/config.guess new file mode 100644 index 00000000..30230b3d --- /dev/null +++ b/config.guess @@ -0,0 +1,890 @@ +#! /bin/sh +# Attempt to guess a canonical system name. +# Copyright (C) 1992, 93, 94, 95, 96, 97, 1998 Free Software Foundation, Inc. +# +# This file is free software; you can redistribute it and/or modify it +# under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Written by Per Bothner . +# The master version of this file is at the FSF in /home/gd/gnu/lib. +# +# This script attempts to guess a canonical system name similar to +# config.sub. If it succeeds, it prints the system name on stdout, and +# exits with 0. Otherwise, it exits with 1. +# +# The plan is that this can be called by configure scripts if you +# don't specify an explicit system type (host/target name). +# +# Only a few systems have been added to this list; please add others +# (but try to keep the structure clean). +# + +# This is needed to find uname on a Pyramid OSx when run in the BSD universe. +# (ghazi@noc.rutgers.edu 8/24/94.) +if (test -f /.attbin/uname) >/dev/null 2>&1 ; then + PATH=$PATH:/.attbin ; export PATH +fi + +UNAME_MACHINE=`(uname -m) 2>/dev/null` || UNAME_MACHINE=unknown +UNAME_RELEASE=`(uname -r) 2>/dev/null` || UNAME_RELEASE=unknown +UNAME_SYSTEM=`(uname -s) 2>/dev/null` || UNAME_SYSTEM=unknown +UNAME_VERSION=`(uname -v) 2>/dev/null` || UNAME_VERSION=unknown + +trap 'rm -f dummy.c dummy.o dummy; exit 1' 1 2 15 + +# Note: order is significant - the case branches are not exclusive. + +case "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" in + alpha:OSF1:*:*) + if test $UNAME_RELEASE = "V4.0"; then + UNAME_RELEASE=`/usr/sbin/sizer -v | awk '{print $3}'` + fi + # A Vn.n version is a released version. + # A Tn.n version is a released field test version. + # A Xn.n version is an unreleased experimental baselevel. + # 1.2 uses "1.2" for uname -r. + cat <dummy.s + .globl main + .ent main +main: + .frame \$30,0,\$26,0 + .prologue 0 + .long 0x47e03d80 # implver $0 + lda \$2,259 + .long 0x47e20c21 # amask $2,$1 + srl \$1,8,\$2 + sll \$2,2,\$2 + sll \$0,3,\$0 + addl \$1,\$0,\$0 + addl \$2,\$0,\$0 + ret \$31,(\$26),1 + .end main +EOF + ${CC-cc} dummy.s -o dummy 2>/dev/null + if test "$?" = 0 ; then + ./dummy + case "$?" in + 7) + UNAME_MACHINE="alpha" + ;; + 15) + UNAME_MACHINE="alphaev5" + ;; + 14) + UNAME_MACHINE="alphaev56" + ;; + 10) + UNAME_MACHINE="alphapca56" + ;; + 16) + UNAME_MACHINE="alphaev6" + ;; + esac + fi + rm -f dummy.s dummy + echo ${UNAME_MACHINE}-dec-osf`echo ${UNAME_RELEASE} | sed -e 's/^[VTX]//' | tr [[A-Z]] [[a-z]]` + exit 0 ;; + 21064:Windows_NT:50:3) + echo alpha-dec-winnt3.5 + exit 0 ;; + Amiga*:UNIX_System_V:4.0:*) + echo m68k-cbm-sysv4 + exit 0;; + amiga:NetBSD:*:*) + echo m68k-cbm-netbsd${UNAME_RELEASE} + exit 0 ;; + amiga:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + arc64:OpenBSD:*:*) + echo mips64el-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + arc:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + hkmips:OpenBSD:*:*) + echo mips-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + pmax:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + sgi:OpenBSD:*:*) + echo mips-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + wgrisc:OpenBSD:*:*) + echo mipsel-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + arm:RISC*:1.[012]*:*|arm:riscix:1.[012]*:*) + echo arm-acorn-riscix${UNAME_RELEASE} + exit 0;; + arm32:NetBSD:*:*) + echo arm-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'` + exit 0 ;; + SR2?01:HI-UX/MPP:*:*) + echo hppa1.1-hitachi-hiuxmpp + exit 0;; + Pyramid*:OSx*:*:*|MIS*:OSx*:*:*) + # akee@wpdis03.wpafb.af.mil (Earle F. Ake) contributed MIS and NILE. + if test "`(/bin/universe) 2>/dev/null`" = att ; then + echo pyramid-pyramid-sysv3 + else + echo pyramid-pyramid-bsd + fi + exit 0 ;; + NILE:*:*:dcosx) + echo pyramid-pyramid-svr4 + exit 0 ;; + sun4*:SunOS:5.*:* | tadpole*:SunOS:5.*:*) + echo sparc-sun-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + i86pc:SunOS:5.*:*) + echo i386-pc-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + sun4*:SunOS:6*:*) + # According to config.sub, this is the proper way to canonicalize + # SunOS6. Hard to guess exactly what SunOS6 will be like, but + # it's likely to be more like Solaris than SunOS4. + echo sparc-sun-solaris3`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + sun4*:SunOS:*:*) + case "`/usr/bin/arch -k`" in + Series*|S4*) + UNAME_RELEASE=`uname -v` + ;; + esac + # Japanese Language versions have a version number like `4.1.3-JL'. + echo sparc-sun-sunos`echo ${UNAME_RELEASE}|sed -e 's/-/_/'` + exit 0 ;; + sun3*:SunOS:*:*) + echo m68k-sun-sunos${UNAME_RELEASE} + exit 0 ;; + sun*:*:4.2BSD:*) + UNAME_RELEASE=`(head -1 /etc/motd | awk '{print substr($5,1,3)}') 2>/dev/null` + test "x${UNAME_RELEASE}" = "x" && UNAME_RELEASE=3 + case "`/bin/arch`" in + sun3) + echo m68k-sun-sunos${UNAME_RELEASE} + ;; + sun4) + echo sparc-sun-sunos${UNAME_RELEASE} + ;; + esac + exit 0 ;; + aushp:SunOS:*:*) + echo sparc-auspex-sunos${UNAME_RELEASE} + exit 0 ;; + atari*:NetBSD:*:*) + echo m68k-atari-netbsd${UNAME_RELEASE} + exit 0 ;; + atari*:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + sun3*:NetBSD:*:*) + echo m68k-sun-netbsd${UNAME_RELEASE} + exit 0 ;; + sun3*:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mac68k:NetBSD:*:*) + echo m68k-apple-netbsd${UNAME_RELEASE} + exit 0 ;; + mac68k:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mvme68k:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + mvme88k:OpenBSD:*:*) + echo m88k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + powerpc:machten:*:*) + echo powerpc-apple-machten${UNAME_RELEASE} + exit 0 ;; + RISC*:Mach:*:*) + echo mips-dec-mach_bsd4.3 + exit 0 ;; + RISC*:ULTRIX:*:*) + echo mips-dec-ultrix${UNAME_RELEASE} + exit 0 ;; + VAX*:ULTRIX*:*:*) + echo vax-dec-ultrix${UNAME_RELEASE} + exit 0 ;; + 2020:CLIX:*:*) + echo clipper-intergraph-clix${UNAME_RELEASE} + exit 0 ;; + mips:*:*:UMIPS | mips:*:*:RISCos) + sed 's/^ //' << EOF >dummy.c + int main (argc, argv) int argc; char **argv; { + #if defined (host_mips) && defined (MIPSEB) + #if defined (SYSTYPE_SYSV) + printf ("mips-mips-riscos%ssysv\n", argv[1]); exit (0); + #endif + #if defined (SYSTYPE_SVR4) + printf ("mips-mips-riscos%ssvr4\n", argv[1]); exit (0); + #endif + #if defined (SYSTYPE_BSD43) || defined(SYSTYPE_BSD) + printf ("mips-mips-riscos%sbsd\n", argv[1]); exit (0); + #endif + #endif + exit (-1); + } +EOF + ${CC-cc} dummy.c -o dummy \ + && ./dummy `echo "${UNAME_RELEASE}" | sed -n 's/\([0-9]*\).*/\1/p'` \ + && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + echo mips-mips-riscos${UNAME_RELEASE} + exit 0 ;; + Night_Hawk:Power_UNIX:*:*) + echo powerpc-harris-powerunix + exit 0 ;; + m88k:CX/UX:7*:*) + echo m88k-harris-cxux7 + exit 0 ;; + m88k:*:4*:R4*) + echo m88k-motorola-sysv4 + exit 0 ;; + m88k:*:3*:R3*) + echo m88k-motorola-sysv3 + exit 0 ;; + AViiON:dgux:*:*) + # DG/UX returns AViiON for all architectures + UNAME_PROCESSOR=`/usr/bin/uname -p` + if [ $UNAME_PROCESSOR = mc88100 -o $UNAME_PROCESSOR = mc88110 ] ; then + if [ ${TARGET_BINARY_INTERFACE}x = m88kdguxelfx \ + -o ${TARGET_BINARY_INTERFACE}x = x ] ; then + echo m88k-dg-dgux${UNAME_RELEASE} + else + echo m88k-dg-dguxbcs${UNAME_RELEASE} + fi + else echo i586-dg-dgux${UNAME_RELEASE} + fi + exit 0 ;; + M88*:DolphinOS:*:*) # DolphinOS (SVR3) + echo m88k-dolphin-sysv3 + exit 0 ;; + M88*:*:R3*:*) + # Delta 88k system running SVR3 + echo m88k-motorola-sysv3 + exit 0 ;; + XD88*:*:*:*) # Tektronix XD88 system running UTekV (SVR3) + echo m88k-tektronix-sysv3 + exit 0 ;; + Tek43[0-9][0-9]:UTek:*:*) # Tektronix 4300 system running UTek (BSD) + echo m68k-tektronix-bsd + exit 0 ;; + *:IRIX*:*:*) + echo mips-sgi-irix`echo ${UNAME_RELEASE}|sed -e 's/-/_/g'` + exit 0 ;; + ????????:AIX?:[12].1:2) # AIX 2.2.1 or AIX 2.1.1 is RT/PC AIX. + echo romp-ibm-aix # uname -m gives an 8 hex-code CPU id + exit 0 ;; # Note that: echo "'`uname -s`'" gives 'AIX ' + i?86:AIX:*:*) + echo i386-ibm-aix + exit 0 ;; + *:AIX:2:3) + if grep bos325 /usr/include/stdio.h >/dev/null 2>&1; then + sed 's/^ //' << EOF >dummy.c + #include + + main() + { + if (!__power_pc()) + exit(1); + puts("powerpc-ibm-aix3.2.5"); + exit(0); + } +EOF + ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + echo rs6000-ibm-aix3.2.5 + elif grep bos324 /usr/include/stdio.h >/dev/null 2>&1; then + echo rs6000-ibm-aix3.2.4 + else + echo rs6000-ibm-aix3.2 + fi + exit 0 ;; + *:AIX:*:4) + if /usr/sbin/lsattr -EHl proc0 | grep POWER >/dev/null 2>&1; then + IBM_ARCH=rs6000 + else + IBM_ARCH=powerpc + fi + if [ -x /usr/bin/oslevel ] ; then + IBM_REV=`/usr/bin/oslevel` + else + IBM_REV=4.${UNAME_RELEASE} + fi + echo ${IBM_ARCH}-ibm-aix${IBM_REV} + exit 0 ;; + *:AIX:*:*) + echo rs6000-ibm-aix + exit 0 ;; + ibmrt:4.4BSD:*|romp-ibm:BSD:*) + echo romp-ibm-bsd4.4 + exit 0 ;; + ibmrt:*BSD:*|romp-ibm:BSD:*) # covers RT/PC NetBSD and + echo romp-ibm-bsd${UNAME_RELEASE} # 4.3 with uname added to + exit 0 ;; # report: romp-ibm BSD 4.3 + *:BOSX:*:*) + echo rs6000-bull-bosx + exit 0 ;; + DPX/2?00:B.O.S.:*:*) + echo m68k-bull-sysv3 + exit 0 ;; + 9000/[34]??:4.3bsd:1.*:*) + echo m68k-hp-bsd + exit 0 ;; + hp300:4.4BSD:*:* | 9000/[34]??:4.3bsd:2.*:*) + echo m68k-hp-bsd4.4 + exit 0 ;; + 9000/[3478]??:HP-UX:*:*) + case "${UNAME_MACHINE}" in + 9000/31? ) HP_ARCH=m68000 ;; + 9000/[34]?? ) HP_ARCH=m68k ;; + 9000/7?? | 9000/8?[1679] ) HP_ARCH=hppa1.1 ;; + 9000/8?? ) HP_ARCH=hppa1.0 ;; + esac + HPUX_REV=`echo ${UNAME_RELEASE}|sed -e 's/[^.]*.[0B]*//'` + echo ${HP_ARCH}-hp-hpux${HPUX_REV} + exit 0 ;; + 3050*:HI-UX:*:*) + sed 's/^ //' << EOF >dummy.c + #include + int + main () + { + long cpu = sysconf (_SC_CPU_VERSION); + /* The order matters, because CPU_IS_HP_MC68K erroneously returns + true for CPU_PA_RISC1_0. CPU_IS_PA_RISC returns correct + results, however. */ + if (CPU_IS_PA_RISC (cpu)) + { + switch (cpu) + { + case CPU_PA_RISC1_0: puts ("hppa1.0-hitachi-hiuxwe2"); break; + case CPU_PA_RISC1_1: puts ("hppa1.1-hitachi-hiuxwe2"); break; + case CPU_PA_RISC2_0: puts ("hppa2.0-hitachi-hiuxwe2"); break; + default: puts ("hppa-hitachi-hiuxwe2"); break; + } + } + else if (CPU_IS_HP_MC68K (cpu)) + puts ("m68k-hitachi-hiuxwe2"); + else puts ("unknown-hitachi-hiuxwe2"); + exit (0); + } +EOF + ${CC-cc} dummy.c -o dummy && ./dummy && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + echo unknown-hitachi-hiuxwe2 + exit 0 ;; + 9000/7??:4.3bsd:*:* | 9000/8?[79]:4.3bsd:*:* ) + echo hppa1.1-hp-bsd + exit 0 ;; + 9000/8??:4.3bsd:*:*) + echo hppa1.0-hp-bsd + exit 0 ;; + hp7??:OSF1:*:* | hp8?[79]:OSF1:*:* ) + echo hppa1.1-hp-osf + exit 0 ;; + hp8??:OSF1:*:*) + echo hppa1.0-hp-osf + exit 0 ;; + i?86:OSF1:*:*) + if [ -x /usr/sbin/sysversion ] ; then + echo ${UNAME_MACHINE}-unknown-osf1mk + else + echo ${UNAME_MACHINE}-unknown-osf1 + fi + exit 0 ;; + parisc*:Lites*:*:*) + echo hppa1.1-hp-lites + exit 0 ;; + C1*:ConvexOS:*:* | convex:ConvexOS:C1*:*) + echo c1-convex-bsd + exit 0 ;; + C2*:ConvexOS:*:* | convex:ConvexOS:C2*:*) + if getsysinfo -f scalar_acc + then echo c32-convex-bsd + else echo c2-convex-bsd + fi + exit 0 ;; + C34*:ConvexOS:*:* | convex:ConvexOS:C34*:*) + echo c34-convex-bsd + exit 0 ;; + C38*:ConvexOS:*:* | convex:ConvexOS:C38*:*) + echo c38-convex-bsd + exit 0 ;; + C4*:ConvexOS:*:* | convex:ConvexOS:C4*:*) + echo c4-convex-bsd + exit 0 ;; + CRAY*X-MP:*:*:*) + echo xmp-cray-unicos + exit 0 ;; + CRAY*Y-MP:*:*:*) + echo ymp-cray-unicos${UNAME_RELEASE} + exit 0 ;; + CRAY*[A-Z]90:*:*:*) + echo ${UNAME_MACHINE}-cray-unicos${UNAME_RELEASE} \ + | sed -e 's/CRAY.*\([A-Z]90\)/\1/' \ + -e y/ABCDEFGHIJKLMNOPQRSTUVWXYZ/abcdefghijklmnopqrstuvwxyz/ + exit 0 ;; + CRAY*TS:*:*:*) + echo t90-cray-unicos${UNAME_RELEASE} + exit 0 ;; + CRAY-2:*:*:*) + echo cray2-cray-unicos + exit 0 ;; + F300:UNIX_System_V:*:*) + FUJITSU_SYS=`uname -p | tr [A-Z] [a-z] | sed -e 's/\///'` + FUJITSU_REL=`echo ${UNAME_RELEASE} | sed -e 's/ /_/'` + echo "f300-fujitsu-${FUJITSU_SYS}${FUJITSU_REL}" + exit 0 ;; + F301:UNIX_System_V:*:*) + echo f301-fujitsu-uxpv`echo $UNAME_RELEASE | sed 's/ .*//'` + exit 0 ;; + hp3[0-9][05]:NetBSD:*:*) + echo m68k-hp-netbsd${UNAME_RELEASE} + exit 0 ;; + hp300:OpenBSD:*:*) + echo m68k-unknown-openbsd${UNAME_RELEASE} + exit 0 ;; + i?86:BSD/386:*:* | *:BSD/OS:*:*) + echo ${UNAME_MACHINE}-pc-bsdi${UNAME_RELEASE} + exit 0 ;; + *:FreeBSD:*:*) + echo ${UNAME_MACHINE}-unknown-freebsd`echo ${UNAME_RELEASE}|sed -e 's/[-(].*//'` + exit 0 ;; + *:NetBSD:*:*) + echo ${UNAME_MACHINE}-unknown-netbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'` + exit 0 ;; + *:OpenBSD:*:*) + echo ${UNAME_MACHINE}-unknown-openbsd`echo ${UNAME_RELEASE}|sed -e 's/[-_].*/\./'` + exit 0 ;; + i*:CYGWIN*:*) + echo ${UNAME_MACHINE}-pc-cygwin32 + exit 0 ;; + i*:MINGW*:*) + echo ${UNAME_MACHINE}-pc-mingw32 + exit 0 ;; + p*:CYGWIN*:*) + echo powerpcle-unknown-cygwin32 + exit 0 ;; + prep*:SunOS:5.*:*) + echo powerpcle-unknown-solaris2`echo ${UNAME_RELEASE}|sed -e 's/[^.]*//'` + exit 0 ;; + *:GNU:*:*) + echo `echo ${UNAME_MACHINE}|sed -e 's,[-/].*$,,'`-unknown-gnu`echo ${UNAME_RELEASE}|sed -e 's,/.*$,,'` + exit 0 ;; + *:Linux:*:*) + # uname on the ARM produces all sorts of strangeness, and we need to + # filter it out. + case "$UNAME_MACHINE" in + arm* | sa110*) UNAME_MACHINE="arm" ;; + esac + + # The BFD linker knows what the default object file format is, so + # first see if it will tell us. + ld_help_string=`ld --help 2>&1` + ld_supported_emulations=`echo $ld_help_string \ + | sed -ne '/supported emulations:/!d + s/[ ][ ]*/ /g + s/.*supported emulations: *// + s/ .*// + p'` + case "$ld_supported_emulations" in + i?86linux) echo "${UNAME_MACHINE}-pc-linux-gnuaout" ; exit 0 ;; + i?86coff) echo "${UNAME_MACHINE}-pc-linux-gnucoff" ; exit 0 ;; + sparclinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;; + armlinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;; + m68klinux) echo "${UNAME_MACHINE}-unknown-linux-gnuaout" ; exit 0 ;; + elf32ppc) echo "powerpc-unknown-linux-gnu" ; exit 0 ;; + esac + + if test "${UNAME_MACHINE}" = "alpha" ; then + sed 's/^ //' <dummy.s + .globl main + .ent main + main: + .frame \$30,0,\$26,0 + .prologue 0 + .long 0x47e03d80 # implver $0 + lda \$2,259 + .long 0x47e20c21 # amask $2,$1 + srl \$1,8,\$2 + sll \$2,2,\$2 + sll \$0,3,\$0 + addl \$1,\$0,\$0 + addl \$2,\$0,\$0 + ret \$31,(\$26),1 + .end main +EOF + LIBC="" + ${CC-cc} dummy.s -o dummy 2>/dev/null + if test "$?" = 0 ; then + ./dummy + case "$?" in + 7) + UNAME_MACHINE="alpha" + ;; + 15) + UNAME_MACHINE="alphaev5" + ;; + 14) + UNAME_MACHINE="alphaev56" + ;; + 10) + UNAME_MACHINE="alphapca56" + ;; + 16) + UNAME_MACHINE="alphaev6" + ;; + esac + + objdump --private-headers dummy | \ + grep ld.so.1 > /dev/null + if test "$?" = 0 ; then + LIBC="libc1" + fi + fi + rm -f dummy.s dummy + echo ${UNAME_MACHINE}-unknown-linux-gnu${LIBC} ; exit 0 + elif test "${UNAME_MACHINE}" = "mips" ; then + cat >dummy.c </dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + else + # Either a pre-BFD a.out linker (linux-gnuoldld) + # or one that does not give us useful --help. + # GCC wants to distinguish between linux-gnuoldld and linux-gnuaout. + # If ld does not provide *any* "supported emulations:" + # that means it is gnuoldld. + echo "$ld_help_string" | grep >/dev/null 2>&1 "supported emulations:" + test $? != 0 && echo "${UNAME_MACHINE}-pc-linux-gnuoldld" && exit 0 + + case "${UNAME_MACHINE}" in + i?86) + VENDOR=pc; + ;; + *) + VENDOR=unknown; + ;; + esac + # Determine whether the default compiler is a.out or elf + cat >dummy.c < +main(argc, argv) + int argc; + char *argv[]; +{ +#ifdef __ELF__ +# ifdef __GLIBC__ +# if __GLIBC__ >= 2 + printf ("%s-${VENDOR}-linux-gnu\n", argv[1]); +# else + printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]); +# endif +# else + printf ("%s-${VENDOR}-linux-gnulibc1\n", argv[1]); +# endif +#else + printf ("%s-${VENDOR}-linux-gnuaout\n", argv[1]); +#endif + return 0; +} +EOF + ${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy "${UNAME_MACHINE}" && rm dummy.c dummy && exit 0 + rm -f dummy.c dummy + fi ;; +# ptx 4.0 does uname -s correctly, with DYNIX/ptx in there. earlier versions +# are messed up and put the nodename in both sysname and nodename. + i?86:DYNIX/ptx:4*:*) + echo i386-sequent-sysv4 + exit 0 ;; + i?86:UNIX_SV:4.2MP:2.*) + # Unixware is an offshoot of SVR4, but it has its own version + # number series starting with 2... + # I am not positive that other SVR4 systems won't match this, + # I just have to hope. -- rms. + # Use sysv4.2uw... so that sysv4* matches it. + echo ${UNAME_MACHINE}-pc-sysv4.2uw${UNAME_VERSION} + exit 0 ;; + i?86:*:4.*:* | i?86:SYSTEM_V:4.*:*) + if grep Novell /usr/include/link.h >/dev/null 2>/dev/null; then + echo ${UNAME_MACHINE}-univel-sysv${UNAME_RELEASE} + else + echo ${UNAME_MACHINE}-pc-sysv${UNAME_RELEASE} + fi + exit 0 ;; + i?86:*:3.2:*) + if test -f /usr/options/cb.name; then + UNAME_REL=`sed -n 's/.*Version //p' /dev/null >/dev/null ; then + UNAME_REL=`(/bin/uname -X|egrep Release|sed -e 's/.*= //')` + (/bin/uname -X|egrep i80486 >/dev/null) && UNAME_MACHINE=i486 + (/bin/uname -X|egrep '^Machine.*Pentium' >/dev/null) \ + && UNAME_MACHINE=i586 + echo ${UNAME_MACHINE}-pc-sco$UNAME_REL + else + echo ${UNAME_MACHINE}-pc-sysv32 + fi + exit 0 ;; + pc:*:*:*) + # uname -m prints for DJGPP always 'pc', but it prints nothing about + # the processor, so we play safe by assuming i386. + echo i386-pc-msdosdjgpp + exit 0 ;; + Intel:Mach:3*:*) + echo i386-pc-mach3 + exit 0 ;; + paragon:*:*:*) + echo i860-intel-osf1 + exit 0 ;; + i860:*:4.*:*) # i860-SVR4 + if grep Stardent /usr/include/sys/uadmin.h >/dev/null 2>&1 ; then + echo i860-stardent-sysv${UNAME_RELEASE} # Stardent Vistra i860-SVR4 + else # Add other i860-SVR4 vendors below as they are discovered. + echo i860-unknown-sysv${UNAME_RELEASE} # Unknown i860-SVR4 + fi + exit 0 ;; + mini*:CTIX:SYS*5:*) + # "miniframe" + echo m68010-convergent-sysv + exit 0 ;; + M68*:*:R3V[567]*:*) + test -r /sysV68 && echo 'm68k-motorola-sysv' && exit 0 ;; + 3[34]??:*:4.0:3.0 | 3[34]??,*:*:4.0:3.0 | 4850:*:4.0:3.0) + OS_REL='' + test -r /etc/.relid \ + && OS_REL=.`sed -n 's/[^ ]* [^ ]* \([0-9][0-9]\).*/\1/p' < /etc/.relid` + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && echo i486-ncr-sysv4.3${OS_REL} && exit 0 + /bin/uname -p 2>/dev/null | /bin/grep entium >/dev/null \ + && echo i586-ncr-sysv4.3${OS_REL} && exit 0 ;; + 3[34]??:*:4.0:* | 3[34]??,*:*:4.0:*) + /bin/uname -p 2>/dev/null | grep 86 >/dev/null \ + && echo i486-ncr-sysv4 && exit 0 ;; + m68*:LynxOS:2.*:*) + echo m68k-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + mc68030:UNIX_System_V:4.*:*) + echo m68k-atari-sysv4 + exit 0 ;; + i?86:LynxOS:2.*:*) + echo i386-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + TSUNAMI:LynxOS:2.*:*) + echo sparc-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + rs6000:LynxOS:2.*:* | PowerPC:LynxOS:2.*:*) + echo rs6000-unknown-lynxos${UNAME_RELEASE} + exit 0 ;; + SM[BE]S:UNIX_SV:*:*) + echo mips-dde-sysv${UNAME_RELEASE} + exit 0 ;; + RM*:SINIX-*:*:*) + echo mips-sni-sysv4 + exit 0 ;; + *:SINIX-*:*:*) + if uname -p 2>/dev/null >/dev/null ; then + UNAME_MACHINE=`(uname -p) 2>/dev/null` + echo ${UNAME_MACHINE}-sni-sysv4 + else + echo ns32k-sni-sysv + fi + exit 0 ;; + PENTIUM:CPunix:4.0*:*) # Unisys `ClearPath HMP IX 4000' SVR4/MP effort + # says + echo i586-unisys-sysv4 + exit 0 ;; + *:UNIX_System_V:4*:FTX*) + # From Gerald Hewes . + # How about differentiating between stratus architectures? -djm + echo hppa1.1-stratus-sysv4 + exit 0 ;; + *:*:*:FTX*) + # From seanf@swdc.stratus.com. + echo i860-stratus-sysv4 + exit 0 ;; + mc68*:A/UX:*:*) + echo m68k-apple-aux${UNAME_RELEASE} + exit 0 ;; + news*:NEWS-OS:*:6*) + echo mips-sony-newsos6 + exit 0 ;; + R3000:*System_V*:*:* | R4000:UNIX_SYSV:*:*) + if [ -d /usr/nec ]; then + echo mips-nec-sysv${UNAME_RELEASE} + else + echo mips-unknown-sysv${UNAME_RELEASE} + fi + exit 0 ;; +esac + +#echo '(No uname command or uname output not recognized.)' 1>&2 +#echo "${UNAME_MACHINE}:${UNAME_SYSTEM}:${UNAME_RELEASE}:${UNAME_VERSION}" 1>&2 + +cat >dummy.c < +# include +#endif +main () +{ +#if defined (sony) +#if defined (MIPSEB) + /* BFD wants "bsd" instead of "newsos". Perhaps BFD should be changed, + I don't know.... */ + printf ("mips-sony-bsd\n"); exit (0); +#else +#include + printf ("m68k-sony-newsos%s\n", +#ifdef NEWSOS4 + "4" +#else + "" +#endif + ); exit (0); +#endif +#endif + +#if defined (__arm) && defined (__acorn) && defined (__unix) + printf ("arm-acorn-riscix"); exit (0); +#endif + +#if defined (hp300) && !defined (hpux) + printf ("m68k-hp-bsd\n"); exit (0); +#endif + +#if defined (NeXT) +#if !defined (__ARCHITECTURE__) +#define __ARCHITECTURE__ "m68k" +#endif + int version; + version=`(hostinfo | sed -n 's/.*NeXT Mach \([0-9]*\).*/\1/p') 2>/dev/null`; + printf ("%s-next-nextstep%d\n", __ARCHITECTURE__, version); + exit (0); +#endif + +#if defined (MULTIMAX) || defined (n16) +#if defined (UMAXV) + printf ("ns32k-encore-sysv\n"); exit (0); +#else +#if defined (CMU) + printf ("ns32k-encore-mach\n"); exit (0); +#else + printf ("ns32k-encore-bsd\n"); exit (0); +#endif +#endif +#endif + +#if defined (__386BSD__) + printf ("i386-pc-bsd\n"); exit (0); +#endif + +#if defined (sequent) +#if defined (i386) + printf ("i386-sequent-dynix\n"); exit (0); +#endif +#if defined (ns32000) + printf ("ns32k-sequent-dynix\n"); exit (0); +#endif +#endif + +#if defined (_SEQUENT_) + struct utsname un; + + uname(&un); + + if (strncmp(un.version, "V2", 2) == 0) { + printf ("i386-sequent-ptx2\n"); exit (0); + } + if (strncmp(un.version, "V1", 2) == 0) { /* XXX is V1 correct? */ + printf ("i386-sequent-ptx1\n"); exit (0); + } + printf ("i386-sequent-ptx\n"); exit (0); + +#endif + +#if defined (vax) +#if !defined (ultrix) + printf ("vax-dec-bsd\n"); exit (0); +#else + printf ("vax-dec-ultrix\n"); exit (0); +#endif +#endif + +#if defined (alliant) && defined (i860) + printf ("i860-alliant-bsd\n"); exit (0); +#endif + + exit (1); +} +EOF + +${CC-cc} dummy.c -o dummy 2>/dev/null && ./dummy && rm dummy.c dummy && exit 0 +rm -f dummy.c dummy + +# Apollos put the system type in the environment. + +test -d /usr/apollo && { echo ${ISP}-apollo-${SYSTYPE}; exit 0; } + +# Convex versions that predate uname can use getsysinfo(1) + +if [ -x /usr/convex/getsysinfo ] +then + case `getsysinfo -f cpu_type` in + c1*) + echo c1-convex-bsd + exit 0 ;; + c2*) + if getsysinfo -f scalar_acc + then echo c32-convex-bsd + else echo c2-convex-bsd + fi + exit 0 ;; + c34*) + echo c34-convex-bsd + exit 0 ;; + c38*) + echo c38-convex-bsd + exit 0 ;; + c4*) + echo c4-convex-bsd + exit 0 ;; + esac +fi + +#echo '(Unable to guess system type)' 1>&2 + +exit 1 diff --git a/config.sub b/config.sub new file mode 100644 index 00000000..e24b8504 --- /dev/null +++ b/config.sub @@ -0,0 +1,952 @@ +#! /bin/sh +# Configuration validation subroutine script, version 1.1. +# Copyright (C) 1991, 92-97, 1998 Free Software Foundation, Inc. +# This file is (in principle) common to ALL GNU software. +# The presence of a machine in this file suggests that SOME GNU software +# can handle that machine. It does not imply ALL GNU software can. +# +# This file is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, +# Boston, MA 02111-1307, USA. + +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Configuration subroutine to validate and canonicalize a configuration type. +# Supply the specified configuration type as an argument. +# If it is invalid, we print an error message on stderr and exit with code 1. +# Otherwise, we print the canonical config type on stdout and succeed. + +# This file is supposed to be the same for all GNU packages +# and recognize all the CPU types, system types and aliases +# that are meaningful with *any* GNU software. +# Each package is responsible for reporting which valid configurations +# it does not support. The user should be able to distinguish +# a failure to support a valid configuration from a meaningless +# configuration. + +# The goal of this file is to map all the various variations of a given +# machine specification into a single specification in the form: +# CPU_TYPE-MANUFACTURER-OPERATING_SYSTEM +# or in some cases, the newer four-part form: +# CPU_TYPE-MANUFACTURER-KERNEL-OPERATING_SYSTEM +# It is wrong to echo any other type of specification. + +if [ x$1 = x ] +then + echo Configuration name missing. 1>&2 + echo "Usage: $0 CPU-MFR-OPSYS" 1>&2 + echo "or $0 ALIAS" 1>&2 + echo where ALIAS is a recognized configuration type. 1>&2 + exit 1 +fi + +# First pass through any local machine types. +case $1 in + *local*) + echo $1 + exit 0 + ;; + *) + ;; +esac + +# Separate what the user gave into CPU-COMPANY and OS or KERNEL-OS (if any). +# Here we must recognize all the valid KERNEL-OS combinations. +maybe_os=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\2/'` +case $maybe_os in + linux-gnu*) + os=-$maybe_os + basic_machine=`echo $1 | sed 's/^\(.*\)-\([^-]*-[^-]*\)$/\1/'` + ;; + *) + basic_machine=`echo $1 | sed 's/-[^-]*$//'` + if [ $basic_machine != $1 ] + then os=`echo $1 | sed 's/.*-/-/'` + else os=; fi + ;; +esac + +### Let's recognize common machines as not being operating systems so +### that things like config.sub decstation-3100 work. We also +### recognize some manufacturers as not being operating systems, so we +### can provide default operating systems below. +case $os in + -sun*os*) + # Prevent following clause from handling this invalid input. + ;; + -dec* | -mips* | -sequent* | -encore* | -pc532* | -sgi* | -sony* | \ + -att* | -7300* | -3300* | -delta* | -motorola* | -sun[234]* | \ + -unicom* | -ibm* | -next | -hp | -isi* | -apollo | -altos* | \ + -convergent* | -ncr* | -news | -32* | -3600* | -3100* | -hitachi* |\ + -c[123]* | -convex* | -sun | -crds | -omron* | -dg | -ultra | -tti* | \ + -harris | -dolphin | -highlevel | -gould | -cbm | -ns | -masscomp | \ + -apple) + os= + basic_machine=$1 + ;; + -hiux*) + os=-hiuxwe2 + ;; + -sco5) + os=sco3.2v5 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco4) + os=-sco3.2v4 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco3.2.[4-9]*) + os=`echo $os | sed -e 's/sco3.2./sco3.2v/'` + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco3.2v[4-9]*) + # Don't forget version if it is 3.2v4 or newer. + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -sco*) + os=-sco3.2v2 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -isc) + os=-isc2.2 + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -clix*) + basic_machine=clipper-intergraph + ;; + -isc*) + basic_machine=`echo $1 | sed -e 's/86-.*/86-pc/'` + ;; + -lynx*) + os=-lynxos + ;; + -ptx*) + basic_machine=`echo $1 | sed -e 's/86-.*/86-sequent/'` + ;; + -windowsnt*) + os=`echo $os | sed -e 's/windowsnt/winnt/'` + ;; + -psos*) + os=-psos + ;; +esac + +# Decode aliases for certain CPU-COMPANY combinations. +case $basic_machine in + # Recognize the basic CPU types without company name. + # Some are omitted here because they have special meanings below. + tahoe | i860 | m32r | m68k | m68000 | m88k | ns32k | arc | arm \ + | arme[lb] | pyramid | mn10200 | mn10300 \ + | tron | a29k | 580 | i960 | h8300 | hppa | hppa1.0 | hppa1.1 \ + | alpha | alphaev5 | alphaev56 | we32k | ns16k | clipper \ + | i370 | sh | powerpc | powerpcle | 1750a | dsp16xx | pdp11 \ + | mips64 | mipsel | mips64el | mips64orion | mips64orionel \ + | mipstx39 | mipstx39el \ + | sparc | sparclet | sparclite | sparc64 | v850) + basic_machine=$basic_machine-unknown + ;; + # We use `pc' rather than `unknown' + # because (1) that's what they normally are, and + # (2) the word "unknown" tends to confuse beginning users. + i[34567]86) + basic_machine=$basic_machine-pc + ;; + # Object if more than one company name word. + *-*-*) + echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2 + exit 1 + ;; + # Recognize the basic CPU types with company name. + vax-* | tahoe-* | i[34567]86-* | i860-* | m32r-* | m68k-* | m68000-* \ + | m88k-* | sparc-* | ns32k-* | fx80-* | arc-* | arm-* | c[123]* \ + | mips-* | pyramid-* | tron-* | a29k-* | romp-* | rs6000-* \ + | power-* | none-* | 580-* | cray2-* | h8300-* | i960-* \ + | xmp-* | ymp-* | hppa-* | hppa1.0-* | hppa1.1-* \ + | alpha-* | alphaev5-* | alphaev56-* | we32k-* | cydra-* \ + | ns16k-* | pn-* | np1-* | xps100-* | clipper-* | orion-* \ + | sparclite-* | pdp11-* | sh-* | powerpc-* | powerpcle-* \ + | sparc64-* | mips64-* | mipsel-* \ + | mips64el-* | mips64orion-* | mips64orionel-* \ + | mipstx39-* | mipstx39el-* \ + | f301-*) + ;; + # Recognize the various machine names and aliases which stand + # for a CPU type and a company and sometimes even an OS. + 3b1 | 7300 | 7300-att | att-7300 | pc7300 | safari | unixpc) + basic_machine=m68000-att + ;; + 3b*) + basic_machine=we32k-att + ;; + alliant | fx80) + basic_machine=fx80-alliant + ;; + altos | altos3068) + basic_machine=m68k-altos + ;; + am29k) + basic_machine=a29k-none + os=-bsd + ;; + amdahl) + basic_machine=580-amdahl + os=-sysv + ;; + amiga | amiga-*) + basic_machine=m68k-cbm + ;; + amigaos | amigados) + basic_machine=m68k-cbm + os=-amigaos + ;; + amigaunix | amix) + basic_machine=m68k-cbm + os=-sysv4 + ;; + apollo68) + basic_machine=m68k-apollo + os=-sysv + ;; + aux) + basic_machine=m68k-apple + os=-aux + ;; + balance) + basic_machine=ns32k-sequent + os=-dynix + ;; + convex-c1) + basic_machine=c1-convex + os=-bsd + ;; + convex-c2) + basic_machine=c2-convex + os=-bsd + ;; + convex-c32) + basic_machine=c32-convex + os=-bsd + ;; + convex-c34) + basic_machine=c34-convex + os=-bsd + ;; + convex-c38) + basic_machine=c38-convex + os=-bsd + ;; + cray | ymp) + basic_machine=ymp-cray + os=-unicos + ;; + cray2) + basic_machine=cray2-cray + os=-unicos + ;; + [ctj]90-cray) + basic_machine=c90-cray + os=-unicos + ;; + crds | unos) + basic_machine=m68k-crds + ;; + da30 | da30-*) + basic_machine=m68k-da30 + ;; + decstation | decstation-3100 | pmax | pmax-* | pmin | dec3100 | decstatn) + basic_machine=mips-dec + ;; + delta | 3300 | motorola-3300 | motorola-delta \ + | 3300-motorola | delta-motorola) + basic_machine=m68k-motorola + ;; + delta88) + basic_machine=m88k-motorola + os=-sysv3 + ;; + dpx20 | dpx20-*) + basic_machine=rs6000-bull + os=-bosx + ;; + dpx2* | dpx2*-bull) + basic_machine=m68k-bull + os=-sysv3 + ;; + ebmon29k) + basic_machine=a29k-amd + os=-ebmon + ;; + elxsi) + basic_machine=elxsi-elxsi + os=-bsd + ;; + encore | umax | mmax) + basic_machine=ns32k-encore + ;; + fx2800) + basic_machine=i860-alliant + ;; + genix) + basic_machine=ns32k-ns + ;; + gmicro) + basic_machine=tron-gmicro + os=-sysv + ;; + h3050r* | hiux*) + basic_machine=hppa1.1-hitachi + os=-hiuxwe2 + ;; + h8300hms) + basic_machine=h8300-hitachi + os=-hms + ;; + harris) + basic_machine=m88k-harris + os=-sysv3 + ;; + hp300-*) + basic_machine=m68k-hp + ;; + hp300bsd) + basic_machine=m68k-hp + os=-bsd + ;; + hp300hpux) + basic_machine=m68k-hp + os=-hpux + ;; + hp9k2[0-9][0-9] | hp9k31[0-9]) + basic_machine=m68000-hp + ;; + hp9k3[2-9][0-9]) + basic_machine=m68k-hp + ;; + hp9k7[0-9][0-9] | hp7[0-9][0-9] | hp9k8[0-9]7 | hp8[0-9]7) + basic_machine=hppa1.1-hp + ;; + hp9k8[0-9][0-9] | hp8[0-9][0-9]) + basic_machine=hppa1.0-hp + ;; + hppa-next) + os=-nextstep3 + ;; + i370-ibm* | ibm*) + basic_machine=i370-ibm + os=-mvs + ;; +# I'm not sure what "Sysv32" means. Should this be sysv3.2? + i[34567]86v32) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv32 + ;; + i[34567]86v4*) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv4 + ;; + i[34567]86v) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-sysv + ;; + i[34567]86sol2) + basic_machine=`echo $1 | sed -e 's/86.*/86-pc/'` + os=-solaris2 + ;; + iris | iris4d) + basic_machine=mips-sgi + case $os in + -irix*) + ;; + *) + os=-irix4 + ;; + esac + ;; + isi68 | isi) + basic_machine=m68k-isi + os=-sysv + ;; + m88k-omron*) + basic_machine=m88k-omron + ;; + magnum | m3230) + basic_machine=mips-mips + os=-sysv + ;; + merlin) + basic_machine=ns32k-utek + os=-sysv + ;; + miniframe) + basic_machine=m68000-convergent + ;; + mipsel*-linux*) + basic_machine=mipsel-unknown + os=-linux-gnu + ;; + mips*-linux*) + basic_machine=mips-unknown + os=-linux-gnu + ;; + mips3*-*) + basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'` + ;; + mips3*) + basic_machine=`echo $basic_machine | sed -e 's/mips3/mips64/'`-unknown + ;; + ncr3000) + basic_machine=i486-ncr + os=-sysv4 + ;; + news | news700 | news800 | news900) + basic_machine=m68k-sony + os=-newsos + ;; + news1000) + basic_machine=m68030-sony + os=-newsos + ;; + news-3600 | risc-news) + basic_machine=mips-sony + os=-newsos + ;; + next | m*-next ) + basic_machine=m68k-next + case $os in + -nextstep* ) + ;; + -ns2*) + os=-nextstep2 + ;; + *) + os=-nextstep3 + ;; + esac + ;; + nh3000) + basic_machine=m68k-harris + os=-cxux + ;; + nh[45]000) + basic_machine=m88k-harris + os=-cxux + ;; + nindy960) + basic_machine=i960-intel + os=-nindy + ;; + np1) + basic_machine=np1-gould + ;; + pa-hitachi) + basic_machine=hppa1.1-hitachi + os=-hiuxwe2 + ;; + paragon) + basic_machine=i860-intel + os=-osf + ;; + pbd) + basic_machine=sparc-tti + ;; + pbb) + basic_machine=m68k-tti + ;; + pc532 | pc532-*) + basic_machine=ns32k-pc532 + ;; + pentium | p5 | k5 | nexen) + basic_machine=i586-pc + ;; + pentiumpro | p6 | k6 | 6x86) + basic_machine=i686-pc + ;; + pentiumii | pentium2) + basic_machine=i786-pc + ;; + pentium-* | p5-* | k5-* | nexen-*) + basic_machine=i586-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pentiumpro-* | p6-* | k6-* | 6x86-*) + basic_machine=i686-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pentiumii-* | pentium2-*) + basic_machine=i786-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + pn) + basic_machine=pn-gould + ;; + power) basic_machine=rs6000-ibm + ;; + ppc) basic_machine=powerpc-unknown + ;; + ppc-*) basic_machine=powerpc-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ppcle | powerpclittle | ppc-le | powerpc-little) + basic_machine=powerpcle-unknown + ;; + ppcle-* | powerpclittle-*) + basic_machine=powerpcle-`echo $basic_machine | sed 's/^[^-]*-//'` + ;; + ps2) + basic_machine=i386-ibm + ;; + rm[46]00) + basic_machine=mips-siemens + ;; + rtpc | rtpc-*) + basic_machine=romp-ibm + ;; + sequent) + basic_machine=i386-sequent + ;; + sh) + basic_machine=sh-hitachi + os=-hms + ;; + sps7) + basic_machine=m68k-bull + os=-sysv2 + ;; + spur) + basic_machine=spur-unknown + ;; + sun2) + basic_machine=m68000-sun + ;; + sun2os3) + basic_machine=m68000-sun + os=-sunos3 + ;; + sun2os4) + basic_machine=m68000-sun + os=-sunos4 + ;; + sun3os3) + basic_machine=m68k-sun + os=-sunos3 + ;; + sun3os4) + basic_machine=m68k-sun + os=-sunos4 + ;; + sun4os3) + basic_machine=sparc-sun + os=-sunos3 + ;; + sun4os4) + basic_machine=sparc-sun + os=-sunos4 + ;; + sun4sol2) + basic_machine=sparc-sun + os=-solaris2 + ;; + sun3 | sun3-*) + basic_machine=m68k-sun + ;; + sun4) + basic_machine=sparc-sun + ;; + sun386 | sun386i | roadrunner) + basic_machine=i386-sun + ;; + symmetry) + basic_machine=i386-sequent + os=-dynix + ;; + tx39) + basic_machine=mipstx39-unknown + ;; + tx39el) + basic_machine=mipstx39el-unknown + ;; + tower | tower-32) + basic_machine=m68k-ncr + ;; + udi29k) + basic_machine=a29k-amd + os=-udi + ;; + ultra3) + basic_machine=a29k-nyu + os=-sym1 + ;; + vaxv) + basic_machine=vax-dec + os=-sysv + ;; + vms) + basic_machine=vax-dec + os=-vms + ;; + vpp*|vx|vx-*) + basic_machine=f301-fujitsu + ;; + vxworks960) + basic_machine=i960-wrs + os=-vxworks + ;; + vxworks68) + basic_machine=m68k-wrs + os=-vxworks + ;; + vxworks29k) + basic_machine=a29k-wrs + os=-vxworks + ;; + xmp) + basic_machine=xmp-cray + os=-unicos + ;; + xps | xps100) + basic_machine=xps100-honeywell + ;; + none) + basic_machine=none-none + os=-none + ;; + +# Here we handle the default manufacturer of certain CPU types. It is in +# some cases the only manufacturer, in others, it is the most popular. + mips) + if [ x$os = x-linux-gnu ]; then + basic_machine=mips-unknown + else + basic_machine=mips-mips + fi + ;; + romp) + basic_machine=romp-ibm + ;; + rs6000) + basic_machine=rs6000-ibm + ;; + vax) + basic_machine=vax-dec + ;; + pdp11) + basic_machine=pdp11-dec + ;; + we32k) + basic_machine=we32k-att + ;; + sparc) + basic_machine=sparc-sun + ;; + cydra) + basic_machine=cydra-cydrome + ;; + orion) + basic_machine=orion-highlevel + ;; + orion105) + basic_machine=clipper-highlevel + ;; + *) + echo Invalid configuration \`$1\': machine \`$basic_machine\' not recognized 1>&2 + exit 1 + ;; +esac + +# Here we canonicalize certain aliases for manufacturers. +case $basic_machine in + *-digital*) + basic_machine=`echo $basic_machine | sed 's/digital.*/dec/'` + ;; + *-commodore*) + basic_machine=`echo $basic_machine | sed 's/commodore.*/cbm/'` + ;; + *) + ;; +esac + +# Decode manufacturer-specific aliases for certain operating systems. + +if [ x"$os" != x"" ] +then +case $os in + # First match some system type aliases + # that might get confused with valid system types. + # -solaris* is a basic system type, with this one exception. + -solaris1 | -solaris1.*) + os=`echo $os | sed -e 's|solaris1|sunos4|'` + ;; + -solaris) + os=-solaris2 + ;; + -svr4*) + os=-sysv4 + ;; + -unixware*) + os=-sysv4.2uw + ;; + -gnu/linux*) + os=`echo $os | sed -e 's|gnu/linux|linux-gnu|'` + ;; + # First accept the basic system types. + # The portable systems comes first. + # Each alternative MUST END IN A *, to match a version number. + # -sysv* is not here because it comes later, after sysvr4. + -gnu* | -bsd* | -mach* | -minix* | -genix* | -ultrix* | -irix* \ + | -*vms* | -sco* | -esix* | -isc* | -aix* | -sunos | -sunos[34]*\ + | -hpux* | -unos* | -osf* | -luna* | -dgux* | -solaris* | -sym* \ + | -amigaos* | -amigados* | -msdos* | -newsos* | -unicos* | -aof* \ + | -aos* \ + | -nindy* | -vxsim* | -vxworks* | -ebmon* | -hms* | -mvs* \ + | -clix* | -riscos* | -uniplus* | -iris* | -rtu* | -xenix* \ + | -hiux* | -386bsd* | -netbsd* | -openbsd* | -freebsd* | -riscix* \ + | -lynxos* | -bosx* | -nextstep* | -cxux* | -aout* | -elf* \ + | -ptx* | -coff* | -ecoff* | -winnt* | -domain* | -vsta* \ + | -udi* | -eabi* | -lites* | -ieee* | -go32* | -aux* \ + | -cygwin32* | -pe* | -psos* | -moss* | -proelf* | -rtems* \ + | -mingw32* | -linux-gnu* | -uxpv*) + # Remember, each alternative MUST END IN *, to match a version number. + ;; + -linux*) + os=`echo $os | sed -e 's|linux|linux-gnu|'` + ;; + -sunos5*) + os=`echo $os | sed -e 's|sunos5|solaris2|'` + ;; + -sunos6*) + os=`echo $os | sed -e 's|sunos6|solaris3|'` + ;; + -osfrose*) + os=-osfrose + ;; + -osf*) + os=-osf + ;; + -utek*) + os=-bsd + ;; + -dynix*) + os=-bsd + ;; + -acis*) + os=-aos + ;; + -ctix* | -uts*) + os=-sysv + ;; + -ns2 ) + os=-nextstep2 + ;; + # Preserve the version number of sinix5. + -sinix5.*) + os=`echo $os | sed -e 's|sinix|sysv|'` + ;; + -sinix*) + os=-sysv4 + ;; + -triton*) + os=-sysv3 + ;; + -oss*) + os=-sysv3 + ;; + -svr4) + os=-sysv4 + ;; + -svr3) + os=-sysv3 + ;; + -sysvr4) + os=-sysv4 + ;; + # This must come after -sysvr4. + -sysv*) + ;; + -xenix) + os=-xenix + ;; + -none) + ;; + *) + # Get rid of the `-' at the beginning of $os. + os=`echo $os | sed 's/[^-]*-//'` + echo Invalid configuration \`$1\': system \`$os\' not recognized 1>&2 + exit 1 + ;; +esac +else + +# Here we handle the default operating systems that come with various machines. +# The value should be what the vendor currently ships out the door with their +# machine or put another way, the most popular os provided with the machine. + +# Note that if you're going to try to match "-MANUFACTURER" here (say, +# "-sun"), then you have to tell the case statement up towards the top +# that MANUFACTURER isn't an operating system. Otherwise, code above +# will signal an error saying that MANUFACTURER isn't an operating +# system, and we'll never get to this point. + +case $basic_machine in + *-acorn) + os=-riscix1.2 + ;; + arm*-semi) + os=-aout + ;; + pdp11-*) + os=-none + ;; + *-dec | vax-*) + os=-ultrix4.2 + ;; + m68*-apollo) + os=-domain + ;; + i386-sun) + os=-sunos4.0.2 + ;; + m68000-sun) + os=-sunos3 + # This also exists in the configure program, but was not the + # default. + # os=-sunos4 + ;; + *-tti) # must be before sparc entry or we get the wrong os. + os=-sysv3 + ;; + sparc-* | *-sun) + os=-sunos4.1.1 + ;; + *-ibm) + os=-aix + ;; + *-hp) + os=-hpux + ;; + *-hitachi) + os=-hiux + ;; + i860-* | *-att | *-ncr | *-altos | *-motorola | *-convergent) + os=-sysv + ;; + *-cbm) + os=-amigaos + ;; + *-dg) + os=-dgux + ;; + *-dolphin) + os=-sysv3 + ;; + m68k-ccur) + os=-rtu + ;; + m88k-omron*) + os=-luna + ;; + *-next ) + os=-nextstep + ;; + *-sequent) + os=-ptx + ;; + *-crds) + os=-unos + ;; + *-ns) + os=-genix + ;; + i370-*) + os=-mvs + ;; + *-next) + os=-nextstep3 + ;; + *-gould) + os=-sysv + ;; + *-highlevel) + os=-bsd + ;; + *-encore) + os=-bsd + ;; + *-sgi) + os=-irix + ;; + *-siemens) + os=-sysv4 + ;; + *-masscomp) + os=-rtu + ;; + f301-fujitsu) + os=-uxpv + ;; + *) + os=-none + ;; +esac +fi + +# Here we handle the case where we know the os, and the CPU type, but not the +# manufacturer. We pick the logical manufacturer. +vendor=unknown +case $basic_machine in + *-unknown) + case $os in + -riscix*) + vendor=acorn + ;; + -sunos*) + vendor=sun + ;; + -aix*) + vendor=ibm + ;; + -hpux*) + vendor=hp + ;; + -hiux*) + vendor=hitachi + ;; + -unos*) + vendor=crds + ;; + -dgux*) + vendor=dg + ;; + -luna*) + vendor=omron + ;; + -genix*) + vendor=ns + ;; + -mvs*) + vendor=ibm + ;; + -ptx*) + vendor=sequent + ;; + -vxsim* | -vxworks*) + vendor=wrs + ;; + -aux*) + vendor=apple + ;; + esac + basic_machine=`echo $basic_machine | sed "s/unknown/$vendor/"` + ;; +esac + +echo $basic_machine$os diff --git a/configure.in b/configure.in index 3ea6e2fa..271c1a14 100644 --- a/configure.in +++ b/configure.in @@ -1,17 +1,18 @@ dnl Process this file with autoconf to produce a configure script. +AC_INIT(src/control/control.c) +AM_INIT_AUTOMAKE(alsa-lib, 0.1.2) -AC_INIT(Makefile.conf.in) AC_PREFIX_DEFAULT(/usr) dnl Checks for programs. AC_PROG_CC -AC_PROG_RANLIB AC_PROG_INSTALL AC_PROG_LN_S +AM_PROG_LIBTOOL dnl Checks for header files. AC_HEADER_STDC -AC_CONFIG_HEADER(include/config.h) +AM_CONFIG_HEADER(include/config.h) AC_CHECK_HEADERS(linux/asound.h) dnl Checks for typedefs, structures, and compiler characteristics. @@ -23,41 +24,9 @@ AC_HEADER_TIME dnl Checks for library functions. AC_PROG_GCC_TRADITIONAL -dnl Check for ALSA driver package. -myprefix=$prefix -if test "$myprefix" = "NONE"; then - myprefix=$ac_default_prefix -fi -CFLAGS="-I$myprefix/include" -#echo "CFLAGS=$CFLAGS" -AC_MSG_CHECKING(for alsa-driver package) -AC_TRY_RUN([ -#include -void main(void) -{ -#if !defined( SND_PROTOCOL_VERSION ) || !defined( SND_PROTOCOL_UNCOMPATIBLE ) - exit(1); -#else - exit(0); -#endif -} -], - AC_MSG_RESULT("present"), - AC_MSG_RESULT("not found"); echo "Fatal error: Install alsa-driver v0.2.0pre6+ package at first..."; exit 1;, - AC_MSG_RESULT("not supported"); echo "Fatal error: Cross-compiling isn't supported..."; exit 1;, -) +AM_PATH_ALSA -dnl Check for version... -AC_MSG_CHECKING(for library version) -SND_LIB_VERSION=`cat $srcdir/version` -AC_DEFINE_UNQUOTED(SND_LIB_VERSION, "$SND_LIB_VERSION") -AC_SUBST(SND_LIB_VERSION) -SND_LIB_MAJOR=`echo $SND_LIB_VERSION | cut -d . -f 1` -AC_SUBST(SND_LIB_MAJOR) -SND_LIB_MINOR=`echo $SND_LIB_VERSION | cut -d . -f 2` -AC_SUBST(SND_LIB_MINOR) -SND_LIB_SUBMINOR=`echo $SND_LIB_VERSION | cut -d . -f 3` -AC_SUBST(SND_LIB_SUBMINOR) -AC_MSG_RESULT($SND_LIB_VERSION) - -AC_OUTPUT(Makefile.conf include/version.h utils/alsa-lib.spec) +AC_OUTPUT(Makefile doc/Makefile include/Makefile src/Makefile \ + src/control/Makefile src/mixer/Makefile src/pcm/Makefile \ + src/rawmidi/Makefile test/Makefile utils/Makefile include/version.h \ + utils/alsa-lib.spec) diff --git a/doc/Makefile b/doc/Makefile deleted file mode 100644 index 708995bf..00000000 --- a/doc/Makefile +++ /dev/null @@ -1,20 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -include ../Makefile.conf - -TARGETS=soundapi.txt \ - soundapi.html - -all: $(TARGETS) - -soundapi.txt: soundapi.sgml - sgml2txt soundapi.sgml - -soundapi.html: soundapi.sgml - sgml2html soundapi.sgml - -clean: - rm -f core .depend *.orig *~ diff --git a/doc/Makefile.am b/doc/Makefile.am new file mode 100644 index 00000000..aa8e4466 --- /dev/null +++ b/doc/Makefile.am @@ -0,0 +1,3 @@ + + +INCLUDES=-I$(top_srcdir)/include diff --git a/doc/Makefile.in b/doc/Makefile.in new file mode 100644 index 00000000..a9ef7226 --- /dev/null +++ b/doc/Makefile.in @@ -0,0 +1,159 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: Makefile + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps doc/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + +tags: TAGS +TAGS: + + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = doc + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-generic + +clean: clean-generic mostlyclean + +distclean: distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-generic distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: tags distdir info dvi installcheck install-exec install-data \ +install uninstall all installdirs mostlyclean-generic distclean-generic \ +clean-generic maintainer-clean-generic clean mostlyclean distclean \ +maintainer-clean + + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/include/Makefile.am b/include/Makefile.am new file mode 100644 index 00000000..501365f6 --- /dev/null +++ b/include/Makefile.am @@ -0,0 +1,15 @@ +sysincludedir = ${includedir}/sys +sysinclude_HEADERS = asoundlib.h + +# This is the order they will be concatenated into asoundlib.h! +# +header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \ + footer.h + +noinst_HEADERS=$(header_files) + +$(srcdir)/asoundlib.h: $(header_files) + cat $^ > $@ + + +INCLUDES=-I$(top_srcdir)/include diff --git a/include/Makefile.in b/include/Makefile.in new file mode 100644 index 00000000..f4000a4e --- /dev/null +++ b/include/Makefile.in @@ -0,0 +1,240 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +sysincludedir = ${includedir}/sys +sysinclude_HEADERS = asoundlib.h + +# This is the order they will be concatenated into asoundlib.h! +# +header_files=header.h version.h error.h control.h mixer.h pcm.h rawmidi.h \ + footer.h + +noinst_HEADERS=$(header_files) + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = config.h +CONFIG_CLEAN_FILES = version.h +HEADERS = $(noinst_HEADERS) $(sysinclude_HEADERS) + +DIST_COMMON = Makefile.am Makefile.in config.h.in stamp-h.in \ +version.h.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: Makefile $(HEADERS) config.h + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps include/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +config.h: stamp-h + @: +stamp-h: $(srcdir)/config.h.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES= CONFIG_HEADERS=include/config.h \ + $(SHELL) ./config.status + @echo timestamp > stamp-h +$(srcdir)/config.h.in: $(srcdir)/stamp-h.in +$(srcdir)/stamp-h.in: $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOHEADER) + @echo timestamp > $(srcdir)/stamp-h.in + +mostlyclean-hdr: + +clean-hdr: + +distclean-hdr: + -rm -f config.h + +maintainer-clean-hdr: +version.h: $(top_builddir)/config.status version.h.in + cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + +install-sysincludeHEADERS: $(sysinclude_HEADERS) + @$(NORMAL_INSTALL) + $(mkinstalldirs) $(DESTDIR)$(sysincludedir) + @list='$(sysinclude_HEADERS)'; for p in $$list; do \ + if test -f "$$p"; then d= ; else d="$(srcdir)/"; fi; \ + echo " $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p"; \ + $(INSTALL_DATA) $$d$$p $(DESTDIR)$(sysincludedir)/$$p; \ + done + +uninstall-sysincludeHEADERS: + @$(NORMAL_UNINSTALL) + list='$(sysinclude_HEADERS)'; for p in $$list; do \ + rm -f $(DESTDIR)$(sysincludedir)/$$p; \ + done + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) config.h.in $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)config.h.in$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags config.h.in $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = include + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: install-sysincludeHEADERS + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: uninstall-sysincludeHEADERS + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + $(mkinstalldirs) $(DESTDIR)$(sysincludedir) + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-hdr mostlyclean-tags mostlyclean-generic + +clean: clean-hdr clean-tags clean-generic mostlyclean + +distclean: distclean-hdr distclean-tags distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-hdr maintainer-clean-tags \ + maintainer-clean-generic distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-hdr distclean-hdr clean-hdr maintainer-clean-hdr \ +uninstall-sysincludeHEADERS install-sysincludeHEADERS tags \ +mostlyclean-tags distclean-tags clean-tags maintainer-clean-tags \ +distdir info dvi installcheck install-exec install-data install \ +uninstall all installdirs mostlyclean-generic distclean-generic \ +clean-generic maintainer-clean-generic clean mostlyclean distclean \ +maintainer-clean + + +$(srcdir)/asoundlib.h: $(header_files) + cat $^ > $@ + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/include/config.h.in b/include/config.h.in index b6042e02..3dda2224 100644 --- a/include/config.h.in +++ b/include/config.h.in @@ -1,6 +1,29 @@ -/* - * Configuration header file for compilation of the ALSA driver - */ +/* include/config.h.in. Generated automatically from configure.in by autoheader. */ -#undef SND_LIB_VERSION +/* Define to empty if the keyword does not work. */ +#undef const + +/* Define as __inline if that's what the C compiler calls it. */ +#undef inline + +/* Define if you have the ANSI C header files. */ +#undef STDC_HEADERS + +/* Define if you can safely include both and . */ +#undef TIME_WITH_SYS_TIME + +/* Define if your processor stores words with the most significant + byte first (like Motorola and SPARC, unlike Intel and VAX). */ #undef WORDS_BIGENDIAN + +/* Package name */ +#undef PACKAGE + +/* Package version */ +#undef VERSION + +/* Sound library version string */ +#undef SND_LIB_VERSION + +/* Define if you have the header file. */ +#undef HAVE_LINUX_ASOUND_H diff --git a/include/version.h.in b/include/version.h.in index 0a4ac282..19b3a91c 100644 --- a/include/version.h.in +++ b/include/version.h.in @@ -5,5 +5,5 @@ #define SOUNDLIB_VERSION_MAJOR @SND_LIB_MAJOR@ #define SOUNDLIB_VERSION_MINOR @SND_LIB_MINOR@ #define SOUNDLIB_VERSION_SUBMINOR @SND_LIB_SUBMINOR@ -#define SOUNDLIB_VERSION ( ( LIBULTRA_VERSION_MAJOR << 16 ) | ( LIBULTRA_VERSION_MINOR << 8 ) | LIB_ULTRA_VERSION_SUBMINOR ) +#define SOUNDLIB_VERSION ( ( SOUNDLIB_VERSION_MAJOR << 16 ) | ( SOUNDLIB_VERSION_MINOR << 8 ) | SOUNDLIB_VERSION_SUBMINOR ) diff --git a/ltconfig b/ltconfig new file mode 100644 index 00000000..40d40da0 --- /dev/null +++ b/ltconfig @@ -0,0 +1,1563 @@ +#! /bin/sh + +# ltconfig - Create a system-specific libtool. +# Copyright (C) 1996-1998 Free Software Foundation, Inc. +# Gordon Matzigkeit , 1996 +# +# This file is free software; you can redistribute it and/or modify it +# under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# A lot of this script is taken from autoconf-2.10. + +# Check that we are running under the correct shell. +SHELL=${CONFIG_SHELL-/bin/sh} +echo=echo +if test "X$1" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift +elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then + # Yippee, $echo works! + : +else + # Restart under the correct shell. + exec "$SHELL" "$0" --no-reexec ${1+"$@"} +fi + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +if test "${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi + +if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then + # The Solaris, AIX, and Digital Unix default echo programs unquote + # backslashes. This makes it impossible to quote backslashes using + # echo "$something" | sed 's/\\/\\\\/g' + # + # So, first we look for a working echo in the user's PATH. + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + for dir in $PATH /usr/ucb; do + if test -f $dir/echo && test "X`($dir/echo '\t') 2>/dev/null`" = 'X\t'; then + echo="$dir/echo" + break + fi + done + IFS="$save_ifs" + + if test "X$echo" = Xecho; then + # We didn't find a better echo, so look for alternatives. + if test "X`(print -r '\t') 2>/dev/null`" = 'X\t'; then + # This shell has a builtin print -r that does the trick. + echo='print -r' + elif test -f /bin/ksh && test "X$CONFIG_SHELL" != X/bin/ksh; then + # If we have ksh, try running ltconfig again with it. + CONFIG_SHELL=/bin/ksh + export CONFIG_SHELL + exec "$CONFIG_SHELL" "$0" --no-reexec ${1+"$@"} + else + # Try using printf. + echo='printf %s\n' + if test "X`($echo '\t') 2>/dev/null`" != 'X\t'; then + # Oops. We lost completely, so just stick with echo. + echo=echo + fi + fi + fi +fi + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e s/^X//' +sed_quote_subst='s/\([\\"\\`$\\\\]\)/\\\1/g' + +# Same as above, but do not quote variable references. +double_quote_subst='s/\([\\"\\`\\\\]\)/\\\1/g' + +# The name of this program. +progname=`$echo "X$0" | $Xsed -e 's%^.*/%%'` + +# Constants: +PROGRAM=ltconfig +PACKAGE=libtool +VERSION=1.2b +ac_compile='${CC-cc} -c $CFLAGS $CPPFLAGS conftest.c 1>&5' +ac_link='${CC-cc} -o conftest $CFLAGS $CPPFLAGS $LDFLAGS conftest.c $LIBS 1>&5' +rm="rm -f" + +help="Try \`$progname --help' for more information." + +# Global variables: +default_ofile=libtool +can_build_shared=yes +enable_shared=yes +# All known linkers require a `.a' archive for static linking. +enable_static=yes +ltmain= +silent= +srcdir= +ac_config_guess= +ac_config_sub= +host= +nonopt= +ofile="$default_ofile" +verify_host=yes +with_gcc=no +with_gnu_ld=no + +old_AR="$AR" +old_CC="$CC" +old_CFLAGS="$CFLAGS" +old_CPPFLAGS="$CPPFLAGS" +old_LD="$LD" +old_LN_S="$LN_S" +old_NM="$NM" +old_RANLIB="$RANLIB" + +# Parse the command line options. +args= +prev= +for option +do + case "$option" in + -*=*) optarg=`echo "$option" | sed 's/[-_a-zA-Z0-9]*=//'` ;; + *) optarg= ;; + esac + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + eval "$prev=\$option" + prev= + continue + fi + + case "$option" in + --help) cat <&2 + echo "$help" 1>&2 + exit 1 + ;; + + *) + if test -z "$ltmain"; then + ltmain="$option" + elif test -z "$host"; then +# This generates an unnecessary warning for sparc-sun-solaris4.1.3_U1 +# if test -n "`echo $option| sed 's/[-a-z0-9.]//g'`"; then +# echo "$progname: warning \`$option' is not a valid host type" 1>&2 +# fi + host="$option" + else + echo "$progname: too many arguments" 1>&2 + echo "$help" 1>&2 + exit 1 + fi ;; + esac +done + +if test -z "$ltmain"; then + echo "$progname: you must specify a LTMAIN file" 1>&2 + echo "$help" 1>&2 + exit 1 +fi + +if test ! -f "$ltmain"; then + echo "$progname: \`$ltmain' does not exist" 1>&2 + echo "$help" 1>&2 + exit 1 +fi + +# Quote any args containing shell metacharacters. +ltconfig_args= +for arg +do + case "$arg" in + *" "*|*" "*|*[\[\]\~\#\$\^\&\*\(\)\{\}\\\|\;\<\>\?]*) + ltconfig_args="$ltconfig_args '$arg'" ;; + *) ltconfig_args="$ltconfig_args $arg" ;; + esac +done + +# A relevant subset of AC_INIT. + +# File descriptor usage: +# 0 standard input +# 1 file creation +# 2 errors and warnings +# 3 some systems may open it to /dev/tty +# 4 used on the Kubota Titan +# 5 compiler messages saved in config.log +# 6 checking for... messages and results +if test "$silent" = yes; then + exec 6>/dev/null +else + exec 6>&1 +fi +exec 5>>./config.log + +# NLS nuisances. +# Only set LANG and LC_ALL to C if already set. +# These must not be set unconditionally because not all systems understand +# e.g. LANG=C (notably SCO). +if test "${LC_ALL+set}" = set; then LC_ALL=C; export LC_ALL; fi +if test "${LANG+set}" = set; then LANG=C; export LANG; fi + +if (echo "testing\c"; echo 1,2,3) | grep c >/dev/null; then + # Stardent Vistra SVR4 grep lacks -e, says ghazi@caip.rutgers.edu. + if (echo -n testing; echo 1,2,3) | sed s/-n/xn/ | grep xn >/dev/null; then + ac_n= ac_c=' +' ac_t=' ' + else + ac_n=-n ac_c= ac_t= + fi +else + ac_n= ac_c='\c' ac_t= +fi + +if test -z "$srcdir"; then + # Assume the source directory is the same one as the path to ltmain.sh. + srcdir=`$echo "$ltmain" | $Xsed -e 's%/[^/]*$%%'` + test "$srcdir" = "$ltmain" && srcdir=. +fi + +trap "$rm conftest*; exit 1" 1 2 15 +if test "$verify_host" = yes; then + # Check for config.guess and config.sub. + ac_aux_dir= + for ac_dir in $srcdir $srcdir/.. $srcdir/../..; do + if test -f $ac_dir/config.guess; then + ac_aux_dir=$ac_dir + break + fi + done + if test -z "$ac_aux_dir"; then + echo "$progname: cannot find config.guess in $srcdir $srcdir/.. $srcdir/../.." 1>&2 + echo "$help" 1>&2 + exit 1 + fi + ac_config_guess=$ac_aux_dir/config.guess + ac_config_sub=$ac_aux_dir/config.sub + + # Make sure we can run config.sub. + if $SHELL $ac_config_sub sun4 >/dev/null 2>&1; then : + else + echo "$progname: cannot run $ac_config_sub" 1>&2 + echo "$help" 1>&2 + exit 1 + fi + + echo $ac_n "checking host system type""... $ac_c" 1>&6 + + host_alias=$host + case "$host_alias" in + "") + if host_alias=`$SHELL $ac_config_guess`; then : + else + echo "$progname: cannot guess host type; you must specify one" 1>&2 + echo "$help" 1>&2 + exit 1 + fi ;; + esac + host=`$SHELL $ac_config_sub $host_alias` + echo "$ac_t$host" 1>&6 + + # Make sure the host verified. + test -z "$host" && exit 1 + +elif test -z "$host"; then + echo "$progname: you must specify a host type if you use \`--no-verify'" 1>&2 + echo "$help" 1>&2 + exit 1 +else + host_alias=$host +fi + +# Transform linux* to *-*-linux-gnu*, to support old configure scripts. +case "$host_os" in +linux-gnu*) ;; +linux*) host=`echo $host | sed 's/^\(.*-.*-linux\)\(.*\)$/\1-gnu\2/'` +esac + +host_cpu=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\1/'` +host_vendor=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\2/'` +host_os=`echo $host | sed 's/^\([^-]*\)-\([^-]*\)-\(.*\)$/\3/'` + +case "$host_os" in +aix3*) + # AIX sometimes has problems with the GCC collect2 program. For some + # reason, if we set the COLLECT_NAMES environment variable, the problems + # vanish in a puff of smoke. + if test "${COLLECT_NAMES+set}" != set; then + COLLECT_NAMES= + export COLLECT_NAMES + fi + ;; +esac + +# Determine commands to create old-style static archives. +old_archive_cmds='$AR cru $oldlib$oldobjs' +old_postinstall_cmds='chmod 644 $oldlib' +old_postuninstall_cmds= + +# Set a sane default for `AR'. +test -z "$AR" && AR=ar + +# If RANLIB is not set, then run the test. +if test "${RANLIB+set}" != "set"; then + result=no + + echo $ac_n "checking for ranlib... $ac_c" 1>&6 + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + for dir in $PATH; do + test -z "$dir" && dir=. + if test -f $dir/ranlib; then + RANLIB="ranlib" + result="ranlib" + break + fi + done + IFS="$save_ifs" + + echo "$ac_t$result" 1>&6 +fi + +if test -n "$RANLIB"; then + old_archive_cmds="$old_archive_cmds;\$RANLIB \$oldlib" + old_postinstall_cmds="\$RANLIB \$oldlib;$old_postinstall_cmds" +fi + +# Check to see if we are using GCC. +if test "$with_gcc" != yes || test -z "$CC"; then + # If CC is not set, then try to find GCC or a usable CC. + if test -z "$CC"; then + echo $ac_n "checking for gcc... $ac_c" 1>&6 + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + for dir in $PATH; do + IFS="$save_ifs" + test -z "$dir" && dir=. + if test -f $dir/gcc; then + CC="gcc" + break + fi + done + IFS="$save_ifs" + + if test -n "$CC"; then + echo "$ac_t$CC" 1>&6 + else + echo "$ac_t"no 1>&6 + fi + fi + + # Not "gcc", so try "cc", rejecting "/usr/ucb/cc". + if test -z "$CC"; then + echo $ac_n "checking for cc... $ac_c" 1>&6 + IFS="${IFS= }"; save_ifs="$IFS"; IFS="${IFS}:" + cc_rejected=no + for dir in $PATH; do + test -z "$dir" && dir=. + if test -f $dir/cc; then + if test "$dir/cc" = "/usr/ucb/cc"; then + cc_rejected=yes + continue + fi + CC="cc" + break + fi + done + IFS="$save_ifs" + if test $cc_rejected = yes; then + # We found a bogon in the path, so make sure we never use it. + set dummy $CC + shift + if test $# -gt 0; then + # We chose a different compiler from the bogus one. + # However, it has the same name, so the bogon will be chosen + # first if we set CC to just the name; use the full file name. + shift + set dummy "$dir/cc" "$@" + shift + CC="$@" + fi + fi + + if test -n "$CC"; then + echo "$ac_t$CC" 1>&6 + else + echo "$ac_t"no 1>&6 + fi + + if test -z "$CC"; then + echo "$progname: error: no acceptable cc found in \$PATH" 1>&2 + exit 1 + fi + fi + + # Now see if the compiler is really GCC. + with_gcc=no + echo $ac_n "checking whether we are using GNU C... $ac_c" 1>&6 + echo "$progname:462: checking whether we are using GNU C" >&5 + + $rm conftest.c + cat > conftest.c <&5; (eval $ac_try) 2>&5; }; } | egrep yes >/dev/null 2>&1; then + with_gcc=yes + fi + $rm conftest.c + echo "$ac_t$with_gcc" 1>&6 +fi + +# Allow CC to be a program name with arguments. +set dummy $CC +compiler="$2" + +echo $ac_n "checking for $compiler option to produce PIC... $ac_c" 1>&6 +pic_flag= +special_shlib_compile_flags= +wl= +link_static_flag= +no_builtin_flag= + +if test "$with_gcc" = yes; then + wl='-Wl,' + link_static_flag='-static' + no_builtin_flag=' -fno-builtin' + + case "$host_os" in + aix3* | aix4* | irix5* | irix6* | osf3* | osf4*) + # PIC is the default for these OSes. + ;; + os2*) + # We can build DLLs from non-PIC. + ;; + amigaos*) + # FIXME: we need at least 68020 code to build shared libraries, but + # adding the `-m68020' flag to GCC prevents building anything better, + # like `-m68040'. + pic_flag='-m68020 -resident32 -malways-restore-a4' + ;; + *) + pic_flag='-fPIC' + ;; + esac +else + # PORTME Check for PIC flags for the system compiler. + case "$host_os" in + aix3* | aix4*) + # All AIX code is PIC. + link_static_flag='-bnso -bI:/lib/syscalls.exp' + ;; + + hpux9* | hpux10* | hpux11*) + # Is there a better link_static_flag that works with the bundled CC? + wl='-Wl,' + link_static_flag="${wl}-a ${wl}archive" + pic_flag='+Z' + ;; + + irix5* | irix6*) + wl='-Wl,' + link_static_flag='-non_shared' + # PIC (with -KPIC) is the default. + ;; + + os2*) + # We can build DLLs from non-PIC. + ;; + + osf3* | osf4*) + # All OSF/1 code is PIC. + wl='-Wl,' + link_static_flag='-non_shared' + ;; + + sco3.2v5*) + pic_flag='-Kpic' + link_static_flag='-dn' + special_shlib_compile_flags='-belf' + ;; + + solaris2*) + pic_flag='-KPIC' + link_static_flag='-Bstatic' + wl='-Wl,' + ;; + + sunos4*) + pic_flag='-PIC' + link_static_flag='-Bstatic' + wl='-Qoption ld ' + ;; + + sysv4.2uw2*) + pic_flag='-KPIC' + link_static_flag='-Bstatic' + wl='-Wl,' + ;; + + uts4*) + pic_flag='-pic' + link_static_flag='-Bstatic' + ;; + + *) + can_build_shared=no + ;; + esac +fi + +if test -n "$pic_flag"; then + echo "$ac_t$pic_flag" 1>&6 + + # Check to make sure the pic_flag actually works. + echo $ac_n "checking if $compiler PIC flag $pic_flag works... $ac_c" 1>&6 + $rm conftest* + echo "int some_variable = 0;" > conftest.c + save_CFLAGS="$CFLAGS" + CFLAGS="$CFLAGS $pic_flag -DPIC" + echo "$progname:585: checking if $compiler PIC flag $pic_flag works" >&5 + if { (eval echo $progname:586: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>conftest.err; } && test -s conftest.o; then + # Append any warnings to the config.log. + cat conftest.err 1>&5 + + # On HP-UX, both CC and GCC only warn that PIC is supported... then they + # create non-PIC objects. So, if there were any warnings, we assume that + # PIC is not supported. + if test -s conftest.err; then + echo "$ac_t"no 1>&6 + can_build_shared=no + pic_flag= + else + echo "$ac_t"yes 1>&6 + pic_flag=" $pic_flag" + fi + else + # Append any errors to the config.log. + cat conftest.err 1>&5 + can_build_shared=no + pic_flag= + echo "$ac_t"no 1>&6 + fi + CFLAGS="$save_CFLAGS" + $rm conftest* +else + echo "$ac_t"none 1>&6 +fi + +# Check for any special shared library compilation flags. +if test -n "$special_shlib_compile_flags"; then + echo "$progname: warning: \`$CC' requires \`$special_shlib_compile_flags' to build shared libraries" 1>&2 + if echo "$old_CC $old_CFLAGS " | egrep -e "[ ]$special_shlib_compile_flags[ ]" >/dev/null; then : + else + echo "$progname: add \`$special_shlib_compile_flags' to the CC or CFLAGS env variable and reconfigure" 1>&2 + can_build_shared=no + fi +fi + +echo $ac_n "checking if $compiler static flag $link_static_flag works... $ac_c" 1>&6 +$rm conftest* +echo 'main(){return(0);}' > conftest.c +save_LDFLAGS="$LDFLAGS" +LDFLAGS="$LDFLAGS $link_static_flag" +echo "$progname:629: checking if $compiler static flag $link_static_flag works" >&5 +if { (eval echo $progname:630: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then + echo "$ac_t$link_static_flag" 1>&6 +else + echo "$ac_t"none 1>&6 + link_static_flag= +fi +LDFLAGS="$save_LDFLAGS" +$rm conftest* + +if test -z "$LN_S"; then + # Check to see if we can use ln -s, or we need hard links. + echo $ac_n "checking whether ln -s works... $ac_c" 1>&6 + $rm conftestdata + if ln -s X conftestdata 2>/dev/null; then + $rm conftestdata + LN_S="ln -s" + else + LN_S=ln + fi + if test "$LN_S" = "ln -s"; then + echo "$ac_t"yes 1>&6 + else + echo "$ac_t"no 1>&6 + fi +fi + +# Make sure LD is an absolute path. +if test -z "$LD"; then + ac_prog=ld + if test "$with_gcc" = yes; then + # Check if gcc -print-prog-name=ld gives a path. + echo $ac_n "checking for ld used by GCC... $ac_c" 1>&6 + echo "$progname:662: checking for ld used by GCC" >&5 + ac_prog=`($CC -print-prog-name=ld) 2>&5` + case "$ac_prog" in + # Accept absolute paths. + /* | [A-Za-z]:[/\\]*) + test -z "$LD" && LD="$ac_prog" + ;; + "") + # If it fails, then pretend we are not using GCC. + ac_prog=ld + ;; + *) + # If it is relative, then search for the first ld in PATH. + with_gnu_ld=unknown + ;; + esac + elif test "$with_gnu_ld" = yes; then + echo $ac_n "checking for GNU ld... $ac_c" 1>&6 + echo "$progname:680: checking for GNU ld" >&5 + else + echo $ac_n "checking for non-GNU ld""... $ac_c" 1>&6 + echo "$progname:683: checking for non-GNU ld" >&5 + fi + + if test -z "$LD"; then + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in $PATH; do + test -z "$ac_dir" && ac_dir=. + if test -f "$ac_dir/$ac_prog"; then + LD="$ac_dir/$ac_prog" + # Check to see if the program is GNU ld. I'd rather use --version, + # but apparently some GNU ld's only accept -v. + # Break only if it was the GNU/non-GNU ld that we prefer. + if "$LD" -v 2>&1 < /dev/null | egrep '(GNU|with BFD)' > /dev/null; then + test "$with_gnu_ld" != no && break + else + test "$with_gnu_ld" != yes && break + fi + fi + done + IFS="$ac_save_ifs" + fi + + if test -n "$LD"; then + echo "$ac_t$LD" 1>&6 + else + echo "$ac_t"no 1>&6 + fi + + if test -z "$LD"; then + echo "$progname: error: no acceptable ld found in \$PATH" 1>&2 + exit 1 + fi +fi + +# Check to see if it really is or is not GNU ld. +echo $ac_n "checking if the linker ($LD) is GNU ld... $ac_c" 1>&6 +# I'd rather use --version here, but apparently some GNU ld's only accept -v. +if $LD -v 2>&1 &5; then + with_gnu_ld=yes +else + with_gnu_ld=no +fi +echo "$ac_t$with_gnu_ld" 1>&6 + +# See if the linker supports building shared libraries. +echo $ac_n "checking whether the linker ($LD) supports shared libraries... $ac_c" 1>&6 + +allow_undefined_flag= +no_undefined_flag= +archive_cmds= +old_archive_from_new_cmds= +export_dynamic_flag_spec= +whole_archive_flag_spec= +hardcode_libdir_flag_spec= +hardcode_libdir_separator= +hardcode_direct=no +hardcode_minus_L=no +hardcode_shlibpath_var=unsupported +runpath_var= + +ld_shlibs=yes +if test "$with_gnu_ld" = yes; then + + # See if GNU ld supports shared libraries. + case "$host_os" in + amigaos*) + archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + + linux-gnu*) + if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs $deplibs' + else + ld_shlibs=no + fi + ;; + + sunos4*) + archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + *) + if $LD --help 2>&1 | egrep ': supported targets:.* elf' > /dev/null; then + archive_cmds='$CC -shared ${wl}-soname $wl$soname -o $lib$libobjs' + else + ld_shlibs=no + fi + ;; + esac + + if test "$ld_shlibs" = yes; then + runpath_var=LD_RUN_PATH + hardcode_libdir_flag_spec='${wl}--rpath ${wl}$libdir' + export_dynamic_flag_spec='${wl}--export-dynamic' + whole_archive_flag_spec='${wl}--whole-archive$convenience ${wl}--no-whole-archive' + fi +else + # PORTME fill in a description of your system's linker (not GNU ld) + case "$host_os" in + aix3*) + allow_undefined_flag=unsupported + archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$LD -o $objdir/$soname$libobjs -bE:$lib.exp -T512 -H512 -bM:SRE;$AR cru $lib $objdir/$soname' + # Note: this linker hardcodes the directories in LIBPATH if there + # are no directories specified by -L. + hardcode_minus_L=yes + if test "$with_gcc" = yes && test -z "$link_static_flag"; then + # Neither direct hardcoding nor static linking is supported with a + # broken collect2. + hardcode_direct=unsupported + fi + ;; + + aix4*) + allow_undefined_flag=unsupported + archive_cmds='$NM$libobjs | $global_symbol_pipe | sed '\''s/.* //'\'' > $lib.exp;$CC -o $objdir/$soname$libobjs ${wl}-bE:$lib.exp ${wl}-bM:SRE ${wl}-bnoentry;$AR cru $lib $objdir/$soname' + hardcode_direct=yes + hardcode_minus_L=yes + ;; + + amigaos*) + archive_cmds='$rm $objdir/a2ixlibrary.data;$echo "#define NAME $libname" > $objdir/a2ixlibrary.data;$echo "#define LIBRARY_ID 1" >> $objdir/a2ixlibrary.data;$echo "#define VERSION $major" >> $objdir/a2ixlibrary.data;$echo "#define REVISION $revision" >> $objdir/a2ixlibrary.data;$AR cru $lib$libobjs;$RANLIB $lib;(cd $objdir && a2ixlibrary -32)' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + ;; + + # FreeBSD 2.2.[012] allows us to include c++rt0.o to get C++ constructor + # support. Future versions do this automatically, but an explicit c++rt0.o + # does not break anything, and helps significantly (at the cost of a little + # extra space). + freebsd2.2*) + archive_cmds='$LD -Bshareable -o $lib$libobjs /usr/lib/c++rt0.o' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + # Unfortunately, older versions of FreeBSD 2 do not have this feature. + freebsd2*) + archive_cmds='$LD -Bshareable -o $lib$libobjs' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + # FreeBSD 3, at last, uses gcc -shared to do shared libraries. + freebsd3*) + archive_cmds='$CC -shared -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_minus_L=no + hardcode_shlibpath_var=no + ;; + + hpux9*) + archive_cmds='$rm $objdir/$soname;$LD -b +s +b $install_libdir -o $objdir/$soname$libobjs;mv $objdir/$soname $lib' + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + export_dynamic_flag_spec='${wl}-E' + ;; + + hpux10* | hpux11*) + archive_cmds='$LD -b +h $soname +s +b $install_libdir -o $lib$libobjs' + hardcode_libdir_flag_spec='${wl}+b ${wl}$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + export_dynamic_flag_spec='${wl}-E' + ;; + + irix5* | irix6*) + if test "$with_gcc" = yes; then + archive_cmds='$CC -shared -o $lib ${wl}-soname ${wl}$soname ${wl}-set_version ${wl}$verstring$libobjs' + else + archive_cmds='$LD -shared -o $lib -soname $soname -set_version $verstring$libobjs' + fi + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + ;; + + netbsd*) + # Tested with NetBSD 1.2 ld + archive_cmds='$LD -Bshareable -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + openbsd*) + archive_cmds='$LD -Bshareable -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_direct=yes + hardcode_shlibpath_var=no + ;; + + os2*) + hardcode_libdir_flag_spec='-L$libdir' + hardcode_minus_L=yes + allow_undefined_flag=unsupported + archive_cmds='$echo "LIBRARY $libname INITINSTANCE" > $objdir/$libname.def;$echo "DESCRIPTION \"$libname\"" >> $objdir/$libname.def;$echo DATA >> $objdir/$libname.def;$echo " SINGLE NONSHARED" >> $objdir/$libname.def;$echo EXPORTS >> $objdir/$libname.def;emxexp$libobjs >> $objdir/$libname.def;$CC -Zdll -Zcrtdll -o $lib$libobjs $objdir/$libname.def' + old_archive_from_new_cmds='emximp -o $objdir/$libname.a $objdir/$libname.def' + ;; + + osf3* | osf4*) + allow_undefined_flag=' -expect_unresolved \*' + archive_cmds='$LD -shared${allow_undefined_flag} -o $lib -soname $soname -set_version $verstring$libobjs$deplibs' + hardcode_libdir_flag_spec='${wl}-rpath ${wl}$libdir' + hardcode_libdir_separator=: + ;; + + sco3.2v5*) + archive_cmds='$LD -G -o $lib$libobjs' + hardcode_direct=yes + ;; + + solaris2*) + no_undefined_flag=' -z text' + archive_cmds='$LD -G${allow_undefined_flag} -h $soname -o $lib$libobjs' + hardcode_libdir_flag_spec='-R$libdir' + hardcode_shlibpath_var=no + + # Solaris 2 before 2.5 hardcodes -L paths. + case "$host_os" in + solaris2.[0-4]*) + hardcode_minus_L=yes + ;; + esac + ;; + + sunos4*) + archive_cmds='$LD -assert pure-text -Bstatic -o $lib$libobjs' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_direct=yes + hardcode_minus_L=yes + hardcode_shlibpath_var=no + ;; + + uts4*) + archive_cmds='$LD -G -h $soname -o $lib$libobjs' + hardcode_libdir_flag_spec='-L$libdir' + hardcode_direct=no + hardcode_minus_L=no + hardcode_shlibpath_var=no + ;; + + *) + ld_shlibs=no + can_build_shared=no + ;; + esac +fi +echo "$ac_t$ld_shlibs" 1>&6 + +if test -z "$NM"; then + echo $ac_n "checking for BSD-compatible nm... $ac_c" 1>&6 + case "$NM" in + /* | [A-Za-z]:[/\\]*) ;; # Let the user override the test with a path. + *) + IFS="${IFS= }"; ac_save_ifs="$IFS"; IFS="${IFS}:" + for ac_dir in /usr/ucb /usr/ccs/bin $PATH /bin; do + test -z "$ac_dir" && ac_dir=. + if test -f $ac_dir/nm; then + # Check to see if the nm accepts a BSD-compat flag. + # Adding the `sed 1q' prevents false positives on HP-UX, which says: + # nm: unknown option "B" ignored + if ($ac_dir/nm -B /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + NM="$ac_dir/nm -B" + elif ($ac_dir/nm -p /dev/null 2>&1 | sed '1q'; exit 0) | egrep /dev/null >/dev/null; then + NM="$ac_dir/nm -p" + else + NM="$ac_dir/nm" + fi + break + fi + done + IFS="$ac_save_ifs" + test -z "$NM" && NM=nm + ;; + esac + echo "$ac_t$NM" 1>&6 +fi + +# Check for command to grab the raw symbol name followed by C symbol from nm. +echo $ac_n "checking command to parse $NM output... $ac_c" 1>&6 + +# These are sane defaults that work on at least a few old systems. +# [They come from Ultrix. What could be older than Ultrix?!! ;)] + +# Character class describing NM global symbol codes. +symcode='[BCDEGRSTU]' + +# Regexp to match symbols that can be accessed directly from C. +sympat='\([_A-Za-z][_A-Za-z0-9]*\)' + +# Transform the above into a raw symbol and a C symbol. +symxfrm='\1 \1' + +# Define system-specific variables. +case "$host_os" in +aix*) + symcode='[BCDTU]' + ;; +irix*) + # Cannot use undefined symbols on IRIX because inlined functions mess us up. + symcode='[BCDEGRST]' + ;; +solaris2*) + symcode='[BDTU]' + ;; +esac + +# If we're using GNU nm, then use its standard symbol codes. +if $NM -V 2>&1 | egrep '(GNU|with BFD)' > /dev/null; then + symcode='[ABCDGISTUW]' +fi + +# Write the raw and C identifiers. +global_symbol_pipe="sed -n -e 's/^.* $symcode $sympat$/$symxfrm/p'" + +# Check to see that the pipe works correctly. +pipe_works=no +$rm conftest* +cat > conftest.c <&5 +if { (eval echo $progname:1022: \"$ac_compile\") 1>&5; (eval $ac_compile) 2>&5; } && test -s conftest.o; then + # Now try to grab the symbols. + nlist=conftest.nm + if { echo "$progname:1025: eval \"$NM conftest.o | $global_symbol_pipe > $nlist\"" >&5; eval "$NM conftest.o | $global_symbol_pipe > $nlist 2>&5"; } && test -s "$nlist"; then + + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + wcout=`wc "$nlist" 2>/dev/null` + count=`$echo "X$wcout" | $Xsed -e 's/^[ ]*\([0-9][0-9]*\).*$/\1/'` + (test "$count" -ge 0) 2>/dev/null || count=-1 + else + rm -f "$nlist"T + count=-1 + fi + + # Make sure that we snagged all the symbols we need. + if egrep ' nm_test_var$' "$nlist" >/dev/null; then + if egrep ' nm_test_func$' "$nlist" >/dev/null; then + cat < conftest.c +#ifdef __cplusplus +extern "C" { +#endif + +EOF + # Now generate the symbol file. + sed 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> conftest.c + + cat <> conftest.c +#if defined (__STDC__) && __STDC__ +# define __ptr_t void * +#else +# define __ptr_t char * +#endif + +/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */ +int dld_preloaded_symbol_count = $count; + +/* The mapping between symbol names and symbols. */ +struct { + char *name; + __ptr_t address; +} +dld_preloaded_symbols[] = +{ +EOF + sed 's/^\(.*\) \(.*\)$/ {"\1", (__ptr_t) \&\2},/' < "$nlist" >> conftest.c + cat <<\EOF >> conftest.c + {0, (__ptr_t) 0} +}; + +#ifdef __cplusplus +} +#endif +EOF + # Now try linking the two files. + mv conftest.o conftestm.o + save_LIBS="$LIBS" + save_CFLAGS="$CFLAGS" + LIBS='conftestm.o' + CFLAGS="$CFLAGS$no_builtin_flag" + if { (eval echo $progname:1083: \"$ac_link\") 1>&5; (eval $ac_link) 2>&5; } && test -s conftest; then + pipe_works=yes + else + echo "$progname: failed program was:" >&5 + cat conftest.c >&5 + fi + LIBS="$save_LIBS" + else + echo "cannot find nm_test_func in $nlist" >&5 + fi + else + echo "cannot find nm_test_var in $nlist" >&5 + fi + else + echo "cannot run $global_symbol_pipe" >&5 + fi +else + echo "$progname: failed program was:" >&5 + cat conftest.c >&5 +fi +$rm conftest* + +# Do not use the global_symbol_pipe unless it works. +echo "$ac_t$pipe_works" 1>&6 +test "$pipe_works" = yes || global_symbol_pipe= + +# Check hardcoding attributes. +echo $ac_n "checking how to hardcode library paths into programs... $ac_c" 1>&6 +hardcode_action= +if test -n "$hardcode_libdir_flag_spec" || \ + test -n "$runpath_var"; then + + # We can hardcode non-existant directories. + if test "$hardcode_direct" != no && \ + test "$hardcode_minus_L" != no && \ + test "$hardcode_shlibpath_var" != no; then + + # Linking always hardcodes the temporary library directory. + hardcode_action=relink + else + # We can link without hardcoding, and we can hardcode nonexisting dirs. + hardcode_action=immediate + fi +else + # We cannot hardcode anything, or else we can only hardcode existing + # directories. + hardcode_action=unsupported +fi +echo "$ac_t$hardcode_action" 1>&6 + + +reload_flag= +reload_cmds='$LD$reload_flag -o $output$reload_objs' +echo $ac_n "checking for $LD option to reload object files... $ac_c" 1>&6 +# PORTME Some linkers may need a different reload flag. +reload_flag='-r' +echo "$ac_t$reload_flag" 1>&6 +test -n "$reload_flag" && reload_flag=" $reload_flag" + +# PORTME Fill in your ld.so characteristics +library_names_spec= +libname_spec='lib$name' +soname_spec= +postinstall_cmds= +postuninstall_cmds= +finish_cmds= +finish_eval= +shlibpath_var= +version_type=none +dynamic_linker="$host_os ld.so" + +echo $ac_n "checking dynamic linker characteristics... $ac_c" 1>&6 +case "$host_os" in +aix3* | aix4*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix $libname.a' + shlibpath_var=LIBPATH + + # AIX has no versioning support, so we append a major version to the name. + soname_spec='${libname}${release}.so$major' + ;; + +amigaos*) + library_names_spec='$libname.ixlibrary $libname.a' + # Create ${libname}_ixlibrary.a entries in /sys/libs. + finish_eval='for lib in `ls $libdir/*.ixlibrary 2>/dev/null`; do libname=`$echo "X$lib" | $Xsed -e '\''s%^.*/\([^/]*\)\.ixlibrary$%\1%'\''`; test $rm /sys/libs/${libname}_ixlibrary.a; $show "(cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a)"; (cd /sys/libs && $LN_S $lib ${libname}_ixlibrary.a) || exit 1; done' + ;; + +freebsd2* | freebsd3*) + version_type=sunos + library_names_spec='${libname}${release}.so$versuffix $libname.so' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + ;; + +gnu*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +hpux9* | hpux10* | hpux11*) + # Give a soname corresponding to the major version so that dld.sl refuses to + # link against other versions. + dynamic_linker="$host_os dld.sl" + version_type=sunos + shlibpath_var=SHLIB_PATH + library_names_spec='${libname}${release}.sl$versuffix ${libname}${release}.sl$major $libname.sl' + soname_spec='${libname}${release}.sl$major' + # HP-UX runs *really* slowly unless shared libraries are mode 555. + postinstall_cmds='chmod 555 $lib' + ;; + +irix5* | irix6*) + version_type=osf + soname_spec='${libname}${release}.so' + library_names_spec='${libname}${release}.so$versuffix $libname.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +# No shared lib support for Linux oldld, aout, or coff. +linux-gnuoldld* | linux-gnuaout* | linux-gnucoff*) + dynamic_linker=no + ;; + +# This must be Linux ELF. +linux-gnu*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -n $libdir' + shlibpath_var=LD_LIBRARY_PATH + + if test -f /lib/ld.so.1; then + dynamic_linker='GNU ld.so' + else + # Only the GNU ld.so supports shared libraries on MkLinux. + case "$host_cpu" in + powerpc*) dynamic_linker=no ;; + *) dynamic_linker='Linux ld.so' ;; + esac + fi + ;; + +netbsd* | openbsd*) + version_type=sunos + library_names_spec='${libname}${release}.so$versuffix' + finish_cmds='PATH="\$PATH:/sbin" ldconfig -m $libdir' + shlibpath_var=LD_LIBRARY_PATH + ;; + +os2*) + libname_spec='$name' + library_names_spec='$libname.dll $libname.a' + dynamic_linker='OS/2 ld.exe' + shlibpath_var=LIBPATH + ;; + +osf3* | osf4*) + version_type=osf + soname_spec='${libname}${release}.so' + library_names_spec='${libname}${release}.so$versuffix $libname.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +sco3.2v5*) + version_type=osf + soname_spec='${libname}${release}.so$major' + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + shlibpath_var=LD_LIBRARY_PATH + ;; + +solaris2*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + shlibpath_var=LD_LIBRARY_PATH + # ldd complains unless libraries are executable + postinstall_cmds='chmod +x $lib' + ;; + +sunos4*) + version_type=sunos + library_names_spec='${libname}${release}.so$versuffix' + finish_cmds='PATH="\$PATH:/usr/etc" ldconfig $libdir' + shlibpath_var=LD_LIBRARY_PATH + ;; + +sysv4.2uw2*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +uts4*) + version_type=linux + library_names_spec='${libname}${release}.so$versuffix ${libname}${release}.so$major $libname.so' + soname_spec='${libname}${release}.so$major' + shlibpath_var=LD_LIBRARY_PATH + ;; + +*) + dynamic_linker=no + ;; +esac +echo "$ac_t$dynamic_linker" +test "$dynamic_linker" = no && can_build_shared=no + +# Report the final consequences. +echo "checking if libtool supports shared libraries... $can_build_shared" 1>&6 + +echo $ac_n "checking whether to build shared libraries... $ac_c" 1>&6 +test "$can_build_shared" = "no" && enable_shared=no + +# On AIX, shared libraries and static libraries use the same namespace, and +# are all built from PIC. +case "$host_os" in +aix*) + test "$enable_shared" = yes && enable_static=no + if test -n "$RANLIB"; then + archive_cmds="$archive_cmds;\$RANLIB \$lib" + postinstall_cmds='$RANLIB $lib' + fi + ;; +esac + +echo "$ac_t$enable_shared" 1>&6 + +# Make sure either enable_shared or enable_static is yes. +test "$enable_shared" = yes || enable_static=yes + +echo "checking whether to build static libraries... $enable_static" 1>&6 + +echo $ac_n "checking for objdir... $ac_c" 1>&6 +rm -f .libs 2>/dev/null +mkdir .libs 2>/dev/null +if test -d .libs; then + objdir=.libs +else + # MS-DOS does not allow filenames that begin with a dot. + objdir=_libs +fi +rmdir .libs 2>/dev/null +echo "$ac_t$objdir" 1>&6 + +# Copy echo and quote the copy, instead of the original, because it is +# used later. +ltecho="$echo" + +# Now quote all the things that may contain metacharacters. +for var in ltecho old_CC old_CFLAGS old_CPPFLAGS old_LD old_NM old_RANLIB \ + old_LN_S AR CC LD LN_S NM reload_flag reload_cmds wl pic_flag \ + link_static_flag no_builtin_flag export_dynamic_flag_spec \ + whole_archive_flag_spec libname_spec library_names_spec soname_spec RANLIB \ + old_archive_cmds old_archive_from_new_cmds old_postinstall_cmds \ + old_postuninstall_cmds archive_cmds postinstall_cmds postuninstall_cmds \ + allow_undefined_flag no_undefined_flag \ + finish_cmds finish_eval global_symbol_pipe \ + hardcode_libdir_flag_spec hardcode_libdir_separator; do + + case "$var" in + reload_cmds | old_archive_cmds | old_archive_from_new_cmds | \ + old_postinstall_cmds | old_postuninstall_cmds | archive_cmds | \ + postinstall_cmds | postuninstall_cmds | finish_cmds) + # Double-quote double-evaled strings. + eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$double_quote_subst\" -e \"\$sed_quote_subst\"\`" + ;; + *) + eval "$var=\`\$echo \"X\$$var\" | \$Xsed -e \"\$sed_quote_subst\"\`" + ;; + esac +done + +trap "$rm \"$ofile\"; exit 1" 1 2 15 +echo "creating $ofile" +$rm "$ofile" +cat < "$ofile" +#! $SHELL + +# `$echo "$ofile" | sed 's%^.*/%%'` - Provide generalized library-building support services. +# Generated automatically by $PROGRAM - GNU $PACKAGE $VERSION +# NOTE: Changes made to this file will be lost: look at ltconfig or ltmain.sh. +# +# Copyright (C) 1996-1998 Free Software Foundation, Inc. +# Gordon Matzigkeit , 1996 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Sed that helps us avoid accidentally triggering echo(1) options like -n. +Xsed="sed -e s/^X//" + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +if test "\${CDPATH+set}" = set; then CDPATH=; export CDPATH; fi + +### BEGIN LIBTOOL CONFIG +# Libtool was configured as follows, on host `(hostname || uname -n) 2>/dev/null | sed 1q`: +# +# CC="$old_CC" CFLAGS="$old_CFLAGS" CPPFLAGS="$old_CPPFLAGS" \\ +# LD="$old_LD" NM="$old_NM" RANLIB="$old_RANLIB" LN_S="$old_LN_S" \\ +# $0$ltconfig_args +# +# Compiler and other test output produced by $progname, useful for +# debugging $progname, is in ./config.log if it exists. + +# The version of $progname that generated this script. +LTCONFIG_VERSION="$VERSION" + +# Shell to use when invoking shell scripts. +SHELL="$SHELL" + +# Whether or not to build shared libraries. +build_libtool_libs=$enable_shared + +# Whether or not to build static libraries. +build_old_libs=$enable_static + +# The host system. +host_alias="$host_alias" +host="$host" + +# An echo program that does not interpret backslashes. +echo="$ltecho" + +# The archiver. +AR="$AR" + +# The default C compiler. +CC="$CC" + +# The linker used to build libraries. +LD="$LD" + +# Whether we need hard or soft links. +LN_S="$LN_S" + +# A BSD-compatible nm program. +NM="$NM" + +# The name of the directory that contains temporary libtool files. +objdir="$objdir" + +# How to create reloadable object files. +reload_flag="$reload_flag" +reload_cmds="$reload_cmds" + +# How to pass a linker flag through the compiler. +wl="$wl" + +# Additional compiler flags for building library objects. +pic_flag="$pic_flag" + +# Compiler flag to prevent dynamic linking. +link_static_flag="$link_static_flag" + +# Compiler flag to turn off builtin functions. +no_builtin_flag="$no_builtin_flag" + +# Compiler flag to allow reflexive dlopens. +export_dynamic_flag_spec="$export_dynamic_flag_spec" + +# Compiler flag to generate shared objects directly from archives. +whole_archive_flag_spec="$whole_archive_flag_spec" + +# Library versioning type. +version_type=$version_type + +# Format of library name prefix. +libname_spec="$libname_spec" + +# List of archive names. First name is the real one, the rest are links. +# The last name is the one that the linker finds with -lNAME. +library_names_spec="$library_names_spec" + +# The coded name of the library, if different from the real name. +soname_spec="$soname_spec" + +# Commands used to build and install an old-style archive. +RANLIB="$RANLIB" +old_archive_cmds="$old_archive_cmds" +old_postinstall_cmds="$old_postinstall_cmds" +old_postuninstall_cmds="$old_postuninstall_cmds" + +# Create an old-style archive from a shared archive. +old_archive_from_new_cmds="$old_archive_from_new_cmds" + +# Commands used to build and install a shared archive. +archive_cmds="$archive_cmds" +postinstall_cmds="$postinstall_cmds" +postuninstall_cmds="$postuninstall_cmds" + +# Flag that allows shared libraries with undefined symbols to be built. +allow_undefined_flag="$allow_undefined_flag" + +# Flag that forces no undefined symbols. +no_undefined_flag="$no_undefined_flag" + +# Commands used to finish a libtool library installation in a directory. +finish_cmds="$finish_cmds" + +# Same as above, but a single script fragment to be evaled but not shown. +finish_eval="$finish_eval" + +# Take the output of nm and produce a listing of raw symbols and C names. +global_symbol_pipe="$global_symbol_pipe" + +# This is the shared library runtime path variable. +runpath_var=$runpath_var + +# This is the shared library path variable. +shlibpath_var=$shlibpath_var + +# How to hardcode a shared library path into an executable. +hardcode_action=$hardcode_action + +# Flag to hardcode \$libdir into a binary during linking. +# This must work even if \$libdir does not exist. +hardcode_libdir_flag_spec="$hardcode_libdir_flag_spec" + +# Whether we need a single -rpath flag with a separated argument. +hardcode_libdir_separator="$hardcode_libdir_separator" + +# Set to yes if using DIR/libNAME.so during linking hardcodes DIR into the +# resulting binary. +hardcode_direct=$hardcode_direct + +# Set to yes if using the -LDIR flag during linking hardcodes DIR into the +# resulting binary. +hardcode_minus_L=$hardcode_minus_L + +# Set to yes if using SHLIBPATH_VAR=DIR during linking hardcodes DIR into +# the resulting binary. +hardcode_shlibpath_var=$hardcode_shlibpath_var +EOF + +case "$host_os" in +aix3*) + cat <<\EOF >> "$ofile" + +# AIX sometimes has problems with the GCC collect2 program. For some +# reason, if we set the COLLECT_NAMES environment variable, the problems +# vanish in a puff of smoke. +if test "${COLLECT_NAMES+set}" != set; then + COLLECT_NAMES= + export COLLECT_NAMES +fi +EOF + ;; +esac + +echo '### END LIBTOOL CONFIG' >> "$ofile" +echo >> "$ofile" + +# Append the ltmain.sh script. +cat "$ltmain" >> "$ofile" || (rm -f "$ofile"; exit 1) + +chmod +x "$ofile" +exit 0 + +# Local Variables: +# mode:shell-script +# sh-indentation:2 +# End: diff --git a/ltmain.sh b/ltmain.sh new file mode 100644 index 00000000..cb817471 --- /dev/null +++ b/ltmain.sh @@ -0,0 +1,2608 @@ +# ltmain.sh - Provide generalized library-building support services. +# NOTE: Changing this file will not affect anything until you rerun ltconfig. +# +# Copyright (C) 1996-1998 Free Software Foundation, Inc. +# Gordon Matzigkeit , 1996 +# +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2 of the License, or +# (at your option) any later version. +# +# This program is distributed in the hope that it will be useful, but +# WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU +# General Public License for more details. +# +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA. +# +# As a special exception to the GNU General Public License, if you +# distribute this file as part of a program that contains a +# configuration script generated by Autoconf, you may include it under +# the same distribution terms that you use for the rest of that program. + +# Check that we have a working $echo. +if test "X$1" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift +elif test "X`($echo '\t') 2>/dev/null`" = 'X\t'; then + # Yippee, $echo works! + : +else + # Restart under the correct shell, and then maybe $echo will work. + exec $SHELL "$0" --no-reexec ${1+"$@"} +fi + +# The name of this program. +progname=`$echo "$0" | sed 's%^.*/%%'` +modename="$progname" + +# Constants. +PROGRAM=ltmain.sh +PACKAGE=libtool +VERSION=1.2b + +default_mode= +help="Try \`$progname --help' for more information." +magic="%%%MAGIC variable%%%" +mkdir="mkdir" +mv="mv -f" +rm="rm -f" + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e s/^X//' +sed_quote_subst='s/\([\\`\\"$\\\\]\)/\\\1/g' + +# NLS nuisances. +# Only set LANG and LC_ALL to C if already set. +# These must not be set unconditionally because not all systems understand +# e.g. LANG=C (notably SCO). +# We save the old values to restore during execute mode. +if test "${LC_ALL+set}" = set; then + save_LC_ALL="$LC_ALL"; LC_ALL=C; export LC_ALL +fi +if test "${LANG+set}" = set; then + save_LANG="$LANG"; LANG=C; export LANG +fi + +if test "$LTCONFIG_VERSION" != "$VERSION"; then + echo "$modename: ltconfig version \`$LTCONFIG_VERSION' does not match $PROGRAM version \`$VERSION'" 1>&2 + echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit 1 +fi + +if test "$build_libtool_libs" != yes && test "$build_old_libs" != yes; then + echo "$modename: not configured to build any kind of library" 1>&2 + echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit 1 +fi + +# Global variables. +mode=$default_mode +nonopt= +prev= +prevopt= +run= +show="$echo" +show_help= +execute_dlfiles= + +# Parse our command line options once, thoroughly. +while test $# -gt 0 +do + arg="$1" + shift + + case "$arg" in + -*=*) optarg=`$echo "X$arg" | $Xsed -e 's/[-_a-zA-Z0-9]*=//'` ;; + *) optarg= ;; + esac + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + case "$prev" in + execute_dlfiles) + eval "$prev=\"\$$prev \$arg\"" + ;; + *) + eval "$prev=\$arg" + ;; + esac + + prev= + prevopt= + continue + fi + + # Have we seen a non-optional argument yet? + case "$arg" in + --help) + show_help=yes + ;; + + --version) + echo "$PROGRAM (GNU $PACKAGE) $VERSION" + exit 0 + ;; + + --config) + sed -e '1,/^### BEGIN LIBTOOL CONFIG/d' -e '/^### END LIBTOOL CONFIG/,$d' $0 + exit 0 + ;; + + --debug) + echo "$progname: enabling shell trace mode" + set -x + ;; + + --dry-run | -n) + run=: + ;; + + --features) + echo "host: $host" + if test "$build_libtool_libs" = yes; then + echo "enable shared libraries" + else + echo "disable shared libraries" + fi + if test "$build_old_libs" = yes; then + echo "enable static libraries" + else + echo "disable static libraries" + fi + exit 0 + ;; + + --finish) mode="finish" ;; + + --mode) prevopt="--mode" prev=mode ;; + --mode=*) mode="$optarg" ;; + + --quiet | --silent) + show=: + ;; + + -dlopen) + prevopt="-dlopen" + prev=execute_dlfiles + ;; + + -*) + $echo "$modename: unrecognized option \`$arg'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + *) + nonopt="$arg" + break + ;; + esac +done + +if test -n "$prevopt"; then + $echo "$modename: option \`$prevopt' requires an argument" 1>&2 + $echo "$help" 1>&2 + exit 1 +fi + +if test -z "$show_help"; then + + # Infer the operation mode. + if test -z "$mode"; then + case "$nonopt" in + *cc | *++ | gcc* | *-gcc*) + mode=link + for arg + do + case "$arg" in + -c) + mode=compile + break + ;; + esac + done + ;; + *db | *dbx | *strace | *truss) + mode=execute + ;; + *install*|cp|mv) + mode=install + ;; + *rm) + mode=uninstall + ;; + *) + # If we have no mode, but dlfiles were specified, then do execute mode. + test -n "$execute_dlfiles" && mode=execute + + # Just use the default operation mode. + if test -z "$mode"; then + if test -n "$nonopt"; then + $echo "$modename: warning: cannot infer operation mode from \`$nonopt'" 1>&2 + else + $echo "$modename: warning: cannot infer operation mode without MODE-ARGS" 1>&2 + fi + fi + ;; + esac + fi + + # Only execute mode is allowed to have -dlopen flags. + if test -n "$execute_dlfiles" && test "$mode" != execute; then + $echo "$modename: unrecognized option \`-dlopen'" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + # Change the help message to a mode-specific one. + generic_help="$help" + help="Try \`$modename --help --mode=$mode' for more information." + + # These modes are in order of execution frequency so that they run quickly. + case "$mode" in + # libtool compile mode + compile) + modename="$modename: compile" + # Get the compilation command and the source file. + base_compile= + lastarg= + srcfile="$nonopt" + suppress_output= + + for arg + do + # Accept any command-line options. + case "$arg" in + -o) + $echo "$modename: you cannot specify the output filename with \`-o'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + -static) + build_old_libs=yes + continue + ;; + esac + + # Accept the current argument as the source file. + lastarg="$srcfile" + srcfile="$arg" + + # Aesthetically quote the previous argument. + + # Backslashify any backslashes, double quotes, and dollar signs. + # These are the only characters that are still specially + # interpreted inside of double-quoted scrings. + lastarg=`$echo "X$lastarg" | $Xsed -e "$sed_quote_subst"` + + # Double-quote args containing other shell metacharacters. + # Many Bourne shells cannot handle close brackets correctly in scan + # sets, so we specify it separately. + case "$lastarg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + lastarg="\"$lastarg\"" + ;; + esac + + # Add the previous argument to base_compile. + if test -z "$base_compile"; then + base_compile="$lastarg" + else + base_compile="$base_compile $lastarg" + fi + done + + # Get the name of the library object. + libobj=`$echo "X$srcfile" | $Xsed -e 's%^.*/%%'` + + # Recognize several different file suffixes. + xform='[cCFSfms]' + case "$libobj" in + *.ada) xform=ada ;; + *.adb) xform=adb ;; + *.ads) xform=ads ;; + *.asm) xform=asm ;; + *.c++) xform=c++ ;; + *.cc) xform=cc ;; + *.cpp) xform=cpp ;; + *.cxx) xform=cxx ;; + *.f90) xform=f90 ;; + *.for) xform=for ;; + esac + + libobj=`$echo "X$libobj" | $Xsed -e "s/\.$xform$/.lo/"` + + case "$libobj" in + *.lo) obj=`$echo "X$libobj" | $Xsed -e 's/\.lo$/.o/'` ;; + *) + $echo "$modename: cannot determine name of library object from \`$srcfile'" 1>&2 + exit 1 + ;; + esac + + if test -z "$base_compile"; then + $echo "$modename: you must specify a compilation command" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + # Delete any leftover library objects. + if test "$build_old_libs" = yes; then + $run $rm $obj $libobj + trap "$run $rm $obj $libobj; exit 1" 1 2 15 + else + $run $rm $libobj + trap "$run $rm $libobj; exit 1" 1 2 15 + fi + + # Only build a PIC object if we are building libtool libraries. + if test "$build_libtool_libs" = yes; then + # Without this assignment, base_compile gets emptied. + fbsd_hideous_sh_bug=$base_compile + + # All platforms use -DPIC, to notify preprocessed assembler code. + $show "$base_compile$pic_flag -DPIC $srcfile" + if $run eval "$base_compile\$pic_flag -DPIC \$srcfile"; then : + else + test -n "$obj" && $run $rm $obj + exit 1 + fi + + # If we have no pic_flag, then copy the object into place and finish. + if test -z "$pic_flag"; then + $show "$LN_S $obj $libobj" + $run $LN_S $obj $libobj + exit $? + fi + + # Just move the object, then go on to compile the next one + $show "$mv $obj $libobj" + $run $mv $obj $libobj || exit $? + + # Allow error messages only from the first compilation. + suppress_output=' >/dev/null 2>&1' + fi + + # Only build a position-dependent object if we build old libraries. + if test "$build_old_libs" = yes; then + # Suppress compiler output if we already did a PIC compilation. + $show "$base_compile $srcfile$suppress_output" + if $run eval "$base_compile \$srcfile$suppress_output"; then : + else + $run $rm $obj $libobj + exit 1 + fi + fi + + # Create an invalid libtool object if no PIC, so that we do not + # accidentally link it into a program. + if test "$build_libtool_libs" != yes; then + $show "echo timestamp > $libobj" + $run eval "echo timestamp > \$libobj" || exit $? + fi + + exit 0 + ;; + + # libtool link mode + link) + modename="$modename: link" + CC="$nonopt" + allow_undefined=yes + compile_command="$CC" + finalize_command="$CC" + + compile_shlibpath= + finalize_shlibpath= + convenience= + old_convenience= + deplibs= + dlfiles= + dlprefiles= + export_dynamic=no + generated= + hardcode_libdirs= + libobjs= + link_against_libtool_libs= + ltlibs= + objs= + prev= + prevarg= + release= + rpath= + perm_rpath= + temp_rpath= + vinfo= + + # We need to know -static, to get the right output filenames. + for arg + do + case "$arg" in + -all-static | -static) + if test "X$arg" = "X-all-static" && test "$build_libtool_libs" = yes && test -z "$link_static_flag"; then + $echo "$modename: warning: complete static linking is impossible in this configuration" 1>&2 + fi + build_libtool_libs=no + build_old_libs=yes + break + ;; + esac + done + + # See if our shared archives depend on static archives. + test -n "$old_archive_from_new_cmds" && build_old_libs=yes + + # Go through the arguments, transforming them on the way. + while test $# -gt 0; do + arg="$1" + shift + + # If the previous option needs an argument, assign it. + if test -n "$prev"; then + case "$prev" in + output) + compile_command="$compile_command @OUTPUT@" + finalize_command="$finalize_command @OUTPUT@" + ;; + esac + + case "$prev" in + dlfiles|dlprefiles) + case "$arg" in + *.la | *.lo) ;; # We handle these cases below. + *) + dlprefiles="$dlprefiles $arg" + test "$prev" = dlfiles && dlfiles="$dlfiles $arg" + prev= + ;; + esac + ;; + release) + release="-$arg" + prev= + continue + ;; + rpath) + rpath="$rpath $arg" + prev= + continue + ;; + *) + eval "$prev=\"\$arg\"" + prev= + continue + ;; + esac + fi + + prevarg="$arg" + + case "$arg" in + -all-static) + if test -n "$link_static_flag"; then + compile_command="$compile_command $link_static_flag" + finalize_command="$finalize_command $link_static_flag" + fi + continue + ;; + + -allow-undefined) + # FIXME: remove this flag sometime in the future. + $echo "$modename: \`-allow-undefined' is deprecated because it is the default" 1>&2 + continue + ;; + + -dlopen) + prev=dlfiles + continue + ;; + + -dlpreopen) + prev=dlprefiles + continue + ;; + + -export-dynamic) + if test "$export_dynamic" != yes; then + export_dynamic=yes + if test -n "$export_dynamic_flag_spec"; then + eval arg=\"$export_dynamic_flag_spec\" + else + arg= + fi + + # Add the symbol object into the linking commands. + compile_command="$compile_command @SYMFILE@" + finalize_command="$finalize_command @SYMFILE@" + fi + ;; + + -L*) + dir=`$echo "X$arg" | $Xsed -e 's%^-L\(.*\)$%\1%'` + case "$dir" in + /* | [A-Za-z]:[/\\]*) + # Add the corresponding hardcode_libdir_flag, if it is not identical. + ;; + *) + $echo "$modename: \`-L$dir' cannot specify a relative directory" 1>&2 + exit 1 + ;; + esac + deplibs="$deplibs $arg" + ;; + + -l*) deplibs="$deplibs $arg" ;; + + -no-undefined) + allow_undefined=no + continue + ;; + + -o) prev=output ;; + + -release) + prev=release + continue + ;; + + -rpath) + prev=rpath + continue + ;; + + -static) + # If we have no pic_flag, then this is the same as -all-static. + if test -z "$pic_flag" && test -n "$link_static_flag"; then + compile_command="$compile_command $link_static_flag" + finalize_command="$finalize_command $link_static_flag" + fi + continue + ;; + + -version-info) + prev=vinfo + continue + ;; + + # Some other compiler flag. + -* | +*) + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + ;; + + *.o | *.a) + # A standard object. + objs="$objs $arg" + ;; + + *.lo) + # A library object. + if test "$prev" = dlfiles; then + dlfiles="$dlfiles $arg" + if test "$build_libtool_libs" = yes; then + prev= + continue + else + # If libtool objects are unsupported, then we need to preload. + prev=dlprefiles + fi + fi + + if test "$prev" = dlprefiles; then + # Preload the old-style object. + dlprefiles="$dlprefiles "`$echo "X$arg" | $Xsed -e 's/\.lo$/.o/'` + prev= + fi + libobjs="$libobjs $arg" + ;; + + *.la) + # A libtool-controlled library. + + dlname= + libdir= + library_names= + old_library= + + # Check to see that this really is a libtool archive. + if (sed -e '2q' $arg | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$arg' is not a valid libtool archive" 1>&2 + exit 1 + fi + + # If there is no directory component, then add one. + case "$arg" in + */* | *\\*) . $arg ;; + *) . ./$arg ;; + esac + + # Get the name of the library we link against. + linklib= + for l in $old_library $library_names; do + linklib="$l" + done + + if test -z "$linklib"; then + $echo "$modename: cannot find name of link library for \`$arg'" 1>&2 + exit 1 + fi + + # Find the relevant object directory and library name. + name=`$echo "X$arg" | $Xsed -e 's%^.*/%%' -e 's/\.la$//' -e 's/^lib//'` + dir=`$echo "X$arg" | $Xsed -e 's%/[^/]*$%%'` + if test "X$dir" = "X$arg"; then + dir="$objdir" + else + dir="$dir/$objdir" + fi + + if test -z "$libdir"; then + # It is a libtool convenience library, so add in its objects. + convenience="$convenience $dir/$old_library"l + old_convenience="$old_convenience $dir/$old_library" + compile_command="$compile_command $dir/$old_library" + finalize_command="$finalize_command $dir/$old_library" + continue + fi + + # This library was specified with -dlopen. + if test "$prev" = dlfiles; then + dlfiles="$dlfiles $arg" + if test -z "$dlname"; then + # If there is no dlname, we need to preload. + prev=dlprefiles + else + # We should not create a dependency on this library, but we + # may need any libraries it requires. + compile_command="$compile_command$dependency_libs" + finalize_command="$finalize_command$dependency_libs" + prev= + continue + fi + fi + + # The library was specified with -dlpreopen. + if test "$prev" = dlprefiles; then + # Prefer using a static library (so that no silly _DYNAMIC symbols + # are required to link). + if test -n "$old_library"; then + dlprefiles="$dlprefiles $dir/$old_library" + else + dlprefiles="$dlprefiles $dir/$linklib" + fi + prev= + fi + + if test "$build_libtool_libs" = yes && test -n "$library_names"; then + link_against_libtool_libs="$link_against_libtool_libs $arg" + if test -n "$shlibpath_var"; then + # Make sure the rpath contains only unique directories. + case "$temp_rpath " in + *" $dir "*) ;; + *) temp_rpath="$temp_rpath $dir" ;; + esac + fi + + # This is the magic to use -rpath. + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + # Put the magic libdir with the hardcode flag. + hardcode_libdirs="$libdir" + libdir="@HARDCODE_LIBDIRS@" + else + # Just accumulate the unique libdirs. + case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir" + ;; + esac + libdir= + fi + fi + + if test -n "$libdir"; then + eval flag=\"$hardcode_libdir_flag_spec\" + + compile_command="$compile_command $flag" + finalize_command="$finalize_command $flag" + fi + elif test -n "$runpath_var"; then + # Do the same for the permanent run path. + case "$perm_rpath " in + *" $libdir "*) ;; + *) perm_rpath="$perm_rpath $libdir" ;; + esac + fi + + + lib_linked=yes + case "$hardcode_action" in + immediate | unsupported) + if test "$hardcode_direct" = no; then + compile_command="$compile_command $dir/$linklib" + elif test "$hardcode_minus_L" = no; then + compile_command="$compile_command -L$dir -l$name" + elif test "$hardcode_shlibpath_var" = no; then + compile_shlibpath="$compile_shlibpath$dir:" + compile_command="$compile_command -l$name" + else + lib_linked=no + fi + ;; + + relink) + # We need an absolute path. + case "$dir" in + /* | [A-Za-z]:[/\\]*) ;; + *) + absdir=`cd "$dir" && pwd` + if test -z "$absdir"; then + $echo "$modename: cannot determine absolute directory name of \`$dir'" 1>&2 + exit 1 + fi + dir="$absdir" + ;; + esac + + if test "$hardcode_direct" = yes; then + compile_command="$compile_command $dir/$linklib" + elif test "$hardcode_minus_L" = yes; then + compile_command="$compile_command -L$dir -l$name" + elif test "$hardcode_shlibpath_var" = yes; then + compile_shlibpath="$compile_shlibpath$dir:" + compile_command="$compile_command -l$name" + else + lib_linked=no + fi + ;; + + *) + lib_linked=no + ;; + esac + + if test "$lib_linked" != yes; then + $echo "$modename: configuration error: unsupported hardcode properties" + exit 1 + fi + + # Finalize command for both is simple: just hardcode it. + if test "$hardcode_direct" = yes; then + finalize_command="$finalize_command $libdir/$linklib" + elif test "$hardcode_minus_L" = yes; then + finalize_command="$finalize_command -L$libdir -l$name" + elif test "$hardcode_shlibpath_var" = yes; then + finalize_shlibpath="$finalize_shlibpath$libdir:" + finalize_command="$finalize_command -l$name" + else + # We cannot seem to hardcode it, guess we'll fake it. + finalize_command="$finalize_command -L$libdir -l$name" + fi + else + # Transform directly to old archives if we don't build new libraries. + if test -n "$pic_flag" && test -z "$old_library"; then + $echo "$modename: cannot find static library for \`$arg'" 1>&2 + exit 1 + fi + + # Here we assume that one of hardcode_direct or hardcode_minus_L + # is not unsupported. This is valid on all known static and + # shared platforms. + if test "$hardcode_direct" != unsupported; then + test -n "$old_library" && linklib="$old_library" + compile_command="$compile_command $dir/$linklib" + finalize_command="$finalize_command $dir/$linklib" + else + compile_command="$compile_command -L$dir -l$name" + finalize_command="$finalize_command -L$dir -l$name" + fi + fi + + # Add in any libraries that this one depends upon. + compile_command="$compile_command$dependency_libs" + finalize_command="$finalize_command$dependency_libs" + continue + ;; + + # Some other compiler argument. + *) + # Unknown arguments in both finalize_command and compile_command need + # to be aesthetically quoted because they are evaled later. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + ;; + esac + + # Now actually substitute the argument into the commands. + if test -n "$arg"; then + compile_command="$compile_command $arg" + finalize_command="$finalize_command $arg" + fi + done + + if test -n "$prev"; then + $echo "$modename: the \`$prevarg' option requires an argument" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + oldlibs= + case "$output" in + "") + $echo "$modename: you must specify an output file" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + */* | *\\*) + $echo "$modename: output file \`$output' must have no directory components" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + + *.a) + if test -n "$link_against_libtool_libs"; then + $echo "$modename: error: cannot link libtool libraries into archives" 1>&2 + exit 1 + fi + + if test -n "$deplibs"; then + $echo "$modename: warning: \`-l' and \`-L' are ignored for archives" 1>&2 + fi + + if test -n "$dlfiles$dlprefiles"; then + $echo "$modename: warning: \`-dlopen' is ignored for archives" 1>&2 + fi + + if test -n "$rpath"; then + $echo "$modename: warning: \`-rpath' is ignored for archives" 1>&2 + fi + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for archives" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for archives" 1>&2 + fi + + # Now set the variables for building old libraries. + build_libtool_libs=no + oldlibs="$output" + ;; + + *.la) + # Make sure we only generate libraries of the form `libNAME.la'. + case "$output" in + lib*) ;; + *) + $echo "$modename: libtool library \`$output' must begin with \`lib'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + esac + + name=`$echo "X$output" | $Xsed -e 's/\.la$//' -e 's/^lib//'` + eval libname=\"$libname_spec\" + + # All the library-specific variables (install_libdir is set above). + library_names= + old_library= + dlname= + + if test -n "$objs"; then + $echo "$modename: cannot build libtool library \`$output' from non-libtool objects:$objs" 2>&1 + exit 1 + fi + + # How the heck are we supposed to write a wrapper for a shared library? + if test -n "$link_against_libtool_libs"; then + $echo "$modename: error: cannot link shared libraries into libtool libraries" 1>&2 + exit 1 + fi + + if test -n "$dlfiles$dlprefiles"; then + $echo "$modename: warning: \`-dlopen' is ignored for libtool libraries" 1>&2 + fi + + set dummy $rpath + if test $# -gt 2; then + $echo "$modename: warning: ignoring multiple \`-rpath's for a libtool library" 1>&2 + fi + install_libdir="$2" + + # Now set the variables for building old libraries. + oldlibs="$objdir/$libname.a" + if test -z "$rpath"; then + # Building a libtool convenience library. + oldlibs="$objdir/$libname.al $oldlibs" + build_libtool_libs=convenience + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for convenience libraries" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for convenience libraries" 1>&2 + fi + else + + # Parse the version information argument. + IFS="${IFS= }"; save_ifs="$IFS"; IFS=':' + set dummy $vinfo 0 0 0 + IFS="$save_ifs" + + if test -n "$8"; then + $echo "$modename: too many parameters to \`-version-info'" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + current="$2" + revision="$3" + age="$4" + + # Check that each of the things are valid numbers. + case "$current" in + 0 | [1-9] | [1-9][0-9]*) ;; + *) + $echo "$modename: CURRENT \`$current' is not a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + ;; + esac + + case "$revision" in + 0 | [1-9] | [1-9][0-9]*) ;; + *) + $echo "$modename: REVISION \`$revision' is not a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + ;; + esac + + case "$age" in + 0 | [1-9] | [1-9][0-9]*) ;; + *) + $echo "$modename: AGE \`$age' is not a nonnegative integer" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + ;; + esac + + if test $age -gt $current; then + $echo "$modename: AGE \`$age' is greater than the current interface number \`$current'" 1>&2 + $echo "$modename: \`$vinfo' is not valid version information" 1>&2 + exit 1 + fi + + # Calculate the version variables. + major= + versuffix= + verstring= + case "$version_type" in + none) ;; + + linux) + major=.`expr $current - $age` + versuffix="$major.$age.$revision" + ;; + + osf) + major=`expr $current - $age` + versuffix=".$current.$age.$revision" + verstring="$current.$age.$revision" + + # Add in all the interfaces that we are compatible with. + loop=$age + while test $loop != 0; do + iface=`expr $current - $loop` + loop=`expr $loop - 1` + verstring="$verstring:${iface}.0" + done + + # Make executables depend on our current version. + verstring="$verstring:${current}.0" + ;; + + sunos) + major=".$current" + versuffix=".$current.$revision" + ;; + + *) + $echo "$modename: unknown library version type \`$version_type'" 1>&2 + echo "Fatal configuration error. See the $PACKAGE docs for more information." 1>&2 + exit 1 + ;; + esac + + # Clear the version info if we defaulted, and they specified a release. + if test -z "$vinfo" && test -n "$release"; then + major= + versuffix= + verstring="0.0" + fi + + # Check to see if the archive will have undefined symbols. + if test "$allow_undefined" = yes; then + if test "$allow_undefined_flag" = unsupported; then + $echo "$modename: warning: undefined symbols not allowed in $host shared libraries" 1>&2 + build_libtool_libs=no + build_old_libs=yes + fi + else + # Don't allow undefined symbols. + allow_undefined_flag="$no_undefined_flag" + fi + + # Add libc to deplibs on all systems. + dependency_libs="$deplibs" + deplibs="$deplibs -lc" + fi + + # Create the output directory, or remove our outputs if we need to. + if test -d $objdir; then + $show "${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.*" + $run ${rm}r $objdir/$output $objdir/$libname.* $objdir/${libname}${release}.* + else + $show "$mkdir $objdir" + $run $mkdir $objdir + status=$? + if test $status -ne 0 && test ! -d $objdir; then + exit $status + fi + fi + + if test "$build_libtool_libs" = yes; then + # Get the real and link names of the library. + eval library_names=\"$library_names_spec\" + set dummy $library_names + realname="$2" + shift; shift + + if test -n "$soname_spec"; then + eval soname=\"$soname_spec\" + else + soname="$realname" + fi + + lib="$objdir/$realname" + for link + do + linknames="$linknames $link" + done + + # Use standard objects if they are PIC. + test -z "$pic_flag" && libobjs=`$echo "X$libobjs " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//g'` + + # Transform .lo files to .o files. + test "$build_old_libs" = yes && oldobjs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^ ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'` + + if test -n "$whole_archive_flag_spec"; then + if test -n "$convenience"; then + eval libobjs=\"\$libobjs $whole_archive_flag_spec\" + fi + else + for xlib in $convenience; do + # Extract the objects. + xdir="$xlib"x + generated="$generated $xdir" + xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'` + + $show "${rm}r $xdir" + $run ${rm}r "$xdir" + $show "mkdir $xdir" + $run mkdir "$xdir" + status=$? + if test $status -ne 0 && test ! -d "$xdir"; then + exit $status + fi + $show "(cd $xdir && $AR x ../$xlib)" + $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $? + + libobjs="$libobjs `echo $xdir/*`" + done + fi + + # Do each of the archive commands. + eval cmds=\"$archive_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + + # Create links to the real library. + for linkname in $linknames; do + if test "$realname" != "$linkname"; then + $show "(cd $objdir && $LN_S $realname $linkname)" + $run eval '(cd $objdir && $LN_S $realname $linkname)' || exit $? + fi + done + + # If -export-dynamic was specified, set the dlname. + if test "$export_dynamic" = yes; then + # On all known operating systems, these are identical. + dlname="$soname" + fi + fi + ;; + + *.lo | *.o) + if test -n "$link_against_libtool_libs"; then + $echo "$modename: error: cannot link libtool libraries into objects" 1>&2 + exit 1 + fi + + if test -n "$deplibs"; then + $echo "$modename: warning: \`-l' and \`-L' are ignored for objects" 1>&2 + fi + + if test -n "$dlfiles$dlprefiles"; then + $echo "$modename: warning: \`-dlopen' is ignored for objects" 1>&2 + fi + + if test -n "$rpath"; then + $echo "$modename: warning: \`-rpath' is ignored for objects" 1>&2 + fi + + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for objects" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for objects" 1>&2 + fi + + case "$output" in + *.lo) + if test -n "$objs"; then + $echo "$modename: cannot build library object \`$output' from non-libtool objects" 1>&2 + exit 1 + fi + libobj="$output" + obj=`$echo "X$output" | $Xsed -e 's/\.lo$/.o/'` + ;; + *) + libobj= + obj="$output" + ;; + esac + + # Delete the old objects. + $run $rm $obj $libobj + + # Create the old-style object. + reload_objs="$objs"`$echo "X$libobjs " | $Xsed -e 's/[^ ]*\.a //g' -e 's/\.lo /.o /g' -e 's/ $//g'` + + output="$obj" + eval cmds=\"$reload_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + + # Exit if we aren't doing a library object file. + test -z "$libobj" && exit 0 + + if test "$build_libtool_libs" != yes; then + # Create an invalid libtool object if no PIC, so that we don't + # accidentally link it into a program. + $show "echo timestamp > $libobj" + $run eval "echo timestamp > $libobj" || exit $? + exit 0 + fi + + if test -n "$pic_flag"; then + # Only do commands if we really have different PIC objects. + reload_objs="$libobjs" + output="$libobj" + eval cmds=\"$reload_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + else + # Just create a symlink. + $show "$LN_S $obj $libobj" + $run $LN_S $obj $libobj || exit $? + fi + + exit 0 + ;; + + *) + if test -n "$vinfo"; then + $echo "$modename: warning: \`-version-info' is ignored for programs" 1>&2 + fi + + if test -n "$release"; then + $echo "$modename: warning: \`-release' is ignored for programs" 1>&2 + fi + + if test -n "$rpath"; then + # If the user specified any rpath flags, then add them. + for libdir in $rpath; do + if test -n "$hardcode_libdir_flag_spec"; then + if test -n "$hardcode_libdir_separator"; then + if test -z "$hardcode_libdirs"; then + # Put the magic libdir with the hardcode flag. + hardcode_libdirs="$libdir" + libdir="@HARDCODE_LIBDIRS@" + else + # Just accumulate the unique libdirs. + case "$hardcode_libdir_separator$hardcode_libdirs$hardcode_libdir_separator" in + *"$hardcode_libdir_separator$libdir$hardcode_libdir_separator"*) + ;; + *) + hardcode_libdirs="$hardcode_libdirs$hardcode_libdir_separator$libdir" + ;; + esac + libdir= + fi + fi + + if test -n "$libdir"; then + eval flag=\"$hardcode_libdir_flag_spec\" + + compile_command="$compile_command $flag" + finalize_command="$finalize_command $flag" + fi + elif test -n "$runpath_var"; then + case "$perm_rpath " in + *" $libdir "*) ;; + *) perm_rpath="$perm_rpath $libdir" ;; + esac + fi + done + fi + + # Substitute the hardcoded libdirs into the compile commands. + if test -n "$hardcode_libdir_separator"; then + compile_command=`$echo "X$compile_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"` + finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@HARDCODE_LIBDIRS@%$hardcode_libdirs%g"` + fi + + if test -n "$libobjs" && test "$build_old_libs" = yes; then + # Transform all the library objects into standard objects. + compile_command=`$echo "X$compile_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'` + finalize_command=`$echo "X$finalize_command " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'` + fi + + if test "$export_dynamic" = yes && test -n "$NM" && test -n "$global_symbol_pipe"; then + dlsyms="${output}S.c" + else + dlsyms= + fi + + if test -n "$dlsyms"; then + # Add our own program objects to the preloaded list. + dlprefiles=`$echo "X$objs$dlprefiles " | $Xsed -e 's/\.lo /.o /g' -e 's/ $//'` + + # Discover the nlist of each of the dlfiles. + nlist="$objdir/${output}.nm" + + if test -d $objdir; then + $show "$rm $nlist ${nlist}T" + $run $rm "$nlist" "${nlist}T" + else + $show "$mkdir $objdir" + $run $mkdir $objdir + status=$? + if test $status -ne 0 && test ! -d $objdir; then + exit $status + fi + fi + + for arg in $dlprefiles; do + $show "extracting global C symbols from \`$arg'" + $run eval "$NM $arg | $global_symbol_pipe >> '$nlist'" + done + + # Parse the name list into a source file. + $show "creating $objdir/$dlsyms" + if test -z "$run"; then + # Make sure we at least have an empty file. + test -f "$nlist" || : > "$nlist" + + # Try sorting and uniquifying the output. + if sort "$nlist" | uniq > "$nlist"T; then + mv -f "$nlist"T "$nlist" + wcout=`wc "$nlist" 2>/dev/null` + count=`echo "X$wcout" | $Xsed -e 's/^[ ]*\([0-9][0-9]*\).*$/\1/'` + (test "$count" -ge 0) 2>/dev/null || count=-1 + else + $rm "$nlist"T + count=-1 + fi + + case "$dlsyms" in + "") ;; + *.c) + $echo > "$objdir/$dlsyms" "\ +/* $dlsyms - symbol resolution table for \`$output' dlsym emulation. */ +/* Generated by $PROGRAM - GNU $PACKAGE $VERSION */ + +#ifdef __cplusplus +extern \"C\" { +#endif + +/* Prevent the only kind of declaration conflicts we can make. */ +#define dld_preloaded_symbol_count some_other_symbol +#define dld_preloaded_symbols some_other_symbol + +/* External symbol declarations for the compiler. */\ +" + + if test -f "$nlist"; then + sed -e 's/^.* \(.*\)$/extern char \1;/' < "$nlist" >> "$objdir/$dlsyms" + else + echo '/* NONE */' >> "$objdir/$dlsyms" + fi + + $echo >> "$objdir/$dlsyms" "\ + +#undef dld_preloaded_symbol_count +#undef dld_preloaded_symbols + +#if defined (__STDC__) && __STDC__ +# define __ptr_t void * +#else +# define __ptr_t char * +#endif + +/* The number of symbols in dld_preloaded_symbols, -1 if unsorted. */ +int dld_preloaded_symbol_count = $count; + +/* The mapping between symbol names and symbols. */ +struct { + char *name; + __ptr_t address; +} +dld_preloaded_symbols[] = +{\ +" + + if test -f "$nlist"; then + sed 's/^\(.*\) \(.*\)$/ {"\1", (__ptr_t) \&\2},/' < "$nlist" >> "$objdir/$dlsyms" + fi + + $echo >> "$objdir/$dlsyms" "\ + {0, (__ptr_t) 0} +}; + +#ifdef __cplusplus +} +#endif\ +" + ;; + + *) + $echo "$modename: unknown suffix for \`$dlsyms'" 1>&2 + exit 1 + ;; + esac + fi + + # Now compile the dynamic symbol file. + $show "(cd $objdir && $CC -c$no_builtin_flag \"$dlsyms\")" + $run eval '(cd $objdir && $CC -c$no_builtin_flag "$dlsyms")' || exit $? + + # Transform the symbol file into the correct name. + compile_command=`$echo "X$compile_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"` + finalize_command=`$echo "X$finalize_command" | $Xsed -e "s%@SYMFILE@%$objdir/${output}S.o%"` + elif test "$export_dynamic" != yes; then + test -n "$dlfiles$dlprefiles" && $echo "$modename: warning: \`-dlopen' and \`-dlpreopen' are ignored without \`-export-dynamic'" 1>&2 + else + # We keep going just in case the user didn't refer to + # dld_preloaded_symbols. The linker will fail if global_symbol_pipe + # really was required. + $echo "$modename: not configured to extract global symbols from dlpreopened files" 1>&2 + + # Nullify the symbol file. + compile_command=`$echo "X$compile_command" | $Xsed -e "s% @SYMFILE@%%"` + finalize_command=`$echo "X$finalize_command" | $Xsed -e "s% @SYMFILE@%%"` + fi + + if test -z "$link_against_libtool_libs" || test "$build_libtool_libs" != yes; then + # Replace the output file specification. + compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'` + finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$output"'%g'` + + # We have no uninstalled library dependencies, so finalize right now. + $show "$compile_command" + $run eval "$compile_command" + exit $? + fi + + # Replace the output file specification. + compile_command=`$echo "X$compile_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'%g'` + finalize_command=`$echo "X$finalize_command" | $Xsed -e 's%@OUTPUT@%'"$objdir/$output"'T%g'` + + # Create the binary in the object directory, then wrap it. + if test ! -d $objdir; then + $show "$mkdir $objdir" + $run $mkdir $objdir + status=$? + if test $status -ne 0 && test ! -d $objdir; then + exit $status + fi + fi + + if test -n "$shlibpath_var"; then + # We should set the shlibpath_var + rpath= + for dir in $temp_rpath; do + case "$dir" in + /* | [A-Za-z]:[/\\]*) + # Absolute path. + rpath="$rpath$dir:" + ;; + *) + # Relative path: add a thisdir entry. + rpath="$rpath\$thisdir/$dir:" + ;; + esac + done + temp_rpath="$rpath" + fi + + # Delete the old output file. + $run $rm $output + + if test -n "$compile_shlibpath"; then + compile_command="$shlibpath_var=\"$compile_shlibpath\$$shlibpath_var\" $compile_command" + fi + if test -n "$finalize_shlibpath"; then + finalize_command="$shlibpath_var=\"$finalize_shlibpath\$$shlibpath_var\" $finalize_command" + fi + + if test -n "$runpath_var" && test -n "$perm_rpath"; then + # We should set the runpath_var. + rpath= + for dir in $perm_rpath; do + rpath="$rpath$dir:" + done + compile_command="$runpath_var=\"$rpath\$$runpath_var\" $compile_command" + finalize_command="$runpath_var=\"$rpath\$$runpath_var\" $finalize_command" + fi + + if test "$hardcode_action" = relink; then + # AGH! Flame the AIX and HP-UX people for me, will ya? + $echo "$modename: warning: using a buggy system linker" 1>&2 + $echo "$modename: relinking will be required before \`$output' can be installed" 1>&2 + fi + + $show "$compile_command" + $run eval "$compile_command" || exit $? + + # Now create the wrapper script. + $show "creating $output" + + # Quote the finalize command for shipping. + finalize_command=`$echo "X$finalize_command" | $Xsed -e "$sed_quote_subst"` + + # Quote $echo for shipping. + qecho=`$echo "X$echo" | $Xsed -e "$sed_quote_subst"` + + # Only actually do things if our run command is non-null. + if test -z "$run"; then + $rm $output + trap "$rm $output; exit 1" 1 2 15 + + $echo > $output "\ +#! $SHELL + +# $output - temporary wrapper script for $objdir/$output +# Generated by $PROGRAM - GNU $PACKAGE $VERSION +# +# The $output program cannot be directly executed until all the libtool +# libraries that it depends on are installed. +# +# This wrapper script should never be moved out of \``pwd`'. +# If it is, it will not operate correctly. + +# Sed substitution that helps us do robust quoting. It backslashifies +# metacharacters that are still active within double-quoted strings. +Xsed='sed -e s/^X//' +sed_quote_subst='$sed_quote_subst' + +# The HP-UX ksh and POSIX shell print the target directory to stdout +# if CDPATH is set. +if test \"\${CDPATH+set}\" = set; then CDPATH=; export CDPATH; fi + +# This environment variable determines our operation mode. +if test \"\$libtool_install_magic\" = \"$magic\"; then + # install mode needs the following variables: + link_against_libtool_libs='$link_against_libtool_libs' + finalize_command=\"$finalize_command\" +else + # When we are sourced in execute mode, \$file and \$echo are already set. + if test \"\$libtool_execute_magic\" != \"$magic\"; then + echo=\"$qecho\" + file=\"\$0\" + # Make sure echo works. + if test \"X\$1\" = X--no-reexec; then + # Discard the --no-reexec flag, and continue. + shift + elif test \"X\`(\$echo '\t') 2>/dev/null\`\" = 'X\t'; then + # Yippee, \$echo works! + : + else + # Restart under the correct shell, and then maybe \$echo will work. + exec $SHELL \"\$0\" --no-reexec \${1+\"\$@\"} + fi + fi\ +" + $echo >> $output "\ + + # Find the directory that this script lives in. + thisdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*$%%'\` + test \"x\$thisdir\" = \"x\$file\" && thisdir=. + + # Follow symbolic links until we get to the real thisdir. + file=\`ls -ld \"\$file\" | sed -n 's/.*-> //p'\` + while test -n \"\$file\"; do + destdir=\`\$echo \"X\$file\" | \$Xsed -e 's%/[^/]*\$%%'\` + + # If there was a directory component, then change thisdir. + if test \"x\$destdir\" != \"x\$file\"; then + case \"\$destdir\" in + /* | [A-Za-z]:[/\\]*) thisdir=\"\$destdir\" ;; + *) thisdir=\"\$thisdir/\$destdir\" ;; + esac + fi + + file=\`\$echo \"X\$file\" | \$Xsed -e 's%^.*/%%'\` + file=\`ls -ld \"\$thisdir/\$file\" | sed -n 's/.*-> //p'\` + done + + # Try to get the absolute directory name. + absdir=\`cd \"\$thisdir\" && pwd\` + test -n \"\$absdir\" && thisdir=\"\$absdir\" + + progdir=\"\$thisdir/$objdir\" + program='$output' + + if test -f \"\$progdir/\$program\"; then" + + # Export our shlibpath_var if we have one. + if test -n "$shlibpath_var" && test -n "$temp_rpath"; then + $echo >> $output "\ + # Add our own library path to $shlibpath_var + $shlibpath_var=\"$temp_rpath\$$shlibpath_var\" + + # Some systems cannot cope with colon-terminated $shlibpath_var + $shlibpath_var=\`\$echo \"X\$$shlibpath_var\" | \$Xsed -e 's/:*\$//'\` + + export $shlibpath_var +" + fi + + $echo >> $output "\ + if test \"\$libtool_execute_magic\" != \"$magic\"; then + # Run the actual program with our arguments. + + # Export the path to the program. + PATH=\"\$progdir:\$PATH\" + export PATH + + exec \$program \${1+\"\$@\"} + + \$echo \"\$0: cannot exec \$program \${1+\"\$@\"}\" + exit 1 + fi + else + # The program doesn't exist. + \$echo \"\$0: error: \$progdir/\$program does not exist\" 1>&2 + \$echo \"This script is just a wrapper for \$program.\" 1>&2 + echo \"See the $PACKAGE documentation for more information.\" 1>&2 + exit 1 + fi +fi\ +" + chmod +x $output + fi + exit 0 + ;; + esac + + # See if we need to build an old-fashioned archive. + for oldlib in $oldlibs; do + + if test "$build_libtool_libs" = convenience; then + oldobjs="$libobjs" + addlibs="$convenience" + build_libtool_libs=no + else + addlibs="$old_convenience" + fi + + # Add in members from convenience archives. + for xlib in $addlibs; do + # Extract the objects. + xdir="$xlib"x + generated="$generated $xdir" + xlib=`echo "$xlib" | $Xsed -e 's%^.*/%%'` + + $show "${rm}r $xdir" + $run ${rm}r "$xdir" + $show "mkdir $xdir" + $run mkdir "$xdir" + status=$? + if test $status -ne 0 && test ! -d "$xdir"; then + exit $status + fi + $show "(cd $xdir && $AR x ../$xlib)" + $run eval "(cd \$xdir && $AR x ../\$xlib)" || exit $? + + oldobjs="$oldobjs `echo $xdir/*`" + done + + # Do each command in the archive commands. + if test -n "$old_archive_from_new_cmds" && test "$build_libtool_libs" = yes; then + eval cmds=\"$old_archive_from_new_cmds\" + else + eval cmds=\"$old_archive_cmds\" + fi + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + done + + if test -n "$generated"; then + $show "${rm}r$generated" + $run ${rm}r$generated + fi + + # Now create the libtool archive. + case "$output" in + *.la) + old_library= + test "$build_old_libs" = yes && old_library="$libname.a" + $show "creating $output" + + # Only create the output if not a dry run. + if test -z "$run"; then + $echo > $output "\ +# $output - a libtool library file +# Generated by $PROGRAM - GNU $PACKAGE $VERSION + +# The name that we can dlopen(3). +dlname='$dlname' + +# Names of this library. +library_names='$library_names' + +# The name of the static archive. +old_library='$old_library' + +# Libraries that this one depends upon. +dependency_libs='$dependency_libs' + +# Version information for $libname. +current=$current +age=$age +revision=$revision + +# Directory that this library needs to be installed in: +libdir='$install_libdir'\ +" + fi + + # Do a symbolic link so that the libtool archive can be found in + # LD_LIBRARY_PATH before the program is installed. + $show "(cd $objdir && $LN_S ../$output $output)" + $run eval "(cd $objdir && $LN_S ../$output $output)" || exit $? + ;; + esac + exit 0 + ;; + + # libtool install mode + install) + modename="$modename: install" + + # There may be an optional sh(1) argument at the beginning of + # install_prog (especially on Windows NT). + if test "$nonopt" = "$SHELL"; then + # Aesthetically quote it. + arg=`$echo "X$nonopt" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + install_prog="$arg " + arg="$1" + shift + else + install_prog= + arg="$nonopt" + fi + + # The real first argument should be the name of the installation program. + # Aesthetically quote it. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + install_prog="$install_prog$arg" + + # We need to accept at least all the BSD install flags. + dest= + files= + opts= + prev= + install_type= + isdir=no + stripme= + for arg + do + if test -n "$dest"; then + files="$files $dest" + dest="$arg" + continue + fi + + case "$arg" in + -d) isdir=yes ;; + -f) prev="-f" ;; + -g) prev="-g" ;; + -m) prev="-m" ;; + -o) prev="-o" ;; + -s) + stripme=" -s" + continue + ;; + -*) ;; + + *) + # If the previous option needed an argument, then skip it. + if test -n "$prev"; then + prev= + else + dest="$arg" + continue + fi + ;; + esac + + # Aesthetically quote the argument. + arg=`$echo "X$arg" | $Xsed -e "$sed_quote_subst"` + case "$arg" in + *[\[\~\#\^\&\*\(\)\{\}\|\;\<\>\?\'\ \ ]*|*]*) + arg="\"$arg\"" + ;; + esac + install_prog="$install_prog $arg" + done + + if test -z "$install_prog"; then + $echo "$modename: you must specify an install program" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + if test -n "$prev"; then + $echo "$modename: the \`$prev' option requires an argument" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + if test -z "$files"; then + if test -z "$dest"; then + $echo "$modename: no file or destination specified" 1>&2 + else + $echo "$modename: you must specify a destination" 1>&2 + fi + $echo "$help" 1>&2 + exit 1 + fi + + # Strip any trailing slash from the destination. + dest=`$echo "X$dest" | $Xsed -e 's%/$%%'` + + # Check to see that the destination is a directory. + test -d "$dest" && isdir=yes + if test "$isdir" = yes; then + destdir="$dest" + destname= + else + destdir=`$echo "X$dest" | $Xsed -e 's%/[^/]*$%%'` + test "X$destdir" = "X$dest" && destdir=. + destname=`$echo "X$dest" | $Xsed -e 's%^.*/%%'` + + # Not a directory, so check to see that there is only one file specified. + set dummy $files + if test $# -gt 2; then + $echo "$modename: \`$dest' is not a directory" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + fi + case "$destdir" in + /* | [A-Za-z]:[/\\]*) ;; + *) + for file in $files; do + case "$file" in + *.lo) ;; + *) + $echo "$modename: \`$destdir' must be an absolute directory name" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + esac + done + ;; + esac + + # This variable tells wrapper scripts just to set variables rather + # than running their programs. + libtool_install_magic="$magic" + + staticlibs= + future_libdirs= + current_libdirs= + for file in $files; do + + # Do each installation. + case "$file" in + *.a) + # Do the static libraries later. + staticlibs="$staticlibs $file" + ;; + + *.la) + # Check to see that this really is a libtool archive. + if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$file' is not a valid libtool archive" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + library_names= + old_library= + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Add the libdir to current_libdirs if it is the destination. + if test "X$destdir" = "X$libdir"; then + case "$current_libdirs " in + *" $libdir "*) ;; + *) current_libdirs="$current_libdirs $libdir" ;; + esac + else + # Note the libdir as a future libdir. + case "$future_libdirs " in + *" $libdir "*) ;; + *) future_libdirs="$future_libdirs $libdir" ;; + esac + fi + + dir="`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'`/" + test "X$dir" = "X$file/" && dir= + dir="$dir$objdir" + + # See the names of the shared library. + set dummy $library_names + if test -n "$2"; then + realname="$2" + shift + shift + + # Install the shared library and build the symlinks. + $show "$install_prog $dir/$realname $destdir/$realname" + $run eval "$install_prog $dir/$realname $destdir/$realname" || exit $? + test "X$dlname" = "X$realname" && dlname= + + if test $# -gt 0; then + # Delete the old symlinks. + rmcmd="$rm" + for linkname + do + rmcmd="$rmcmd $destdir/$linkname" + done + $show "$rmcmd" + $run $rmcmd + + # ... and create new ones. + for linkname + do + test "X$dlname" = "X$linkname" && dlname= + $show "(cd $destdir && $LN_S $realname $linkname)" + $run eval "(cd $destdir && $LN_S $realname $linkname)" + done + fi + + if test -n "$dlname"; then + # Install the dynamically-loadable library. + $show "$install_prog $dir/$dlname $destdir/$dlname" + $run eval "$install_prog $dir/$dlname $destdir/$dlname" || exit $? + fi + + # Do each command in the postinstall commands. + lib="$destdir/$realname" + eval cmds=\"$postinstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + fi + + # Install the pseudo-library for information purposes. + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + $show "$install_prog $file $destdir/$name" + $run eval "$install_prog $file $destdir/$name" || exit $? + + # Maybe install the static library, too. + test -n "$old_library" && staticlibs="$staticlibs $dir/$old_library" + ;; + + *.lo) + # Install (i.e. copy) a libtool object. + + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + destfile="$destdir/$destfile" + fi + + # Deduce the name of the destination old-style object file. + case "$destfile" in + *.lo) + staticdest=`$echo "X$destfile" | $Xsed -e 's/\.lo$/.o/'` + ;; + *.o) + staticdest="$destfile" + destfile= + ;; + *) + $echo "$modename: cannot copy a libtool object to \`$destfile'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; + esac + + # Install the libtool object if requested. + if test -n "$destfile"; then + $show "$install_prog $file $destfile" + $run eval "$install_prog $file $destfile" || exit $? + fi + + # Install the old object if enabled. + if test "$build_old_libs" = yes; then + # Deduce the name of the old-style object file. + staticobj=`$echo "X$file" | $Xsed -e 's/\.lo$/.o/'` + + $show "$install_prog $staticobj $staticdest" + $run eval "$install_prog \$staticobj \$staticdest" || exit $? + fi + exit 0 + ;; + + *) + # Figure out destination file name, if it wasn't already specified. + if test -n "$destname"; then + destfile="$destdir/$destname" + else + destfile=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + destfile="$destdir/$destfile" + fi + + # Do a test to see if this is really a libtool program. + if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + link_against_libtool_libs= + finalize_command= + + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Check the variables that should have been set. + if test -z "$link_against_libtool_libs" || test -z "$finalize_command"; then + $echo "$modename: invalid libtool wrapper script \`$file'" 1>&2 + exit 1 + fi + + finalize=yes + for lib in $link_against_libtool_libs; do + # Check to see that each library is installed. + libdir= + if test -f "$lib"; then + # If there is no directory component, then add one. + case "$lib" in + */* | *\\*) . $lib ;; + *) . ./$lib ;; + esac + fi + libfile="$libdir/`$echo "X$lib" | $Xsed -e 's%^.*/%%g'`" + if test -n "$libdir" && test ! -f "$libfile"; then + $echo "$modename: warning: \`$lib' has not been installed in \`$libdir'" 1>&2 + finalize=no + fi + done + + if test "$hardcode_action" = relink; then + if test "$finalize" = yes; then + $echo "$modename: warning: relinking \`$file' on behalf of your buggy system linker" 1>&2 + $show "$finalize_command" + if $run eval "$finalize_command"; then : + else + $echo "$modename: error: relink \`$file' with the above command before installing it" 1>&2 + continue + fi + file="$objdir/$file"T + else + $echo "$modename: warning: cannot relink \`$file' on behalf of your buggy system linker" 1>&2 + fi + else + # Install the binary that we compiled earlier. + file=`$echo "X$file" | $Xsed -e "s%\([^/]*\)$%$objdir/\1%"` + fi + fi + + $show "$install_prog$stripme $file $destfile" + $run eval "$install_prog\$stripme \$file \$destfile" || exit $? + ;; + esac + done + + for file in $staticlibs; do + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + + # Set up the ranlib parameters. + oldlib="$destdir/$name" + + $show "$install_prog $file $oldlib" + $run eval "$install_prog \$file \$oldlib" || exit $? + + # Do each command in the postinstall commands. + eval cmds=\"$old_postinstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || exit $? + done + IFS="$save_ifs" + done + + if test -n "$future_libdirs"; then + $echo "$modename: warning: remember to run \`$progname --finish$future_libdirs'" 1>&2 + fi + + if test -n "$current_libdirs"; then + # Maybe just do a dry run. + test -n "$run" && current_libdirs=" -n$current_libdirs" + exec $SHELL $0 --finish$current_libdirs + exit 1 + fi + + exit 0 + ;; + + # libtool finish mode + finish) + modename="$modename: finish" + libdirs="$nonopt" + admincmds= + + if test -n "$finish_cmds$finish_eval" && test -n "$libdirs"; then + for dir + do + libdirs="$libdirs $dir" + done + + for libdir in $libdirs; do + if test -n "$finish_cmds"; then + # Do each command in the finish commands. + eval cmds=\"$finish_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" || admincmds="$admincmds + $cmd" + done + IFS="$save_ifs" + fi + if test -n "$finish_eval"; then + # Do the single finish_eval. + eval cmds=\"$finish_eval\" + $run eval "$cmds" || admincmds="$admincmds + $cmds" + fi + done + fi + + echo "----------------------------------------------------------------------" + echo "Libraries have been installed in:" + for libdir in $libdirs; do + echo " $libdir" + done + echo + echo "To link against installed libraries in a given directory, LIBDIR," + echo "you must use the \`-LLIBDIR' flag during linking." + echo + echo " You will also need to do at least one of the following:" + if test -n "$shlibpath_var"; then + echo " - add LIBDIR to the \`$shlibpath_var' environment variable" + echo " during execution" + fi + if test -n "$runpath_var"; then + echo " - add LIBDIR to the \`$runpath_var' environment variable" + echo " during linking" + fi + if test -n "$hardcode_libdir_flag_spec"; then + libdir=LIBDIR + eval flag=\"$hardcode_libdir_flag_spec\" + + echo " - use the \`$flag' linker flag" + fi + if test -n "$admincmds"; then + echo " - have your system administrator run these commands:$admincmds" + fi + if test -f /etc/ld.so.conf; then + echo " - have your system administrator add LIBDIR to \`/etc/ld.so.conf'" + fi + echo + echo "See any operating system documentation about shared libraries for" + echo "more information, such as the ld(1) and ld.so(8) manual pages." + echo "----------------------------------------------------------------------" + exit 0 + ;; + + # libtool execute mode + execute) + modename="$modename: execute" + + # The first argument is the command name. + cmd="$nonopt" + if test -z "$cmd"; then + $echo "$modename: you must specify a COMMAND" 1>&2 + $echo "$help" + exit 1 + fi + + # Handle -dlopen flags immediately. + for file in $execute_dlfiles; do + if test ! -f "$file"; then + $echo "$modename: \`$file' is not a file" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + dir= + case "$file" in + *.la) + # Check to see that this really is a libtool archive. + if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then : + else + $echo "$modename: \`$lib' is not a valid libtool archive" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + # Read the libtool library. + dlname= + library_names= + + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Skip this library if it cannot be dlopened. + if test -z "$dlname"; then + # Warn if it was a shared library. + test -n "$library_names" && $echo "$modename: warning: \`$file' was not linked with \`-export-dynamic'" + continue + fi + + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + + if test -f "$dir/$objdir/$dlname"; then + dir="$dir/$objdir" + else + $echo "$modename: cannot find \`$dlname' in \`$dir' or \`$dir/$objdir'" 1>&2 + exit 1 + fi + ;; + + *.lo) + # Just add the directory containing the .lo file. + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + ;; + + *) + $echo "$modename: warning \`-dlopen' is ignored for non-libtool libraries and objects" 1>&2 + continue + ;; + esac + + # Get the absolute pathname. + absdir=`cd "$dir" && pwd` + test -n "$absdir" && dir="$absdir" + + # Now add the directory to shlibpath_var. + if eval "test -z \"\$$shlibpath_var\""; then + eval "$shlibpath_var=\"\$dir\"" + else + eval "$shlibpath_var=\"\$dir:\$$shlibpath_var\"" + fi + done + + # This variable tells wrapper scripts just to set shlibpath_var + # rather than running their programs. + libtool_execute_magic="$magic" + + # Check if any of the arguments is a wrapper script. + args= + for file + do + case "$file" in + -*) ;; + *) + # Do a test to see if this is really a libtool program. + if (sed -e '4q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + # If there is no directory component, then add one. + case "$file" in + */* | *\\*) . $file ;; + *) . ./$file ;; + esac + + # Transform arg to wrapped name. + file="$progdir/$program" + fi + ;; + esac + # Quote arguments (to preserve shell metacharacters). + file=`$echo "X$file" | $Xsed -e "$sed_quote_subst"` + args="$args \"$file\"" + done + + if test -z "$run"; then + # Export the shlibpath_var. + eval "export $shlibpath_var" + + # Restore saved enviroment variables + if test "${save_LC_ALL+set}" = set; then + LC_ALL="$save_LC_ALL"; export LC_ALL + fi + if test "${save_LANG+set}" = set; then + LANG="$save_LANG"; export LANG + fi + + # Now actually exec the command. + eval "exec \$cmd$args" + + $echo "$modename: cannot exec \$cmd$args" + exit 1 + else + # Display what would be done. + eval "\$echo \"\$shlibpath_var=\$$shlibpath_var\"" + $echo "export $shlibpath_var" + $echo "$cmd$args" + exit 0 + fi + ;; + + # libtool uninstall mode + uninstall) + modename="$modename: uninstall" + rm="$nonopt" + files= + + for arg + do + case "$arg" in + -*) rm="$rm $arg" ;; + *) files="$files $arg" ;; + esac + done + + if test -z "$rm"; then + $echo "$modename: you must specify an RM program" 1>&2 + $echo "$help" 1>&2 + exit 1 + fi + + for file in $files; do + dir=`$echo "X$file" | $Xsed -e 's%/[^/]*$%%'` + test "X$dir" = "X$file" && dir=. + name=`$echo "X$file" | $Xsed -e 's%^.*/%%'` + + rmfiles="$file" + + case "$name" in + *.la) + # Possibly a libtool archive, so verify it. + if (sed -e '2q' $file | egrep "^# Generated by .*$PACKAGE") >/dev/null 2>&1; then + . $dir/$name + + # Delete the libtool libraries and symlinks. + for n in $library_names; do + rmfiles="$rmfiles $dir/$n" + test "X$n" = "X$dlname" && dlname= + done + test -n "$dlname" && rmfiles="$rmfiles $dir/$dlname" + test -n "$old_library" && rmfiles="$rmfiles $dir/$old_library" + + $show "$rm $rmfiles" + $run $rm $rmfiles + + if test -n "$library_names"; then + # Do each command in the postuninstall commands. + eval cmds=\"$postuninstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" + done + IFS="$save_ifs" + fi + + if test -n "$old_library"; then + # Do each command in the old_postuninstall commands. + eval cmds=\"$old_postuninstall_cmds\" + IFS="${IFS= }"; save_ifs="$IFS"; IFS=';' + for cmd in $cmds; do + IFS="$save_ifs" + $show "$cmd" + $run eval "$cmd" + done + IFS="$save_ifs" + fi + + # FIXME: should reinstall the best remaining shared library. + fi + ;; + + *.lo) + if test "$build_old_libs" = yes; then + oldobj=`$echo "X$name" | $Xsed -e 's/\.lo$/.o/'` + rmfiles="$rmfiles $dir/$oldobj" + fi + $show "$rm $rmfiles" + $run $rm $rmfiles + ;; + + *) + $show "$rm $rmfiles" + $run $rm $rmfiles + ;; + esac + done + exit 0 + ;; + + "") + $echo "$modename: you must specify a MODE" 1>&2 + $echo "$generic_help" 1>&2 + exit 1 + ;; + esac + + $echo "$modename: invalid operation mode \`$mode'" 1>&2 + $echo "$generic_help" 1>&2 + exit 1 +fi # test -z "$show_help" + +# We need to display help for each of the modes. +case "$mode" in +"") $echo \ +"Usage: $modename [OPTION]... [MODE-ARG]... + +Provide generalized library-building support services. + + --config show all configuration variables + --debug enable verbose shell tracing +-n, --dry-run display commands without modifying any files + --features display basic configuration information and exit + --finish same as \`--mode=finish' + --help display this help message and exit + --mode=MODE use operation mode MODE [default=inferred from MODE-ARGS] + --quiet same as \`--silent' + --silent don't print informational messages + --version print version information + +MODE must be one of the following: + + compile compile a source file into a libtool object + execute automatically set library path, then run a program + finish complete the installation of libtool libraries + install install libraries or executables + link create a library or an executable + uninstall remove libraries from an installed directory + +MODE-ARGS vary depending on the MODE. Try \`$modename --help --mode=MODE' for +a more detailed description of MODE." + exit 0 + ;; + +compile) + $echo \ +"Usage: $modename [OPTION]... --mode=compile COMPILE-COMMAND... SOURCEFILE + +Compile a source file into a libtool library object. + +This mode accepts the following additional options: + + -static always build a \`.o' file suitable for static linking + +COMPILE-COMMAND is a command to be used in creating a \`standard' object file +from the given SOURCEFILE. + +The output file name is determined by removing the directory component from +SOURCEFILE, then substituting the C source code suffix \`.c' with the +library object suffix, \`.lo'." + ;; + +execute) + $echo \ +"Usage: $modename [OPTION]... --mode=execute COMMAND [ARGS]... + +Automatically set library path, then run a program. + +This mode accepts the following additional options: + + -dlopen FILE add the directory containing FILE to the library path + +This mode sets the library path environment variable according to \`-dlopen' +flags. + +If any of the ARGS are libtool executable wrappers, then they are translated +into their corresponding uninstalled binary, and any of their required library +directories are added to the library path. + +Then, COMMAND is executed, with ARGS as arguments." + ;; + +finish) + $echo \ +"Usage: $modename [OPTION]... --mode=finish [LIBDIR]... + +Complete the installation of libtool libraries. + +Each LIBDIR is a directory that contains libtool libraries. + +The commands that this mode executes may require superuser privileges. Use +the \`--dry-run' option if you just want to see what would be executed." + ;; + +install) + $echo \ +"Usage: $modename [OPTION]... --mode=install INSTALL-COMMAND... + +Install executables or libraries. + +INSTALL-COMMAND is the installation command. The first component should be +either the \`install' or \`cp' program. + +The rest of the components are interpreted as arguments to that command (only +BSD-compatible install options are recognized)." + ;; + +link) + $echo \ +"Usage: $modename [OPTION]... --mode=link LINK-COMMAND... + +Link object files or libraries together to form another library, or to +create an executable program. + +LINK-COMMAND is a command using the C compiler that you would use to create +a program from several object files. + +The following components of LINK-COMMAND are treated specially: + + -all-static do not do any dynamic linking at all + -dlopen FILE \`-dlpreopen' FILE if it cannot be dlopened at runtime + -dlpreopen FILE link in FILE and add its symbols to dld_preloaded_symbols + -export-dynamic allow symbols from OUTPUT-FILE to be resolved with dlsym(3) + -LLIBDIR search LIBDIR for required installed libraries + -lNAME OUTPUT-FILE requires the installed library libNAME + -no-undefined declare that a library does not refer to external symbols + -o OUTPUT-FILE create OUTPUT-FILE from the specified objects + -release RELEASE specify package release information + -rpath LIBDIR the created library will eventually be installed in LIBDIR + -static do not do any dynamic linking of libtool libraries + -version-info CURRENT[:REVISION[:AGE]] + specify library version info [each variable defaults to 0] + +All other options (arguments beginning with \`-') are ignored. + +Every other argument is treated as a filename. Files ending in \`.la' are +treated as uninstalled libtool libraries, other files are standard or library +object files. + +If the OUTPUT-FILE ends in \`.la', then a libtool library is created, only +library objects (\`.lo' files) may be specified, and \`-rpath' is required. + +If OUTPUT-FILE ends in \`.a', then a standard library is created using \`ar' +and \`ranlib'. + +If OUTPUT-FILE ends in \`.lo' or \`.o', then a reloadable object file is +created, otherwise an executable program is created." + ;; + +uninstall) + $echo +"Usage: $modename [OPTION]... --mode=uninstall RM [RM-OPTION]... FILE... + +Remove libraries from an installation directory. + +RM is the name of the program to use to delete files associated with each FILE +(typically \`/bin/rm'). RM-OPTIONS are options (such as \`-f') to be passed +to RM. + +If FILE is a libtool library, all the files associated with it are deleted. +Otherwise, only FILE itself is deleted using RM." + ;; + +*) + $echo "$modename: invalid operation mode \`$mode'" 1>&2 + $echo "$help" 1>&2 + exit 1 + ;; +esac + +echo +$echo "Try \`$modename --help' for more information about other modes." + +exit 0 + +# Local Variables: +# mode:shell-script +# sh-indentation:2 +# End: diff --git a/missing b/missing new file mode 100644 index 00000000..cbe2b0ef --- /dev/null +++ b/missing @@ -0,0 +1,188 @@ +#! /bin/sh +# Common stub for a few missing GNU programs while installing. +# Copyright (C) 1996, 1997 Free Software Foundation, Inc. +# Franc,ois Pinard , 1996. + +# This program is free software; you can redistribute it and/or modify +# it under the terms of the GNU General Public License as published by +# the Free Software Foundation; either version 2, or (at your option) +# any later version. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY; without even the implied warranty of +# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the +# GNU General Public License for more details. + +# You should have received a copy of the GNU General Public License +# along with this program; if not, write to the Free Software +# Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA +# 02111-1307, USA. + +if test $# -eq 0; then + echo 1>&2 "Try \`$0 --help' for more information" + exit 1 +fi + +case "$1" in + + -h|--h|--he|--hel|--help) + echo "\ +$0 [OPTION]... PROGRAM [ARGUMENT]... + +Handle \`PROGRAM [ARGUMENT]...' for when PROGRAM is missing, or return an +error status if there is no known handling for PROGRAM. + +Options: + -h, --help display this help and exit + -v, --version output version information and exit + +Supported PROGRAM values: + aclocal touch file \`aclocal.m4' + autoconf touch file \`configure' + autoheader touch file \`config.h.in' + automake touch all \`Makefile.in' files + bison create \`y.tab.[ch]', if possible, from existing .[ch] + flex create \`lex.yy.c', if possible, from existing .c + lex create \`lex.yy.c', if possible, from existing .c + makeinfo touch the output file + yacc create \`y.tab.[ch]', if possible, from existing .[ch]" + ;; + + -v|--v|--ve|--ver|--vers|--versi|--versio|--version) + echo "missing - GNU libit 0.0" + ;; + + -*) + echo 1>&2 "$0: Unknown \`$1' option" + echo 1>&2 "Try \`$0 --help' for more information" + exit 1 + ;; + + aclocal) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`acinclude.m4' or \`configure.in'. You might want + to install the \`Automake' and \`Perl' packages. Grab them from + any GNU archive site." + touch aclocal.m4 + ;; + + autoconf) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`configure.in'. You might want to install the + \`Autoconf' and \`GNU m4' packages. Grab them from any GNU + archive site." + touch configure + ;; + + autoheader) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`acconfig.h' or \`configure.in'. You might want + to install the \`Autoconf' and \`GNU m4' packages. Grab them + from any GNU archive site." + files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER([^):]*:\([^)]*\)).*/\1/p' configure.in` + if test -z "$files"; then + files=`sed -n 's/^[ ]*A[CM]_CONFIG_HEADER(\([^):]*\)).*/\1/p' configure.in` + test -z "$files" || files="$files.in" + else + files=`echo "$files" | sed -e 's/:/ /g'` + fi + test -z "$files" && files="config.h.in" + touch $files + ;; + + automake) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified \`Makefile.am', \`acinclude.m4' or \`configure.in'. + You might want to install the \`Automake' and \`Perl' packages. + Grab them from any GNU archive site." + find . -type f -name Makefile.am -print \ + | sed 's/^\(.*\).am$/touch \1.in/' \ + | sh + ;; + + bison|yacc) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified a \`.y' file. You may need the \`Bison' package + in order for those modifications to take effect. You can get + \`Bison' from any GNU archive site." + rm -f y.tab.c y.tab.h + if [ $# -ne 1 ]; then + eval LASTARG="\${$#}" + case "$LASTARG" in + *.y) + SRCFILE=`echo "$LASTARG" | sed 's/y$/c/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" y.tab.c + fi + SRCFILE=`echo "$LASTARG" | sed 's/y$/h/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" y.tab.h + fi + ;; + esac + fi + if [ ! -f y.tab.h ]; then + echo >y.tab.h + fi + if [ ! -f y.tab.c ]; then + echo 'main() { return 0; }' >y.tab.c + fi + ;; + + lex|flex) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified a \`.l' file. You may need the \`Flex' package + in order for those modifications to take effect. You can get + \`Flex' from any GNU archive site." + rm -f lex.yy.c + if [ $# -ne 1 ]; then + eval LASTARG="\${$#}" + case "$LASTARG" in + *.l) + SRCFILE=`echo "$LASTARG" | sed 's/l$/c/'` + if [ -f "$SRCFILE" ]; then + cp "$SRCFILE" lex.yy.c + fi + ;; + esac + fi + if [ ! -f lex.yy.c ]; then + echo 'main() { return 0; }' >lex.yy.c + fi + ;; + + makeinfo) + echo 1>&2 "\ +WARNING: \`$1' is missing on your system. You should only need it if + you modified a \`.texi' or \`.texinfo' file, or any other file + indirectly affecting the aspect of the manual. The spurious + call might also be the consequence of using a buggy \`make' (AIX, + DU, IRIX). You might want to install the \`Texinfo' package or + the \`GNU make' package. Grab either from any GNU archive site." + file=`echo "$*" | sed -n 's/.*-o \([^ ]*\).*/\1/p'` + if test -z "$file"; then + file=`echo "$*" | sed 's/.* \([^ ]*\) *$/\1/'` + file=`sed -n '/^@setfilename/ { s/.* \([^ ]*\) *$/\1/; p; q; }' $file` + fi + touch $file + ;; + + *) + echo 1>&2 "\ +WARNING: \`$1' is needed, and you do not seem to have it handy on your + system. You might have modified some files without having the + proper tools for further handling them. Check the \`README' file, + it often tells you about the needed prerequirements for installing + this package. You may also peek at any GNU archive site, in case + some other package would contain this missing \`$1' program." + exit 1 + ;; +esac + +exit 0 diff --git a/mkinstalldirs b/mkinstalldirs new file mode 100644 index 00000000..a719d6a6 --- /dev/null +++ b/mkinstalldirs @@ -0,0 +1,40 @@ +#! /bin/sh +# mkinstalldirs --- make directory hierarchy +# Author: Noah Friedman +# Created: 1993-05-16 +# Public domain + +# $Id: mkinstalldirs,v 1.1 1998/11/18 20:42:13 chris Exp $ + +errstatus=0 + +for file +do + set fnord `echo ":$file" | sed -ne 's/^:\//#/;s/^://;s/\// /g;s/^#/\//;p'` + shift + + pathcomp= + for d + do + pathcomp="$pathcomp$d" + case "$pathcomp" in + -* ) pathcomp=./$pathcomp ;; + esac + + if test ! -d "$pathcomp"; then + echo "mkdir $pathcomp" 1>&2 + + mkdir "$pathcomp" || lasterr=$? + + if test ! -d "$pathcomp"; then + errstatus=$lasterr + fi + fi + + pathcomp="$pathcomp/" + done +done + +exit $errstatus + +# mkinstalldirs ends here diff --git a/src/Makefile b/src/Makefile deleted file mode 100644 index 42740fe1..00000000 --- a/src/Makefile +++ /dev/null @@ -1,82 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -include ../Makefile.conf - -TARGET=../lib/libasound.a -STARGET=../lib/libasound.so -STARGETX=../lib/libasound.so.$(SND_LIB_VERSION) -STARGETO=../lib/libasound.so.$(SND_LIB_MAJOR) -TARGETS=$(TARGET) $(STARGET) - -STATIC_LIBS= control/libcontrol.a \ - mixer/libmixer.a \ - pcm/libpcm.a \ - rawmidi/librawmidi.a -DYNAMIC_LIBS= control/libcontrol.Sa \ - mixer/libmixer.Sa \ - pcm/libpcm.Sa \ - rawmidi/librawmidi.Sa - -OBJECTS=error.o -SOBJECTS=error.So - -.SUFFIXES: -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) $(STATIC_LIBS) - rm -f ../lib/libasound.a - $(LINKER) -r -o $(TARGET) $(STATIC_LIBS) $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) $(DYNAMIC_LIBS) - rm -f ../lib/libasound*.so* - $(CC) -shared -Wl,-soname,libasound.so.$(SND_LIB_MAJOR) $(DYNAMIC_LIBS) $(SOBJECTS) -o $(STARGETX) - ln -s libasound.so.$(SND_LIB_VERSION) $(STARGET) - ln -s libasound.so.$(SND_LIB_VERSION) $(STARGETO) - -control/libcontrol.a: - $(MAKE) -C control -control/libcontrol.sa: - $(MAKE) -C control - -mixer/libmixer.a: - $(MAKE) -C mixer -mixer/libmixer.sa: - $(MAKE) -C mixer - -pcm/libpcm.a: - $(MAKE) -C pcm -pcm/libpcm.sa: - $(MAKE) -C pcm - -rawmidi/librawmidi.a: - $(MAKE) -C rawmidi -rawmidi/librawmidi.sa: - $(MAKE) -C rawmidi - -clean: - $(MAKE) -C control clean - $(MAKE) -C pcm clean - $(MAKE) -C mixer clean - $(MAKE) -C rawmidi clean - rm -f core .depend *.o *.So *.orig *~ - rm -f ../lib/libasound.* - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/Makefile.am b/src/Makefile.am new file mode 100644 index 00000000..9e1c1ca0 --- /dev/null +++ b/src/Makefile.am @@ -0,0 +1,22 @@ +SUBDIRS=control mixer pcm rawmidi + +lib_LTLIBRARIES = libasound.la +libasound_la_SOURCES = error.c +libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \ + rawmidi/librawmidi.la + +control/libcontrol.la: + $(MAKE) -C control libcontrol.la + +mixer/libmixer.la: + $(MAKE) -C mixer libmixer.la + +pcm/libpcm.la: + $(MAKE) -C pcm libpcm.la + +rawmidi/librawmidi.la: + $(MAKE) -C rawmidi librawmidi.la + + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/Makefile.in b/src/Makefile.in new file mode 100644 index 00000000..064b432d --- /dev/null +++ b/src/Makefile.in @@ -0,0 +1,369 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +SUBDIRS=control mixer pcm rawmidi + +lib_LTLIBRARIES = libasound.la +libasound_la_SOURCES = error.c +libasound_la_LIBADD = control/libcontrol.la mixer/libmixer.la pcm/libpcm.la \ + rawmidi/librawmidi.la + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = +LTLIBRARIES = $(lib_LTLIBRARIES) + + +DEFS = @DEFS@ -I. -I$(srcdir) -I../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libasound_la_LDFLAGS = +libasound_la_DEPENDENCIES = control/libcontrol.la mixer/libmixer.la \ +pcm/libpcm.la rawmidi/librawmidi.la +libasound_la_OBJECTS = error.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libasound_la_SOURCES) +OBJECTS = $(libasound_la_OBJECTS) + +all: all-recursive all-am + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +mostlyclean-libLTLIBRARIES: + +clean-libLTLIBRARIES: + -test -z "$(lib_LTLIBRARIES)" || rm -f $(lib_LTLIBRARIES) + +distclean-libLTLIBRARIES: + +maintainer-clean-libLTLIBRARIES: + +install-libLTLIBRARIES: $(lib_LTLIBRARIES) + @$(NORMAL_INSTALL) + $(mkinstalldirs) $(DESTDIR)$(libdir) + @list='$(lib_LTLIBRARIES)'; for p in $$list; do \ + if test -f $$p; then \ + echo "$(LIBTOOL) --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p"; \ + $(LIBTOOL) --mode=install $(INSTALL_DATA) $$p $(DESTDIR)$(libdir)/$$p; \ + else :; fi; \ + done + +uninstall-libLTLIBRARIES: + @$(NORMAL_UNINSTALL) + list='$(lib_LTLIBRARIES)'; for p in $$list; do \ + $(LIBTOOL) --mode=uninstall rm -f $(DESTDIR)$(libdir)/$$p; \ + done + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libasound.la: $(libasound_la_OBJECTS) $(libasound_la_DEPENDENCIES) + $(LINK) -rpath $(libdir) $(libasound_la_LDFLAGS) $(libasound_la_OBJECTS) $(libasound_la_LIBADD) $(LIBS) + +# This directory's subdirectories are mostly independent; you can cd +# into them and run `make' without going through this Makefile. +# To change the values of `make' variables: instead of editing Makefiles, +# (1) if the variable is set in `config.status', edit `config.status' +# (which will cause the Makefiles to be regenerated when you run `make'); +# (2) otherwise, pass the desired values on the `make' command line. + +@SET_MAKE@ + +all-recursive install-data-recursive install-exec-recursive \ +installdirs-recursive install-recursive uninstall-recursive \ +check-recursive installcheck-recursive info-recursive dvi-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" + +mostlyclean-recursive clean-recursive distclean-recursive \ +maintainer-clean-recursive: + @set fnord $(MAKEFLAGS); amf=$$2; \ + rev=''; list='$(SUBDIRS)'; for subdir in $$list; do \ + rev="$$subdir $$rev"; \ + done; \ + for subdir in $$rev; do \ + target=`echo $@ | sed s/-recursive//`; \ + echo "Making $$target in $$subdir"; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) $$target) \ + || case "$$amf" in *=*) exit 1;; *k*) fail=yes;; *) exit 1;; esac; \ + done && test -z "$$fail" +tags-recursive: + list='$(SUBDIRS)'; for subdir in $$list; do \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) tags); \ + done + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: tags-recursive $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SUBDIRS)'; for subdir in $$list; do \ + test -f $$subdir/TAGS && tags="$$tags -i $$here/$$subdir/TAGS"; \ + done; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done + for subdir in $(SUBDIRS); do \ + test -d $(distdir)/$$subdir \ + || mkdir $(distdir)/$$subdir \ + || exit 1; \ + chmod 777 $(distdir)/$$subdir; \ + (cd $$subdir && $(MAKE) $(AM_MAKEFLAGS) top_distdir=../$(top_distdir) distdir=../$(distdir)/$$subdir distdir) \ + || exit 1; \ + done +info: info-recursive +dvi: dvi-recursive +check: all-am + $(MAKE) $(AM_MAKEFLAGS) check-recursive +installcheck: installcheck-recursive +all-am: Makefile $(LTLIBRARIES) + +install-exec-am: install-libLTLIBRARIES + +uninstall-am: uninstall-libLTLIBRARIES + +install-exec: install-exec-recursive install-exec-am + @$(NORMAL_INSTALL) + +install-data: install-data-recursive + @$(NORMAL_INSTALL) + +install: install-recursive install-exec-am + @: + +uninstall: uninstall-recursive uninstall-am + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: installdirs-recursive + $(mkinstalldirs) $(DESTDIR)$(libdir) + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean-am: mostlyclean-libLTLIBRARIES mostlyclean-compile \ + mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean-am: clean-libLTLIBRARIES clean-compile clean-libtool clean-tags \ + clean-generic mostlyclean-am + +distclean-am: distclean-libLTLIBRARIES distclean-compile \ + distclean-libtool distclean-tags distclean-generic \ + clean-am + +maintainer-clean-am: maintainer-clean-libLTLIBRARIES \ + maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean-am + +mostlyclean: mostlyclean-recursive mostlyclean-am + +clean: clean-recursive clean-am + +distclean: distclean-recursive distclean-am + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-recursive maintainer-clean-am + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-libLTLIBRARIES distclean-libLTLIBRARIES \ +clean-libLTLIBRARIES maintainer-clean-libLTLIBRARIES \ +uninstall-libLTLIBRARIES install-libLTLIBRARIES mostlyclean-compile \ +distclean-compile clean-compile maintainer-clean-compile \ +mostlyclean-libtool distclean-libtool clean-libtool \ +maintainer-clean-libtool install-data-recursive \ +uninstall-data-recursive install-exec-recursive \ +uninstall-exec-recursive installdirs-recursive uninstalldirs-recursive \ +all-recursive check-recursive installcheck-recursive info-recursive \ +dvi-recursive mostlyclean-recursive distclean-recursive clean-recursive \ +maintainer-clean-recursive tags tags-recursive mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck all-am install-exec-am uninstall-am install-exec \ +install-data install uninstall all installdirs mostlyclean-generic \ +distclean-generic clean-generic maintainer-clean-generic clean \ +mostlyclean distclean maintainer-clean + + +control/libcontrol.la: + $(MAKE) -C control libcontrol.la + +mixer/libmixer.la: + $(MAKE) -C mixer libmixer.la + +pcm/libpcm.la: + $(MAKE) -C pcm libpcm.la + +rawmidi/librawmidi.la: + $(MAKE) -C rawmidi librawmidi.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/control/Makefile b/src/control/Makefile deleted file mode 100644 index 38a47f15..00000000 --- a/src/control/Makefile +++ /dev/null @@ -1,42 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -include ../../Makefile.conf - -TARGET=libcontrol.a -STARGET=libcontrol.Sa -OBJECTS=cards.o control.o -SOBJECTS=cards.So control.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/control/Makefile.am b/src/control/Makefile.am new file mode 100644 index 00000000..5390f278 --- /dev/null +++ b/src/control/Makefile.am @@ -0,0 +1,8 @@ +EXTRA_LTLIBRARIES = libcontrol.la + +libcontrol_la_SOURCES = cards.c control.c + +all: libcontrol.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/control/Makefile.in b/src/control/Makefile.in new file mode 100644 index 00000000..f49957e0 --- /dev/null +++ b/src/control/Makefile.in @@ -0,0 +1,251 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES = libcontrol.la + +libcontrol_la_SOURCES = cards.c control.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libcontrol_la_LDFLAGS = +libcontrol_la_LIBADD = +libcontrol_la_OBJECTS = cards.lo control.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libcontrol_la_SOURCES) +OBJECTS = $(libcontrol_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/control/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libcontrol.la: $(libcontrol_la_OBJECTS) $(libcontrol_la_DEPENDENCIES) + $(LINK) $(libcontrol_la_LDFLAGS) $(libcontrol_la_OBJECTS) $(libcontrol_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/control + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +all: libcontrol.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/mixer/Makefile b/src/mixer/Makefile deleted file mode 100644 index 6d60adbf..00000000 --- a/src/mixer/Makefile +++ /dev/null @@ -1,41 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -include ../../Makefile.conf - -TARGET=libmixer.a -STARGET=libmixer.Sa -OBJECTS=mixer.o -SOBJECTS=mixer.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/mixer/Makefile.am b/src/mixer/Makefile.am new file mode 100644 index 00000000..1350aba6 --- /dev/null +++ b/src/mixer/Makefile.am @@ -0,0 +1,8 @@ +EXTRA_LTLIBRARIES=libmixer.la + +libmixer_la_SOURCES = mixer.c + +all: libmixer.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/mixer/Makefile.in b/src/mixer/Makefile.in new file mode 100644 index 00000000..1e922680 --- /dev/null +++ b/src/mixer/Makefile.in @@ -0,0 +1,251 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES=libmixer.la + +libmixer_la_SOURCES = mixer.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libmixer_la_LDFLAGS = +libmixer_la_LIBADD = +libmixer_la_OBJECTS = mixer.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libmixer_la_SOURCES) +OBJECTS = $(libmixer_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/mixer/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libmixer.la: $(libmixer_la_OBJECTS) $(libmixer_la_DEPENDENCIES) + $(LINK) $(libmixer_la_LDFLAGS) $(libmixer_la_OBJECTS) $(libmixer_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/mixer + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +all: libmixer.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/pcm/Makefile b/src/pcm/Makefile deleted file mode 100644 index 8bc28fbc..00000000 --- a/src/pcm/Makefile +++ /dev/null @@ -1,40 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -include ../../Makefile.conf - -TARGET=libpcm.a -STARGET=libpcm.Sa -OBJECTS=pcm.o pcm_loopback.o -SOBJECTS=pcm.So pcm_loopback.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/pcm/Makefile.am b/src/pcm/Makefile.am new file mode 100644 index 00000000..2f08022f --- /dev/null +++ b/src/pcm/Makefile.am @@ -0,0 +1,7 @@ +EXTRA_LTLIBRARIES=libpcm.la + +libpcm_la_SOURCES = pcm.c +all: libpcm.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/pcm/Makefile.in b/src/pcm/Makefile.in new file mode 100644 index 00000000..901ac576 --- /dev/null +++ b/src/pcm/Makefile.in @@ -0,0 +1,250 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES=libpcm.la + +libpcm_la_SOURCES = pcm.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +libpcm_la_LDFLAGS = +libpcm_la_LIBADD = +libpcm_la_OBJECTS = pcm.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(libpcm_la_SOURCES) +OBJECTS = $(libpcm_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/pcm/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +libpcm.la: $(libpcm_la_OBJECTS) $(libpcm_la_DEPENDENCIES) + $(LINK) $(libpcm_la_LDFLAGS) $(libpcm_la_OBJECTS) $(libpcm_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/pcm + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + +all: libpcm.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/src/rawmidi/Makefile b/src/rawmidi/Makefile deleted file mode 100644 index c675bf4a..00000000 --- a/src/rawmidi/Makefile +++ /dev/null @@ -1,40 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -include ../../Makefile.conf - -TARGET=librawmidi.a -STARGET=librawmidi.Sa -OBJECTS=rawmidi.o -SOBJECTS=rawmidi.So -TARGETS=$(TARGET) $(STARGET) - -.SUFFIXES: .c .s .S .o .So .a .Sa - -.c.o: - $(CC) $(COPTS) $(INCLUDE) -c -o $*.o $< -.c.So: - $(CC) $(COPTS) $(INCLUDE) -fPIC -c -o $*.So $< - -all: $(TARGETS) - -$(TARGET): .depend $(OBJECTS) - $(LINKER) -r -o $@ $(OBJECTS) - -$(STARGET): .depend $(SOBJECTS) - $(LINKER) -r -o $@ $(SOBJECTS) - -clean: - rm -f core .depend *.o *.So *.a *.Sa *.orig *~ - -.depend: - $(CPP) $(COPTS) $(INCLUDE) -M *.c > .depend - -# -# include a dependency file if one exists -# -ifeq (.depend,$(wildcard .depend)) -include .depend -endif diff --git a/src/rawmidi/Makefile.am b/src/rawmidi/Makefile.am new file mode 100644 index 00000000..1abeadd1 --- /dev/null +++ b/src/rawmidi/Makefile.am @@ -0,0 +1,7 @@ +EXTRA_LTLIBRARIES=librawmidi.la + +librawmidi_la_SOURCES = rawmidi.c +all: librawmidi.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/src/rawmidi/Makefile.in b/src/rawmidi/Makefile.in new file mode 100644 index 00000000..b9c1b6e2 --- /dev/null +++ b/src/rawmidi/Makefile.in @@ -0,0 +1,250 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = ../.. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +EXTRA_LTLIBRARIES=librawmidi.la + +librawmidi_la_SOURCES = rawmidi.c + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +librawmidi_la_LDFLAGS = +librawmidi_la_LIBADD = +librawmidi_la_OBJECTS = rawmidi.lo +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = $(librawmidi_la_SOURCES) +OBJECTS = $(librawmidi_la_OBJECTS) + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps src/rawmidi/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +librawmidi.la: $(librawmidi_la_OBJECTS) $(librawmidi_la_DEPENDENCIES) + $(LINK) $(librawmidi_la_LDFLAGS) $(librawmidi_la_OBJECTS) $(librawmidi_la_LIBADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = src/rawmidi + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-compile mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-compile clean-libtool clean-tags clean-generic mostlyclean + +distclean: distclean-compile distclean-libtool distclean-tags \ + distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-compile distclean-compile clean-compile \ +maintainer-clean-compile mostlyclean-libtool distclean-libtool \ +clean-libtool maintainer-clean-libtool tags mostlyclean-tags \ +distclean-tags clean-tags maintainer-clean-tags distdir info dvi \ +installcheck install-exec install-data install uninstall all \ +installdirs mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + +all: librawmidi.la + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/test/Makefile b/test/Makefile deleted file mode 100644 index 5ea08936..00000000 --- a/test/Makefile +++ /dev/null @@ -1,24 +0,0 @@ -CC = gcc -CFLAGS = -static -O2 -g -Wall -pipe -TARGETS = control mixer switches pause pcm -LIB = -L../lib -lasound - -all: $(TARGETS) - -control: control.c - $(CC) $(CFLAGS) $(LIB) -o control control.c - -mixer: mixer.c - $(CC) $(CFLAGS) $(LIB) -o mixer mixer.c - -switches: switches.c - $(CC) $(CFLAGS) $(LIB) -o switches switches.c - -pause: pause.c - $(CC) $(CFLAGS) $(LIB) -o pause pause.c - -pcm: pcm.c - $(CC) $(CFLAGS) $(LIB) -o pcm pcm.c - -clean: - rm -f *.o $(TARGETS) *~ diff --git a/test/Makefile.am b/test/Makefile.am new file mode 100644 index 00000000..d3e5d6e7 --- /dev/null +++ b/test/Makefile.am @@ -0,0 +1,10 @@ +check_PROGRAMS=control mixer switches pause pcm + +control_LDADD=../src/libasound.la +mixer_LDADD=../src/libasound.la +switches_LDADD=../src/libasound.la +pause_LDADD=../src/libasound.la +pcm_LDADD=../src/libasound.la + + +INCLUDES=-I$(top_srcdir)/include diff --git a/test/Makefile.in b/test/Makefile.in new file mode 100644 index 00000000..46acd885 --- /dev/null +++ b/test/Makefile.in @@ -0,0 +1,301 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +check_PROGRAMS=control mixer switches pause pcm + +control_LDADD=../src/libasound.la +mixer_LDADD=../src/libasound.la +switches_LDADD=../src/libasound.la +pause_LDADD=../src/libasound.la +pcm_LDADD=../src/libasound.la + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = + +DEFS = @DEFS@ -I. -I$(srcdir) -I../include +CPPFLAGS = @CPPFLAGS@ +LDFLAGS = @LDFLAGS@ +LIBS = @LIBS@ +control_SOURCES = control.c +control_OBJECTS = control.o +control_DEPENDENCIES = ../src/libasound.la +control_LDFLAGS = +mixer_SOURCES = mixer.c +mixer_OBJECTS = mixer.o +mixer_DEPENDENCIES = ../src/libasound.la +mixer_LDFLAGS = +switches_SOURCES = switches.c +switches_OBJECTS = switches.o +switches_DEPENDENCIES = ../src/libasound.la +switches_LDFLAGS = +pause_SOURCES = pause.c +pause_OBJECTS = pause.o +pause_DEPENDENCIES = ../src/libasound.la +pause_LDFLAGS = +pcm_SOURCES = pcm.c +pcm_OBJECTS = pcm.o +pcm_DEPENDENCIES = ../src/libasound.la +pcm_LDFLAGS = +CFLAGS = @CFLAGS@ +COMPILE = $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LTCOMPILE = $(LIBTOOL) --mode=compile $(CC) $(DEFS) $(INCLUDES) $(AM_CPPFLAGS) $(CPPFLAGS) $(AM_CFLAGS) $(CFLAGS) +LINK = $(LIBTOOL) --mode=link $(CC) $(AM_CFLAGS) $(CFLAGS) $(LDFLAGS) -o $@ +DIST_COMMON = Makefile.am Makefile.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +SOURCES = control.c mixer.c switches.c pause.c pcm.c +OBJECTS = control.o mixer.o switches.o pause.o pcm.o + +all: Makefile + +.SUFFIXES: +.SUFFIXES: .S .c .lo .o .s +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps test/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + + +mostlyclean-checkPROGRAMS: + +clean-checkPROGRAMS: + -test -z "$(check_PROGRAMS)" || rm -f $(check_PROGRAMS) + +distclean-checkPROGRAMS: + +maintainer-clean-checkPROGRAMS: + +.c.o: + $(COMPILE) -c $< + +.s.o: + $(COMPILE) -c $< + +.S.o: + $(COMPILE) -c $< + +mostlyclean-compile: + -rm -f *.o core *.core + +clean-compile: + +distclean-compile: + -rm -f *.tab.c + +maintainer-clean-compile: + +.c.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.s.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +.S.lo: + $(LIBTOOL) --mode=compile $(COMPILE) -c $< + +mostlyclean-libtool: + -rm -f *.lo + +clean-libtool: + -rm -rf .libs _libs + +distclean-libtool: + +maintainer-clean-libtool: + +control: $(control_OBJECTS) $(control_DEPENDENCIES) + @rm -f control + $(LINK) $(control_LDFLAGS) $(control_OBJECTS) $(control_LDADD) $(LIBS) + +mixer: $(mixer_OBJECTS) $(mixer_DEPENDENCIES) + @rm -f mixer + $(LINK) $(mixer_LDFLAGS) $(mixer_OBJECTS) $(mixer_LDADD) $(LIBS) + +switches: $(switches_OBJECTS) $(switches_DEPENDENCIES) + @rm -f switches + $(LINK) $(switches_LDFLAGS) $(switches_OBJECTS) $(switches_LDADD) $(LIBS) + +pause: $(pause_OBJECTS) $(pause_DEPENDENCIES) + @rm -f pause + $(LINK) $(pause_LDFLAGS) $(pause_OBJECTS) $(pause_LDADD) $(LIBS) + +pcm: $(pcm_OBJECTS) $(pcm_DEPENDENCIES) + @rm -f pcm + $(LINK) $(pcm_LDFLAGS) $(pcm_OBJECTS) $(pcm_LDADD) $(LIBS) + +tags: TAGS + +ID: $(HEADERS) $(SOURCES) $(LISP) + here=`pwd` && cd $(srcdir) \ + && mkid -f$$here/ID $(SOURCES) $(HEADERS) $(LISP) + +TAGS: $(HEADERS) $(SOURCES) $(TAGS_DEPENDENCIES) $(LISP) + tags=; \ + here=`pwd`; \ + list='$(SOURCES) $(HEADERS)'; \ + unique=`for i in $$list; do echo $$i; done | \ + awk ' { files[$$0] = 1; } \ + END { for (i in files) print i; }'`; \ + test -z "$(ETAGS_ARGS)$$unique$(LISP)$$tags" \ + || (cd $(srcdir) && etags $(ETAGS_ARGS) $$tags $$unique $(LISP) -o $$here/TAGS) + +mostlyclean-tags: + +clean-tags: + +distclean-tags: + -rm -f TAGS ID + +maintainer-clean-tags: + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = test + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all $(check_PROGRAMS) +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-checkPROGRAMS mostlyclean-compile \ + mostlyclean-libtool mostlyclean-tags \ + mostlyclean-generic + +clean: clean-checkPROGRAMS clean-compile clean-libtool clean-tags \ + clean-generic mostlyclean + +distclean: distclean-checkPROGRAMS distclean-compile distclean-libtool \ + distclean-tags distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-checkPROGRAMS \ + maintainer-clean-compile maintainer-clean-libtool \ + maintainer-clean-tags maintainer-clean-generic \ + distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: mostlyclean-checkPROGRAMS distclean-checkPROGRAMS \ +clean-checkPROGRAMS maintainer-clean-checkPROGRAMS mostlyclean-compile \ +distclean-compile clean-compile maintainer-clean-compile \ +mostlyclean-libtool distclean-libtool clean-libtool \ +maintainer-clean-libtool tags mostlyclean-tags distclean-tags \ +clean-tags maintainer-clean-tags distdir info dvi installcheck \ +install-exec install-data install uninstall all installdirs \ +mostlyclean-generic distclean-generic clean-generic \ +maintainer-clean-generic clean mostlyclean distclean maintainer-clean + + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/utils/Makefile b/utils/Makefile deleted file mode 100644 index d9e97658..00000000 --- a/utils/Makefile +++ /dev/null @@ -1,10 +0,0 @@ -# -# Makefile for ALSA library -# Copyright (c) 1994-98 by Jaroslav Kysela -# - -include ../Makefile.conf - -clean: - rm -f core .depend *.o *.orig *~ - diff --git a/utils/Makefile.am b/utils/Makefile.am new file mode 100644 index 00000000..de052686 --- /dev/null +++ b/utils/Makefile.am @@ -0,0 +1,4 @@ +rpm: buildrpm alsa-lib.spec + VERSION=$(VERSION) $(srcdir)/buildrpm + +INCLUDES=-I$(top_srcdir)/include diff --git a/utils/Makefile.in b/utils/Makefile.in new file mode 100644 index 00000000..f6a6b798 --- /dev/null +++ b/utils/Makefile.in @@ -0,0 +1,164 @@ +# Makefile.in generated automatically by automake 1.3b from Makefile.am + +# Copyright (C) 1994, 1995, 1996, 1997, 1998 Free Software Foundation, Inc. +# This Makefile.in is free software; the Free Software Foundation +# gives unlimited permission to copy and/or distribute it, +# with or without modifications, as long as this notice is preserved. + +# This program is distributed in the hope that it will be useful, +# but WITHOUT ANY WARRANTY, to the extent permitted by law; without +# even the implied warranty of MERCHANTABILITY or FITNESS FOR A +# PARTICULAR PURPOSE. + + +SHELL = /bin/sh + +srcdir = @srcdir@ +top_srcdir = @top_srcdir@ +VPATH = @srcdir@ +prefix = @prefix@ +exec_prefix = @exec_prefix@ + +bindir = @bindir@ +sbindir = @sbindir@ +libexecdir = @libexecdir@ +datadir = @datadir@ +sysconfdir = @sysconfdir@ +sharedstatedir = @sharedstatedir@ +localstatedir = @localstatedir@ +libdir = @libdir@ +infodir = @infodir@ +mandir = @mandir@ +includedir = @includedir@ +oldincludedir = /usr/include + +DESTDIR = + +pkgdatadir = $(datadir)/@PACKAGE@ +pkglibdir = $(libdir)/@PACKAGE@ +pkgincludedir = $(includedir)/@PACKAGE@ + +top_builddir = .. + +ACLOCAL = @ACLOCAL@ +AUTOCONF = @AUTOCONF@ +AUTOMAKE = @AUTOMAKE@ +AUTOHEADER = @AUTOHEADER@ + +INSTALL = @INSTALL@ +INSTALL_PROGRAM = @INSTALL_PROGRAM@ +INSTALL_DATA = @INSTALL_DATA@ +INSTALL_SCRIPT = @INSTALL_SCRIPT@ +transform = @program_transform_name@ + +NORMAL_INSTALL = : +PRE_INSTALL = : +POST_INSTALL = : +NORMAL_UNINSTALL = : +PRE_UNINSTALL = : +POST_UNINSTALL = : +host_alias = @host_alias@ +host_triplet = @host@ +ALSA_CFLAGS = @ALSA_CFLAGS@ +ALSA_LIBS = @ALSA_LIBS@ +CC = @CC@ +LD = @LD@ +LIBTOOL = @LIBTOOL@ +LN_S = @LN_S@ +MAKEINFO = @MAKEINFO@ +NM = @NM@ +PACKAGE = @PACKAGE@ +RANLIB = @RANLIB@ +VERSION = @VERSION@ + +INCLUDES=-I$(top_srcdir)/include +mkinstalldirs = $(SHELL) $(top_srcdir)/mkinstalldirs +CONFIG_HEADER = ../include/config.h +CONFIG_CLEAN_FILES = alsa-lib.spec +DIST_COMMON = Makefile.am Makefile.in alsa-lib.spec.in + + +DISTFILES = $(DIST_COMMON) $(SOURCES) $(HEADERS) $(TEXINFOS) $(EXTRA_DIST) + +TAR = tar +GZIP = --best +all: Makefile + +.SUFFIXES: +$(srcdir)/Makefile.in: Makefile.am $(top_srcdir)/configure.in $(ACLOCAL_M4) + cd $(top_srcdir) && $(AUTOMAKE) --foreign --include-deps utils/Makefile + +Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status + cd $(top_builddir) \ + && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status + +alsa-lib.spec: $(top_builddir)/config.status alsa-lib.spec.in + cd $(top_builddir) && CONFIG_FILES=$(subdir)/$@ CONFIG_HEADERS= $(SHELL) ./config.status +tags: TAGS +TAGS: + + +distdir = $(top_builddir)/$(PACKAGE)-$(VERSION)/$(subdir) + +subdir = utils + +distdir: $(DISTFILES) + @for file in $(DISTFILES); do \ + d=$(srcdir); \ + test -f $(distdir)/$$file \ + || ln $$d/$$file $(distdir)/$$file 2> /dev/null \ + || cp -p $$d/$$file $(distdir)/$$file; \ + done +info: +dvi: +check: all +installcheck: +install-exec: + @$(NORMAL_INSTALL) + +install-data: + @$(NORMAL_INSTALL) + +install: install-exec install-data all + @: + +uninstall: + +install-strip: + $(MAKE) $(AM_MAKEFLAGS) INSTALL_PROGRAM='$(INSTALL_PROGRAM) -s' INSTALL_SCRIPT='$(INSTALL_PROGRAM)' install +installdirs: + + +mostlyclean-generic: + +clean-generic: + +distclean-generic: + -rm -f Makefile $(CONFIG_CLEAN_FILES) + -rm -f config.cache config.log stamp-h stamp-h[0-9]* + +maintainer-clean-generic: +mostlyclean: mostlyclean-generic + +clean: clean-generic mostlyclean + +distclean: distclean-generic clean + -rm -f config.status + -rm -f libtool + +maintainer-clean: maintainer-clean-generic distclean + @echo "This command is intended for maintainers to use;" + @echo "it deletes files that may require special tools to rebuild." + +.PHONY: tags distdir info dvi installcheck install-exec install-data \ +install uninstall all installdirs mostlyclean-generic distclean-generic \ +clean-generic maintainer-clean-generic clean mostlyclean distclean \ +maintainer-clean + + +rpm: buildrpm alsa-lib.spec + VERSION=$(VERSION) $(srcdir)/buildrpm + +# Tell versions [3.59,3.63) of GNU make to not export all variables. +# Otherwise a system limit (for SysV at least) may be exceeded. +.NOEXPORT: diff --git a/utils/alsa-lib.spec.in b/utils/alsa-lib.spec.in index 8989a987..8ff7f66e 100644 --- a/utils/alsa-lib.spec.in +++ b/utils/alsa-lib.spec.in @@ -74,6 +74,5 @@ rm -rf $RPM_BUILD_ROOT %doc doc/*.sgml %doc doc/*.txt -%{prefix}/usr/include/sys/asoundlib.h +%{prefix}/usr/include/sys/soundlib.h %{prefix}/usr/lib/lib* -/usr/share/aclocal/alsa-lib.m4 diff --git a/utils/buildrpm b/utils/buildrpm index 36230e22..aaf88659 100644 --- a/utils/buildrpm +++ b/utils/buildrpm @@ -1,15 +1,15 @@ #!/bin/bash source=. -version=`cat $source/../version` -package=$source/../../alsa-lib-$version.tar.gz +version=$VERSION +package=$source/../alsa-lib-$version.tar.gz if [ ! -r $package ]; then echo "Error: wrong package: $package" exit 1 fi -make -C .. pack +make -C .. dist cp -fv $package /usr/src/redhat/SOURCES diff --git a/version b/version deleted file mode 100644 index 0ea3a944..00000000 --- a/version +++ /dev/null @@ -1 +0,0 @@ -0.2.0 -- 2.47.3